mirror of
https://gitcode.com/gh_mirrors/se/Semi.Avalonia
synced 2026-04-06 01:06:36 +08:00
10754 lines
400 KiB
JavaScript
10754 lines
400 KiB
JavaScript
|
|
var createDotnetRuntime = (() => {
|
|
var _scriptDir = import.meta.url;
|
|
|
|
return (
|
|
async function(moduleArg = {}) {
|
|
|
|
// include: shell.js
|
|
// The Module object: Our interface to the outside world. We import
|
|
// and export values on it. There are various ways Module can be used:
|
|
// 1. Not defined. We create it here
|
|
// 2. A function parameter, function(Module) { ..generated code.. }
|
|
// 3. pre-run appended it, var Module = {}; ..generated code..
|
|
// 4. External script tag defines var Module.
|
|
// We need to check if Module already exists (e.g. case 3 above).
|
|
// Substitution will be replaced with actual code on later stage of the build,
|
|
// this way Closure Compiler will not mangle it (e.g. case 4. above).
|
|
// Note that if you want to run closure, and also to use Module
|
|
// after the generated code, you will need to define var Module = {};
|
|
// before the code. Then that object will be used in the code, and you
|
|
// can continue to use Module afterwards as well.
|
|
var Module = moduleArg;
|
|
|
|
// Set up the promise that indicates the Module is initialized
|
|
var readyPromiseResolve, readyPromiseReject;
|
|
Module['ready'] = new Promise((resolve, reject) => {
|
|
readyPromiseResolve = resolve;
|
|
readyPromiseReject = reject;
|
|
});
|
|
|
|
// --pre-jses are emitted after the Module integration code, so that they can
|
|
// refer to Module (if they choose; they can also define Module)
|
|
// include: /usr/share/dotnet/packs/Microsoft.NETCore.App.Runtime.Mono.browser-wasm/10.0.2/runtimes/browser-wasm/native/src/es6/dotnet.es6.pre.js
|
|
if (_nativeModuleLoaded) throw new Error("Native module already loaded");
|
|
_nativeModuleLoaded = true;
|
|
createDotnetRuntime = Module = moduleArg(Module);
|
|
// end include: /usr/share/dotnet/packs/Microsoft.NETCore.App.Runtime.Mono.browser-wasm/10.0.2/runtimes/browser-wasm/native/src/es6/dotnet.es6.pre.js
|
|
|
|
|
|
// Sometimes an existing Module object exists with properties
|
|
// meant to overwrite the default module functionality. Here
|
|
// we collect those properties and reapply _after_ we configure
|
|
// the current environment's defaults to avoid having to be so
|
|
// defensive during initialization.
|
|
var moduleOverrides = Object.assign({}, Module);
|
|
|
|
var arguments_ = [];
|
|
var thisProgram = './this.program';
|
|
var quit_ = (status, toThrow) => {
|
|
throw toThrow;
|
|
};
|
|
|
|
// Determine the runtime environment we are in. You can customize this by
|
|
// setting the ENVIRONMENT setting at compile time (see settings.js).
|
|
|
|
// Attempt to auto-detect the environment
|
|
var ENVIRONMENT_IS_WEB = typeof window == 'object';
|
|
var ENVIRONMENT_IS_WORKER = typeof importScripts == 'function';
|
|
// N.b. Electron.js environment is simultaneously a NODE-environment, but
|
|
// also a web environment.
|
|
var ENVIRONMENT_IS_NODE = typeof process == 'object' && typeof process.versions == 'object' && typeof process.versions.node == 'string';
|
|
var ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER;
|
|
|
|
// `/` should be present at the end if `scriptDirectory` is not empty
|
|
var scriptDirectory = '';
|
|
function locateFile(path) {
|
|
if (Module['locateFile']) {
|
|
return Module['locateFile'](path, scriptDirectory);
|
|
}
|
|
return scriptDirectory + path;
|
|
}
|
|
|
|
// Hooks that are implemented differently in different runtime environments.
|
|
var read_,
|
|
readAsync,
|
|
readBinary;
|
|
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
|
|
// `require()` is no-op in an ESM module, use `createRequire()` to construct
|
|
// the require()` function. This is only necessary for multi-environment
|
|
// builds, `-sENVIRONMENT=node` emits a static import declaration instead.
|
|
// TODO: Swap all `require()`'s with `import()`'s?
|
|
const { createRequire } = await import('module');
|
|
/** @suppress{duplicate} */
|
|
var require = createRequire(import.meta.url);
|
|
// These modules will usually be used on Node.js. Load them eagerly to avoid
|
|
// the complexity of lazy-loading.
|
|
var fs = require('fs');
|
|
var nodePath = require('path');
|
|
|
|
if (ENVIRONMENT_IS_WORKER) {
|
|
scriptDirectory = nodePath.dirname(scriptDirectory) + '/';
|
|
} else {
|
|
// EXPORT_ES6 + ENVIRONMENT_IS_NODE always requires use of import.meta.url,
|
|
// since there's no way getting the current absolute path of the module when
|
|
// support for that is not available.
|
|
scriptDirectory = require('url').fileURLToPath(new URL('./', import.meta.url)); // includes trailing slash
|
|
}
|
|
|
|
// include: node_shell_read.js
|
|
read_ = (filename, binary) => {
|
|
// We need to re-wrap `file://` strings to URLs. Normalizing isn't
|
|
// necessary in that case, the path should already be absolute.
|
|
filename = isFileURI(filename) ? new URL(filename) : nodePath.normalize(filename);
|
|
return fs.readFileSync(filename, binary ? undefined : 'utf8');
|
|
};
|
|
|
|
readBinary = (filename) => {
|
|
var ret = read_(filename, true);
|
|
if (!ret.buffer) {
|
|
ret = new Uint8Array(ret);
|
|
}
|
|
return ret;
|
|
};
|
|
|
|
readAsync = (filename, onload, onerror, binary = true) => {
|
|
// See the comment in the `read_` function.
|
|
filename = isFileURI(filename) ? new URL(filename) : nodePath.normalize(filename);
|
|
fs.readFile(filename, binary ? undefined : 'utf8', (err, data) => {
|
|
if (err) onerror(err);
|
|
else onload(binary ? data.buffer : data);
|
|
});
|
|
};
|
|
// end include: node_shell_read.js
|
|
if (!Module['thisProgram'] && process.argv.length > 1) {
|
|
thisProgram = process.argv[1].replace(/\\/g, '/');
|
|
}
|
|
|
|
arguments_ = process.argv.slice(2);
|
|
|
|
// MODULARIZE will export the module in the proper place outside, we don't need to export here
|
|
|
|
quit_ = (status, toThrow) => {
|
|
process.exitCode = status;
|
|
throw toThrow;
|
|
};
|
|
|
|
} else
|
|
if (ENVIRONMENT_IS_SHELL) {
|
|
|
|
if (typeof read != 'undefined') {
|
|
read_ = read;
|
|
}
|
|
|
|
readBinary = (f) => {
|
|
if (typeof readbuffer == 'function') {
|
|
return new Uint8Array(readbuffer(f));
|
|
}
|
|
let data = read(f, 'binary');
|
|
assert(typeof data == 'object');
|
|
return data;
|
|
};
|
|
|
|
readAsync = (f, onload, onerror) => {
|
|
setTimeout(() => onload(readBinary(f)));
|
|
};
|
|
|
|
if (typeof clearTimeout == 'undefined') {
|
|
globalThis.clearTimeout = (id) => {};
|
|
}
|
|
|
|
if (typeof setTimeout == 'undefined') {
|
|
// spidermonkey lacks setTimeout but we use it above in readAsync.
|
|
globalThis.setTimeout = (f) => (typeof f == 'function') ? f() : abort();
|
|
}
|
|
|
|
if (typeof scriptArgs != 'undefined') {
|
|
arguments_ = scriptArgs;
|
|
} else if (typeof arguments != 'undefined') {
|
|
arguments_ = arguments;
|
|
}
|
|
|
|
if (typeof quit == 'function') {
|
|
quit_ = (status, toThrow) => {
|
|
// Unlike node which has process.exitCode, d8 has no such mechanism. So we
|
|
// have no way to set the exit code and then let the program exit with
|
|
// that code when it naturally stops running (say, when all setTimeouts
|
|
// have completed). For that reason, we must call `quit` - the only way to
|
|
// set the exit code - but quit also halts immediately. To increase
|
|
// consistency with node (and the web) we schedule the actual quit call
|
|
// using a setTimeout to give the current stack and any exception handlers
|
|
// a chance to run. This enables features such as addOnPostRun (which
|
|
// expected to be able to run code after main returns).
|
|
setTimeout(() => {
|
|
if (!(toThrow instanceof ExitStatus)) {
|
|
let toLog = toThrow;
|
|
if (toThrow && typeof toThrow == 'object' && toThrow.stack) {
|
|
toLog = [toThrow, toThrow.stack];
|
|
}
|
|
err(`exiting due to exception: ${toLog}`);
|
|
}
|
|
quit(status);
|
|
});
|
|
throw toThrow;
|
|
};
|
|
}
|
|
|
|
if (typeof print != 'undefined') {
|
|
// Prefer to use print/printErr where they exist, as they usually work better.
|
|
if (typeof console == 'undefined') console = /** @type{!Console} */({});
|
|
console.log = /** @type{!function(this:Console, ...*): undefined} */ (print);
|
|
console.warn = console.error = /** @type{!function(this:Console, ...*): undefined} */ (typeof printErr != 'undefined' ? printErr : print);
|
|
}
|
|
|
|
} else
|
|
|
|
// Note that this includes Node.js workers when relevant (pthreads is enabled).
|
|
// Node.js workers are detected as a combination of ENVIRONMENT_IS_WORKER and
|
|
// ENVIRONMENT_IS_NODE.
|
|
if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) {
|
|
if (ENVIRONMENT_IS_WORKER) { // Check worker, not web, since window could be polyfilled
|
|
scriptDirectory = self.location.href;
|
|
} else if (typeof document != 'undefined' && document.currentScript) { // web
|
|
scriptDirectory = document.currentScript.src;
|
|
}
|
|
// When MODULARIZE, this JS may be executed later, after document.currentScript
|
|
// is gone, so we saved it, and we use it here instead of any other info.
|
|
if (_scriptDir) {
|
|
scriptDirectory = _scriptDir;
|
|
}
|
|
// blob urls look like blob:http://site.com/etc/etc and we cannot infer anything from them.
|
|
// otherwise, slice off the final part of the url to find the script directory.
|
|
// if scriptDirectory does not contain a slash, lastIndexOf will return -1,
|
|
// and scriptDirectory will correctly be replaced with an empty string.
|
|
// If scriptDirectory contains a query (starting with ?) or a fragment (starting with #),
|
|
// they are removed because they could contain a slash.
|
|
if (scriptDirectory.startsWith('blob:')) {
|
|
scriptDirectory = '';
|
|
} else {
|
|
scriptDirectory = scriptDirectory.substr(0, scriptDirectory.replace(/[?#].*/, '').lastIndexOf('/')+1);
|
|
}
|
|
|
|
// Differentiate the Web Worker from the Node Worker case, as reading must
|
|
// be done differently.
|
|
{
|
|
// include: web_or_worker_shell_read.js
|
|
read_ = (url) => {
|
|
var xhr = new XMLHttpRequest();
|
|
xhr.open('GET', url, false);
|
|
xhr.send(null);
|
|
return xhr.responseText;
|
|
}
|
|
|
|
if (ENVIRONMENT_IS_WORKER) {
|
|
readBinary = (url) => {
|
|
var xhr = new XMLHttpRequest();
|
|
xhr.open('GET', url, false);
|
|
xhr.responseType = 'arraybuffer';
|
|
xhr.send(null);
|
|
return new Uint8Array(/** @type{!ArrayBuffer} */(xhr.response));
|
|
};
|
|
}
|
|
|
|
readAsync = (url, onload, onerror) => {
|
|
var xhr = new XMLHttpRequest();
|
|
xhr.open('GET', url, true);
|
|
xhr.responseType = 'arraybuffer';
|
|
xhr.onload = () => {
|
|
if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0
|
|
onload(xhr.response);
|
|
return;
|
|
}
|
|
onerror();
|
|
};
|
|
xhr.onerror = onerror;
|
|
xhr.send(null);
|
|
}
|
|
|
|
// end include: web_or_worker_shell_read.js
|
|
}
|
|
} else
|
|
{
|
|
}
|
|
|
|
var out = Module['print'] || console.log.bind(console);
|
|
var err = Module['printErr'] || console.error.bind(console);
|
|
|
|
// Merge back in the overrides
|
|
Object.assign(Module, moduleOverrides);
|
|
// Free the object hierarchy contained in the overrides, this lets the GC
|
|
// reclaim data used.
|
|
moduleOverrides = null;
|
|
|
|
// Emit code to handle expected values on the Module object. This applies Module.x
|
|
// to the proper local x. This has two benefits: first, we only emit it if it is
|
|
// expected to arrive, and second, by using a local everywhere else that can be
|
|
// minified.
|
|
|
|
if (Module['arguments']) arguments_ = Module['arguments'];
|
|
|
|
if (Module['thisProgram']) thisProgram = Module['thisProgram'];
|
|
|
|
if (Module['quit']) quit_ = Module['quit'];
|
|
|
|
// perform assertions in shell.js after we set up out() and err(), as otherwise if an assertion fails it cannot print the message
|
|
// end include: shell.js
|
|
|
|
// include: preamble.js
|
|
// === Preamble library stuff ===
|
|
|
|
// Documentation for the public APIs defined in this file must be updated in:
|
|
// site/source/docs/api_reference/preamble.js.rst
|
|
// A prebuilt local version of the documentation is available at:
|
|
// site/build/text/docs/api_reference/preamble.js.txt
|
|
// You can also build docs locally as HTML or other formats in site/
|
|
// An online HTML version (which may be of a different version of Emscripten)
|
|
// is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html
|
|
|
|
var wasmBinary;
|
|
if (Module['wasmBinary']) wasmBinary = Module['wasmBinary'];
|
|
|
|
// include: base64Utils.js
|
|
// include: polyfill/atob.js
|
|
// Copied from https://github.com/strophe/strophejs/blob/e06d027/src/polyfills.js#L149
|
|
|
|
// This code was written by Tyler Akins and has been placed in the
|
|
// public domain. It would be nice if you left this header intact.
|
|
// Base64 code from Tyler Akins -- http://rumkin.com
|
|
|
|
if (typeof atob == 'undefined') {
|
|
if (typeof global != 'undefined' && typeof globalThis == 'undefined') {
|
|
globalThis = global;
|
|
}
|
|
|
|
/**
|
|
* Decodes a base64 string.
|
|
* @param {string} input The string to decode.
|
|
*/
|
|
globalThis.atob = function(input) {
|
|
var keyStr = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=';
|
|
|
|
var output = '';
|
|
var chr1, chr2, chr3;
|
|
var enc1, enc2, enc3, enc4;
|
|
var i = 0;
|
|
// remove all characters that are not A-Z, a-z, 0-9, +, /, or =
|
|
input = input.replace(/[^A-Za-z0-9\+\/\=]/g, '');
|
|
do {
|
|
enc1 = keyStr.indexOf(input.charAt(i++));
|
|
enc2 = keyStr.indexOf(input.charAt(i++));
|
|
enc3 = keyStr.indexOf(input.charAt(i++));
|
|
enc4 = keyStr.indexOf(input.charAt(i++));
|
|
|
|
chr1 = (enc1 << 2) | (enc2 >> 4);
|
|
chr2 = ((enc2 & 15) << 4) | (enc3 >> 2);
|
|
chr3 = ((enc3 & 3) << 6) | enc4;
|
|
|
|
output = output + String.fromCharCode(chr1);
|
|
|
|
if (enc3 !== 64) {
|
|
output = output + String.fromCharCode(chr2);
|
|
}
|
|
if (enc4 !== 64) {
|
|
output = output + String.fromCharCode(chr3);
|
|
}
|
|
} while (i < input.length);
|
|
return output;
|
|
};
|
|
}
|
|
// end include: polyfill/atob.js
|
|
// Converts a string of base64 into a byte array (Uint8Array).
|
|
function intArrayFromBase64(s) {
|
|
if (typeof ENVIRONMENT_IS_NODE != 'undefined' && ENVIRONMENT_IS_NODE) {
|
|
var buf = Buffer.from(s, 'base64');
|
|
return new Uint8Array(buf.buffer, buf.byteOffset, buf.length);
|
|
}
|
|
|
|
var decoded = atob(s);
|
|
var bytes = new Uint8Array(decoded.length);
|
|
for (var i = 0 ; i < decoded.length ; ++i) {
|
|
bytes[i] = decoded.charCodeAt(i);
|
|
}
|
|
return bytes;
|
|
}
|
|
|
|
// If filename is a base64 data URI, parses and returns data (Buffer on node,
|
|
// Uint8Array otherwise). If filename is not a base64 data URI, returns undefined.
|
|
function tryParseAsDataURI(filename) {
|
|
if (!isDataURI(filename)) {
|
|
return;
|
|
}
|
|
|
|
return intArrayFromBase64(filename.slice(dataURIPrefix.length));
|
|
}
|
|
// end include: base64Utils.js
|
|
// Wasm globals
|
|
|
|
var wasmMemory;
|
|
|
|
//========================================
|
|
// Runtime essentials
|
|
//========================================
|
|
|
|
// whether we are quitting the application. no code should run after this.
|
|
// set in exit() and abort()
|
|
var ABORT = false;
|
|
|
|
// set by exit() and abort(). Passed to 'onExit' handler.
|
|
// NOTE: This is also used as the process return code code in shell environments
|
|
// but only when noExitRuntime is false.
|
|
var EXITSTATUS;
|
|
|
|
// In STRICT mode, we only define assert() when ASSERTIONS is set. i.e. we
|
|
// don't define it at all in release modes. This matches the behaviour of
|
|
// MINIMAL_RUNTIME.
|
|
// TODO(sbc): Make this the default even without STRICT enabled.
|
|
/** @type {function(*, string=)} */
|
|
function assert(condition, text) {
|
|
if (!condition) {
|
|
// This build was created without ASSERTIONS defined. `assert()` should not
|
|
// ever be called in this configuration but in case there are callers in
|
|
// the wild leave this simple abort() implementation here for now.
|
|
abort(text);
|
|
}
|
|
}
|
|
|
|
// Memory management
|
|
|
|
var HEAP,
|
|
/** @type {!Int8Array} */
|
|
HEAP8,
|
|
/** @type {!Uint8Array} */
|
|
HEAPU8,
|
|
/** @type {!Int16Array} */
|
|
HEAP16,
|
|
/** @type {!Uint16Array} */
|
|
HEAPU16,
|
|
/** @type {!Int32Array} */
|
|
HEAP32,
|
|
/** @type {!Uint32Array} */
|
|
HEAPU32,
|
|
/** @type {!Float32Array} */
|
|
HEAPF32,
|
|
/* BigInt64Array type is not correctly defined in closure
|
|
/** not-@type {!BigInt64Array} */
|
|
HEAP64,
|
|
/* BigUInt64Array type is not correctly defined in closure
|
|
/** not-t@type {!BigUint64Array} */
|
|
HEAPU64,
|
|
/** @type {!Float64Array} */
|
|
HEAPF64;
|
|
|
|
// include: runtime_shared.js
|
|
function updateMemoryViews() {
|
|
var b = wasmMemory.buffer;
|
|
Module['HEAP8'] = HEAP8 = new Int8Array(b);
|
|
Module['HEAP16'] = HEAP16 = new Int16Array(b);
|
|
Module['HEAPU8'] = HEAPU8 = new Uint8Array(b);
|
|
Module['HEAPU16'] = HEAPU16 = new Uint16Array(b);
|
|
Module['HEAP32'] = HEAP32 = new Int32Array(b);
|
|
Module['HEAPU32'] = HEAPU32 = new Uint32Array(b);
|
|
Module['HEAPF32'] = HEAPF32 = new Float32Array(b);
|
|
Module['HEAPF64'] = HEAPF64 = new Float64Array(b);
|
|
Module['HEAP64'] = HEAP64 = new BigInt64Array(b);
|
|
Module['HEAPU64'] = HEAPU64 = new BigUint64Array(b);
|
|
}
|
|
// end include: runtime_shared.js
|
|
// include: runtime_stack_check.js
|
|
// end include: runtime_stack_check.js
|
|
// include: runtime_assertions.js
|
|
// end include: runtime_assertions.js
|
|
var __ATPRERUN__ = []; // functions called before the runtime is initialized
|
|
var __ATINIT__ = []; // functions called during startup
|
|
var __ATEXIT__ = []; // functions called during shutdown
|
|
var __ATPOSTRUN__ = []; // functions called after the main() is called
|
|
|
|
var runtimeInitialized = false;
|
|
|
|
var runtimeExited = false;
|
|
|
|
function preRun() {
|
|
if (Module['preRun']) {
|
|
if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']];
|
|
while (Module['preRun'].length) {
|
|
addOnPreRun(Module['preRun'].shift());
|
|
}
|
|
}
|
|
callRuntimeCallbacks(__ATPRERUN__);
|
|
}
|
|
|
|
function initRuntime() {
|
|
runtimeInitialized = true;
|
|
|
|
SOCKFS.root = FS.mount(SOCKFS, {}, null);
|
|
|
|
if (!Module['noFSInit'] && !FS.init.initialized)
|
|
FS.init();
|
|
FS.ignorePermissions = false;
|
|
|
|
TTY.init();
|
|
callRuntimeCallbacks(__ATINIT__);
|
|
}
|
|
|
|
function exitRuntime() {
|
|
___funcs_on_exit(); // Native atexit() functions
|
|
callRuntimeCallbacks(__ATEXIT__);
|
|
FS.quit();
|
|
TTY.shutdown();
|
|
runtimeExited = true;
|
|
}
|
|
|
|
function postRun() {
|
|
|
|
if (Module['postRun']) {
|
|
if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']];
|
|
while (Module['postRun'].length) {
|
|
addOnPostRun(Module['postRun'].shift());
|
|
}
|
|
}
|
|
|
|
callRuntimeCallbacks(__ATPOSTRUN__);
|
|
}
|
|
|
|
function addOnPreRun(cb) {
|
|
__ATPRERUN__.unshift(cb);
|
|
}
|
|
|
|
function addOnInit(cb) {
|
|
__ATINIT__.unshift(cb);
|
|
}
|
|
|
|
function addOnExit(cb) {
|
|
__ATEXIT__.unshift(cb);
|
|
}
|
|
|
|
function addOnPostRun(cb) {
|
|
__ATPOSTRUN__.unshift(cb);
|
|
}
|
|
|
|
// include: runtime_math.js
|
|
// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/imul
|
|
|
|
// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/fround
|
|
|
|
// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/clz32
|
|
|
|
// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/trunc
|
|
|
|
// end include: runtime_math.js
|
|
// A counter of dependencies for calling run(). If we need to
|
|
// do asynchronous work before running, increment this and
|
|
// decrement it. Incrementing must happen in a place like
|
|
// Module.preRun (used by emcc to add file preloading).
|
|
// Note that you can add dependencies in preRun, even though
|
|
// it happens right before run - run will be postponed until
|
|
// the dependencies are met.
|
|
var runDependencies = 0;
|
|
var runDependencyWatcher = null;
|
|
var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled
|
|
|
|
function getUniqueRunDependency(id) {
|
|
return id;
|
|
}
|
|
|
|
function addRunDependency(id) {
|
|
runDependencies++;
|
|
|
|
Module['monitorRunDependencies']?.(runDependencies);
|
|
|
|
}
|
|
|
|
function removeRunDependency(id) {
|
|
runDependencies--;
|
|
|
|
Module['monitorRunDependencies']?.(runDependencies);
|
|
|
|
if (runDependencies == 0) {
|
|
if (runDependencyWatcher !== null) {
|
|
clearInterval(runDependencyWatcher);
|
|
runDependencyWatcher = null;
|
|
}
|
|
if (dependenciesFulfilled) {
|
|
var callback = dependenciesFulfilled;
|
|
dependenciesFulfilled = null;
|
|
callback(); // can add another dependenciesFulfilled
|
|
}
|
|
}
|
|
}
|
|
|
|
/** @param {string|number=} what */
|
|
function abort(what) {
|
|
Module['onAbort']?.(what);
|
|
|
|
what = 'Aborted(' + what + ')';
|
|
// TODO(sbc): Should we remove printing and leave it up to whoever
|
|
// catches the exception?
|
|
err(what);
|
|
|
|
ABORT = true;
|
|
EXITSTATUS = 1;
|
|
|
|
what += '. Build with -sASSERTIONS for more info.';
|
|
|
|
// Use a wasm runtime error, because a JS error might be seen as a foreign
|
|
// exception, which means we'd run destructors on it. We need the error to
|
|
// simply make the program stop.
|
|
// FIXME This approach does not work in Wasm EH because it currently does not assume
|
|
// all RuntimeErrors are from traps; it decides whether a RuntimeError is from
|
|
// a trap or not based on a hidden field within the object. So at the moment
|
|
// we don't have a way of throwing a wasm trap from JS. TODO Make a JS API that
|
|
// allows this in the wasm spec.
|
|
|
|
// Suppress closure compiler warning here. Closure compiler's builtin extern
|
|
// definition for WebAssembly.RuntimeError claims it takes no arguments even
|
|
// though it can.
|
|
// TODO(https://github.com/google/closure-compiler/pull/3913): Remove if/when upstream closure gets fixed.
|
|
// See above, in the meantime, we resort to wasm code for trapping.
|
|
//
|
|
// In case abort() is called before the module is initialized, wasmExports
|
|
// and its exported '__trap' function is not available, in which case we throw
|
|
// a RuntimeError.
|
|
//
|
|
// We trap instead of throwing RuntimeError to prevent infinite-looping in
|
|
// Wasm EH code (because RuntimeError is considered as a foreign exception and
|
|
// caught by 'catch_all'), but in case throwing RuntimeError is fine because
|
|
// the module has not even been instantiated, even less running.
|
|
if (runtimeInitialized) {
|
|
___trap();
|
|
}
|
|
/** @suppress {checkTypes} */
|
|
var e = new WebAssembly.RuntimeError(what);
|
|
|
|
readyPromiseReject(e);
|
|
// Throw the error whether or not MODULARIZE is set because abort is used
|
|
// in code paths apart from instantiation where an exception is expected
|
|
// to be thrown when abort is called.
|
|
throw e;
|
|
}
|
|
|
|
// include: memoryprofiler.js
|
|
// end include: memoryprofiler.js
|
|
// include: URIUtils.js
|
|
// Prefix of data URIs emitted by SINGLE_FILE and related options.
|
|
var dataURIPrefix = 'data:application/octet-stream;base64,';
|
|
|
|
/**
|
|
* Indicates whether filename is a base64 data URI.
|
|
* @noinline
|
|
*/
|
|
var isDataURI = (filename) => filename.startsWith(dataURIPrefix);
|
|
|
|
/**
|
|
* Indicates whether filename is delivered via file protocol (as opposed to http/https)
|
|
* @noinline
|
|
*/
|
|
var isFileURI = (filename) => filename.startsWith('file://');
|
|
// end include: URIUtils.js
|
|
// include: runtime_exceptions.js
|
|
// end include: runtime_exceptions.js
|
|
var wasmBinaryFile;
|
|
if (Module['locateFile']) {
|
|
wasmBinaryFile = 'dotnet.native.wasm';
|
|
if (!isDataURI(wasmBinaryFile)) {
|
|
wasmBinaryFile = locateFile(wasmBinaryFile);
|
|
}
|
|
} else {
|
|
if (ENVIRONMENT_IS_SHELL)
|
|
wasmBinaryFile = 'dotnet.native.wasm';
|
|
else
|
|
// Use bundler-friendly `new URL(..., import.meta.url)` pattern; works in browsers too.
|
|
wasmBinaryFile = new URL('dotnet.native.wasm', import.meta.url).href;
|
|
}
|
|
|
|
function getBinarySync(file) {
|
|
if (file == wasmBinaryFile && wasmBinary) {
|
|
return new Uint8Array(wasmBinary);
|
|
}
|
|
if (readBinary) {
|
|
return readBinary(file);
|
|
}
|
|
throw 'both async and sync fetching of the wasm failed';
|
|
}
|
|
|
|
function getBinaryPromise(binaryFile) {
|
|
// If we don't have the binary yet, try to load it asynchronously.
|
|
// Fetch has some additional restrictions over XHR, like it can't be used on a file:// url.
|
|
// See https://github.com/github/fetch/pull/92#issuecomment-140665932
|
|
// Cordova or Electron apps are typically loaded from a file:// url.
|
|
// So use fetch if it is available and the url is not a file, otherwise fall back to XHR.
|
|
if (!wasmBinary
|
|
&& (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER)) {
|
|
if (typeof fetch == 'function'
|
|
&& !isFileURI(binaryFile)
|
|
) {
|
|
return fetch(binaryFile, { credentials: 'same-origin' }).then((response) => {
|
|
if (!response['ok']) {
|
|
throw `failed to load wasm binary file at '${binaryFile}'`;
|
|
}
|
|
return response['arrayBuffer']();
|
|
}).catch(() => getBinarySync(binaryFile));
|
|
}
|
|
else if (readAsync) {
|
|
// fetch is not available or url is file => try XHR (readAsync uses XHR internally)
|
|
return new Promise((resolve, reject) => {
|
|
readAsync(binaryFile, (response) => resolve(new Uint8Array(/** @type{!ArrayBuffer} */(response))), reject)
|
|
});
|
|
}
|
|
}
|
|
|
|
// Otherwise, getBinarySync should be able to get it synchronously
|
|
return Promise.resolve().then(() => getBinarySync(binaryFile));
|
|
}
|
|
|
|
function instantiateArrayBuffer(binaryFile, imports, receiver) {
|
|
return getBinaryPromise(binaryFile).then((binary) => {
|
|
return WebAssembly.instantiate(binary, imports);
|
|
}).then(receiver, (reason) => {
|
|
err(`failed to asynchronously prepare wasm: ${reason}`);
|
|
|
|
abort(reason);
|
|
});
|
|
}
|
|
|
|
function instantiateAsync(binary, binaryFile, imports, callback) {
|
|
if (!binary &&
|
|
typeof WebAssembly.instantiateStreaming == 'function' &&
|
|
!isDataURI(binaryFile) &&
|
|
// Don't use streaming for file:// delivered objects in a webview, fetch them synchronously.
|
|
!isFileURI(binaryFile) &&
|
|
// Avoid instantiateStreaming() on Node.js environment for now, as while
|
|
// Node.js v18.1.0 implements it, it does not have a full fetch()
|
|
// implementation yet.
|
|
//
|
|
// Reference:
|
|
// https://github.com/emscripten-core/emscripten/pull/16917
|
|
!ENVIRONMENT_IS_NODE &&
|
|
typeof fetch == 'function') {
|
|
return fetch(binaryFile, { credentials: 'same-origin' }).then((response) => {
|
|
// Suppress closure warning here since the upstream definition for
|
|
// instantiateStreaming only allows Promise<Repsponse> rather than
|
|
// an actual Response.
|
|
// TODO(https://github.com/google/closure-compiler/pull/3913): Remove if/when upstream closure is fixed.
|
|
/** @suppress {checkTypes} */
|
|
var result = WebAssembly.instantiateStreaming(response, imports);
|
|
|
|
return result.then(
|
|
callback,
|
|
function(reason) {
|
|
// We expect the most common failure cause to be a bad MIME type for the binary,
|
|
// in which case falling back to ArrayBuffer instantiation should work.
|
|
err(`wasm streaming compile failed: ${reason}`);
|
|
err('falling back to ArrayBuffer instantiation');
|
|
return instantiateArrayBuffer(binaryFile, imports, callback);
|
|
});
|
|
});
|
|
}
|
|
return instantiateArrayBuffer(binaryFile, imports, callback);
|
|
}
|
|
|
|
// Create the wasm instance.
|
|
// Receives the wasm imports, returns the exports.
|
|
function createWasm() {
|
|
// prepare imports
|
|
var info = {
|
|
'env': wasmImports,
|
|
'wasi_snapshot_preview1': wasmImports,
|
|
};
|
|
// Load the wasm module and create an instance of using native support in the JS engine.
|
|
// handle a generated wasm instance, receiving its exports and
|
|
// performing other necessary setup
|
|
/** @param {WebAssembly.Module=} module*/
|
|
function receiveInstance(instance, module) {
|
|
wasmExports = instance.exports;
|
|
|
|
Module['wasmExports'] = wasmExports;
|
|
|
|
wasmMemory = wasmExports['memory'];
|
|
|
|
updateMemoryViews();
|
|
|
|
wasmTable = wasmExports['__indirect_function_table'];
|
|
|
|
|
|
addOnInit(wasmExports['__wasm_call_ctors']);
|
|
|
|
removeRunDependency('wasm-instantiate');
|
|
return wasmExports;
|
|
}
|
|
// wait for the pthread pool (if any)
|
|
addRunDependency('wasm-instantiate');
|
|
|
|
// Prefer streaming instantiation if available.
|
|
function receiveInstantiationResult(result) {
|
|
// 'result' is a ResultObject object which has both the module and instance.
|
|
// receiveInstance() will swap in the exports (to Module.asm) so they can be called
|
|
// TODO: Due to Closure regression https://github.com/google/closure-compiler/issues/3193, the above line no longer optimizes out down to the following line.
|
|
// When the regression is fixed, can restore the above PTHREADS-enabled path.
|
|
receiveInstance(result['instance']);
|
|
}
|
|
|
|
// User shell pages can write their own Module.instantiateWasm = function(imports, successCallback) callback
|
|
// to manually instantiate the Wasm module themselves. This allows pages to
|
|
// run the instantiation parallel to any other async startup actions they are
|
|
// performing.
|
|
// Also pthreads and wasm workers initialize the wasm instance through this
|
|
// path.
|
|
if (Module['instantiateWasm']) {
|
|
|
|
try {
|
|
return Module['instantiateWasm'](info, receiveInstance);
|
|
} catch(e) {
|
|
err(`Module.instantiateWasm callback failed with error: ${e}`);
|
|
// If instantiation fails, reject the module ready promise.
|
|
readyPromiseReject(e);
|
|
}
|
|
}
|
|
|
|
// If instantiation fails, reject the module ready promise.
|
|
instantiateAsync(wasmBinary, wasmBinaryFile, info, receiveInstantiationResult).catch(readyPromiseReject);
|
|
return {}; // no exports yet; we'll fill them in later
|
|
}
|
|
|
|
// include: runtime_debug.js
|
|
// end include: runtime_debug.js
|
|
// === Body ===
|
|
// end include: preamble.js
|
|
|
|
|
|
/** @constructor */
|
|
function ExitStatus(status) {
|
|
this.name = 'ExitStatus';
|
|
this.message = `Program terminated with exit(${status})`;
|
|
this.status = status;
|
|
}
|
|
|
|
var callRuntimeCallbacks = (callbacks) => {
|
|
while (callbacks.length > 0) {
|
|
// Pass the module as the first argument.
|
|
callbacks.shift()(Module);
|
|
}
|
|
};
|
|
|
|
|
|
/**
|
|
* @param {number} ptr
|
|
* @param {string} type
|
|
*/
|
|
function getValue(ptr, type = 'i8') {
|
|
if (type.endsWith('*')) type = '*';
|
|
switch (type) {
|
|
case 'i1': return HEAP8[ptr];
|
|
case 'i8': return HEAP8[ptr];
|
|
case 'i16': return HEAP16[((ptr)>>1)];
|
|
case 'i32': return HEAP32[((ptr)>>2)];
|
|
case 'i64': return HEAP64[((ptr)>>3)];
|
|
case 'float': return HEAPF32[((ptr)>>2)];
|
|
case 'double': return HEAPF64[((ptr)>>3)];
|
|
case '*': return HEAPU32[((ptr)>>2)];
|
|
default: abort(`invalid type for getValue: ${type}`);
|
|
}
|
|
}
|
|
|
|
var noExitRuntime = Module['noExitRuntime'] || false;
|
|
|
|
|
|
/**
|
|
* @param {number} ptr
|
|
* @param {number} value
|
|
* @param {string} type
|
|
*/
|
|
function setValue(ptr, value, type = 'i8') {
|
|
if (type.endsWith('*')) type = '*';
|
|
switch (type) {
|
|
case 'i1': HEAP8[ptr] = value; break;
|
|
case 'i8': HEAP8[ptr] = value; break;
|
|
case 'i16': HEAP16[((ptr)>>1)] = value; break;
|
|
case 'i32': HEAP32[((ptr)>>2)] = value; break;
|
|
case 'i64': HEAP64[((ptr)>>3)] = BigInt(value); break;
|
|
case 'float': HEAPF32[((ptr)>>2)] = value; break;
|
|
case 'double': HEAPF64[((ptr)>>3)] = value; break;
|
|
case '*': HEAPU32[((ptr)>>2)] = value; break;
|
|
default: abort(`invalid type for setValue: ${type}`);
|
|
}
|
|
}
|
|
|
|
var UTF8Decoder = typeof TextDecoder != 'undefined' ? new TextDecoder('utf8') : undefined;
|
|
|
|
/**
|
|
* Given a pointer 'idx' to a null-terminated UTF8-encoded string in the given
|
|
* array that contains uint8 values, returns a copy of that string as a
|
|
* Javascript String object.
|
|
* heapOrArray is either a regular array, or a JavaScript typed array view.
|
|
* @param {number} idx
|
|
* @param {number=} maxBytesToRead
|
|
* @return {string}
|
|
*/
|
|
var UTF8ArrayToString = (heapOrArray, idx, maxBytesToRead) => {
|
|
var endIdx = idx + maxBytesToRead;
|
|
var endPtr = idx;
|
|
// TextDecoder needs to know the byte length in advance, it doesn't stop on
|
|
// null terminator by itself. Also, use the length info to avoid running tiny
|
|
// strings through TextDecoder, since .subarray() allocates garbage.
|
|
// (As a tiny code save trick, compare endPtr against endIdx using a negation,
|
|
// so that undefined means Infinity)
|
|
while (heapOrArray[endPtr] && !(endPtr >= endIdx)) ++endPtr;
|
|
|
|
if (endPtr - idx > 16 && heapOrArray.buffer && UTF8Decoder) {
|
|
return UTF8Decoder.decode(heapOrArray.subarray(idx, endPtr));
|
|
}
|
|
var str = '';
|
|
// If building with TextDecoder, we have already computed the string length
|
|
// above, so test loop end condition against that
|
|
while (idx < endPtr) {
|
|
// For UTF8 byte structure, see:
|
|
// http://en.wikipedia.org/wiki/UTF-8#Description
|
|
// https://www.ietf.org/rfc/rfc2279.txt
|
|
// https://tools.ietf.org/html/rfc3629
|
|
var u0 = heapOrArray[idx++];
|
|
if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; }
|
|
var u1 = heapOrArray[idx++] & 63;
|
|
if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; }
|
|
var u2 = heapOrArray[idx++] & 63;
|
|
if ((u0 & 0xF0) == 0xE0) {
|
|
u0 = ((u0 & 15) << 12) | (u1 << 6) | u2;
|
|
} else {
|
|
u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | (heapOrArray[idx++] & 63);
|
|
}
|
|
|
|
if (u0 < 0x10000) {
|
|
str += String.fromCharCode(u0);
|
|
} else {
|
|
var ch = u0 - 0x10000;
|
|
str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
|
|
}
|
|
}
|
|
return str;
|
|
};
|
|
|
|
/**
|
|
* Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the
|
|
* emscripten HEAP, returns a copy of that string as a Javascript String object.
|
|
*
|
|
* @param {number} ptr
|
|
* @param {number=} maxBytesToRead - An optional length that specifies the
|
|
* maximum number of bytes to read. You can omit this parameter to scan the
|
|
* string until the first 0 byte. If maxBytesToRead is passed, and the string
|
|
* at [ptr, ptr+maxBytesToReadr[ contains a null byte in the middle, then the
|
|
* string will cut short at that byte index (i.e. maxBytesToRead will not
|
|
* produce a string of exact length [ptr, ptr+maxBytesToRead[) N.B. mixing
|
|
* frequent uses of UTF8ToString() with and without maxBytesToRead may throw
|
|
* JS JIT optimizations off, so it is worth to consider consistently using one
|
|
* @return {string}
|
|
*/
|
|
var UTF8ToString = (ptr, maxBytesToRead) => {
|
|
return ptr ? UTF8ArrayToString(HEAPU8, ptr, maxBytesToRead) : '';
|
|
};
|
|
var ___assert_fail = (condition, filename, line, func) => {
|
|
abort(`Assertion failed: ${UTF8ToString(condition)}, at: ` + [filename ? UTF8ToString(filename) : 'unknown filename', line, func ? UTF8ToString(func) : 'unknown function']);
|
|
};
|
|
|
|
var initRandomFill = () => {
|
|
if (typeof crypto == 'object' && typeof crypto['getRandomValues'] == 'function') {
|
|
// for modern web browsers
|
|
return (view) => crypto.getRandomValues(view);
|
|
} else
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
// for nodejs with or without crypto support included
|
|
try {
|
|
var crypto_module = require('crypto');
|
|
var randomFillSync = crypto_module['randomFillSync'];
|
|
if (randomFillSync) {
|
|
// nodejs with LTS crypto support
|
|
return (view) => crypto_module['randomFillSync'](view);
|
|
}
|
|
// very old nodejs with the original crypto API
|
|
var randomBytes = crypto_module['randomBytes'];
|
|
return (view) => (
|
|
view.set(randomBytes(view.byteLength)),
|
|
// Return the original view to match modern native implementations.
|
|
view
|
|
);
|
|
} catch (e) {
|
|
// nodejs doesn't have crypto support
|
|
}
|
|
}
|
|
// we couldn't find a proper implementation, as Math.random() is not suitable for /dev/random, see emscripten-core/emscripten/pull/7096
|
|
abort('initRandomDevice');
|
|
};
|
|
var randomFill = (view) => {
|
|
// Lazily init on the first invocation.
|
|
return (randomFill = initRandomFill())(view);
|
|
};
|
|
|
|
var PATH = {
|
|
isAbs:(path) => path.charAt(0) === '/',
|
|
splitPath:(filename) => {
|
|
var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
|
|
return splitPathRe.exec(filename).slice(1);
|
|
},
|
|
normalizeArray:(parts, allowAboveRoot) => {
|
|
// if the path tries to go above the root, `up` ends up > 0
|
|
var up = 0;
|
|
for (var i = parts.length - 1; i >= 0; i--) {
|
|
var last = parts[i];
|
|
if (last === '.') {
|
|
parts.splice(i, 1);
|
|
} else if (last === '..') {
|
|
parts.splice(i, 1);
|
|
up++;
|
|
} else if (up) {
|
|
parts.splice(i, 1);
|
|
up--;
|
|
}
|
|
}
|
|
// if the path is allowed to go above the root, restore leading ..s
|
|
if (allowAboveRoot) {
|
|
for (; up; up--) {
|
|
parts.unshift('..');
|
|
}
|
|
}
|
|
return parts;
|
|
},
|
|
normalize:(path) => {
|
|
var isAbsolute = PATH.isAbs(path),
|
|
trailingSlash = path.substr(-1) === '/';
|
|
// Normalize the path
|
|
path = PATH.normalizeArray(path.split('/').filter((p) => !!p), !isAbsolute).join('/');
|
|
if (!path && !isAbsolute) {
|
|
path = '.';
|
|
}
|
|
if (path && trailingSlash) {
|
|
path += '/';
|
|
}
|
|
return (isAbsolute ? '/' : '') + path;
|
|
},
|
|
dirname:(path) => {
|
|
var result = PATH.splitPath(path),
|
|
root = result[0],
|
|
dir = result[1];
|
|
if (!root && !dir) {
|
|
// No dirname whatsoever
|
|
return '.';
|
|
}
|
|
if (dir) {
|
|
// It has a dirname, strip trailing slash
|
|
dir = dir.substr(0, dir.length - 1);
|
|
}
|
|
return root + dir;
|
|
},
|
|
basename:(path) => {
|
|
// EMSCRIPTEN return '/'' for '/', not an empty string
|
|
if (path === '/') return '/';
|
|
path = PATH.normalize(path);
|
|
path = path.replace(/\/$/, "");
|
|
var lastSlash = path.lastIndexOf('/');
|
|
if (lastSlash === -1) return path;
|
|
return path.substr(lastSlash+1);
|
|
},
|
|
join:(...paths) => PATH.normalize(paths.join('/')),
|
|
join2:(l, r) => PATH.normalize(l + '/' + r),
|
|
};
|
|
|
|
|
|
var PATH_FS = {
|
|
resolve:(...args) => {
|
|
var resolvedPath = '',
|
|
resolvedAbsolute = false;
|
|
for (var i = args.length - 1; i >= -1 && !resolvedAbsolute; i--) {
|
|
var path = (i >= 0) ? args[i] : FS.cwd();
|
|
// Skip empty and invalid entries
|
|
if (typeof path != 'string') {
|
|
throw new TypeError('Arguments to path.resolve must be strings');
|
|
} else if (!path) {
|
|
return ''; // an invalid portion invalidates the whole thing
|
|
}
|
|
resolvedPath = path + '/' + resolvedPath;
|
|
resolvedAbsolute = PATH.isAbs(path);
|
|
}
|
|
// At this point the path should be resolved to a full absolute path, but
|
|
// handle relative paths to be safe (might happen when process.cwd() fails)
|
|
resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter((p) => !!p), !resolvedAbsolute).join('/');
|
|
return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.';
|
|
},
|
|
relative:(from, to) => {
|
|
from = PATH_FS.resolve(from).substr(1);
|
|
to = PATH_FS.resolve(to).substr(1);
|
|
function trim(arr) {
|
|
var start = 0;
|
|
for (; start < arr.length; start++) {
|
|
if (arr[start] !== '') break;
|
|
}
|
|
var end = arr.length - 1;
|
|
for (; end >= 0; end--) {
|
|
if (arr[end] !== '') break;
|
|
}
|
|
if (start > end) return [];
|
|
return arr.slice(start, end - start + 1);
|
|
}
|
|
var fromParts = trim(from.split('/'));
|
|
var toParts = trim(to.split('/'));
|
|
var length = Math.min(fromParts.length, toParts.length);
|
|
var samePartsLength = length;
|
|
for (var i = 0; i < length; i++) {
|
|
if (fromParts[i] !== toParts[i]) {
|
|
samePartsLength = i;
|
|
break;
|
|
}
|
|
}
|
|
var outputParts = [];
|
|
for (var i = samePartsLength; i < fromParts.length; i++) {
|
|
outputParts.push('..');
|
|
}
|
|
outputParts = outputParts.concat(toParts.slice(samePartsLength));
|
|
return outputParts.join('/');
|
|
},
|
|
};
|
|
|
|
|
|
|
|
var FS_stdin_getChar_buffer = [];
|
|
|
|
var lengthBytesUTF8 = (str) => {
|
|
var len = 0;
|
|
for (var i = 0; i < str.length; ++i) {
|
|
// Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code
|
|
// unit, not a Unicode code point of the character! So decode
|
|
// UTF16->UTF32->UTF8.
|
|
// See http://unicode.org/faq/utf_bom.html#utf16-3
|
|
var c = str.charCodeAt(i); // possibly a lead surrogate
|
|
if (c <= 0x7F) {
|
|
len++;
|
|
} else if (c <= 0x7FF) {
|
|
len += 2;
|
|
} else if (c >= 0xD800 && c <= 0xDFFF) {
|
|
len += 4; ++i;
|
|
} else {
|
|
len += 3;
|
|
}
|
|
}
|
|
return len;
|
|
};
|
|
|
|
var stringToUTF8Array = (str, heap, outIdx, maxBytesToWrite) => {
|
|
// Parameter maxBytesToWrite is not optional. Negative values, 0, null,
|
|
// undefined and false each don't write out any bytes.
|
|
if (!(maxBytesToWrite > 0))
|
|
return 0;
|
|
|
|
var startIdx = outIdx;
|
|
var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator.
|
|
for (var i = 0; i < str.length; ++i) {
|
|
// Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code
|
|
// unit, not a Unicode code point of the character! So decode
|
|
// UTF16->UTF32->UTF8.
|
|
// See http://unicode.org/faq/utf_bom.html#utf16-3
|
|
// For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description
|
|
// and https://www.ietf.org/rfc/rfc2279.txt
|
|
// and https://tools.ietf.org/html/rfc3629
|
|
var u = str.charCodeAt(i); // possibly a lead surrogate
|
|
if (u >= 0xD800 && u <= 0xDFFF) {
|
|
var u1 = str.charCodeAt(++i);
|
|
u = 0x10000 + ((u & 0x3FF) << 10) | (u1 & 0x3FF);
|
|
}
|
|
if (u <= 0x7F) {
|
|
if (outIdx >= endIdx) break;
|
|
heap[outIdx++] = u;
|
|
} else if (u <= 0x7FF) {
|
|
if (outIdx + 1 >= endIdx) break;
|
|
heap[outIdx++] = 0xC0 | (u >> 6);
|
|
heap[outIdx++] = 0x80 | (u & 63);
|
|
} else if (u <= 0xFFFF) {
|
|
if (outIdx + 2 >= endIdx) break;
|
|
heap[outIdx++] = 0xE0 | (u >> 12);
|
|
heap[outIdx++] = 0x80 | ((u >> 6) & 63);
|
|
heap[outIdx++] = 0x80 | (u & 63);
|
|
} else {
|
|
if (outIdx + 3 >= endIdx) break;
|
|
heap[outIdx++] = 0xF0 | (u >> 18);
|
|
heap[outIdx++] = 0x80 | ((u >> 12) & 63);
|
|
heap[outIdx++] = 0x80 | ((u >> 6) & 63);
|
|
heap[outIdx++] = 0x80 | (u & 63);
|
|
}
|
|
}
|
|
// Null-terminate the pointer to the buffer.
|
|
heap[outIdx] = 0;
|
|
return outIdx - startIdx;
|
|
};
|
|
/** @type {function(string, boolean=, number=)} */
|
|
function intArrayFromString(stringy, dontAddNull, length) {
|
|
var len = length > 0 ? length : lengthBytesUTF8(stringy)+1;
|
|
var u8array = new Array(len);
|
|
var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length);
|
|
if (dontAddNull) u8array.length = numBytesWritten;
|
|
return u8array;
|
|
}
|
|
var FS_stdin_getChar = () => {
|
|
if (!FS_stdin_getChar_buffer.length) {
|
|
var result = null;
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
// we will read data by chunks of BUFSIZE
|
|
var BUFSIZE = 256;
|
|
var buf = Buffer.alloc(BUFSIZE);
|
|
var bytesRead = 0;
|
|
|
|
// For some reason we must suppress a closure warning here, even though
|
|
// fd definitely exists on process.stdin, and is even the proper way to
|
|
// get the fd of stdin,
|
|
// https://github.com/nodejs/help/issues/2136#issuecomment-523649904
|
|
// This started to happen after moving this logic out of library_tty.js,
|
|
// so it is related to the surrounding code in some unclear manner.
|
|
/** @suppress {missingProperties} */
|
|
var fd = process.stdin.fd;
|
|
|
|
try {
|
|
bytesRead = fs.readSync(fd, buf);
|
|
} catch(e) {
|
|
// Cross-platform differences: on Windows, reading EOF throws an exception, but on other OSes,
|
|
// reading EOF returns 0. Uniformize behavior by treating the EOF exception to return 0.
|
|
if (e.toString().includes('EOF')) bytesRead = 0;
|
|
else throw e;
|
|
}
|
|
|
|
if (bytesRead > 0) {
|
|
result = buf.slice(0, bytesRead).toString('utf-8');
|
|
} else {
|
|
result = null;
|
|
}
|
|
} else
|
|
if (typeof window != 'undefined' &&
|
|
typeof window.prompt == 'function') {
|
|
// Browser.
|
|
result = window.prompt('Input: '); // returns null on cancel
|
|
if (result !== null) {
|
|
result += '\n';
|
|
}
|
|
} else if (typeof readline == 'function') {
|
|
// Command line.
|
|
result = readline();
|
|
if (result !== null) {
|
|
result += '\n';
|
|
}
|
|
}
|
|
if (!result) {
|
|
return null;
|
|
}
|
|
FS_stdin_getChar_buffer = intArrayFromString(result, true);
|
|
}
|
|
return FS_stdin_getChar_buffer.shift();
|
|
};
|
|
var TTY = {
|
|
ttys:[],
|
|
init() {
|
|
// https://github.com/emscripten-core/emscripten/pull/1555
|
|
// if (ENVIRONMENT_IS_NODE) {
|
|
// // currently, FS.init does not distinguish if process.stdin is a file or TTY
|
|
// // device, it always assumes it's a TTY device. because of this, we're forcing
|
|
// // process.stdin to UTF8 encoding to at least make stdin reading compatible
|
|
// // with text files until FS.init can be refactored.
|
|
// process.stdin.setEncoding('utf8');
|
|
// }
|
|
},
|
|
shutdown() {
|
|
// https://github.com/emscripten-core/emscripten/pull/1555
|
|
// if (ENVIRONMENT_IS_NODE) {
|
|
// // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)?
|
|
// // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation
|
|
// // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists?
|
|
// // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle
|
|
// // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call
|
|
// process.stdin.pause();
|
|
// }
|
|
},
|
|
register(dev, ops) {
|
|
TTY.ttys[dev] = { input: [], output: [], ops: ops };
|
|
FS.registerDevice(dev, TTY.stream_ops);
|
|
},
|
|
stream_ops:{
|
|
open(stream) {
|
|
var tty = TTY.ttys[stream.node.rdev];
|
|
if (!tty) {
|
|
throw new FS.ErrnoError(43);
|
|
}
|
|
stream.tty = tty;
|
|
stream.seekable = false;
|
|
},
|
|
close(stream) {
|
|
// flush any pending line data
|
|
stream.tty.ops.fsync(stream.tty);
|
|
},
|
|
fsync(stream) {
|
|
stream.tty.ops.fsync(stream.tty);
|
|
},
|
|
read(stream, buffer, offset, length, pos /* ignored */) {
|
|
if (!stream.tty || !stream.tty.ops.get_char) {
|
|
throw new FS.ErrnoError(60);
|
|
}
|
|
var bytesRead = 0;
|
|
for (var i = 0; i < length; i++) {
|
|
var result;
|
|
try {
|
|
result = stream.tty.ops.get_char(stream.tty);
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(29);
|
|
}
|
|
if (result === undefined && bytesRead === 0) {
|
|
throw new FS.ErrnoError(6);
|
|
}
|
|
if (result === null || result === undefined) break;
|
|
bytesRead++;
|
|
buffer[offset+i] = result;
|
|
}
|
|
if (bytesRead) {
|
|
stream.node.timestamp = Date.now();
|
|
}
|
|
return bytesRead;
|
|
},
|
|
write(stream, buffer, offset, length, pos) {
|
|
if (!stream.tty || !stream.tty.ops.put_char) {
|
|
throw new FS.ErrnoError(60);
|
|
}
|
|
try {
|
|
for (var i = 0; i < length; i++) {
|
|
stream.tty.ops.put_char(stream.tty, buffer[offset+i]);
|
|
}
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(29);
|
|
}
|
|
if (length) {
|
|
stream.node.timestamp = Date.now();
|
|
}
|
|
return i;
|
|
},
|
|
},
|
|
default_tty_ops:{
|
|
get_char(tty) {
|
|
return FS_stdin_getChar();
|
|
},
|
|
put_char(tty, val) {
|
|
if (val === null || val === 10) {
|
|
out(UTF8ArrayToString(tty.output, 0));
|
|
tty.output = [];
|
|
} else {
|
|
if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle.
|
|
}
|
|
},
|
|
fsync(tty) {
|
|
if (tty.output && tty.output.length > 0) {
|
|
out(UTF8ArrayToString(tty.output, 0));
|
|
tty.output = [];
|
|
}
|
|
},
|
|
ioctl_tcgets(tty) {
|
|
// typical setting
|
|
return {
|
|
c_iflag: 25856,
|
|
c_oflag: 5,
|
|
c_cflag: 191,
|
|
c_lflag: 35387,
|
|
c_cc: [
|
|
0x03, 0x1c, 0x7f, 0x15, 0x04, 0x00, 0x01, 0x00, 0x11, 0x13, 0x1a, 0x00,
|
|
0x12, 0x0f, 0x17, 0x16, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
|
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
|
]
|
|
};
|
|
},
|
|
ioctl_tcsets(tty, optional_actions, data) {
|
|
// currently just ignore
|
|
return 0;
|
|
},
|
|
ioctl_tiocgwinsz(tty) {
|
|
return [24, 80];
|
|
},
|
|
},
|
|
default_tty1_ops:{
|
|
put_char(tty, val) {
|
|
if (val === null || val === 10) {
|
|
err(UTF8ArrayToString(tty.output, 0));
|
|
tty.output = [];
|
|
} else {
|
|
if (val != 0) tty.output.push(val);
|
|
}
|
|
},
|
|
fsync(tty) {
|
|
if (tty.output && tty.output.length > 0) {
|
|
err(UTF8ArrayToString(tty.output, 0));
|
|
tty.output = [];
|
|
}
|
|
},
|
|
},
|
|
};
|
|
|
|
|
|
var zeroMemory = (address, size) => {
|
|
HEAPU8.fill(0, address, address + size);
|
|
return address;
|
|
};
|
|
|
|
var alignMemory = (size, alignment) => {
|
|
return Math.ceil(size / alignment) * alignment;
|
|
};
|
|
var mmapAlloc = (size) => {
|
|
size = alignMemory(size, 65536);
|
|
var ptr = _emscripten_builtin_memalign(65536, size);
|
|
if (!ptr) return 0;
|
|
return zeroMemory(ptr, size);
|
|
};
|
|
var MEMFS = {
|
|
ops_table:null,
|
|
mount(mount) {
|
|
return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
|
|
},
|
|
createNode(parent, name, mode, dev) {
|
|
if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
|
|
// no supported
|
|
throw new FS.ErrnoError(63);
|
|
}
|
|
MEMFS.ops_table ||= {
|
|
dir: {
|
|
node: {
|
|
getattr: MEMFS.node_ops.getattr,
|
|
setattr: MEMFS.node_ops.setattr,
|
|
lookup: MEMFS.node_ops.lookup,
|
|
mknod: MEMFS.node_ops.mknod,
|
|
rename: MEMFS.node_ops.rename,
|
|
unlink: MEMFS.node_ops.unlink,
|
|
rmdir: MEMFS.node_ops.rmdir,
|
|
readdir: MEMFS.node_ops.readdir,
|
|
symlink: MEMFS.node_ops.symlink
|
|
},
|
|
stream: {
|
|
llseek: MEMFS.stream_ops.llseek
|
|
}
|
|
},
|
|
file: {
|
|
node: {
|
|
getattr: MEMFS.node_ops.getattr,
|
|
setattr: MEMFS.node_ops.setattr
|
|
},
|
|
stream: {
|
|
llseek: MEMFS.stream_ops.llseek,
|
|
read: MEMFS.stream_ops.read,
|
|
write: MEMFS.stream_ops.write,
|
|
allocate: MEMFS.stream_ops.allocate,
|
|
mmap: MEMFS.stream_ops.mmap,
|
|
msync: MEMFS.stream_ops.msync
|
|
}
|
|
},
|
|
link: {
|
|
node: {
|
|
getattr: MEMFS.node_ops.getattr,
|
|
setattr: MEMFS.node_ops.setattr,
|
|
readlink: MEMFS.node_ops.readlink
|
|
},
|
|
stream: {}
|
|
},
|
|
chrdev: {
|
|
node: {
|
|
getattr: MEMFS.node_ops.getattr,
|
|
setattr: MEMFS.node_ops.setattr
|
|
},
|
|
stream: FS.chrdev_stream_ops
|
|
}
|
|
};
|
|
var node = FS.createNode(parent, name, mode, dev);
|
|
if (FS.isDir(node.mode)) {
|
|
node.node_ops = MEMFS.ops_table.dir.node;
|
|
node.stream_ops = MEMFS.ops_table.dir.stream;
|
|
node.contents = {};
|
|
} else if (FS.isFile(node.mode)) {
|
|
node.node_ops = MEMFS.ops_table.file.node;
|
|
node.stream_ops = MEMFS.ops_table.file.stream;
|
|
node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity.
|
|
// When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred
|
|
// for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size
|
|
// penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme.
|
|
node.contents = null;
|
|
} else if (FS.isLink(node.mode)) {
|
|
node.node_ops = MEMFS.ops_table.link.node;
|
|
node.stream_ops = MEMFS.ops_table.link.stream;
|
|
} else if (FS.isChrdev(node.mode)) {
|
|
node.node_ops = MEMFS.ops_table.chrdev.node;
|
|
node.stream_ops = MEMFS.ops_table.chrdev.stream;
|
|
}
|
|
node.timestamp = Date.now();
|
|
// add the new node to the parent
|
|
if (parent) {
|
|
parent.contents[name] = node;
|
|
parent.timestamp = node.timestamp;
|
|
}
|
|
return node;
|
|
},
|
|
getFileDataAsTypedArray(node) {
|
|
if (!node.contents) return new Uint8Array(0);
|
|
if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes.
|
|
return new Uint8Array(node.contents);
|
|
},
|
|
expandFileStorage(node, newCapacity) {
|
|
var prevCapacity = node.contents ? node.contents.length : 0;
|
|
if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough.
|
|
// Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity.
|
|
// For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to
|
|
// avoid overshooting the allocation cap by a very large margin.
|
|
var CAPACITY_DOUBLING_MAX = 1024 * 1024;
|
|
newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) >>> 0);
|
|
if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding.
|
|
var oldContents = node.contents;
|
|
node.contents = new Uint8Array(newCapacity); // Allocate new storage.
|
|
if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage.
|
|
},
|
|
resizeFileStorage(node, newSize) {
|
|
if (node.usedBytes == newSize) return;
|
|
if (newSize == 0) {
|
|
node.contents = null; // Fully decommit when requesting a resize to zero.
|
|
node.usedBytes = 0;
|
|
} else {
|
|
var oldContents = node.contents;
|
|
node.contents = new Uint8Array(newSize); // Allocate new storage.
|
|
if (oldContents) {
|
|
node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage.
|
|
}
|
|
node.usedBytes = newSize;
|
|
}
|
|
},
|
|
node_ops:{
|
|
getattr(node) {
|
|
var attr = {};
|
|
// device numbers reuse inode numbers.
|
|
attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
|
|
attr.ino = node.id;
|
|
attr.mode = node.mode;
|
|
attr.nlink = 1;
|
|
attr.uid = 0;
|
|
attr.gid = 0;
|
|
attr.rdev = node.rdev;
|
|
if (FS.isDir(node.mode)) {
|
|
attr.size = 4096;
|
|
} else if (FS.isFile(node.mode)) {
|
|
attr.size = node.usedBytes;
|
|
} else if (FS.isLink(node.mode)) {
|
|
attr.size = node.link.length;
|
|
} else {
|
|
attr.size = 0;
|
|
}
|
|
attr.atime = new Date(node.timestamp);
|
|
attr.mtime = new Date(node.timestamp);
|
|
attr.ctime = new Date(node.timestamp);
|
|
// NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize),
|
|
// but this is not required by the standard.
|
|
attr.blksize = 4096;
|
|
attr.blocks = Math.ceil(attr.size / attr.blksize);
|
|
return attr;
|
|
},
|
|
setattr(node, attr) {
|
|
if (attr.mode !== undefined) {
|
|
node.mode = attr.mode;
|
|
}
|
|
if (attr.timestamp !== undefined) {
|
|
node.timestamp = attr.timestamp;
|
|
}
|
|
if (attr.size !== undefined) {
|
|
MEMFS.resizeFileStorage(node, attr.size);
|
|
}
|
|
},
|
|
lookup(parent, name) {
|
|
throw FS.genericErrors[44];
|
|
},
|
|
mknod(parent, name, mode, dev) {
|
|
return MEMFS.createNode(parent, name, mode, dev);
|
|
},
|
|
rename(old_node, new_dir, new_name) {
|
|
// if we're overwriting a directory at new_name, make sure it's empty.
|
|
if (FS.isDir(old_node.mode)) {
|
|
var new_node;
|
|
try {
|
|
new_node = FS.lookupNode(new_dir, new_name);
|
|
} catch (e) {
|
|
}
|
|
if (new_node) {
|
|
for (var i in new_node.contents) {
|
|
throw new FS.ErrnoError(55);
|
|
}
|
|
}
|
|
}
|
|
// do the internal rewiring
|
|
delete old_node.parent.contents[old_node.name];
|
|
old_node.parent.timestamp = Date.now()
|
|
old_node.name = new_name;
|
|
new_dir.contents[new_name] = old_node;
|
|
new_dir.timestamp = old_node.parent.timestamp;
|
|
old_node.parent = new_dir;
|
|
},
|
|
unlink(parent, name) {
|
|
delete parent.contents[name];
|
|
parent.timestamp = Date.now();
|
|
},
|
|
rmdir(parent, name) {
|
|
var node = FS.lookupNode(parent, name);
|
|
for (var i in node.contents) {
|
|
throw new FS.ErrnoError(55);
|
|
}
|
|
delete parent.contents[name];
|
|
parent.timestamp = Date.now();
|
|
},
|
|
readdir(node) {
|
|
var entries = ['.', '..'];
|
|
for (var key of Object.keys(node.contents)) {
|
|
entries.push(key);
|
|
}
|
|
return entries;
|
|
},
|
|
symlink(parent, newname, oldpath) {
|
|
var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0);
|
|
node.link = oldpath;
|
|
return node;
|
|
},
|
|
readlink(node) {
|
|
if (!FS.isLink(node.mode)) {
|
|
throw new FS.ErrnoError(28);
|
|
}
|
|
return node.link;
|
|
},
|
|
},
|
|
stream_ops:{
|
|
read(stream, buffer, offset, length, position) {
|
|
var contents = stream.node.contents;
|
|
if (position >= stream.node.usedBytes) return 0;
|
|
var size = Math.min(stream.node.usedBytes - position, length);
|
|
if (size > 8 && contents.subarray) { // non-trivial, and typed array
|
|
buffer.set(contents.subarray(position, position + size), offset);
|
|
} else {
|
|
for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i];
|
|
}
|
|
return size;
|
|
},
|
|
write(stream, buffer, offset, length, position, canOwn) {
|
|
// If the buffer is located in main memory (HEAP), and if
|
|
// memory can grow, we can't hold on to references of the
|
|
// memory buffer, as they may get invalidated. That means we
|
|
// need to do copy its contents.
|
|
if (buffer.buffer === HEAP8.buffer) {
|
|
canOwn = false;
|
|
}
|
|
|
|
if (!length) return 0;
|
|
var node = stream.node;
|
|
node.timestamp = Date.now();
|
|
|
|
if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array?
|
|
if (canOwn) {
|
|
node.contents = buffer.subarray(offset, offset + length);
|
|
node.usedBytes = length;
|
|
return length;
|
|
} else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data.
|
|
node.contents = buffer.slice(offset, offset + length);
|
|
node.usedBytes = length;
|
|
return length;
|
|
} else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file?
|
|
node.contents.set(buffer.subarray(offset, offset + length), position);
|
|
return length;
|
|
}
|
|
}
|
|
|
|
// Appending to an existing file and we need to reallocate, or source data did not come as a typed array.
|
|
MEMFS.expandFileStorage(node, position+length);
|
|
if (node.contents.subarray && buffer.subarray) {
|
|
// Use typed array write which is available.
|
|
node.contents.set(buffer.subarray(offset, offset + length), position);
|
|
} else {
|
|
for (var i = 0; i < length; i++) {
|
|
node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not.
|
|
}
|
|
}
|
|
node.usedBytes = Math.max(node.usedBytes, position + length);
|
|
return length;
|
|
},
|
|
llseek(stream, offset, whence) {
|
|
var position = offset;
|
|
if (whence === 1) {
|
|
position += stream.position;
|
|
} else if (whence === 2) {
|
|
if (FS.isFile(stream.node.mode)) {
|
|
position += stream.node.usedBytes;
|
|
}
|
|
}
|
|
if (position < 0) {
|
|
throw new FS.ErrnoError(28);
|
|
}
|
|
return position;
|
|
},
|
|
allocate(stream, offset, length) {
|
|
MEMFS.expandFileStorage(stream.node, offset + length);
|
|
stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length);
|
|
},
|
|
mmap(stream, length, position, prot, flags) {
|
|
if (!FS.isFile(stream.node.mode)) {
|
|
throw new FS.ErrnoError(43);
|
|
}
|
|
var ptr;
|
|
var allocated;
|
|
var contents = stream.node.contents;
|
|
// Only make a new copy when MAP_PRIVATE is specified.
|
|
if (!(flags & 2) && contents.buffer === HEAP8.buffer) {
|
|
// We can't emulate MAP_SHARED when the file is not backed by the
|
|
// buffer we're mapping to (e.g. the HEAP buffer).
|
|
allocated = false;
|
|
ptr = contents.byteOffset;
|
|
} else {
|
|
// Try to avoid unnecessary slices.
|
|
if (position > 0 || position + length < contents.length) {
|
|
if (contents.subarray) {
|
|
contents = contents.subarray(position, position + length);
|
|
} else {
|
|
contents = Array.prototype.slice.call(contents, position, position + length);
|
|
}
|
|
}
|
|
allocated = true;
|
|
ptr = mmapAlloc(length);
|
|
if (!ptr) {
|
|
throw new FS.ErrnoError(48);
|
|
}
|
|
HEAP8.set(contents, ptr);
|
|
}
|
|
return { ptr, allocated };
|
|
},
|
|
msync(stream, buffer, offset, length, mmapFlags) {
|
|
MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
|
|
// should we check if bytesWritten and length are the same?
|
|
return 0;
|
|
},
|
|
},
|
|
};
|
|
|
|
/** @param {boolean=} noRunDep */
|
|
var asyncLoad = (url, onload, onerror, noRunDep) => {
|
|
var dep = !noRunDep ? getUniqueRunDependency(`al ${url}`) : '';
|
|
readAsync(url, (arrayBuffer) => {
|
|
onload(new Uint8Array(arrayBuffer));
|
|
if (dep) removeRunDependency(dep);
|
|
}, (event) => {
|
|
if (onerror) {
|
|
onerror();
|
|
} else {
|
|
throw `Loading data file "${url}" failed.`;
|
|
}
|
|
});
|
|
if (dep) addRunDependency(dep);
|
|
};
|
|
|
|
|
|
var FS_createDataFile = (parent, name, fileData, canRead, canWrite, canOwn) => {
|
|
FS.createDataFile(parent, name, fileData, canRead, canWrite, canOwn);
|
|
};
|
|
|
|
var preloadPlugins = Module['preloadPlugins'] || [];
|
|
var FS_handledByPreloadPlugin = (byteArray, fullname, finish, onerror) => {
|
|
// Ensure plugins are ready.
|
|
if (typeof Browser != 'undefined') Browser.init();
|
|
|
|
var handled = false;
|
|
preloadPlugins.forEach((plugin) => {
|
|
if (handled) return;
|
|
if (plugin['canHandle'](fullname)) {
|
|
plugin['handle'](byteArray, fullname, finish, onerror);
|
|
handled = true;
|
|
}
|
|
});
|
|
return handled;
|
|
};
|
|
var FS_createPreloadedFile = (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) => {
|
|
// TODO we should allow people to just pass in a complete filename instead
|
|
// of parent and name being that we just join them anyways
|
|
var fullname = name ? PATH_FS.resolve(PATH.join2(parent, name)) : parent;
|
|
var dep = getUniqueRunDependency(`cp ${fullname}`); // might have several active requests for the same fullname
|
|
function processData(byteArray) {
|
|
function finish(byteArray) {
|
|
preFinish?.();
|
|
if (!dontCreateFile) {
|
|
FS_createDataFile(parent, name, byteArray, canRead, canWrite, canOwn);
|
|
}
|
|
onload?.();
|
|
removeRunDependency(dep);
|
|
}
|
|
if (FS_handledByPreloadPlugin(byteArray, fullname, finish, () => {
|
|
onerror?.();
|
|
removeRunDependency(dep);
|
|
})) {
|
|
return;
|
|
}
|
|
finish(byteArray);
|
|
}
|
|
addRunDependency(dep);
|
|
if (typeof url == 'string') {
|
|
asyncLoad(url, processData, onerror);
|
|
} else {
|
|
processData(url);
|
|
}
|
|
};
|
|
|
|
var FS_modeStringToFlags = (str) => {
|
|
var flagModes = {
|
|
'r': 0,
|
|
'r+': 2,
|
|
'w': 512 | 64 | 1,
|
|
'w+': 512 | 64 | 2,
|
|
'a': 1024 | 64 | 1,
|
|
'a+': 1024 | 64 | 2,
|
|
};
|
|
var flags = flagModes[str];
|
|
if (typeof flags == 'undefined') {
|
|
throw new Error(`Unknown file open mode: ${str}`);
|
|
}
|
|
return flags;
|
|
};
|
|
|
|
var FS_getMode = (canRead, canWrite) => {
|
|
var mode = 0;
|
|
if (canRead) mode |= 292 | 73;
|
|
if (canWrite) mode |= 146;
|
|
return mode;
|
|
};
|
|
|
|
|
|
|
|
var FS = {
|
|
root:null,
|
|
mounts:[],
|
|
devices:{
|
|
},
|
|
streams:[],
|
|
nextInode:1,
|
|
nameTable:null,
|
|
currentPath:"/",
|
|
initialized:false,
|
|
ignorePermissions:true,
|
|
ErrnoError:class {
|
|
// We set the `name` property to be able to identify `FS.ErrnoError`
|
|
// - the `name` is a standard ECMA-262 property of error objects. Kind of good to have it anyway.
|
|
// - when using PROXYFS, an error can come from an underlying FS
|
|
// as different FS objects have their own FS.ErrnoError each,
|
|
// the test `err instanceof FS.ErrnoError` won't detect an error coming from another filesystem, causing bugs.
|
|
// we'll use the reliable test `err.name == "ErrnoError"` instead
|
|
constructor(errno) {
|
|
// TODO(sbc): Use the inline member declaration syntax once we
|
|
// support it in acorn and closure.
|
|
this.name = 'ErrnoError';
|
|
this.errno = errno;
|
|
}
|
|
},
|
|
genericErrors:{
|
|
},
|
|
filesystems:null,
|
|
syncFSRequests:0,
|
|
FSStream:class {
|
|
constructor() {
|
|
// TODO(https://github.com/emscripten-core/emscripten/issues/21414):
|
|
// Use inline field declarations.
|
|
this.shared = {};
|
|
}
|
|
get object() {
|
|
return this.node;
|
|
}
|
|
set object(val) {
|
|
this.node = val;
|
|
}
|
|
get isRead() {
|
|
return (this.flags & 2097155) !== 1;
|
|
}
|
|
get isWrite() {
|
|
return (this.flags & 2097155) !== 0;
|
|
}
|
|
get isAppend() {
|
|
return (this.flags & 1024);
|
|
}
|
|
get flags() {
|
|
return this.shared.flags;
|
|
}
|
|
set flags(val) {
|
|
this.shared.flags = val;
|
|
}
|
|
get position() {
|
|
return this.shared.position;
|
|
}
|
|
set position(val) {
|
|
this.shared.position = val;
|
|
}
|
|
},
|
|
FSNode:class {
|
|
constructor(parent, name, mode, rdev) {
|
|
if (!parent) {
|
|
parent = this; // root node sets parent to itself
|
|
}
|
|
this.parent = parent;
|
|
this.mount = parent.mount;
|
|
this.mounted = null;
|
|
this.id = FS.nextInode++;
|
|
this.name = name;
|
|
this.mode = mode;
|
|
this.node_ops = {};
|
|
this.stream_ops = {};
|
|
this.rdev = rdev;
|
|
this.readMode = 292/*292*/ | 73/*73*/;
|
|
this.writeMode = 146/*146*/;
|
|
}
|
|
get read() {
|
|
return (this.mode & this.readMode) === this.readMode;
|
|
}
|
|
set read(val) {
|
|
val ? this.mode |= this.readMode : this.mode &= ~this.readMode;
|
|
}
|
|
get write() {
|
|
return (this.mode & this.writeMode) === this.writeMode;
|
|
}
|
|
set write(val) {
|
|
val ? this.mode |= this.writeMode : this.mode &= ~this.writeMode;
|
|
}
|
|
get isFolder() {
|
|
return FS.isDir(this.mode);
|
|
}
|
|
get isDevice() {
|
|
return FS.isChrdev(this.mode);
|
|
}
|
|
},
|
|
lookupPath(path, opts = {}) {
|
|
path = PATH_FS.resolve(path);
|
|
|
|
if (!path) return { path: '', node: null };
|
|
|
|
var defaults = {
|
|
follow_mount: true,
|
|
recurse_count: 0
|
|
};
|
|
opts = Object.assign(defaults, opts)
|
|
|
|
if (opts.recurse_count > 8) { // max recursive lookup of 8
|
|
throw new FS.ErrnoError(32);
|
|
}
|
|
|
|
// split the absolute path
|
|
var parts = path.split('/').filter((p) => !!p);
|
|
|
|
// start at the root
|
|
var current = FS.root;
|
|
var current_path = '/';
|
|
|
|
for (var i = 0; i < parts.length; i++) {
|
|
var islast = (i === parts.length-1);
|
|
if (islast && opts.parent) {
|
|
// stop resolving
|
|
break;
|
|
}
|
|
|
|
current = FS.lookupNode(current, parts[i]);
|
|
current_path = PATH.join2(current_path, parts[i]);
|
|
|
|
// jump to the mount's root node if this is a mountpoint
|
|
if (FS.isMountpoint(current)) {
|
|
if (!islast || (islast && opts.follow_mount)) {
|
|
current = current.mounted.root;
|
|
}
|
|
}
|
|
|
|
// by default, lookupPath will not follow a symlink if it is the final path component.
|
|
// setting opts.follow = true will override this behavior.
|
|
if (!islast || opts.follow) {
|
|
var count = 0;
|
|
while (FS.isLink(current.mode)) {
|
|
var link = FS.readlink(current_path);
|
|
current_path = PATH_FS.resolve(PATH.dirname(current_path), link);
|
|
|
|
var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count + 1 });
|
|
current = lookup.node;
|
|
|
|
if (count++ > 40) { // limit max consecutive symlinks to 40 (SYMLOOP_MAX).
|
|
throw new FS.ErrnoError(32);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
return { path: current_path, node: current };
|
|
},
|
|
getPath(node) {
|
|
var path;
|
|
while (true) {
|
|
if (FS.isRoot(node)) {
|
|
var mount = node.mount.mountpoint;
|
|
if (!path) return mount;
|
|
return mount[mount.length-1] !== '/' ? `${mount}/${path}` : mount + path;
|
|
}
|
|
path = path ? `${node.name}/${path}` : node.name;
|
|
node = node.parent;
|
|
}
|
|
},
|
|
hashName(parentid, name) {
|
|
var hash = 0;
|
|
|
|
for (var i = 0; i < name.length; i++) {
|
|
hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0;
|
|
}
|
|
return ((parentid + hash) >>> 0) % FS.nameTable.length;
|
|
},
|
|
hashAddNode(node) {
|
|
var hash = FS.hashName(node.parent.id, node.name);
|
|
node.name_next = FS.nameTable[hash];
|
|
FS.nameTable[hash] = node;
|
|
},
|
|
hashRemoveNode(node) {
|
|
var hash = FS.hashName(node.parent.id, node.name);
|
|
if (FS.nameTable[hash] === node) {
|
|
FS.nameTable[hash] = node.name_next;
|
|
} else {
|
|
var current = FS.nameTable[hash];
|
|
while (current) {
|
|
if (current.name_next === node) {
|
|
current.name_next = node.name_next;
|
|
break;
|
|
}
|
|
current = current.name_next;
|
|
}
|
|
}
|
|
},
|
|
lookupNode(parent, name) {
|
|
var errCode = FS.mayLookup(parent);
|
|
if (errCode) {
|
|
throw new FS.ErrnoError(errCode);
|
|
}
|
|
var hash = FS.hashName(parent.id, name);
|
|
for (var node = FS.nameTable[hash]; node; node = node.name_next) {
|
|
var nodeName = node.name;
|
|
if (node.parent.id === parent.id && nodeName === name) {
|
|
return node;
|
|
}
|
|
}
|
|
// if we failed to find it in the cache, call into the VFS
|
|
return FS.lookup(parent, name);
|
|
},
|
|
createNode(parent, name, mode, rdev) {
|
|
var node = new FS.FSNode(parent, name, mode, rdev);
|
|
|
|
FS.hashAddNode(node);
|
|
|
|
return node;
|
|
},
|
|
destroyNode(node) {
|
|
FS.hashRemoveNode(node);
|
|
},
|
|
isRoot(node) {
|
|
return node === node.parent;
|
|
},
|
|
isMountpoint(node) {
|
|
return !!node.mounted;
|
|
},
|
|
isFile(mode) {
|
|
return (mode & 61440) === 32768;
|
|
},
|
|
isDir(mode) {
|
|
return (mode & 61440) === 16384;
|
|
},
|
|
isLink(mode) {
|
|
return (mode & 61440) === 40960;
|
|
},
|
|
isChrdev(mode) {
|
|
return (mode & 61440) === 8192;
|
|
},
|
|
isBlkdev(mode) {
|
|
return (mode & 61440) === 24576;
|
|
},
|
|
isFIFO(mode) {
|
|
return (mode & 61440) === 4096;
|
|
},
|
|
isSocket(mode) {
|
|
return (mode & 49152) === 49152;
|
|
},
|
|
flagsToPermissionString(flag) {
|
|
var perms = ['r', 'w', 'rw'][flag & 3];
|
|
if ((flag & 512)) {
|
|
perms += 'w';
|
|
}
|
|
return perms;
|
|
},
|
|
nodePermissions(node, perms) {
|
|
if (FS.ignorePermissions) {
|
|
return 0;
|
|
}
|
|
// return 0 if any user, group or owner bits are set.
|
|
if (perms.includes('r') && !(node.mode & 292)) {
|
|
return 2;
|
|
} else if (perms.includes('w') && !(node.mode & 146)) {
|
|
return 2;
|
|
} else if (perms.includes('x') && !(node.mode & 73)) {
|
|
return 2;
|
|
}
|
|
return 0;
|
|
},
|
|
mayLookup(dir) {
|
|
if (!FS.isDir(dir.mode)) return 54;
|
|
var errCode = FS.nodePermissions(dir, 'x');
|
|
if (errCode) return errCode;
|
|
if (!dir.node_ops.lookup) return 2;
|
|
return 0;
|
|
},
|
|
mayCreate(dir, name) {
|
|
try {
|
|
var node = FS.lookupNode(dir, name);
|
|
return 20;
|
|
} catch (e) {
|
|
}
|
|
return FS.nodePermissions(dir, 'wx');
|
|
},
|
|
mayDelete(dir, name, isdir) {
|
|
var node;
|
|
try {
|
|
node = FS.lookupNode(dir, name);
|
|
} catch (e) {
|
|
return e.errno;
|
|
}
|
|
var errCode = FS.nodePermissions(dir, 'wx');
|
|
if (errCode) {
|
|
return errCode;
|
|
}
|
|
if (isdir) {
|
|
if (!FS.isDir(node.mode)) {
|
|
return 54;
|
|
}
|
|
if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
|
|
return 10;
|
|
}
|
|
} else {
|
|
if (FS.isDir(node.mode)) {
|
|
return 31;
|
|
}
|
|
}
|
|
return 0;
|
|
},
|
|
mayOpen(node, flags) {
|
|
if (!node) {
|
|
return 44;
|
|
}
|
|
if (FS.isLink(node.mode)) {
|
|
return 32;
|
|
} else if (FS.isDir(node.mode)) {
|
|
if (FS.flagsToPermissionString(flags) !== 'r' || // opening for write
|
|
(flags & 512)) { // TODO: check for O_SEARCH? (== search for dir only)
|
|
return 31;
|
|
}
|
|
}
|
|
return FS.nodePermissions(node, FS.flagsToPermissionString(flags));
|
|
},
|
|
MAX_OPEN_FDS:4096,
|
|
nextfd() {
|
|
for (var fd = 0; fd <= FS.MAX_OPEN_FDS; fd++) {
|
|
if (!FS.streams[fd]) {
|
|
return fd;
|
|
}
|
|
}
|
|
throw new FS.ErrnoError(33);
|
|
},
|
|
getStreamChecked(fd) {
|
|
var stream = FS.getStream(fd);
|
|
if (!stream) {
|
|
throw new FS.ErrnoError(8);
|
|
}
|
|
return stream;
|
|
},
|
|
getStream:(fd) => FS.streams[fd],
|
|
createStream(stream, fd = -1) {
|
|
|
|
// clone it, so we can return an instance of FSStream
|
|
stream = Object.assign(new FS.FSStream(), stream);
|
|
if (fd == -1) {
|
|
fd = FS.nextfd();
|
|
}
|
|
stream.fd = fd;
|
|
FS.streams[fd] = stream;
|
|
return stream;
|
|
},
|
|
closeStream(fd) {
|
|
FS.streams[fd] = null;
|
|
},
|
|
dupStream(origStream, fd = -1) {
|
|
var stream = FS.createStream(origStream, fd);
|
|
stream.stream_ops?.dup?.(stream);
|
|
return stream;
|
|
},
|
|
chrdev_stream_ops:{
|
|
open(stream) {
|
|
var device = FS.getDevice(stream.node.rdev);
|
|
// override node's stream ops with the device's
|
|
stream.stream_ops = device.stream_ops;
|
|
// forward the open call
|
|
stream.stream_ops.open?.(stream);
|
|
},
|
|
llseek() {
|
|
throw new FS.ErrnoError(70);
|
|
},
|
|
},
|
|
major:(dev) => ((dev) >> 8),
|
|
minor:(dev) => ((dev) & 0xff),
|
|
makedev:(ma, mi) => ((ma) << 8 | (mi)),
|
|
registerDevice(dev, ops) {
|
|
FS.devices[dev] = { stream_ops: ops };
|
|
},
|
|
getDevice:(dev) => FS.devices[dev],
|
|
getMounts(mount) {
|
|
var mounts = [];
|
|
var check = [mount];
|
|
|
|
while (check.length) {
|
|
var m = check.pop();
|
|
|
|
mounts.push(m);
|
|
|
|
check.push(...m.mounts);
|
|
}
|
|
|
|
return mounts;
|
|
},
|
|
syncfs(populate, callback) {
|
|
if (typeof populate == 'function') {
|
|
callback = populate;
|
|
populate = false;
|
|
}
|
|
|
|
FS.syncFSRequests++;
|
|
|
|
if (FS.syncFSRequests > 1) {
|
|
err(`warning: ${FS.syncFSRequests} FS.syncfs operations in flight at once, probably just doing extra work`);
|
|
}
|
|
|
|
var mounts = FS.getMounts(FS.root.mount);
|
|
var completed = 0;
|
|
|
|
function doCallback(errCode) {
|
|
FS.syncFSRequests--;
|
|
return callback(errCode);
|
|
}
|
|
|
|
function done(errCode) {
|
|
if (errCode) {
|
|
if (!done.errored) {
|
|
done.errored = true;
|
|
return doCallback(errCode);
|
|
}
|
|
return;
|
|
}
|
|
if (++completed >= mounts.length) {
|
|
doCallback(null);
|
|
}
|
|
};
|
|
|
|
// sync all mounts
|
|
mounts.forEach((mount) => {
|
|
if (!mount.type.syncfs) {
|
|
return done(null);
|
|
}
|
|
mount.type.syncfs(mount, populate, done);
|
|
});
|
|
},
|
|
mount(type, opts, mountpoint) {
|
|
var root = mountpoint === '/';
|
|
var pseudo = !mountpoint;
|
|
var node;
|
|
|
|
if (root && FS.root) {
|
|
throw new FS.ErrnoError(10);
|
|
} else if (!root && !pseudo) {
|
|
var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
|
|
|
|
mountpoint = lookup.path; // use the absolute path
|
|
node = lookup.node;
|
|
|
|
if (FS.isMountpoint(node)) {
|
|
throw new FS.ErrnoError(10);
|
|
}
|
|
|
|
if (!FS.isDir(node.mode)) {
|
|
throw new FS.ErrnoError(54);
|
|
}
|
|
}
|
|
|
|
var mount = {
|
|
type,
|
|
opts,
|
|
mountpoint,
|
|
mounts: []
|
|
};
|
|
|
|
// create a root node for the fs
|
|
var mountRoot = type.mount(mount);
|
|
mountRoot.mount = mount;
|
|
mount.root = mountRoot;
|
|
|
|
if (root) {
|
|
FS.root = mountRoot;
|
|
} else if (node) {
|
|
// set as a mountpoint
|
|
node.mounted = mount;
|
|
|
|
// add the new mount to the current mount's children
|
|
if (node.mount) {
|
|
node.mount.mounts.push(mount);
|
|
}
|
|
}
|
|
|
|
return mountRoot;
|
|
},
|
|
unmount(mountpoint) {
|
|
var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
|
|
|
|
if (!FS.isMountpoint(lookup.node)) {
|
|
throw new FS.ErrnoError(28);
|
|
}
|
|
|
|
// destroy the nodes for this mount, and all its child mounts
|
|
var node = lookup.node;
|
|
var mount = node.mounted;
|
|
var mounts = FS.getMounts(mount);
|
|
|
|
Object.keys(FS.nameTable).forEach((hash) => {
|
|
var current = FS.nameTable[hash];
|
|
|
|
while (current) {
|
|
var next = current.name_next;
|
|
|
|
if (mounts.includes(current.mount)) {
|
|
FS.destroyNode(current);
|
|
}
|
|
|
|
current = next;
|
|
}
|
|
});
|
|
|
|
// no longer a mountpoint
|
|
node.mounted = null;
|
|
|
|
// remove this mount from the child mounts
|
|
var idx = node.mount.mounts.indexOf(mount);
|
|
node.mount.mounts.splice(idx, 1);
|
|
},
|
|
lookup(parent, name) {
|
|
return parent.node_ops.lookup(parent, name);
|
|
},
|
|
mknod(path, mode, dev) {
|
|
var lookup = FS.lookupPath(path, { parent: true });
|
|
var parent = lookup.node;
|
|
var name = PATH.basename(path);
|
|
if (!name || name === '.' || name === '..') {
|
|
throw new FS.ErrnoError(28);
|
|
}
|
|
var errCode = FS.mayCreate(parent, name);
|
|
if (errCode) {
|
|
throw new FS.ErrnoError(errCode);
|
|
}
|
|
if (!parent.node_ops.mknod) {
|
|
throw new FS.ErrnoError(63);
|
|
}
|
|
return parent.node_ops.mknod(parent, name, mode, dev);
|
|
},
|
|
create(path, mode) {
|
|
mode = mode !== undefined ? mode : 438 /* 0666 */;
|
|
mode &= 4095;
|
|
mode |= 32768;
|
|
return FS.mknod(path, mode, 0);
|
|
},
|
|
mkdir(path, mode) {
|
|
mode = mode !== undefined ? mode : 511 /* 0777 */;
|
|
mode &= 511 | 512;
|
|
mode |= 16384;
|
|
return FS.mknod(path, mode, 0);
|
|
},
|
|
mkdirTree(path, mode) {
|
|
var dirs = path.split('/');
|
|
var d = '';
|
|
for (var i = 0; i < dirs.length; ++i) {
|
|
if (!dirs[i]) continue;
|
|
d += '/' + dirs[i];
|
|
try {
|
|
FS.mkdir(d, mode);
|
|
} catch(e) {
|
|
if (e.errno != 20) throw e;
|
|
}
|
|
}
|
|
},
|
|
mkdev(path, mode, dev) {
|
|
if (typeof dev == 'undefined') {
|
|
dev = mode;
|
|
mode = 438 /* 0666 */;
|
|
}
|
|
mode |= 8192;
|
|
return FS.mknod(path, mode, dev);
|
|
},
|
|
symlink(oldpath, newpath) {
|
|
if (!PATH_FS.resolve(oldpath)) {
|
|
throw new FS.ErrnoError(44);
|
|
}
|
|
var lookup = FS.lookupPath(newpath, { parent: true });
|
|
var parent = lookup.node;
|
|
if (!parent) {
|
|
throw new FS.ErrnoError(44);
|
|
}
|
|
var newname = PATH.basename(newpath);
|
|
var errCode = FS.mayCreate(parent, newname);
|
|
if (errCode) {
|
|
throw new FS.ErrnoError(errCode);
|
|
}
|
|
if (!parent.node_ops.symlink) {
|
|
throw new FS.ErrnoError(63);
|
|
}
|
|
return parent.node_ops.symlink(parent, newname, oldpath);
|
|
},
|
|
rename(old_path, new_path) {
|
|
var old_dirname = PATH.dirname(old_path);
|
|
var new_dirname = PATH.dirname(new_path);
|
|
var old_name = PATH.basename(old_path);
|
|
var new_name = PATH.basename(new_path);
|
|
// parents must exist
|
|
var lookup, old_dir, new_dir;
|
|
|
|
// let the errors from non existent directories percolate up
|
|
lookup = FS.lookupPath(old_path, { parent: true });
|
|
old_dir = lookup.node;
|
|
lookup = FS.lookupPath(new_path, { parent: true });
|
|
new_dir = lookup.node;
|
|
|
|
if (!old_dir || !new_dir) throw new FS.ErrnoError(44);
|
|
// need to be part of the same mount
|
|
if (old_dir.mount !== new_dir.mount) {
|
|
throw new FS.ErrnoError(75);
|
|
}
|
|
// source must exist
|
|
var old_node = FS.lookupNode(old_dir, old_name);
|
|
// old path should not be an ancestor of the new path
|
|
var relative = PATH_FS.relative(old_path, new_dirname);
|
|
if (relative.charAt(0) !== '.') {
|
|
throw new FS.ErrnoError(28);
|
|
}
|
|
// new path should not be an ancestor of the old path
|
|
relative = PATH_FS.relative(new_path, old_dirname);
|
|
if (relative.charAt(0) !== '.') {
|
|
throw new FS.ErrnoError(55);
|
|
}
|
|
// see if the new path already exists
|
|
var new_node;
|
|
try {
|
|
new_node = FS.lookupNode(new_dir, new_name);
|
|
} catch (e) {
|
|
// not fatal
|
|
}
|
|
// early out if nothing needs to change
|
|
if (old_node === new_node) {
|
|
return;
|
|
}
|
|
// we'll need to delete the old entry
|
|
var isdir = FS.isDir(old_node.mode);
|
|
var errCode = FS.mayDelete(old_dir, old_name, isdir);
|
|
if (errCode) {
|
|
throw new FS.ErrnoError(errCode);
|
|
}
|
|
// need delete permissions if we'll be overwriting.
|
|
// need create permissions if new doesn't already exist.
|
|
errCode = new_node ?
|
|
FS.mayDelete(new_dir, new_name, isdir) :
|
|
FS.mayCreate(new_dir, new_name);
|
|
if (errCode) {
|
|
throw new FS.ErrnoError(errCode);
|
|
}
|
|
if (!old_dir.node_ops.rename) {
|
|
throw new FS.ErrnoError(63);
|
|
}
|
|
if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) {
|
|
throw new FS.ErrnoError(10);
|
|
}
|
|
// if we are going to change the parent, check write permissions
|
|
if (new_dir !== old_dir) {
|
|
errCode = FS.nodePermissions(old_dir, 'w');
|
|
if (errCode) {
|
|
throw new FS.ErrnoError(errCode);
|
|
}
|
|
}
|
|
// remove the node from the lookup hash
|
|
FS.hashRemoveNode(old_node);
|
|
// do the underlying fs rename
|
|
try {
|
|
old_dir.node_ops.rename(old_node, new_dir, new_name);
|
|
} catch (e) {
|
|
throw e;
|
|
} finally {
|
|
// add the node back to the hash (in case node_ops.rename
|
|
// changed its name)
|
|
FS.hashAddNode(old_node);
|
|
}
|
|
},
|
|
rmdir(path) {
|
|
var lookup = FS.lookupPath(path, { parent: true });
|
|
var parent = lookup.node;
|
|
var name = PATH.basename(path);
|
|
var node = FS.lookupNode(parent, name);
|
|
var errCode = FS.mayDelete(parent, name, true);
|
|
if (errCode) {
|
|
throw new FS.ErrnoError(errCode);
|
|
}
|
|
if (!parent.node_ops.rmdir) {
|
|
throw new FS.ErrnoError(63);
|
|
}
|
|
if (FS.isMountpoint(node)) {
|
|
throw new FS.ErrnoError(10);
|
|
}
|
|
parent.node_ops.rmdir(parent, name);
|
|
FS.destroyNode(node);
|
|
},
|
|
readdir(path) {
|
|
var lookup = FS.lookupPath(path, { follow: true });
|
|
var node = lookup.node;
|
|
if (!node.node_ops.readdir) {
|
|
throw new FS.ErrnoError(54);
|
|
}
|
|
return node.node_ops.readdir(node);
|
|
},
|
|
unlink(path) {
|
|
var lookup = FS.lookupPath(path, { parent: true });
|
|
var parent = lookup.node;
|
|
if (!parent) {
|
|
throw new FS.ErrnoError(44);
|
|
}
|
|
var name = PATH.basename(path);
|
|
var node = FS.lookupNode(parent, name);
|
|
var errCode = FS.mayDelete(parent, name, false);
|
|
if (errCode) {
|
|
// According to POSIX, we should map EISDIR to EPERM, but
|
|
// we instead do what Linux does (and we must, as we use
|
|
// the musl linux libc).
|
|
throw new FS.ErrnoError(errCode);
|
|
}
|
|
if (!parent.node_ops.unlink) {
|
|
throw new FS.ErrnoError(63);
|
|
}
|
|
if (FS.isMountpoint(node)) {
|
|
throw new FS.ErrnoError(10);
|
|
}
|
|
parent.node_ops.unlink(parent, name);
|
|
FS.destroyNode(node);
|
|
},
|
|
readlink(path) {
|
|
var lookup = FS.lookupPath(path);
|
|
var link = lookup.node;
|
|
if (!link) {
|
|
throw new FS.ErrnoError(44);
|
|
}
|
|
if (!link.node_ops.readlink) {
|
|
throw new FS.ErrnoError(28);
|
|
}
|
|
return PATH_FS.resolve(FS.getPath(link.parent), link.node_ops.readlink(link));
|
|
},
|
|
stat(path, dontFollow) {
|
|
var lookup = FS.lookupPath(path, { follow: !dontFollow });
|
|
var node = lookup.node;
|
|
if (!node) {
|
|
throw new FS.ErrnoError(44);
|
|
}
|
|
if (!node.node_ops.getattr) {
|
|
throw new FS.ErrnoError(63);
|
|
}
|
|
return node.node_ops.getattr(node);
|
|
},
|
|
lstat(path) {
|
|
return FS.stat(path, true);
|
|
},
|
|
chmod(path, mode, dontFollow) {
|
|
var node;
|
|
if (typeof path == 'string') {
|
|
var lookup = FS.lookupPath(path, { follow: !dontFollow });
|
|
node = lookup.node;
|
|
} else {
|
|
node = path;
|
|
}
|
|
if (!node.node_ops.setattr) {
|
|
throw new FS.ErrnoError(63);
|
|
}
|
|
node.node_ops.setattr(node, {
|
|
mode: (mode & 4095) | (node.mode & ~4095),
|
|
timestamp: Date.now()
|
|
});
|
|
},
|
|
lchmod(path, mode) {
|
|
FS.chmod(path, mode, true);
|
|
},
|
|
fchmod(fd, mode) {
|
|
var stream = FS.getStreamChecked(fd);
|
|
FS.chmod(stream.node, mode);
|
|
},
|
|
chown(path, uid, gid, dontFollow) {
|
|
var node;
|
|
if (typeof path == 'string') {
|
|
var lookup = FS.lookupPath(path, { follow: !dontFollow });
|
|
node = lookup.node;
|
|
} else {
|
|
node = path;
|
|
}
|
|
if (!node.node_ops.setattr) {
|
|
throw new FS.ErrnoError(63);
|
|
}
|
|
node.node_ops.setattr(node, {
|
|
timestamp: Date.now()
|
|
// we ignore the uid / gid for now
|
|
});
|
|
},
|
|
lchown(path, uid, gid) {
|
|
FS.chown(path, uid, gid, true);
|
|
},
|
|
fchown(fd, uid, gid) {
|
|
var stream = FS.getStreamChecked(fd);
|
|
FS.chown(stream.node, uid, gid);
|
|
},
|
|
truncate(path, len) {
|
|
if (len < 0) {
|
|
throw new FS.ErrnoError(28);
|
|
}
|
|
var node;
|
|
if (typeof path == 'string') {
|
|
var lookup = FS.lookupPath(path, { follow: true });
|
|
node = lookup.node;
|
|
} else {
|
|
node = path;
|
|
}
|
|
if (!node.node_ops.setattr) {
|
|
throw new FS.ErrnoError(63);
|
|
}
|
|
if (FS.isDir(node.mode)) {
|
|
throw new FS.ErrnoError(31);
|
|
}
|
|
if (!FS.isFile(node.mode)) {
|
|
throw new FS.ErrnoError(28);
|
|
}
|
|
var errCode = FS.nodePermissions(node, 'w');
|
|
if (errCode) {
|
|
throw new FS.ErrnoError(errCode);
|
|
}
|
|
node.node_ops.setattr(node, {
|
|
size: len,
|
|
timestamp: Date.now()
|
|
});
|
|
},
|
|
ftruncate(fd, len) {
|
|
var stream = FS.getStreamChecked(fd);
|
|
if ((stream.flags & 2097155) === 0) {
|
|
throw new FS.ErrnoError(28);
|
|
}
|
|
FS.truncate(stream.node, len);
|
|
},
|
|
utime(path, atime, mtime) {
|
|
var lookup = FS.lookupPath(path, { follow: true });
|
|
var node = lookup.node;
|
|
node.node_ops.setattr(node, {
|
|
timestamp: Math.max(atime, mtime)
|
|
});
|
|
},
|
|
open(path, flags, mode) {
|
|
if (path === "") {
|
|
throw new FS.ErrnoError(44);
|
|
}
|
|
flags = typeof flags == 'string' ? FS_modeStringToFlags(flags) : flags;
|
|
mode = typeof mode == 'undefined' ? 438 /* 0666 */ : mode;
|
|
if ((flags & 64)) {
|
|
mode = (mode & 4095) | 32768;
|
|
} else {
|
|
mode = 0;
|
|
}
|
|
var node;
|
|
if (typeof path == 'object') {
|
|
node = path;
|
|
} else {
|
|
path = PATH.normalize(path);
|
|
try {
|
|
var lookup = FS.lookupPath(path, {
|
|
follow: !(flags & 131072)
|
|
});
|
|
node = lookup.node;
|
|
} catch (e) {
|
|
// ignore
|
|
}
|
|
}
|
|
// perhaps we need to create the node
|
|
var created = false;
|
|
if ((flags & 64)) {
|
|
if (node) {
|
|
// if O_CREAT and O_EXCL are set, error out if the node already exists
|
|
if ((flags & 128)) {
|
|
throw new FS.ErrnoError(20);
|
|
}
|
|
} else {
|
|
// node doesn't exist, try to create it
|
|
node = FS.mknod(path, mode, 0);
|
|
created = true;
|
|
}
|
|
}
|
|
if (!node) {
|
|
throw new FS.ErrnoError(44);
|
|
}
|
|
// can't truncate a device
|
|
if (FS.isChrdev(node.mode)) {
|
|
flags &= ~512;
|
|
}
|
|
// if asked only for a directory, then this must be one
|
|
if ((flags & 65536) && !FS.isDir(node.mode)) {
|
|
throw new FS.ErrnoError(54);
|
|
}
|
|
// check permissions, if this is not a file we just created now (it is ok to
|
|
// create and write to a file with read-only permissions; it is read-only
|
|
// for later use)
|
|
if (!created) {
|
|
var errCode = FS.mayOpen(node, flags);
|
|
if (errCode) {
|
|
throw new FS.ErrnoError(errCode);
|
|
}
|
|
}
|
|
// do truncation if necessary
|
|
if ((flags & 512) && !created) {
|
|
FS.truncate(node, 0);
|
|
}
|
|
// we've already handled these, don't pass down to the underlying vfs
|
|
flags &= ~(128 | 512 | 131072);
|
|
|
|
// register the stream with the filesystem
|
|
var stream = FS.createStream({
|
|
node,
|
|
path: FS.getPath(node), // we want the absolute path to the node
|
|
flags,
|
|
seekable: true,
|
|
position: 0,
|
|
stream_ops: node.stream_ops,
|
|
// used by the file family libc calls (fopen, fwrite, ferror, etc.)
|
|
ungotten: [],
|
|
error: false
|
|
});
|
|
// call the new stream's open function
|
|
if (stream.stream_ops.open) {
|
|
stream.stream_ops.open(stream);
|
|
}
|
|
if (Module['logReadFiles'] && !(flags & 1)) {
|
|
if (!FS.readFiles) FS.readFiles = {};
|
|
if (!(path in FS.readFiles)) {
|
|
FS.readFiles[path] = 1;
|
|
}
|
|
}
|
|
return stream;
|
|
},
|
|
close(stream) {
|
|
if (FS.isClosed(stream)) {
|
|
throw new FS.ErrnoError(8);
|
|
}
|
|
if (stream.getdents) stream.getdents = null; // free readdir state
|
|
try {
|
|
if (stream.stream_ops.close) {
|
|
stream.stream_ops.close(stream);
|
|
}
|
|
} catch (e) {
|
|
throw e;
|
|
} finally {
|
|
FS.closeStream(stream.fd);
|
|
}
|
|
stream.fd = null;
|
|
},
|
|
isClosed(stream) {
|
|
return stream.fd === null;
|
|
},
|
|
llseek(stream, offset, whence) {
|
|
if (FS.isClosed(stream)) {
|
|
throw new FS.ErrnoError(8);
|
|
}
|
|
if (!stream.seekable || !stream.stream_ops.llseek) {
|
|
throw new FS.ErrnoError(70);
|
|
}
|
|
if (whence != 0 && whence != 1 && whence != 2) {
|
|
throw new FS.ErrnoError(28);
|
|
}
|
|
stream.position = stream.stream_ops.llseek(stream, offset, whence);
|
|
stream.ungotten = [];
|
|
return stream.position;
|
|
},
|
|
read(stream, buffer, offset, length, position) {
|
|
if (length < 0 || position < 0) {
|
|
throw new FS.ErrnoError(28);
|
|
}
|
|
if (FS.isClosed(stream)) {
|
|
throw new FS.ErrnoError(8);
|
|
}
|
|
if ((stream.flags & 2097155) === 1) {
|
|
throw new FS.ErrnoError(8);
|
|
}
|
|
if (FS.isDir(stream.node.mode)) {
|
|
throw new FS.ErrnoError(31);
|
|
}
|
|
if (!stream.stream_ops.read) {
|
|
throw new FS.ErrnoError(28);
|
|
}
|
|
var seeking = typeof position != 'undefined';
|
|
if (!seeking) {
|
|
position = stream.position;
|
|
} else if (!stream.seekable) {
|
|
throw new FS.ErrnoError(70);
|
|
}
|
|
var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position);
|
|
if (!seeking) stream.position += bytesRead;
|
|
return bytesRead;
|
|
},
|
|
write(stream, buffer, offset, length, position, canOwn) {
|
|
if (length < 0 || position < 0) {
|
|
throw new FS.ErrnoError(28);
|
|
}
|
|
if (FS.isClosed(stream)) {
|
|
throw new FS.ErrnoError(8);
|
|
}
|
|
if ((stream.flags & 2097155) === 0) {
|
|
throw new FS.ErrnoError(8);
|
|
}
|
|
if (FS.isDir(stream.node.mode)) {
|
|
throw new FS.ErrnoError(31);
|
|
}
|
|
if (!stream.stream_ops.write) {
|
|
throw new FS.ErrnoError(28);
|
|
}
|
|
if (stream.seekable && stream.flags & 1024) {
|
|
// seek to the end before writing in append mode
|
|
FS.llseek(stream, 0, 2);
|
|
}
|
|
var seeking = typeof position != 'undefined';
|
|
if (!seeking) {
|
|
position = stream.position;
|
|
} else if (!stream.seekable) {
|
|
throw new FS.ErrnoError(70);
|
|
}
|
|
var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn);
|
|
if (!seeking) stream.position += bytesWritten;
|
|
return bytesWritten;
|
|
},
|
|
allocate(stream, offset, length) {
|
|
if (FS.isClosed(stream)) {
|
|
throw new FS.ErrnoError(8);
|
|
}
|
|
if (offset < 0 || length <= 0) {
|
|
throw new FS.ErrnoError(28);
|
|
}
|
|
if ((stream.flags & 2097155) === 0) {
|
|
throw new FS.ErrnoError(8);
|
|
}
|
|
if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) {
|
|
throw new FS.ErrnoError(43);
|
|
}
|
|
if (!stream.stream_ops.allocate) {
|
|
throw new FS.ErrnoError(138);
|
|
}
|
|
stream.stream_ops.allocate(stream, offset, length);
|
|
},
|
|
mmap(stream, length, position, prot, flags) {
|
|
// User requests writing to file (prot & PROT_WRITE != 0).
|
|
// Checking if we have permissions to write to the file unless
|
|
// MAP_PRIVATE flag is set. According to POSIX spec it is possible
|
|
// to write to file opened in read-only mode with MAP_PRIVATE flag,
|
|
// as all modifications will be visible only in the memory of
|
|
// the current process.
|
|
if ((prot & 2) !== 0
|
|
&& (flags & 2) === 0
|
|
&& (stream.flags & 2097155) !== 2) {
|
|
throw new FS.ErrnoError(2);
|
|
}
|
|
if ((stream.flags & 2097155) === 1) {
|
|
throw new FS.ErrnoError(2);
|
|
}
|
|
if (!stream.stream_ops.mmap) {
|
|
throw new FS.ErrnoError(43);
|
|
}
|
|
return stream.stream_ops.mmap(stream, length, position, prot, flags);
|
|
},
|
|
msync(stream, buffer, offset, length, mmapFlags) {
|
|
if (!stream.stream_ops.msync) {
|
|
return 0;
|
|
}
|
|
return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags);
|
|
},
|
|
ioctl(stream, cmd, arg) {
|
|
if (!stream.stream_ops.ioctl) {
|
|
throw new FS.ErrnoError(59);
|
|
}
|
|
return stream.stream_ops.ioctl(stream, cmd, arg);
|
|
},
|
|
readFile(path, opts = {}) {
|
|
opts.flags = opts.flags || 0;
|
|
opts.encoding = opts.encoding || 'binary';
|
|
if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
|
|
throw new Error(`Invalid encoding type "${opts.encoding}"`);
|
|
}
|
|
var ret;
|
|
var stream = FS.open(path, opts.flags);
|
|
var stat = FS.stat(path);
|
|
var length = stat.size;
|
|
var buf = new Uint8Array(length);
|
|
FS.read(stream, buf, 0, length, 0);
|
|
if (opts.encoding === 'utf8') {
|
|
ret = UTF8ArrayToString(buf, 0);
|
|
} else if (opts.encoding === 'binary') {
|
|
ret = buf;
|
|
}
|
|
FS.close(stream);
|
|
return ret;
|
|
},
|
|
writeFile(path, data, opts = {}) {
|
|
opts.flags = opts.flags || 577;
|
|
var stream = FS.open(path, opts.flags, opts.mode);
|
|
if (typeof data == 'string') {
|
|
var buf = new Uint8Array(lengthBytesUTF8(data)+1);
|
|
var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
|
|
FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn);
|
|
} else if (ArrayBuffer.isView(data)) {
|
|
FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn);
|
|
} else {
|
|
throw new Error('Unsupported data type');
|
|
}
|
|
FS.close(stream);
|
|
},
|
|
cwd:() => FS.currentPath,
|
|
chdir(path) {
|
|
var lookup = FS.lookupPath(path, { follow: true });
|
|
if (lookup.node === null) {
|
|
throw new FS.ErrnoError(44);
|
|
}
|
|
if (!FS.isDir(lookup.node.mode)) {
|
|
throw new FS.ErrnoError(54);
|
|
}
|
|
var errCode = FS.nodePermissions(lookup.node, 'x');
|
|
if (errCode) {
|
|
throw new FS.ErrnoError(errCode);
|
|
}
|
|
FS.currentPath = lookup.path;
|
|
},
|
|
createDefaultDirectories() {
|
|
FS.mkdir('/tmp');
|
|
FS.mkdir('/home');
|
|
FS.mkdir('/home/web_user');
|
|
},
|
|
createDefaultDevices() {
|
|
// create /dev
|
|
FS.mkdir('/dev');
|
|
// setup /dev/null
|
|
FS.registerDevice(FS.makedev(1, 3), {
|
|
read: () => 0,
|
|
write: (stream, buffer, offset, length, pos) => length,
|
|
});
|
|
FS.mkdev('/dev/null', FS.makedev(1, 3));
|
|
// setup /dev/tty and /dev/tty1
|
|
// stderr needs to print output using err() rather than out()
|
|
// so we register a second tty just for it.
|
|
TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
|
|
TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
|
|
FS.mkdev('/dev/tty', FS.makedev(5, 0));
|
|
FS.mkdev('/dev/tty1', FS.makedev(6, 0));
|
|
// setup /dev/[u]random
|
|
// use a buffer to avoid overhead of individual crypto calls per byte
|
|
var randomBuffer = new Uint8Array(1024), randomLeft = 0;
|
|
var randomByte = () => {
|
|
if (randomLeft === 0) {
|
|
randomLeft = randomFill(randomBuffer).byteLength;
|
|
}
|
|
return randomBuffer[--randomLeft];
|
|
};
|
|
FS.createDevice('/dev', 'random', randomByte);
|
|
FS.createDevice('/dev', 'urandom', randomByte);
|
|
// we're not going to emulate the actual shm device,
|
|
// just create the tmp dirs that reside in it commonly
|
|
FS.mkdir('/dev/shm');
|
|
FS.mkdir('/dev/shm/tmp');
|
|
},
|
|
createSpecialDirectories() {
|
|
// create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the
|
|
// name of the stream for fd 6 (see test_unistd_ttyname)
|
|
FS.mkdir('/proc');
|
|
var proc_self = FS.mkdir('/proc/self');
|
|
FS.mkdir('/proc/self/fd');
|
|
FS.mount({
|
|
mount() {
|
|
var node = FS.createNode(proc_self, 'fd', 16384 | 511 /* 0777 */, 73);
|
|
node.node_ops = {
|
|
lookup(parent, name) {
|
|
var fd = +name;
|
|
var stream = FS.getStreamChecked(fd);
|
|
var ret = {
|
|
parent: null,
|
|
mount: { mountpoint: 'fake' },
|
|
node_ops: { readlink: () => stream.path },
|
|
};
|
|
ret.parent = ret; // make it look like a simple root node
|
|
return ret;
|
|
}
|
|
};
|
|
return node;
|
|
}
|
|
}, {}, '/proc/self/fd');
|
|
},
|
|
createStandardStreams() {
|
|
// TODO deprecate the old functionality of a single
|
|
// input / output callback and that utilizes FS.createDevice
|
|
// and instead require a unique set of stream ops
|
|
|
|
// by default, we symlink the standard streams to the
|
|
// default tty devices. however, if the standard streams
|
|
// have been overwritten we create a unique device for
|
|
// them instead.
|
|
if (Module['stdin']) {
|
|
FS.createDevice('/dev', 'stdin', Module['stdin']);
|
|
} else {
|
|
FS.symlink('/dev/tty', '/dev/stdin');
|
|
}
|
|
if (Module['stdout']) {
|
|
FS.createDevice('/dev', 'stdout', null, Module['stdout']);
|
|
} else {
|
|
FS.symlink('/dev/tty', '/dev/stdout');
|
|
}
|
|
if (Module['stderr']) {
|
|
FS.createDevice('/dev', 'stderr', null, Module['stderr']);
|
|
} else {
|
|
FS.symlink('/dev/tty1', '/dev/stderr');
|
|
}
|
|
|
|
// open default streams for the stdin, stdout and stderr devices
|
|
var stdin = FS.open('/dev/stdin', 0);
|
|
var stdout = FS.open('/dev/stdout', 1);
|
|
var stderr = FS.open('/dev/stderr', 1);
|
|
},
|
|
staticInit() {
|
|
// Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info)
|
|
[44].forEach((code) => {
|
|
FS.genericErrors[code] = new FS.ErrnoError(code);
|
|
FS.genericErrors[code].stack = '<generic error, no stack>';
|
|
});
|
|
|
|
FS.nameTable = new Array(4096);
|
|
|
|
FS.mount(MEMFS, {}, '/');
|
|
|
|
FS.createDefaultDirectories();
|
|
FS.createDefaultDevices();
|
|
FS.createSpecialDirectories();
|
|
|
|
FS.filesystems = {
|
|
'MEMFS': MEMFS,
|
|
};
|
|
},
|
|
init(input, output, error) {
|
|
FS.init.initialized = true;
|
|
|
|
// Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here
|
|
Module['stdin'] = input || Module['stdin'];
|
|
Module['stdout'] = output || Module['stdout'];
|
|
Module['stderr'] = error || Module['stderr'];
|
|
|
|
FS.createStandardStreams();
|
|
},
|
|
quit() {
|
|
FS.init.initialized = false;
|
|
// force-flush all streams, so we get musl std streams printed out
|
|
_fflush(0);
|
|
// close all of our streams
|
|
for (var i = 0; i < FS.streams.length; i++) {
|
|
var stream = FS.streams[i];
|
|
if (!stream) {
|
|
continue;
|
|
}
|
|
FS.close(stream);
|
|
}
|
|
},
|
|
findObject(path, dontResolveLastLink) {
|
|
var ret = FS.analyzePath(path, dontResolveLastLink);
|
|
if (!ret.exists) {
|
|
return null;
|
|
}
|
|
return ret.object;
|
|
},
|
|
analyzePath(path, dontResolveLastLink) {
|
|
// operate from within the context of the symlink's target
|
|
try {
|
|
var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
|
|
path = lookup.path;
|
|
} catch (e) {
|
|
}
|
|
var ret = {
|
|
isRoot: false, exists: false, error: 0, name: null, path: null, object: null,
|
|
parentExists: false, parentPath: null, parentObject: null
|
|
};
|
|
try {
|
|
var lookup = FS.lookupPath(path, { parent: true });
|
|
ret.parentExists = true;
|
|
ret.parentPath = lookup.path;
|
|
ret.parentObject = lookup.node;
|
|
ret.name = PATH.basename(path);
|
|
lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
|
|
ret.exists = true;
|
|
ret.path = lookup.path;
|
|
ret.object = lookup.node;
|
|
ret.name = lookup.node.name;
|
|
ret.isRoot = lookup.path === '/';
|
|
} catch (e) {
|
|
ret.error = e.errno;
|
|
};
|
|
return ret;
|
|
},
|
|
createPath(parent, path, canRead, canWrite) {
|
|
parent = typeof parent == 'string' ? parent : FS.getPath(parent);
|
|
var parts = path.split('/').reverse();
|
|
while (parts.length) {
|
|
var part = parts.pop();
|
|
if (!part) continue;
|
|
var current = PATH.join2(parent, part);
|
|
try {
|
|
FS.mkdir(current);
|
|
} catch (e) {
|
|
// ignore EEXIST
|
|
}
|
|
parent = current;
|
|
}
|
|
return current;
|
|
},
|
|
createFile(parent, name, properties, canRead, canWrite) {
|
|
var path = PATH.join2(typeof parent == 'string' ? parent : FS.getPath(parent), name);
|
|
var mode = FS_getMode(canRead, canWrite);
|
|
return FS.create(path, mode);
|
|
},
|
|
createDataFile(parent, name, data, canRead, canWrite, canOwn) {
|
|
var path = name;
|
|
if (parent) {
|
|
parent = typeof parent == 'string' ? parent : FS.getPath(parent);
|
|
path = name ? PATH.join2(parent, name) : parent;
|
|
}
|
|
var mode = FS_getMode(canRead, canWrite);
|
|
var node = FS.create(path, mode);
|
|
if (data) {
|
|
if (typeof data == 'string') {
|
|
var arr = new Array(data.length);
|
|
for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i);
|
|
data = arr;
|
|
}
|
|
// make sure we can write to the file
|
|
FS.chmod(node, mode | 146);
|
|
var stream = FS.open(node, 577);
|
|
FS.write(stream, data, 0, data.length, 0, canOwn);
|
|
FS.close(stream);
|
|
FS.chmod(node, mode);
|
|
}
|
|
},
|
|
createDevice(parent, name, input, output) {
|
|
var path = PATH.join2(typeof parent == 'string' ? parent : FS.getPath(parent), name);
|
|
var mode = FS_getMode(!!input, !!output);
|
|
if (!FS.createDevice.major) FS.createDevice.major = 64;
|
|
var dev = FS.makedev(FS.createDevice.major++, 0);
|
|
// Create a fake device that a set of stream ops to emulate
|
|
// the old behavior.
|
|
FS.registerDevice(dev, {
|
|
open(stream) {
|
|
stream.seekable = false;
|
|
},
|
|
close(stream) {
|
|
// flush any pending line data
|
|
if (output?.buffer?.length) {
|
|
output(10);
|
|
}
|
|
},
|
|
read(stream, buffer, offset, length, pos /* ignored */) {
|
|
var bytesRead = 0;
|
|
for (var i = 0; i < length; i++) {
|
|
var result;
|
|
try {
|
|
result = input();
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(29);
|
|
}
|
|
if (result === undefined && bytesRead === 0) {
|
|
throw new FS.ErrnoError(6);
|
|
}
|
|
if (result === null || result === undefined) break;
|
|
bytesRead++;
|
|
buffer[offset+i] = result;
|
|
}
|
|
if (bytesRead) {
|
|
stream.node.timestamp = Date.now();
|
|
}
|
|
return bytesRead;
|
|
},
|
|
write(stream, buffer, offset, length, pos) {
|
|
for (var i = 0; i < length; i++) {
|
|
try {
|
|
output(buffer[offset+i]);
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(29);
|
|
}
|
|
}
|
|
if (length) {
|
|
stream.node.timestamp = Date.now();
|
|
}
|
|
return i;
|
|
}
|
|
});
|
|
return FS.mkdev(path, mode, dev);
|
|
},
|
|
forceLoadFile(obj) {
|
|
if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true;
|
|
if (typeof XMLHttpRequest != 'undefined') {
|
|
throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.");
|
|
} else if (read_) {
|
|
// Command-line.
|
|
try {
|
|
// WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as
|
|
// read() will try to parse UTF8.
|
|
obj.contents = intArrayFromString(read_(obj.url), true);
|
|
obj.usedBytes = obj.contents.length;
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(29);
|
|
}
|
|
} else {
|
|
throw new Error('Cannot load without read() or XMLHttpRequest.');
|
|
}
|
|
},
|
|
createLazyFile(parent, name, url, canRead, canWrite) {
|
|
// Lazy chunked Uint8Array (implements get and length from Uint8Array).
|
|
// Actual getting is abstracted away for eventual reuse.
|
|
class LazyUint8Array {
|
|
constructor() {
|
|
this.lengthKnown = false;
|
|
this.chunks = []; // Loaded chunks. Index is the chunk number
|
|
}
|
|
get(idx) {
|
|
if (idx > this.length-1 || idx < 0) {
|
|
return undefined;
|
|
}
|
|
var chunkOffset = idx % this.chunkSize;
|
|
var chunkNum = (idx / this.chunkSize)|0;
|
|
return this.getter(chunkNum)[chunkOffset];
|
|
}
|
|
setDataGetter(getter) {
|
|
this.getter = getter;
|
|
}
|
|
cacheLength() {
|
|
// Find length
|
|
var xhr = new XMLHttpRequest();
|
|
xhr.open('HEAD', url, false);
|
|
xhr.send(null);
|
|
if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
|
|
var datalength = Number(xhr.getResponseHeader("Content-length"));
|
|
var header;
|
|
var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes";
|
|
var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip";
|
|
|
|
var chunkSize = 1024*1024; // Chunk size in bytes
|
|
|
|
if (!hasByteServing) chunkSize = datalength;
|
|
|
|
// Function to get a range from the remote URL.
|
|
var doXHR = (from, to) => {
|
|
if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!");
|
|
if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!");
|
|
|
|
// TODO: Use mozResponseArrayBuffer, responseStream, etc. if available.
|
|
var xhr = new XMLHttpRequest();
|
|
xhr.open('GET', url, false);
|
|
if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
|
|
|
|
// Some hints to the browser that we want binary data.
|
|
xhr.responseType = 'arraybuffer';
|
|
if (xhr.overrideMimeType) {
|
|
xhr.overrideMimeType('text/plain; charset=x-user-defined');
|
|
}
|
|
|
|
xhr.send(null);
|
|
if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
|
|
if (xhr.response !== undefined) {
|
|
return new Uint8Array(/** @type{Array<number>} */(xhr.response || []));
|
|
}
|
|
return intArrayFromString(xhr.responseText || '', true);
|
|
};
|
|
var lazyArray = this;
|
|
lazyArray.setDataGetter((chunkNum) => {
|
|
var start = chunkNum * chunkSize;
|
|
var end = (chunkNum+1) * chunkSize - 1; // including this byte
|
|
end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block
|
|
if (typeof lazyArray.chunks[chunkNum] == 'undefined') {
|
|
lazyArray.chunks[chunkNum] = doXHR(start, end);
|
|
}
|
|
if (typeof lazyArray.chunks[chunkNum] == 'undefined') throw new Error('doXHR failed!');
|
|
return lazyArray.chunks[chunkNum];
|
|
});
|
|
|
|
if (usesGzip || !datalength) {
|
|
// if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length
|
|
chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file
|
|
datalength = this.getter(0).length;
|
|
chunkSize = datalength;
|
|
out("LazyFiles on gzip forces download of the whole file when length is accessed");
|
|
}
|
|
|
|
this._length = datalength;
|
|
this._chunkSize = chunkSize;
|
|
this.lengthKnown = true;
|
|
}
|
|
get length() {
|
|
if (!this.lengthKnown) {
|
|
this.cacheLength();
|
|
}
|
|
return this._length;
|
|
}
|
|
get chunkSize() {
|
|
if (!this.lengthKnown) {
|
|
this.cacheLength();
|
|
}
|
|
return this._chunkSize;
|
|
}
|
|
}
|
|
|
|
if (typeof XMLHttpRequest != 'undefined') {
|
|
if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc';
|
|
var lazyArray = new LazyUint8Array();
|
|
var properties = { isDevice: false, contents: lazyArray };
|
|
} else {
|
|
var properties = { isDevice: false, url: url };
|
|
}
|
|
|
|
var node = FS.createFile(parent, name, properties, canRead, canWrite);
|
|
// This is a total hack, but I want to get this lazy file code out of the
|
|
// core of MEMFS. If we want to keep this lazy file concept I feel it should
|
|
// be its own thin LAZYFS proxying calls to MEMFS.
|
|
if (properties.contents) {
|
|
node.contents = properties.contents;
|
|
} else if (properties.url) {
|
|
node.contents = null;
|
|
node.url = properties.url;
|
|
}
|
|
// Add a function that defers querying the file size until it is asked the first time.
|
|
Object.defineProperties(node, {
|
|
usedBytes: {
|
|
get: function() { return this.contents.length; }
|
|
}
|
|
});
|
|
// override each stream op with one that tries to force load the lazy file first
|
|
var stream_ops = {};
|
|
var keys = Object.keys(node.stream_ops);
|
|
keys.forEach((key) => {
|
|
var fn = node.stream_ops[key];
|
|
stream_ops[key] = (...args) => {
|
|
FS.forceLoadFile(node);
|
|
return fn(...args);
|
|
};
|
|
});
|
|
function writeChunks(stream, buffer, offset, length, position) {
|
|
var contents = stream.node.contents;
|
|
if (position >= contents.length)
|
|
return 0;
|
|
var size = Math.min(contents.length - position, length);
|
|
if (contents.slice) { // normal array
|
|
for (var i = 0; i < size; i++) {
|
|
buffer[offset + i] = contents[position + i];
|
|
}
|
|
} else {
|
|
for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR
|
|
buffer[offset + i] = contents.get(position + i);
|
|
}
|
|
}
|
|
return size;
|
|
}
|
|
// use a custom read function
|
|
stream_ops.read = (stream, buffer, offset, length, position) => {
|
|
FS.forceLoadFile(node);
|
|
return writeChunks(stream, buffer, offset, length, position)
|
|
};
|
|
// use a custom mmap function
|
|
stream_ops.mmap = (stream, length, position, prot, flags) => {
|
|
FS.forceLoadFile(node);
|
|
var ptr = mmapAlloc(length);
|
|
if (!ptr) {
|
|
throw new FS.ErrnoError(48);
|
|
}
|
|
writeChunks(stream, HEAP8, ptr, length, position);
|
|
return { ptr, allocated: true };
|
|
};
|
|
node.stream_ops = stream_ops;
|
|
return node;
|
|
},
|
|
};
|
|
var SOCKFS = {
|
|
mount(mount) {
|
|
// If Module['websocket'] has already been defined (e.g. for configuring
|
|
// the subprotocol/url) use that, if not initialise it to a new object.
|
|
Module['websocket'] = (Module['websocket'] &&
|
|
('object' === typeof Module['websocket'])) ? Module['websocket'] : {};
|
|
|
|
// Add the Event registration mechanism to the exported websocket configuration
|
|
// object so we can register network callbacks from native JavaScript too.
|
|
// For more documentation see system/include/emscripten/emscripten.h
|
|
Module['websocket']._callbacks = {};
|
|
Module['websocket']['on'] = /** @this{Object} */ function(event, callback) {
|
|
if ('function' === typeof callback) {
|
|
this._callbacks[event] = callback;
|
|
}
|
|
return this;
|
|
};
|
|
|
|
Module['websocket'].emit = /** @this{Object} */ function(event, param) {
|
|
if ('function' === typeof this._callbacks[event]) {
|
|
this._callbacks[event].call(this, param);
|
|
}
|
|
};
|
|
|
|
// If debug is enabled register simple default logging callbacks for each Event.
|
|
|
|
return FS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
|
|
},
|
|
createSocket(family, type, protocol) {
|
|
type &= ~526336; // Some applications may pass it; it makes no sense for a single process.
|
|
var streaming = type == 1;
|
|
if (streaming && protocol && protocol != 6) {
|
|
throw new FS.ErrnoError(66); // if SOCK_STREAM, must be tcp or 0.
|
|
}
|
|
|
|
// create our internal socket structure
|
|
var sock = {
|
|
family,
|
|
type,
|
|
protocol,
|
|
server: null,
|
|
error: null, // Used in getsockopt for SOL_SOCKET/SO_ERROR test
|
|
peers: {},
|
|
pending: [],
|
|
recv_queue: [],
|
|
sock_ops: SOCKFS.websocket_sock_ops
|
|
};
|
|
|
|
// create the filesystem node to store the socket structure
|
|
var name = SOCKFS.nextname();
|
|
var node = FS.createNode(SOCKFS.root, name, 49152, 0);
|
|
node.sock = sock;
|
|
|
|
// and the wrapping stream that enables library functions such
|
|
// as read and write to indirectly interact with the socket
|
|
var stream = FS.createStream({
|
|
path: name,
|
|
node,
|
|
flags: 2,
|
|
seekable: false,
|
|
stream_ops: SOCKFS.stream_ops
|
|
});
|
|
|
|
// map the new stream to the socket structure (sockets have a 1:1
|
|
// relationship with a stream)
|
|
sock.stream = stream;
|
|
|
|
return sock;
|
|
},
|
|
getSocket(fd) {
|
|
var stream = FS.getStream(fd);
|
|
if (!stream || !FS.isSocket(stream.node.mode)) {
|
|
return null;
|
|
}
|
|
return stream.node.sock;
|
|
},
|
|
stream_ops:{
|
|
poll(stream) {
|
|
var sock = stream.node.sock;
|
|
return sock.sock_ops.poll(sock);
|
|
},
|
|
ioctl(stream, request, varargs) {
|
|
var sock = stream.node.sock;
|
|
return sock.sock_ops.ioctl(sock, request, varargs);
|
|
},
|
|
read(stream, buffer, offset, length, position /* ignored */) {
|
|
var sock = stream.node.sock;
|
|
var msg = sock.sock_ops.recvmsg(sock, length);
|
|
if (!msg) {
|
|
// socket is closed
|
|
return 0;
|
|
}
|
|
buffer.set(msg.buffer, offset);
|
|
return msg.buffer.length;
|
|
},
|
|
write(stream, buffer, offset, length, position /* ignored */) {
|
|
var sock = stream.node.sock;
|
|
return sock.sock_ops.sendmsg(sock, buffer, offset, length);
|
|
},
|
|
close(stream) {
|
|
var sock = stream.node.sock;
|
|
sock.sock_ops.close(sock);
|
|
},
|
|
},
|
|
nextname() {
|
|
if (!SOCKFS.nextname.current) {
|
|
SOCKFS.nextname.current = 0;
|
|
}
|
|
return 'socket[' + (SOCKFS.nextname.current++) + ']';
|
|
},
|
|
websocket_sock_ops:{
|
|
createPeer(sock, addr, port) {
|
|
var ws;
|
|
|
|
if (typeof addr == 'object') {
|
|
ws = addr;
|
|
addr = null;
|
|
port = null;
|
|
}
|
|
|
|
if (ws) {
|
|
// for sockets that've already connected (e.g. we're the server)
|
|
// we can inspect the _socket property for the address
|
|
if (ws._socket) {
|
|
addr = ws._socket.remoteAddress;
|
|
port = ws._socket.remotePort;
|
|
}
|
|
// if we're just now initializing a connection to the remote,
|
|
// inspect the url property
|
|
else {
|
|
var result = /ws[s]?:\/\/([^:]+):(\d+)/.exec(ws.url);
|
|
if (!result) {
|
|
throw new Error('WebSocket URL must be in the format ws(s)://address:port');
|
|
}
|
|
addr = result[1];
|
|
port = parseInt(result[2], 10);
|
|
}
|
|
} else {
|
|
// create the actual websocket object and connect
|
|
try {
|
|
// runtimeConfig gets set to true if WebSocket runtime configuration is available.
|
|
var runtimeConfig = (Module['websocket'] && ('object' === typeof Module['websocket']));
|
|
|
|
// The default value is 'ws://' the replace is needed because the compiler replaces '//' comments with '#'
|
|
// comments without checking context, so we'd end up with ws:#, the replace swaps the '#' for '//' again.
|
|
var url = 'ws:#'.replace('#', '//');
|
|
|
|
if (runtimeConfig) {
|
|
if ('string' === typeof Module['websocket']['url']) {
|
|
url = Module['websocket']['url']; // Fetch runtime WebSocket URL config.
|
|
}
|
|
}
|
|
|
|
if (url === 'ws://' || url === 'wss://') { // Is the supplied URL config just a prefix, if so complete it.
|
|
var parts = addr.split('/');
|
|
url = url + parts[0] + ":" + port + "/" + parts.slice(1).join('/');
|
|
}
|
|
|
|
// Make the WebSocket subprotocol (Sec-WebSocket-Protocol) default to binary if no configuration is set.
|
|
var subProtocols = 'binary'; // The default value is 'binary'
|
|
|
|
if (runtimeConfig) {
|
|
if ('string' === typeof Module['websocket']['subprotocol']) {
|
|
subProtocols = Module['websocket']['subprotocol']; // Fetch runtime WebSocket subprotocol config.
|
|
}
|
|
}
|
|
|
|
// The default WebSocket options
|
|
var opts = undefined;
|
|
|
|
if (subProtocols !== 'null') {
|
|
// The regex trims the string (removes spaces at the beginning and end, then splits the string by
|
|
// <any space>,<any space> into an Array. Whitespace removal is important for Websockify and ws.
|
|
subProtocols = subProtocols.replace(/^ +| +$/g,"").split(/ *, */);
|
|
|
|
opts = subProtocols;
|
|
}
|
|
|
|
// some webservers (azure) does not support subprotocol header
|
|
if (runtimeConfig && null === Module['websocket']['subprotocol']) {
|
|
subProtocols = 'null';
|
|
opts = undefined;
|
|
}
|
|
|
|
// If node we use the ws library.
|
|
var WebSocketConstructor;
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
WebSocketConstructor = /** @type{(typeof WebSocket)} */(require('ws'));
|
|
} else
|
|
{
|
|
WebSocketConstructor = WebSocket;
|
|
}
|
|
ws = new WebSocketConstructor(url, opts);
|
|
ws.binaryType = 'arraybuffer';
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(23);
|
|
}
|
|
}
|
|
|
|
var peer = {
|
|
addr,
|
|
port,
|
|
socket: ws,
|
|
dgram_send_queue: []
|
|
};
|
|
|
|
SOCKFS.websocket_sock_ops.addPeer(sock, peer);
|
|
SOCKFS.websocket_sock_ops.handlePeerEvents(sock, peer);
|
|
|
|
// if this is a bound dgram socket, send the port number first to allow
|
|
// us to override the ephemeral port reported to us by remotePort on the
|
|
// remote end.
|
|
if (sock.type === 2 && typeof sock.sport != 'undefined') {
|
|
peer.dgram_send_queue.push(new Uint8Array([
|
|
255, 255, 255, 255,
|
|
'p'.charCodeAt(0), 'o'.charCodeAt(0), 'r'.charCodeAt(0), 't'.charCodeAt(0),
|
|
((sock.sport & 0xff00) >> 8) , (sock.sport & 0xff)
|
|
]));
|
|
}
|
|
|
|
return peer;
|
|
},
|
|
getPeer(sock, addr, port) {
|
|
return sock.peers[addr + ':' + port];
|
|
},
|
|
addPeer(sock, peer) {
|
|
sock.peers[peer.addr + ':' + peer.port] = peer;
|
|
},
|
|
removePeer(sock, peer) {
|
|
delete sock.peers[peer.addr + ':' + peer.port];
|
|
},
|
|
handlePeerEvents(sock, peer) {
|
|
var first = true;
|
|
|
|
var handleOpen = function () {
|
|
|
|
Module['websocket'].emit('open', sock.stream.fd);
|
|
|
|
try {
|
|
var queued = peer.dgram_send_queue.shift();
|
|
while (queued) {
|
|
peer.socket.send(queued);
|
|
queued = peer.dgram_send_queue.shift();
|
|
}
|
|
} catch (e) {
|
|
// not much we can do here in the way of proper error handling as we've already
|
|
// lied and said this data was sent. shut it down.
|
|
peer.socket.close();
|
|
}
|
|
};
|
|
|
|
function handleMessage(data) {
|
|
if (typeof data == 'string') {
|
|
var encoder = new TextEncoder(); // should be utf-8
|
|
data = encoder.encode(data); // make a typed array from the string
|
|
} else {
|
|
assert(data.byteLength !== undefined); // must receive an ArrayBuffer
|
|
if (data.byteLength == 0) {
|
|
// An empty ArrayBuffer will emit a pseudo disconnect event
|
|
// as recv/recvmsg will return zero which indicates that a socket
|
|
// has performed a shutdown although the connection has not been disconnected yet.
|
|
return;
|
|
}
|
|
data = new Uint8Array(data); // make a typed array view on the array buffer
|
|
}
|
|
|
|
// if this is the port message, override the peer's port with it
|
|
var wasfirst = first;
|
|
first = false;
|
|
if (wasfirst &&
|
|
data.length === 10 &&
|
|
data[0] === 255 && data[1] === 255 && data[2] === 255 && data[3] === 255 &&
|
|
data[4] === 'p'.charCodeAt(0) && data[5] === 'o'.charCodeAt(0) && data[6] === 'r'.charCodeAt(0) && data[7] === 't'.charCodeAt(0)) {
|
|
// update the peer's port and it's key in the peer map
|
|
var newport = ((data[8] << 8) | data[9]);
|
|
SOCKFS.websocket_sock_ops.removePeer(sock, peer);
|
|
peer.port = newport;
|
|
SOCKFS.websocket_sock_ops.addPeer(sock, peer);
|
|
return;
|
|
}
|
|
|
|
sock.recv_queue.push({ addr: peer.addr, port: peer.port, data: data });
|
|
Module['websocket'].emit('message', sock.stream.fd);
|
|
};
|
|
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
peer.socket.on('open', handleOpen);
|
|
peer.socket.on('message', function(data, isBinary) {
|
|
if (!isBinary) {
|
|
return;
|
|
}
|
|
handleMessage((new Uint8Array(data)).buffer); // copy from node Buffer -> ArrayBuffer
|
|
});
|
|
peer.socket.on('close', function() {
|
|
Module['websocket'].emit('close', sock.stream.fd);
|
|
});
|
|
peer.socket.on('error', function(error) {
|
|
// Although the ws library may pass errors that may be more descriptive than
|
|
// ECONNREFUSED they are not necessarily the expected error code e.g.
|
|
// ENOTFOUND on getaddrinfo seems to be node.js specific, so using ECONNREFUSED
|
|
// is still probably the most useful thing to do.
|
|
sock.error = 14; // Used in getsockopt for SOL_SOCKET/SO_ERROR test.
|
|
Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'ECONNREFUSED: Connection refused']);
|
|
// don't throw
|
|
});
|
|
} else {
|
|
peer.socket.onopen = handleOpen;
|
|
peer.socket.onclose = function() {
|
|
Module['websocket'].emit('close', sock.stream.fd);
|
|
};
|
|
peer.socket.onmessage = function peer_socket_onmessage(event) {
|
|
handleMessage(event.data);
|
|
};
|
|
peer.socket.onerror = function(error) {
|
|
// The WebSocket spec only allows a 'simple event' to be thrown on error,
|
|
// so we only really know as much as ECONNREFUSED.
|
|
sock.error = 14; // Used in getsockopt for SOL_SOCKET/SO_ERROR test.
|
|
Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'ECONNREFUSED: Connection refused']);
|
|
};
|
|
}
|
|
},
|
|
poll(sock) {
|
|
if (sock.type === 1 && sock.server) {
|
|
// listen sockets should only say they're available for reading
|
|
// if there are pending clients.
|
|
return sock.pending.length ? (64 | 1) : 0;
|
|
}
|
|
|
|
var mask = 0;
|
|
var dest = sock.type === 1 ? // we only care about the socket state for connection-based sockets
|
|
SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport) :
|
|
null;
|
|
|
|
if (sock.recv_queue.length ||
|
|
!dest || // connection-less sockets are always ready to read
|
|
(dest && dest.socket.readyState === dest.socket.CLOSING) ||
|
|
(dest && dest.socket.readyState === dest.socket.CLOSED)) { // let recv return 0 once closed
|
|
mask |= (64 | 1);
|
|
}
|
|
|
|
if (!dest || // connection-less sockets are always ready to write
|
|
(dest && dest.socket.readyState === dest.socket.OPEN)) {
|
|
mask |= 4;
|
|
}
|
|
|
|
if ((dest && dest.socket.readyState === dest.socket.CLOSING) ||
|
|
(dest && dest.socket.readyState === dest.socket.CLOSED)) {
|
|
mask |= 16;
|
|
}
|
|
|
|
return mask;
|
|
},
|
|
ioctl(sock, request, arg) {
|
|
switch (request) {
|
|
case 21531:
|
|
var bytes = 0;
|
|
if (sock.recv_queue.length) {
|
|
bytes = sock.recv_queue[0].data.length;
|
|
}
|
|
HEAP32[((arg)>>2)] = bytes;
|
|
return 0;
|
|
default:
|
|
return 28;
|
|
}
|
|
},
|
|
close(sock) {
|
|
// if we've spawned a listen server, close it
|
|
if (sock.server) {
|
|
try {
|
|
sock.server.close();
|
|
} catch (e) {
|
|
}
|
|
sock.server = null;
|
|
}
|
|
// close any peer connections
|
|
var peers = Object.keys(sock.peers);
|
|
for (var i = 0; i < peers.length; i++) {
|
|
var peer = sock.peers[peers[i]];
|
|
try {
|
|
peer.socket.close();
|
|
} catch (e) {
|
|
}
|
|
SOCKFS.websocket_sock_ops.removePeer(sock, peer);
|
|
}
|
|
return 0;
|
|
},
|
|
bind(sock, addr, port) {
|
|
if (typeof sock.saddr != 'undefined' || typeof sock.sport != 'undefined') {
|
|
throw new FS.ErrnoError(28); // already bound
|
|
}
|
|
sock.saddr = addr;
|
|
sock.sport = port;
|
|
// in order to emulate dgram sockets, we need to launch a listen server when
|
|
// binding on a connection-less socket
|
|
// note: this is only required on the server side
|
|
if (sock.type === 2) {
|
|
// close the existing server if it exists
|
|
if (sock.server) {
|
|
sock.server.close();
|
|
sock.server = null;
|
|
}
|
|
// swallow error operation not supported error that occurs when binding in the
|
|
// browser where this isn't supported
|
|
try {
|
|
sock.sock_ops.listen(sock, 0);
|
|
} catch (e) {
|
|
if (!(e.name === 'ErrnoError')) throw e;
|
|
if (e.errno !== 138) throw e;
|
|
}
|
|
}
|
|
},
|
|
connect(sock, addr, port) {
|
|
if (sock.server) {
|
|
throw new FS.ErrnoError(138);
|
|
}
|
|
|
|
// TODO autobind
|
|
// if (!sock.addr && sock.type == 2) {
|
|
// }
|
|
|
|
// early out if we're already connected / in the middle of connecting
|
|
if (typeof sock.daddr != 'undefined' && typeof sock.dport != 'undefined') {
|
|
var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport);
|
|
if (dest) {
|
|
if (dest.socket.readyState === dest.socket.CONNECTING) {
|
|
throw new FS.ErrnoError(7);
|
|
} else {
|
|
throw new FS.ErrnoError(30);
|
|
}
|
|
}
|
|
}
|
|
|
|
// add the socket to our peer list and set our
|
|
// destination address / port to match
|
|
var peer = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port);
|
|
sock.daddr = peer.addr;
|
|
sock.dport = peer.port;
|
|
|
|
// always "fail" in non-blocking mode
|
|
throw new FS.ErrnoError(26);
|
|
},
|
|
listen(sock, backlog) {
|
|
if (!ENVIRONMENT_IS_NODE) {
|
|
throw new FS.ErrnoError(138);
|
|
}
|
|
if (sock.server) {
|
|
throw new FS.ErrnoError(28); // already listening
|
|
}
|
|
var WebSocketServer = require('ws').Server;
|
|
var host = sock.saddr;
|
|
sock.server = new WebSocketServer({
|
|
host,
|
|
port: sock.sport
|
|
// TODO support backlog
|
|
});
|
|
Module['websocket'].emit('listen', sock.stream.fd); // Send Event with listen fd.
|
|
|
|
sock.server.on('connection', function(ws) {
|
|
if (sock.type === 1) {
|
|
var newsock = SOCKFS.createSocket(sock.family, sock.type, sock.protocol);
|
|
|
|
// create a peer on the new socket
|
|
var peer = SOCKFS.websocket_sock_ops.createPeer(newsock, ws);
|
|
newsock.daddr = peer.addr;
|
|
newsock.dport = peer.port;
|
|
|
|
// push to queue for accept to pick up
|
|
sock.pending.push(newsock);
|
|
Module['websocket'].emit('connection', newsock.stream.fd);
|
|
} else {
|
|
// create a peer on the listen socket so calling sendto
|
|
// with the listen socket and an address will resolve
|
|
// to the correct client
|
|
SOCKFS.websocket_sock_ops.createPeer(sock, ws);
|
|
Module['websocket'].emit('connection', sock.stream.fd);
|
|
}
|
|
});
|
|
sock.server.on('close', function() {
|
|
Module['websocket'].emit('close', sock.stream.fd);
|
|
sock.server = null;
|
|
});
|
|
sock.server.on('error', function(error) {
|
|
// Although the ws library may pass errors that may be more descriptive than
|
|
// ECONNREFUSED they are not necessarily the expected error code e.g.
|
|
// ENOTFOUND on getaddrinfo seems to be node.js specific, so using EHOSTUNREACH
|
|
// is still probably the most useful thing to do. This error shouldn't
|
|
// occur in a well written app as errors should get trapped in the compiled
|
|
// app's own getaddrinfo call.
|
|
sock.error = 23; // Used in getsockopt for SOL_SOCKET/SO_ERROR test.
|
|
Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'EHOSTUNREACH: Host is unreachable']);
|
|
// don't throw
|
|
});
|
|
},
|
|
accept(listensock) {
|
|
if (!listensock.server || !listensock.pending.length) {
|
|
throw new FS.ErrnoError(28);
|
|
}
|
|
var newsock = listensock.pending.shift();
|
|
newsock.stream.flags = listensock.stream.flags;
|
|
return newsock;
|
|
},
|
|
getname(sock, peer) {
|
|
var addr, port;
|
|
if (peer) {
|
|
if (sock.daddr === undefined || sock.dport === undefined) {
|
|
throw new FS.ErrnoError(53);
|
|
}
|
|
addr = sock.daddr;
|
|
port = sock.dport;
|
|
} else {
|
|
// TODO saddr and sport will be set for bind()'d UDP sockets, but what
|
|
// should we be returning for TCP sockets that've been connect()'d?
|
|
addr = sock.saddr || 0;
|
|
port = sock.sport || 0;
|
|
}
|
|
return { addr, port };
|
|
},
|
|
sendmsg(sock, buffer, offset, length, addr, port) {
|
|
if (sock.type === 2) {
|
|
// connection-less sockets will honor the message address,
|
|
// and otherwise fall back to the bound destination address
|
|
if (addr === undefined || port === undefined) {
|
|
addr = sock.daddr;
|
|
port = sock.dport;
|
|
}
|
|
// if there was no address to fall back to, error out
|
|
if (addr === undefined || port === undefined) {
|
|
throw new FS.ErrnoError(17);
|
|
}
|
|
} else {
|
|
// connection-based sockets will only use the bound
|
|
addr = sock.daddr;
|
|
port = sock.dport;
|
|
}
|
|
|
|
// find the peer for the destination address
|
|
var dest = SOCKFS.websocket_sock_ops.getPeer(sock, addr, port);
|
|
|
|
// early out if not connected with a connection-based socket
|
|
if (sock.type === 1) {
|
|
if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
|
|
throw new FS.ErrnoError(53);
|
|
} else if (dest.socket.readyState === dest.socket.CONNECTING) {
|
|
throw new FS.ErrnoError(6);
|
|
}
|
|
}
|
|
|
|
// create a copy of the incoming data to send, as the WebSocket API
|
|
// doesn't work entirely with an ArrayBufferView, it'll just send
|
|
// the entire underlying buffer
|
|
if (ArrayBuffer.isView(buffer)) {
|
|
offset += buffer.byteOffset;
|
|
buffer = buffer.buffer;
|
|
}
|
|
|
|
var data;
|
|
data = buffer.slice(offset, offset + length);
|
|
|
|
// if we're emulating a connection-less dgram socket and don't have
|
|
// a cached connection, queue the buffer to send upon connect and
|
|
// lie, saying the data was sent now.
|
|
if (sock.type === 2) {
|
|
if (!dest || dest.socket.readyState !== dest.socket.OPEN) {
|
|
// if we're not connected, open a new connection
|
|
if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
|
|
dest = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port);
|
|
}
|
|
dest.dgram_send_queue.push(data);
|
|
return length;
|
|
}
|
|
}
|
|
|
|
try {
|
|
// send the actual data
|
|
dest.socket.send(data);
|
|
return length;
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(28);
|
|
}
|
|
},
|
|
recvmsg(sock, length) {
|
|
// http://pubs.opengroup.org/onlinepubs/7908799/xns/recvmsg.html
|
|
if (sock.type === 1 && sock.server) {
|
|
// tcp servers should not be recv()'ing on the listen socket
|
|
throw new FS.ErrnoError(53);
|
|
}
|
|
|
|
var queued = sock.recv_queue.shift();
|
|
if (!queued) {
|
|
if (sock.type === 1) {
|
|
var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport);
|
|
|
|
if (!dest) {
|
|
// if we have a destination address but are not connected, error out
|
|
throw new FS.ErrnoError(53);
|
|
}
|
|
if (dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
|
|
// return null if the socket has closed
|
|
return null;
|
|
}
|
|
// else, our socket is in a valid state but truly has nothing available
|
|
throw new FS.ErrnoError(6);
|
|
}
|
|
throw new FS.ErrnoError(6);
|
|
}
|
|
|
|
// queued.data will be an ArrayBuffer if it's unadulterated, but if it's
|
|
// requeued TCP data it'll be an ArrayBufferView
|
|
var queuedLength = queued.data.byteLength || queued.data.length;
|
|
var queuedOffset = queued.data.byteOffset || 0;
|
|
var queuedBuffer = queued.data.buffer || queued.data;
|
|
var bytesRead = Math.min(length, queuedLength);
|
|
var res = {
|
|
buffer: new Uint8Array(queuedBuffer, queuedOffset, bytesRead),
|
|
addr: queued.addr,
|
|
port: queued.port
|
|
};
|
|
|
|
// push back any unread data for TCP connections
|
|
if (sock.type === 1 && bytesRead < queuedLength) {
|
|
var bytesRemaining = queuedLength - bytesRead;
|
|
queued.data = new Uint8Array(queuedBuffer, queuedOffset + bytesRead, bytesRemaining);
|
|
sock.recv_queue.unshift(queued);
|
|
}
|
|
|
|
return res;
|
|
},
|
|
},
|
|
};
|
|
|
|
var getSocketFromFD = (fd) => {
|
|
var socket = SOCKFS.getSocket(fd);
|
|
if (!socket) throw new FS.ErrnoError(8);
|
|
return socket;
|
|
};
|
|
|
|
var Sockets = {
|
|
BUFFER_SIZE:10240,
|
|
MAX_BUFFER_SIZE:10485760,
|
|
nextFd:1,
|
|
fds:{
|
|
},
|
|
nextport:1,
|
|
maxport:65535,
|
|
peer:null,
|
|
connections:{
|
|
},
|
|
portmap:{
|
|
},
|
|
localAddr:4261412874,
|
|
addrPool:[33554442,50331658,67108874,83886090,100663306,117440522,134217738,150994954,167772170,184549386,201326602,218103818,234881034],
|
|
};
|
|
|
|
var inetNtop4 = (addr) => {
|
|
return (addr & 0xff) + '.' + ((addr >> 8) & 0xff) + '.' + ((addr >> 16) & 0xff) + '.' + ((addr >> 24) & 0xff)
|
|
};
|
|
|
|
|
|
var inetNtop6 = (ints) => {
|
|
// ref: http://www.ietf.org/rfc/rfc2373.txt - section 2.5.4
|
|
// Format for IPv4 compatible and mapped 128-bit IPv6 Addresses
|
|
// 128-bits are split into eight 16-bit words
|
|
// stored in network byte order (big-endian)
|
|
// | 80 bits | 16 | 32 bits |
|
|
// +-----------------------------------------------------------------+
|
|
// | 10 bytes | 2 | 4 bytes |
|
|
// +--------------------------------------+--------------------------+
|
|
// + 5 words | 1 | 2 words |
|
|
// +--------------------------------------+--------------------------+
|
|
// |0000..............................0000|0000| IPv4 ADDRESS | (compatible)
|
|
// +--------------------------------------+----+---------------------+
|
|
// |0000..............................0000|FFFF| IPv4 ADDRESS | (mapped)
|
|
// +--------------------------------------+----+---------------------+
|
|
var str = "";
|
|
var word = 0;
|
|
var longest = 0;
|
|
var lastzero = 0;
|
|
var zstart = 0;
|
|
var len = 0;
|
|
var i = 0;
|
|
var parts = [
|
|
ints[0] & 0xffff,
|
|
(ints[0] >> 16),
|
|
ints[1] & 0xffff,
|
|
(ints[1] >> 16),
|
|
ints[2] & 0xffff,
|
|
(ints[2] >> 16),
|
|
ints[3] & 0xffff,
|
|
(ints[3] >> 16)
|
|
];
|
|
|
|
// Handle IPv4-compatible, IPv4-mapped, loopback and any/unspecified addresses
|
|
|
|
var hasipv4 = true;
|
|
var v4part = "";
|
|
// check if the 10 high-order bytes are all zeros (first 5 words)
|
|
for (i = 0; i < 5; i++) {
|
|
if (parts[i] !== 0) { hasipv4 = false; break; }
|
|
}
|
|
|
|
if (hasipv4) {
|
|
// low-order 32-bits store an IPv4 address (bytes 13 to 16) (last 2 words)
|
|
v4part = inetNtop4(parts[6] | (parts[7] << 16));
|
|
// IPv4-mapped IPv6 address if 16-bit value (bytes 11 and 12) == 0xFFFF (6th word)
|
|
if (parts[5] === -1) {
|
|
str = "::ffff:";
|
|
str += v4part;
|
|
return str;
|
|
}
|
|
// IPv4-compatible IPv6 address if 16-bit value (bytes 11 and 12) == 0x0000 (6th word)
|
|
if (parts[5] === 0) {
|
|
str = "::";
|
|
//special case IPv6 addresses
|
|
if (v4part === "0.0.0.0") v4part = ""; // any/unspecified address
|
|
if (v4part === "0.0.0.1") v4part = "1";// loopback address
|
|
str += v4part;
|
|
return str;
|
|
}
|
|
}
|
|
|
|
// Handle all other IPv6 addresses
|
|
|
|
// first run to find the longest contiguous zero words
|
|
for (word = 0; word < 8; word++) {
|
|
if (parts[word] === 0) {
|
|
if (word - lastzero > 1) {
|
|
len = 0;
|
|
}
|
|
lastzero = word;
|
|
len++;
|
|
}
|
|
if (len > longest) {
|
|
longest = len;
|
|
zstart = word - longest + 1;
|
|
}
|
|
}
|
|
|
|
for (word = 0; word < 8; word++) {
|
|
if (longest > 1) {
|
|
// compress contiguous zeros - to produce "::"
|
|
if (parts[word] === 0 && word >= zstart && word < (zstart + longest) ) {
|
|
if (word === zstart) {
|
|
str += ":";
|
|
if (zstart === 0) str += ":"; //leading zeros case
|
|
}
|
|
continue;
|
|
}
|
|
}
|
|
// converts 16-bit words from big-endian to little-endian before converting to hex string
|
|
str += Number(_ntohs(parts[word] & 0xffff)).toString(16);
|
|
str += word < 7 ? ":" : "";
|
|
}
|
|
return str;
|
|
};
|
|
|
|
var readSockaddr = (sa, salen) => {
|
|
// family / port offsets are common to both sockaddr_in and sockaddr_in6
|
|
var family = HEAP16[((sa)>>1)];
|
|
var port = _ntohs(HEAPU16[(((sa)+(2))>>1)]);
|
|
var addr;
|
|
|
|
switch (family) {
|
|
case 2:
|
|
if (salen !== 16) {
|
|
return { errno: 28 };
|
|
}
|
|
addr = HEAP32[(((sa)+(4))>>2)];
|
|
addr = inetNtop4(addr);
|
|
break;
|
|
case 10:
|
|
if (salen !== 28) {
|
|
return { errno: 28 };
|
|
}
|
|
addr = [
|
|
HEAP32[(((sa)+(8))>>2)],
|
|
HEAP32[(((sa)+(12))>>2)],
|
|
HEAP32[(((sa)+(16))>>2)],
|
|
HEAP32[(((sa)+(20))>>2)]
|
|
];
|
|
addr = inetNtop6(addr);
|
|
break;
|
|
default:
|
|
return { errno: 5 };
|
|
}
|
|
|
|
return { family: family, addr: addr, port: port };
|
|
};
|
|
|
|
|
|
var inetPton4 = (str) => {
|
|
var b = str.split('.');
|
|
for (var i = 0; i < 4; i++) {
|
|
var tmp = Number(b[i]);
|
|
if (isNaN(tmp)) return null;
|
|
b[i] = tmp;
|
|
}
|
|
return (b[0] | (b[1] << 8) | (b[2] << 16) | (b[3] << 24)) >>> 0;
|
|
};
|
|
|
|
|
|
/** @suppress {checkTypes} */
|
|
var jstoi_q = (str) => parseInt(str);
|
|
var inetPton6 = (str) => {
|
|
var words;
|
|
var w, offset, z, i;
|
|
/* http://home.deds.nl/~aeron/regex/ */
|
|
var valid6regx = /^((?=.*::)(?!.*::.+::)(::)?([\dA-F]{1,4}:(:|\b)|){5}|([\dA-F]{1,4}:){6})((([\dA-F]{1,4}((?!\3)::|:\b|$))|(?!\2\3)){2}|(((2[0-4]|1\d|[1-9])?\d|25[0-5])\.?\b){4})$/i
|
|
var parts = [];
|
|
if (!valid6regx.test(str)) {
|
|
return null;
|
|
}
|
|
if (str === "::") {
|
|
return [0, 0, 0, 0, 0, 0, 0, 0];
|
|
}
|
|
// Z placeholder to keep track of zeros when splitting the string on ":"
|
|
if (str.startsWith("::")) {
|
|
str = str.replace("::", "Z:"); // leading zeros case
|
|
} else {
|
|
str = str.replace("::", ":Z:");
|
|
}
|
|
|
|
if (str.indexOf(".") > 0) {
|
|
// parse IPv4 embedded stress
|
|
str = str.replace(new RegExp('[.]', 'g'), ":");
|
|
words = str.split(":");
|
|
words[words.length-4] = jstoi_q(words[words.length-4]) + jstoi_q(words[words.length-3])*256;
|
|
words[words.length-3] = jstoi_q(words[words.length-2]) + jstoi_q(words[words.length-1])*256;
|
|
words = words.slice(0, words.length-2);
|
|
} else {
|
|
words = str.split(":");
|
|
}
|
|
|
|
offset = 0; z = 0;
|
|
for (w=0; w < words.length; w++) {
|
|
if (typeof words[w] == 'string') {
|
|
if (words[w] === 'Z') {
|
|
// compressed zeros - write appropriate number of zero words
|
|
for (z = 0; z < (8 - words.length+1); z++) {
|
|
parts[w+z] = 0;
|
|
}
|
|
offset = z-1;
|
|
} else {
|
|
// parse hex to field to 16-bit value and write it in network byte-order
|
|
parts[w+offset] = _htons(parseInt(words[w],16));
|
|
}
|
|
} else {
|
|
// parsed IPv4 words
|
|
parts[w+offset] = words[w];
|
|
}
|
|
}
|
|
return [
|
|
(parts[1] << 16) | parts[0],
|
|
(parts[3] << 16) | parts[2],
|
|
(parts[5] << 16) | parts[4],
|
|
(parts[7] << 16) | parts[6]
|
|
];
|
|
};
|
|
var DNS = {
|
|
address_map:{
|
|
id:1,
|
|
addrs:{
|
|
},
|
|
names:{
|
|
},
|
|
},
|
|
lookup_name(name) {
|
|
// If the name is already a valid ipv4 / ipv6 address, don't generate a fake one.
|
|
var res = inetPton4(name);
|
|
if (res !== null) {
|
|
return name;
|
|
}
|
|
res = inetPton6(name);
|
|
if (res !== null) {
|
|
return name;
|
|
}
|
|
|
|
// See if this name is already mapped.
|
|
var addr;
|
|
|
|
if (DNS.address_map.addrs[name]) {
|
|
addr = DNS.address_map.addrs[name];
|
|
} else {
|
|
var id = DNS.address_map.id++;
|
|
assert(id < 65535, 'exceeded max address mappings of 65535');
|
|
|
|
addr = '172.29.' + (id & 0xff) + '.' + (id & 0xff00);
|
|
|
|
DNS.address_map.names[addr] = name;
|
|
DNS.address_map.addrs[name] = addr;
|
|
}
|
|
|
|
return addr;
|
|
},
|
|
lookup_addr(addr) {
|
|
if (DNS.address_map.names[addr]) {
|
|
return DNS.address_map.names[addr];
|
|
}
|
|
|
|
return null;
|
|
},
|
|
};
|
|
/** @param {boolean=} allowNull */
|
|
var getSocketAddress = (addrp, addrlen, allowNull) => {
|
|
if (allowNull && addrp === 0) return null;
|
|
var info = readSockaddr(addrp, addrlen);
|
|
if (info.errno) throw new FS.ErrnoError(info.errno);
|
|
info.addr = DNS.lookup_addr(info.addr) || info.addr;
|
|
return info;
|
|
};
|
|
function ___syscall_connect(fd, addr, addrlen, d1, d2, d3) {
|
|
try {
|
|
|
|
var sock = getSocketFromFD(fd);
|
|
var info = getSocketAddress(addr, addrlen);
|
|
sock.sock_ops.connect(sock, info.addr, info.port);
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
|
|
|
|
var SYSCALLS = {
|
|
DEFAULT_POLLMASK:5,
|
|
calculateAt(dirfd, path, allowEmpty) {
|
|
if (PATH.isAbs(path)) {
|
|
return path;
|
|
}
|
|
// relative path
|
|
var dir;
|
|
if (dirfd === -100) {
|
|
dir = FS.cwd();
|
|
} else {
|
|
var dirstream = SYSCALLS.getStreamFromFD(dirfd);
|
|
dir = dirstream.path;
|
|
}
|
|
if (path.length == 0) {
|
|
if (!allowEmpty) {
|
|
throw new FS.ErrnoError(44);;
|
|
}
|
|
return dir;
|
|
}
|
|
return PATH.join2(dir, path);
|
|
},
|
|
doStat(func, path, buf) {
|
|
var stat = func(path);
|
|
HEAP32[((buf)>>2)] = stat.dev;
|
|
HEAP32[(((buf)+(4))>>2)] = stat.mode;
|
|
HEAPU32[(((buf)+(8))>>2)] = stat.nlink;
|
|
HEAP32[(((buf)+(12))>>2)] = stat.uid;
|
|
HEAP32[(((buf)+(16))>>2)] = stat.gid;
|
|
HEAP32[(((buf)+(20))>>2)] = stat.rdev;
|
|
HEAP64[(((buf)+(24))>>3)] = BigInt(stat.size);
|
|
HEAP32[(((buf)+(32))>>2)] = 4096;
|
|
HEAP32[(((buf)+(36))>>2)] = stat.blocks;
|
|
var atime = stat.atime.getTime();
|
|
var mtime = stat.mtime.getTime();
|
|
var ctime = stat.ctime.getTime();
|
|
HEAP64[(((buf)+(40))>>3)] = BigInt(Math.floor(atime / 1000));
|
|
HEAPU32[(((buf)+(48))>>2)] = (atime % 1000) * 1000;
|
|
HEAP64[(((buf)+(56))>>3)] = BigInt(Math.floor(mtime / 1000));
|
|
HEAPU32[(((buf)+(64))>>2)] = (mtime % 1000) * 1000;
|
|
HEAP64[(((buf)+(72))>>3)] = BigInt(Math.floor(ctime / 1000));
|
|
HEAPU32[(((buf)+(80))>>2)] = (ctime % 1000) * 1000;
|
|
HEAP64[(((buf)+(88))>>3)] = BigInt(stat.ino);
|
|
return 0;
|
|
},
|
|
doMsync(addr, stream, len, flags, offset) {
|
|
if (!FS.isFile(stream.node.mode)) {
|
|
throw new FS.ErrnoError(43);
|
|
}
|
|
if (flags & 2) {
|
|
// MAP_PRIVATE calls need not to be synced back to underlying fs
|
|
return 0;
|
|
}
|
|
var buffer = HEAPU8.slice(addr, addr + len);
|
|
FS.msync(stream, buffer, offset, len, flags);
|
|
},
|
|
varargs:undefined,
|
|
get() {
|
|
// the `+` prepended here is necessary to convince the JSCompiler that varargs is indeed a number.
|
|
var ret = HEAP32[((+SYSCALLS.varargs)>>2)];
|
|
SYSCALLS.varargs += 4;
|
|
return ret;
|
|
},
|
|
getp() { return SYSCALLS.get() },
|
|
getStr(ptr) {
|
|
var ret = UTF8ToString(ptr);
|
|
return ret;
|
|
},
|
|
getStreamFromFD(fd) {
|
|
var stream = FS.getStreamChecked(fd);
|
|
return stream;
|
|
},
|
|
};
|
|
function ___syscall_faccessat(dirfd, path, amode, flags) {
|
|
try {
|
|
|
|
path = SYSCALLS.getStr(path);
|
|
path = SYSCALLS.calculateAt(dirfd, path);
|
|
if (amode & ~7) {
|
|
// need a valid mode
|
|
return -28;
|
|
}
|
|
var lookup = FS.lookupPath(path, { follow: true });
|
|
var node = lookup.node;
|
|
if (!node) {
|
|
return -44;
|
|
}
|
|
var perms = '';
|
|
if (amode & 4) perms += 'r';
|
|
if (amode & 2) perms += 'w';
|
|
if (amode & 1) perms += 'x';
|
|
if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) {
|
|
return -2;
|
|
}
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
var ___syscall_fadvise64 = (fd, offset, len, advice) => {
|
|
return 0; // your advice is important to us (but we can't use it)
|
|
};
|
|
|
|
function ___syscall_fcntl64(fd, cmd, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
|
|
var stream = SYSCALLS.getStreamFromFD(fd);
|
|
switch (cmd) {
|
|
case 0: {
|
|
var arg = SYSCALLS.get();
|
|
if (arg < 0) {
|
|
return -28;
|
|
}
|
|
while (FS.streams[arg]) {
|
|
arg++;
|
|
}
|
|
var newStream;
|
|
newStream = FS.dupStream(stream, arg);
|
|
return newStream.fd;
|
|
}
|
|
case 1:
|
|
case 2:
|
|
return 0; // FD_CLOEXEC makes no sense for a single process.
|
|
case 3:
|
|
return stream.flags;
|
|
case 4: {
|
|
var arg = SYSCALLS.get();
|
|
stream.flags |= arg;
|
|
return 0;
|
|
}
|
|
case 12: {
|
|
var arg = SYSCALLS.getp();
|
|
var offset = 0;
|
|
// We're always unlocked.
|
|
HEAP16[(((arg)+(offset))>>1)] = 2;
|
|
return 0;
|
|
}
|
|
case 13:
|
|
case 14:
|
|
return 0; // Pretend that the locking is successful.
|
|
}
|
|
return -28;
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
function ___syscall_fstat64(fd, buf) {
|
|
try {
|
|
|
|
var stream = SYSCALLS.getStreamFromFD(fd);
|
|
return SYSCALLS.doStat(FS.stat, stream.path, buf);
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
function ___syscall_statfs64(path, size, buf) {
|
|
try {
|
|
|
|
path = SYSCALLS.getStr(path);
|
|
// NOTE: None of the constants here are true. We're just returning safe and
|
|
// sane values.
|
|
HEAP32[(((buf)+(4))>>2)] = 4096;
|
|
HEAP32[(((buf)+(40))>>2)] = 4096;
|
|
HEAP32[(((buf)+(8))>>2)] = 1000000;
|
|
HEAP32[(((buf)+(12))>>2)] = 500000;
|
|
HEAP32[(((buf)+(16))>>2)] = 500000;
|
|
HEAP32[(((buf)+(20))>>2)] = FS.nextInode;
|
|
HEAP32[(((buf)+(24))>>2)] = 1000000;
|
|
HEAP32[(((buf)+(28))>>2)] = 42;
|
|
HEAP32[(((buf)+(44))>>2)] = 2; // ST_NOSUID
|
|
HEAP32[(((buf)+(36))>>2)] = 255;
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
function ___syscall_fstatfs64(fd, size, buf) {
|
|
try {
|
|
|
|
var stream = SYSCALLS.getStreamFromFD(fd);
|
|
return ___syscall_statfs64(0, size, buf);
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
var MAX_INT53 = 9007199254740992;
|
|
|
|
var MIN_INT53 = -9007199254740992;
|
|
var bigintToI53Checked = (num) => (num < MIN_INT53 || num > MAX_INT53) ? NaN : Number(num);
|
|
function ___syscall_ftruncate64(fd, length) {
|
|
length = bigintToI53Checked(length);
|
|
|
|
|
|
try {
|
|
|
|
if (isNaN(length)) return 61;
|
|
FS.ftruncate(fd, length);
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return -e.errno;
|
|
}
|
|
;
|
|
}
|
|
|
|
|
|
var stringToUTF8 = (str, outPtr, maxBytesToWrite) => {
|
|
return stringToUTF8Array(str, HEAPU8, outPtr, maxBytesToWrite);
|
|
};
|
|
function ___syscall_getcwd(buf, size) {
|
|
try {
|
|
|
|
if (size === 0) return -28;
|
|
var cwd = FS.cwd();
|
|
var cwdLengthInBytes = lengthBytesUTF8(cwd) + 1;
|
|
if (size < cwdLengthInBytes) return -68;
|
|
stringToUTF8(cwd, buf, size);
|
|
return cwdLengthInBytes;
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
|
|
function ___syscall_getdents64(fd, dirp, count) {
|
|
try {
|
|
|
|
var stream = SYSCALLS.getStreamFromFD(fd)
|
|
stream.getdents ||= FS.readdir(stream.path);
|
|
|
|
var struct_size = 280;
|
|
var pos = 0;
|
|
var off = FS.llseek(stream, 0, 1);
|
|
|
|
var idx = Math.floor(off / struct_size);
|
|
|
|
while (idx < stream.getdents.length && pos + struct_size <= count) {
|
|
var id;
|
|
var type;
|
|
var name = stream.getdents[idx];
|
|
if (name === '.') {
|
|
id = stream.node.id;
|
|
type = 4; // DT_DIR
|
|
}
|
|
else if (name === '..') {
|
|
var lookup = FS.lookupPath(stream.path, { parent: true });
|
|
id = lookup.node.id;
|
|
type = 4; // DT_DIR
|
|
}
|
|
else {
|
|
var child = FS.lookupNode(stream.node, name);
|
|
id = child.id;
|
|
type = FS.isChrdev(child.mode) ? 2 : // DT_CHR, character device.
|
|
FS.isDir(child.mode) ? 4 : // DT_DIR, directory.
|
|
FS.isLink(child.mode) ? 10 : // DT_LNK, symbolic link.
|
|
8; // DT_REG, regular file.
|
|
}
|
|
HEAP64[((dirp + pos)>>3)] = BigInt(id);
|
|
HEAP64[(((dirp + pos)+(8))>>3)] = BigInt((idx + 1) * struct_size);
|
|
HEAP16[(((dirp + pos)+(16))>>1)] = 280;
|
|
HEAP8[(dirp + pos)+(18)] = type;
|
|
stringToUTF8(name, dirp + pos + 19, 256);
|
|
pos += struct_size;
|
|
idx += 1;
|
|
}
|
|
FS.llseek(stream, idx * struct_size, 0);
|
|
return pos;
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
function ___syscall_ioctl(fd, op, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
|
|
var stream = SYSCALLS.getStreamFromFD(fd);
|
|
switch (op) {
|
|
case 21509: {
|
|
if (!stream.tty) return -59;
|
|
return 0;
|
|
}
|
|
case 21505: {
|
|
if (!stream.tty) return -59;
|
|
if (stream.tty.ops.ioctl_tcgets) {
|
|
var termios = stream.tty.ops.ioctl_tcgets(stream);
|
|
var argp = SYSCALLS.getp();
|
|
HEAP32[((argp)>>2)] = termios.c_iflag || 0;
|
|
HEAP32[(((argp)+(4))>>2)] = termios.c_oflag || 0;
|
|
HEAP32[(((argp)+(8))>>2)] = termios.c_cflag || 0;
|
|
HEAP32[(((argp)+(12))>>2)] = termios.c_lflag || 0;
|
|
for (var i = 0; i < 32; i++) {
|
|
HEAP8[(argp + i)+(17)] = termios.c_cc[i] || 0;
|
|
}
|
|
return 0;
|
|
}
|
|
return 0;
|
|
}
|
|
case 21510:
|
|
case 21511:
|
|
case 21512: {
|
|
if (!stream.tty) return -59;
|
|
return 0; // no-op, not actually adjusting terminal settings
|
|
}
|
|
case 21506:
|
|
case 21507:
|
|
case 21508: {
|
|
if (!stream.tty) return -59;
|
|
if (stream.tty.ops.ioctl_tcsets) {
|
|
var argp = SYSCALLS.getp();
|
|
var c_iflag = HEAP32[((argp)>>2)];
|
|
var c_oflag = HEAP32[(((argp)+(4))>>2)];
|
|
var c_cflag = HEAP32[(((argp)+(8))>>2)];
|
|
var c_lflag = HEAP32[(((argp)+(12))>>2)];
|
|
var c_cc = []
|
|
for (var i = 0; i < 32; i++) {
|
|
c_cc.push(HEAP8[(argp + i)+(17)]);
|
|
}
|
|
return stream.tty.ops.ioctl_tcsets(stream.tty, op, { c_iflag, c_oflag, c_cflag, c_lflag, c_cc });
|
|
}
|
|
return 0; // no-op, not actually adjusting terminal settings
|
|
}
|
|
case 21519: {
|
|
if (!stream.tty) return -59;
|
|
var argp = SYSCALLS.getp();
|
|
HEAP32[((argp)>>2)] = 0;
|
|
return 0;
|
|
}
|
|
case 21520: {
|
|
if (!stream.tty) return -59;
|
|
return -28; // not supported
|
|
}
|
|
case 21531: {
|
|
var argp = SYSCALLS.getp();
|
|
return FS.ioctl(stream, op, argp);
|
|
}
|
|
case 21523: {
|
|
// TODO: in theory we should write to the winsize struct that gets
|
|
// passed in, but for now musl doesn't read anything on it
|
|
if (!stream.tty) return -59;
|
|
if (stream.tty.ops.ioctl_tiocgwinsz) {
|
|
var winsize = stream.tty.ops.ioctl_tiocgwinsz(stream.tty);
|
|
var argp = SYSCALLS.getp();
|
|
HEAP16[((argp)>>1)] = winsize[0];
|
|
HEAP16[(((argp)+(2))>>1)] = winsize[1];
|
|
}
|
|
return 0;
|
|
}
|
|
case 21524: {
|
|
// TODO: technically, this ioctl call should change the window size.
|
|
// but, since emscripten doesn't have any concept of a terminal window
|
|
// yet, we'll just silently throw it away as we do TIOCGWINSZ
|
|
if (!stream.tty) return -59;
|
|
return 0;
|
|
}
|
|
case 21515: {
|
|
if (!stream.tty) return -59;
|
|
return 0;
|
|
}
|
|
default: return -28; // not supported
|
|
}
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
function ___syscall_lstat64(path, buf) {
|
|
try {
|
|
|
|
path = SYSCALLS.getStr(path);
|
|
return SYSCALLS.doStat(FS.lstat, path, buf);
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
function ___syscall_newfstatat(dirfd, path, buf, flags) {
|
|
try {
|
|
|
|
path = SYSCALLS.getStr(path);
|
|
var nofollow = flags & 256;
|
|
var allowEmpty = flags & 4096;
|
|
flags = flags & (~6400);
|
|
path = SYSCALLS.calculateAt(dirfd, path, allowEmpty);
|
|
return SYSCALLS.doStat(nofollow ? FS.lstat : FS.stat, path, buf);
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
function ___syscall_openat(dirfd, path, flags, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
|
|
path = SYSCALLS.getStr(path);
|
|
path = SYSCALLS.calculateAt(dirfd, path);
|
|
var mode = varargs ? SYSCALLS.get() : 0;
|
|
return FS.open(path, flags, mode).fd;
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
|
|
|
|
function ___syscall_readlinkat(dirfd, path, buf, bufsize) {
|
|
try {
|
|
|
|
path = SYSCALLS.getStr(path);
|
|
path = SYSCALLS.calculateAt(dirfd, path);
|
|
if (bufsize <= 0) return -28;
|
|
var ret = FS.readlink(path);
|
|
|
|
var len = Math.min(bufsize, lengthBytesUTF8(ret));
|
|
var endChar = HEAP8[buf+len];
|
|
stringToUTF8(ret, buf, bufsize+1);
|
|
// readlink is one of the rare functions that write out a C string, but does never append a null to the output buffer(!)
|
|
// stringToUTF8() always appends a null byte, so restore the character under the null byte after the write.
|
|
HEAP8[buf+len] = endChar;
|
|
return len;
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
|
|
function ___syscall_sendto(fd, message, length, flags, addr, addr_len) {
|
|
try {
|
|
|
|
var sock = getSocketFromFD(fd);
|
|
var dest = getSocketAddress(addr, addr_len, true);
|
|
if (!dest) {
|
|
// send, no address provided
|
|
return FS.write(sock.stream, HEAP8, message, length);
|
|
}
|
|
// sendto an address
|
|
return sock.sock_ops.sendmsg(sock, HEAP8, message, length, dest.addr, dest.port);
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
function ___syscall_socket(domain, type, protocol) {
|
|
try {
|
|
|
|
var sock = SOCKFS.createSocket(domain, type, protocol);
|
|
return sock.stream.fd;
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
function ___syscall_stat64(path, buf) {
|
|
try {
|
|
|
|
path = SYSCALLS.getStr(path);
|
|
return SYSCALLS.doStat(FS.stat, path, buf);
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
function ___syscall_unlinkat(dirfd, path, flags) {
|
|
try {
|
|
|
|
path = SYSCALLS.getStr(path);
|
|
path = SYSCALLS.calculateAt(dirfd, path);
|
|
if (flags === 0) {
|
|
FS.unlink(path);
|
|
} else if (flags === 512) {
|
|
FS.rmdir(path);
|
|
} else {
|
|
abort('Invalid flags passed to unlinkat');
|
|
}
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
var nowIsMonotonic = 1;
|
|
var __emscripten_get_now_is_monotonic = () => nowIsMonotonic;
|
|
|
|
function __gmtime_js(time, tmPtr) {
|
|
time = bigintToI53Checked(time);
|
|
|
|
|
|
var date = new Date(time * 1000);
|
|
HEAP32[((tmPtr)>>2)] = date.getUTCSeconds();
|
|
HEAP32[(((tmPtr)+(4))>>2)] = date.getUTCMinutes();
|
|
HEAP32[(((tmPtr)+(8))>>2)] = date.getUTCHours();
|
|
HEAP32[(((tmPtr)+(12))>>2)] = date.getUTCDate();
|
|
HEAP32[(((tmPtr)+(16))>>2)] = date.getUTCMonth();
|
|
HEAP32[(((tmPtr)+(20))>>2)] = date.getUTCFullYear()-1900;
|
|
HEAP32[(((tmPtr)+(24))>>2)] = date.getUTCDay();
|
|
var start = Date.UTC(date.getUTCFullYear(), 0, 1, 0, 0, 0, 0);
|
|
var yday = ((date.getTime() - start) / (1000 * 60 * 60 * 24))|0;
|
|
HEAP32[(((tmPtr)+(28))>>2)] = yday;
|
|
;
|
|
}
|
|
|
|
var isLeapYear = (year) => year%4 === 0 && (year%100 !== 0 || year%400 === 0);
|
|
|
|
var MONTH_DAYS_LEAP_CUMULATIVE = [0,31,60,91,121,152,182,213,244,274,305,335];
|
|
|
|
var MONTH_DAYS_REGULAR_CUMULATIVE = [0,31,59,90,120,151,181,212,243,273,304,334];
|
|
var ydayFromDate = (date) => {
|
|
var leap = isLeapYear(date.getFullYear());
|
|
var monthDaysCumulative = (leap ? MONTH_DAYS_LEAP_CUMULATIVE : MONTH_DAYS_REGULAR_CUMULATIVE);
|
|
var yday = monthDaysCumulative[date.getMonth()] + date.getDate() - 1; // -1 since it's days since Jan 1
|
|
|
|
return yday;
|
|
};
|
|
|
|
function __localtime_js(time, tmPtr) {
|
|
time = bigintToI53Checked(time);
|
|
|
|
|
|
var date = new Date(time*1000);
|
|
HEAP32[((tmPtr)>>2)] = date.getSeconds();
|
|
HEAP32[(((tmPtr)+(4))>>2)] = date.getMinutes();
|
|
HEAP32[(((tmPtr)+(8))>>2)] = date.getHours();
|
|
HEAP32[(((tmPtr)+(12))>>2)] = date.getDate();
|
|
HEAP32[(((tmPtr)+(16))>>2)] = date.getMonth();
|
|
HEAP32[(((tmPtr)+(20))>>2)] = date.getFullYear()-1900;
|
|
HEAP32[(((tmPtr)+(24))>>2)] = date.getDay();
|
|
|
|
var yday = ydayFromDate(date)|0;
|
|
HEAP32[(((tmPtr)+(28))>>2)] = yday;
|
|
HEAP32[(((tmPtr)+(36))>>2)] = -(date.getTimezoneOffset() * 60);
|
|
|
|
// Attention: DST is in December in South, and some regions don't have DST at all.
|
|
var start = new Date(date.getFullYear(), 0, 1);
|
|
var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset();
|
|
var winterOffset = start.getTimezoneOffset();
|
|
var dst = (summerOffset != winterOffset && date.getTimezoneOffset() == Math.min(winterOffset, summerOffset))|0;
|
|
HEAP32[(((tmPtr)+(32))>>2)] = dst;
|
|
;
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function __mmap_js(len, prot, flags, fd, offset, allocated, addr) {
|
|
offset = bigintToI53Checked(offset);
|
|
|
|
|
|
try {
|
|
|
|
if (isNaN(offset)) return 61;
|
|
var stream = SYSCALLS.getStreamFromFD(fd);
|
|
var res = FS.mmap(stream, len, offset, prot, flags);
|
|
var ptr = res.ptr;
|
|
HEAP32[((allocated)>>2)] = res.allocated;
|
|
HEAPU32[((addr)>>2)] = ptr;
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return -e.errno;
|
|
}
|
|
;
|
|
}
|
|
|
|
|
|
function __munmap_js(addr, len, prot, flags, fd, offset) {
|
|
offset = bigintToI53Checked(offset);
|
|
|
|
|
|
try {
|
|
|
|
var stream = SYSCALLS.getStreamFromFD(fd);
|
|
if (prot & 2) {
|
|
SYSCALLS.doMsync(addr, stream, len, flags, offset);
|
|
}
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return -e.errno;
|
|
}
|
|
;
|
|
}
|
|
|
|
var __tzset_js = (timezone, daylight, std_name, dst_name) => {
|
|
// TODO: Use (malleable) environment variables instead of system settings.
|
|
var currentYear = new Date().getFullYear();
|
|
var winter = new Date(currentYear, 0, 1);
|
|
var summer = new Date(currentYear, 6, 1);
|
|
var winterOffset = winter.getTimezoneOffset();
|
|
var summerOffset = summer.getTimezoneOffset();
|
|
|
|
// Local standard timezone offset. Local standard time is not adjusted for
|
|
// daylight savings. This code uses the fact that getTimezoneOffset returns
|
|
// a greater value during Standard Time versus Daylight Saving Time (DST).
|
|
// Thus it determines the expected output during Standard Time, and it
|
|
// compares whether the output of the given date the same (Standard) or less
|
|
// (DST).
|
|
var stdTimezoneOffset = Math.max(winterOffset, summerOffset);
|
|
|
|
// timezone is specified as seconds west of UTC ("The external variable
|
|
// `timezone` shall be set to the difference, in seconds, between
|
|
// Coordinated Universal Time (UTC) and local standard time."), the same
|
|
// as returned by stdTimezoneOffset.
|
|
// See http://pubs.opengroup.org/onlinepubs/009695399/functions/tzset.html
|
|
HEAPU32[((timezone)>>2)] = stdTimezoneOffset * 60;
|
|
|
|
HEAP32[((daylight)>>2)] = Number(winterOffset != summerOffset);
|
|
|
|
function extractZone(date) {
|
|
var match = date.toTimeString().match(/\(([A-Za-z ]+)\)$/);
|
|
return match ? match[1] : "GMT";
|
|
};
|
|
var winterName = extractZone(winter);
|
|
var summerName = extractZone(summer);
|
|
if (summerOffset < winterOffset) {
|
|
// Northern hemisphere
|
|
stringToUTF8(winterName, std_name, 7);
|
|
stringToUTF8(summerName, dst_name, 7);
|
|
} else {
|
|
stringToUTF8(winterName, dst_name, 7);
|
|
stringToUTF8(summerName, std_name, 7);
|
|
}
|
|
};
|
|
|
|
var _abort = () => {
|
|
abort('');
|
|
};
|
|
|
|
var _emscripten_date_now = () => Date.now();
|
|
|
|
|
|
var runtimeKeepaliveCounter = 0;
|
|
var keepRuntimeAlive = () => noExitRuntime || runtimeKeepaliveCounter > 0;
|
|
var _proc_exit = (code) => {
|
|
EXITSTATUS = code;
|
|
if (!keepRuntimeAlive()) {
|
|
Module['onExit']?.(code);
|
|
ABORT = true;
|
|
}
|
|
quit_(code, new ExitStatus(code));
|
|
};
|
|
|
|
/** @suppress {duplicate } */
|
|
/** @param {boolean|number=} implicit */
|
|
var exitJS = (status, implicit) => {
|
|
EXITSTATUS = status;
|
|
|
|
if (!keepRuntimeAlive()) {
|
|
exitRuntime();
|
|
}
|
|
|
|
_proc_exit(status);
|
|
};
|
|
var _exit = exitJS;
|
|
|
|
var __emscripten_runtime_keepalive_clear = () => {
|
|
noExitRuntime = false;
|
|
runtimeKeepaliveCounter = 0;
|
|
};
|
|
|
|
var _emscripten_force_exit = (status) => {
|
|
__emscripten_runtime_keepalive_clear();
|
|
_exit(status);
|
|
};
|
|
Module['_emscripten_force_exit'] = _emscripten_force_exit;
|
|
|
|
var getHeapMax = () =>
|
|
// Stay one Wasm page short of 4GB: while e.g. Chrome is able to allocate
|
|
// full 4GB Wasm memories, the size will wrap back to 0 bytes in Wasm side
|
|
// for any code that deals with heap sizes, which would require special
|
|
// casing all heap size related code to treat 0 specially.
|
|
2147483648;
|
|
var _emscripten_get_heap_max = () => getHeapMax();
|
|
|
|
var _emscripten_get_now;
|
|
// Modern environment where performance.now() is supported:
|
|
// N.B. a shorter form "_emscripten_get_now = performance.now;" is
|
|
// unfortunately not allowed even in current browsers (e.g. FF Nightly 75).
|
|
_emscripten_get_now = () => performance.now();
|
|
;
|
|
|
|
var _emscripten_get_now_res = () => { // return resolution of get_now, in nanoseconds
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
return 1; // nanoseconds
|
|
}
|
|
// Modern environment where performance.now() is supported:
|
|
return 1000; // microseconds (1/1000 of a millisecond)
|
|
};
|
|
|
|
var webgl_enable_ANGLE_instanced_arrays = (ctx) => {
|
|
// Extension available in WebGL 1 from Firefox 26 and Google Chrome 30 onwards. Core feature in WebGL 2.
|
|
var ext = ctx.getExtension('ANGLE_instanced_arrays');
|
|
if (ext) {
|
|
ctx['vertexAttribDivisor'] = (index, divisor) => ext['vertexAttribDivisorANGLE'](index, divisor);
|
|
ctx['drawArraysInstanced'] = (mode, first, count, primcount) => ext['drawArraysInstancedANGLE'](mode, first, count, primcount);
|
|
ctx['drawElementsInstanced'] = (mode, count, type, indices, primcount) => ext['drawElementsInstancedANGLE'](mode, count, type, indices, primcount);
|
|
return 1;
|
|
}
|
|
};
|
|
|
|
var webgl_enable_OES_vertex_array_object = (ctx) => {
|
|
// Extension available in WebGL 1 from Firefox 25 and WebKit 536.28/desktop Safari 6.0.3 onwards. Core feature in WebGL 2.
|
|
var ext = ctx.getExtension('OES_vertex_array_object');
|
|
if (ext) {
|
|
ctx['createVertexArray'] = () => ext['createVertexArrayOES']();
|
|
ctx['deleteVertexArray'] = (vao) => ext['deleteVertexArrayOES'](vao);
|
|
ctx['bindVertexArray'] = (vao) => ext['bindVertexArrayOES'](vao);
|
|
ctx['isVertexArray'] = (vao) => ext['isVertexArrayOES'](vao);
|
|
return 1;
|
|
}
|
|
};
|
|
|
|
var webgl_enable_WEBGL_draw_buffers = (ctx) => {
|
|
// Extension available in WebGL 1 from Firefox 28 onwards. Core feature in WebGL 2.
|
|
var ext = ctx.getExtension('WEBGL_draw_buffers');
|
|
if (ext) {
|
|
ctx['drawBuffers'] = (n, bufs) => ext['drawBuffersWEBGL'](n, bufs);
|
|
return 1;
|
|
}
|
|
};
|
|
|
|
var webgl_enable_WEBGL_draw_instanced_base_vertex_base_instance = (ctx) =>
|
|
// Closure is expected to be allowed to minify the '.dibvbi' property, so not accessing it quoted.
|
|
!!(ctx.dibvbi = ctx.getExtension('WEBGL_draw_instanced_base_vertex_base_instance'));
|
|
|
|
var webgl_enable_WEBGL_multi_draw_instanced_base_vertex_base_instance = (ctx) => {
|
|
// Closure is expected to be allowed to minify the '.mdibvbi' property, so not accessing it quoted.
|
|
return !!(ctx.mdibvbi = ctx.getExtension('WEBGL_multi_draw_instanced_base_vertex_base_instance'));
|
|
};
|
|
|
|
var webgl_enable_WEBGL_multi_draw = (ctx) => {
|
|
// Closure is expected to be allowed to minify the '.multiDrawWebgl' property, so not accessing it quoted.
|
|
return !!(ctx.multiDrawWebgl = ctx.getExtension('WEBGL_multi_draw'));
|
|
};
|
|
|
|
var getEmscriptenSupportedExtensions = (ctx) => {
|
|
// Restrict the list of advertised extensions to those that we actually
|
|
// support.
|
|
var supportedExtensions = [
|
|
// WebGL 1 extensions
|
|
'ANGLE_instanced_arrays',
|
|
'EXT_blend_minmax',
|
|
'EXT_disjoint_timer_query',
|
|
'EXT_frag_depth',
|
|
'EXT_shader_texture_lod',
|
|
'EXT_sRGB',
|
|
'OES_element_index_uint',
|
|
'OES_fbo_render_mipmap',
|
|
'OES_standard_derivatives',
|
|
'OES_texture_float',
|
|
'OES_texture_half_float',
|
|
'OES_texture_half_float_linear',
|
|
'OES_vertex_array_object',
|
|
'WEBGL_color_buffer_float',
|
|
'WEBGL_depth_texture',
|
|
'WEBGL_draw_buffers',
|
|
// WebGL 2 extensions
|
|
'EXT_color_buffer_float',
|
|
'EXT_conservative_depth',
|
|
'EXT_disjoint_timer_query_webgl2',
|
|
'EXT_texture_norm16',
|
|
'NV_shader_noperspective_interpolation',
|
|
'WEBGL_clip_cull_distance',
|
|
// WebGL 1 and WebGL 2 extensions
|
|
'EXT_color_buffer_half_float',
|
|
'EXT_depth_clamp',
|
|
'EXT_float_blend',
|
|
'EXT_texture_compression_bptc',
|
|
'EXT_texture_compression_rgtc',
|
|
'EXT_texture_filter_anisotropic',
|
|
'KHR_parallel_shader_compile',
|
|
'OES_texture_float_linear',
|
|
'WEBGL_blend_func_extended',
|
|
'WEBGL_compressed_texture_astc',
|
|
'WEBGL_compressed_texture_etc',
|
|
'WEBGL_compressed_texture_etc1',
|
|
'WEBGL_compressed_texture_s3tc',
|
|
'WEBGL_compressed_texture_s3tc_srgb',
|
|
'WEBGL_debug_renderer_info',
|
|
'WEBGL_debug_shaders',
|
|
'WEBGL_lose_context',
|
|
'WEBGL_multi_draw',
|
|
];
|
|
// .getSupportedExtensions() can return null if context is lost, so coerce to empty array.
|
|
return (ctx.getSupportedExtensions() || []).filter(ext => supportedExtensions.includes(ext));
|
|
};
|
|
|
|
|
|
var GL = {
|
|
counter:1,
|
|
buffers:[],
|
|
programs:[],
|
|
framebuffers:[],
|
|
renderbuffers:[],
|
|
textures:[],
|
|
shaders:[],
|
|
vaos:[],
|
|
contexts:[],
|
|
offscreenCanvases:{
|
|
},
|
|
queries:[],
|
|
samplers:[],
|
|
transformFeedbacks:[],
|
|
syncs:[],
|
|
stringCache:{
|
|
},
|
|
stringiCache:{
|
|
},
|
|
unpackAlignment:4,
|
|
recordError:(errorCode) => {
|
|
if (!GL.lastError) {
|
|
GL.lastError = errorCode;
|
|
}
|
|
},
|
|
getNewId:(table) => {
|
|
var ret = GL.counter++;
|
|
for (var i = table.length; i < ret; i++) {
|
|
table[i] = null;
|
|
}
|
|
return ret;
|
|
},
|
|
genObject:(n, buffers, createFunction, objectTable
|
|
) => {
|
|
for (var i = 0; i < n; i++) {
|
|
var buffer = GLctx[createFunction]();
|
|
var id = buffer && GL.getNewId(objectTable);
|
|
if (buffer) {
|
|
buffer.name = id;
|
|
objectTable[id] = buffer;
|
|
} else {
|
|
GL.recordError(0x502 /* GL_INVALID_OPERATION */);
|
|
}
|
|
HEAP32[(((buffers)+(i*4))>>2)] = id;
|
|
}
|
|
},
|
|
getSource:(shader, count, string, length) => {
|
|
var source = '';
|
|
for (var i = 0; i < count; ++i) {
|
|
var len = length ? HEAPU32[(((length)+(i*4))>>2)] : undefined;
|
|
source += UTF8ToString(HEAPU32[(((string)+(i*4))>>2)], len);
|
|
}
|
|
return source;
|
|
},
|
|
createContext:(/** @type {HTMLCanvasElement} */ canvas, webGLContextAttributes) => {
|
|
|
|
// BUG: Workaround Safari WebGL issue: After successfully acquiring WebGL
|
|
// context on a canvas, calling .getContext() will always return that
|
|
// context independent of which 'webgl' or 'webgl2'
|
|
// context version was passed. See:
|
|
// https://bugs.webkit.org/show_bug.cgi?id=222758
|
|
// and:
|
|
// https://github.com/emscripten-core/emscripten/issues/13295.
|
|
// TODO: Once the bug is fixed and shipped in Safari, adjust the Safari
|
|
// version field in above check.
|
|
if (!canvas.getContextSafariWebGL2Fixed) {
|
|
canvas.getContextSafariWebGL2Fixed = canvas.getContext;
|
|
/** @type {function(this:HTMLCanvasElement, string, (Object|null)=): (Object|null)} */
|
|
function fixedGetContext(ver, attrs) {
|
|
var gl = canvas.getContextSafariWebGL2Fixed(ver, attrs);
|
|
return ((ver == 'webgl') == (gl instanceof WebGLRenderingContext)) ? gl : null;
|
|
}
|
|
canvas.getContext = fixedGetContext;
|
|
}
|
|
|
|
var ctx =
|
|
(webGLContextAttributes.majorVersion > 1)
|
|
?
|
|
canvas.getContext("webgl2", webGLContextAttributes)
|
|
:
|
|
(canvas.getContext("webgl", webGLContextAttributes)
|
|
// https://caniuse.com/#feat=webgl
|
|
);
|
|
|
|
if (!ctx) return 0;
|
|
|
|
var handle = GL.registerContext(ctx, webGLContextAttributes);
|
|
|
|
return handle;
|
|
},
|
|
registerContext:(ctx, webGLContextAttributes) => {
|
|
// without pthreads a context is just an integer ID
|
|
var handle = GL.getNewId(GL.contexts);
|
|
|
|
var context = {
|
|
handle,
|
|
attributes: webGLContextAttributes,
|
|
version: webGLContextAttributes.majorVersion,
|
|
GLctx: ctx
|
|
};
|
|
|
|
// Store the created context object so that we can access the context
|
|
// given a canvas without having to pass the parameters again.
|
|
if (ctx.canvas) ctx.canvas.GLctxObject = context;
|
|
GL.contexts[handle] = context;
|
|
if (typeof webGLContextAttributes.enableExtensionsByDefault == 'undefined' || webGLContextAttributes.enableExtensionsByDefault) {
|
|
GL.initExtensions(context);
|
|
}
|
|
|
|
return handle;
|
|
},
|
|
makeContextCurrent:(contextHandle) => {
|
|
|
|
// Active Emscripten GL layer context object.
|
|
GL.currentContext = GL.contexts[contextHandle];
|
|
// Active WebGL context object.
|
|
Module.ctx = GLctx = GL.currentContext?.GLctx;
|
|
return !(contextHandle && !GLctx);
|
|
},
|
|
getContext:(contextHandle) => {
|
|
return GL.contexts[contextHandle];
|
|
},
|
|
deleteContext:(contextHandle) => {
|
|
if (GL.currentContext === GL.contexts[contextHandle]) {
|
|
GL.currentContext = null;
|
|
}
|
|
if (typeof JSEvents == 'object') {
|
|
// Release all JS event handlers on the DOM element that the GL context is
|
|
// associated with since the context is now deleted.
|
|
JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas);
|
|
}
|
|
// Make sure the canvas object no longer refers to the context object so
|
|
// there are no GC surprises.
|
|
if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) {
|
|
GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined;
|
|
}
|
|
GL.contexts[contextHandle] = null;
|
|
},
|
|
initExtensions:(context) => {
|
|
// If this function is called without a specific context object, init the
|
|
// extensions of the currently active context.
|
|
context ||= GL.currentContext;
|
|
|
|
if (context.initExtensionsDone) return;
|
|
context.initExtensionsDone = true;
|
|
|
|
var GLctx = context.GLctx;
|
|
|
|
// Detect the presence of a few extensions manually, ction GL interop
|
|
// layer itself will need to know if they exist.
|
|
|
|
// Extensions that are only available in WebGL 1 (the calls will be no-ops
|
|
// if called on a WebGL 2 context active)
|
|
webgl_enable_ANGLE_instanced_arrays(GLctx);
|
|
webgl_enable_OES_vertex_array_object(GLctx);
|
|
webgl_enable_WEBGL_draw_buffers(GLctx);
|
|
// Extensions that are available from WebGL >= 2 (no-op if called on a WebGL 1 context active)
|
|
webgl_enable_WEBGL_draw_instanced_base_vertex_base_instance(GLctx);
|
|
webgl_enable_WEBGL_multi_draw_instanced_base_vertex_base_instance(GLctx);
|
|
|
|
// On WebGL 2, EXT_disjoint_timer_query is replaced with an alternative
|
|
// that's based on core APIs, and exposes only the queryCounterEXT()
|
|
// entrypoint.
|
|
if (context.version >= 2) {
|
|
GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query_webgl2");
|
|
}
|
|
|
|
// However, Firefox exposes the WebGL 1 version on WebGL 2 as well and
|
|
// thus we look for the WebGL 1 version again if the WebGL 2 version
|
|
// isn't present. https://bugzilla.mozilla.org/show_bug.cgi?id=1328882
|
|
if (context.version < 2 || !GLctx.disjointTimerQueryExt)
|
|
{
|
|
GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query");
|
|
}
|
|
|
|
webgl_enable_WEBGL_multi_draw(GLctx);
|
|
|
|
getEmscriptenSupportedExtensions(GLctx).forEach((ext) => {
|
|
// WEBGL_lose_context, WEBGL_debug_renderer_info and WEBGL_debug_shaders
|
|
// are not enabled by default.
|
|
if (!ext.includes('lose_context') && !ext.includes('debug')) {
|
|
// Call .getExtension() to enable that extension permanently.
|
|
GLctx.getExtension(ext);
|
|
}
|
|
});
|
|
},
|
|
};
|
|
/** @suppress {duplicate } */
|
|
var _glActiveTexture = (x0) => GLctx.activeTexture(x0);
|
|
var _emscripten_glActiveTexture = _glActiveTexture;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glAttachShader = (program, shader) => {
|
|
GLctx.attachShader(GL.programs[program], GL.shaders[shader]);
|
|
};
|
|
var _emscripten_glAttachShader = _glAttachShader;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glBeginQuery = (target, id) => {
|
|
GLctx.beginQuery(target, GL.queries[id]);
|
|
};
|
|
var _emscripten_glBeginQuery = _glBeginQuery;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glBeginQueryEXT = (target, id) => {
|
|
GLctx.disjointTimerQueryExt['beginQueryEXT'](target, GL.queries[id]);
|
|
};
|
|
var _emscripten_glBeginQueryEXT = _glBeginQueryEXT;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glBeginTransformFeedback = (x0) => GLctx.beginTransformFeedback(x0);
|
|
var _emscripten_glBeginTransformFeedback = _glBeginTransformFeedback;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glBindAttribLocation = (program, index, name) => {
|
|
GLctx.bindAttribLocation(GL.programs[program], index, UTF8ToString(name));
|
|
};
|
|
var _emscripten_glBindAttribLocation = _glBindAttribLocation;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glBindBuffer = (target, buffer) => {
|
|
|
|
if (target == 0x88EB /*GL_PIXEL_PACK_BUFFER*/) {
|
|
// In WebGL 2 glReadPixels entry point, we need to use a different WebGL 2
|
|
// API function call when a buffer is bound to
|
|
// GL_PIXEL_PACK_BUFFER_BINDING point, so must keep track whether that
|
|
// binding point is non-null to know what is the proper API function to
|
|
// call.
|
|
GLctx.currentPixelPackBufferBinding = buffer;
|
|
} else if (target == 0x88EC /*GL_PIXEL_UNPACK_BUFFER*/) {
|
|
// In WebGL 2 gl(Compressed)Tex(Sub)Image[23]D entry points, we need to
|
|
// use a different WebGL 2 API function call when a buffer is bound to
|
|
// GL_PIXEL_UNPACK_BUFFER_BINDING point, so must keep track whether that
|
|
// binding point is non-null to know what is the proper API function to
|
|
// call.
|
|
GLctx.currentPixelUnpackBufferBinding = buffer;
|
|
}
|
|
GLctx.bindBuffer(target, GL.buffers[buffer]);
|
|
};
|
|
var _emscripten_glBindBuffer = _glBindBuffer;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glBindBufferBase = (target, index, buffer) => {
|
|
GLctx.bindBufferBase(target, index, GL.buffers[buffer]);
|
|
};
|
|
var _emscripten_glBindBufferBase = _glBindBufferBase;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glBindBufferRange = (target, index, buffer, offset, ptrsize) => {
|
|
GLctx.bindBufferRange(target, index, GL.buffers[buffer], offset, ptrsize);
|
|
};
|
|
var _emscripten_glBindBufferRange = _glBindBufferRange;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glBindFramebuffer = (target, framebuffer) => {
|
|
|
|
GLctx.bindFramebuffer(target, GL.framebuffers[framebuffer]);
|
|
|
|
};
|
|
var _emscripten_glBindFramebuffer = _glBindFramebuffer;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glBindRenderbuffer = (target, renderbuffer) => {
|
|
GLctx.bindRenderbuffer(target, GL.renderbuffers[renderbuffer]);
|
|
};
|
|
var _emscripten_glBindRenderbuffer = _glBindRenderbuffer;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glBindSampler = (unit, sampler) => {
|
|
GLctx.bindSampler(unit, GL.samplers[sampler]);
|
|
};
|
|
var _emscripten_glBindSampler = _glBindSampler;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glBindTexture = (target, texture) => {
|
|
GLctx.bindTexture(target, GL.textures[texture]);
|
|
};
|
|
var _emscripten_glBindTexture = _glBindTexture;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glBindTransformFeedback = (target, id) => {
|
|
GLctx.bindTransformFeedback(target, GL.transformFeedbacks[id]);
|
|
};
|
|
var _emscripten_glBindTransformFeedback = _glBindTransformFeedback;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glBindVertexArray = (vao) => {
|
|
GLctx.bindVertexArray(GL.vaos[vao]);
|
|
};
|
|
var _emscripten_glBindVertexArray = _glBindVertexArray;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glBindVertexArrayOES = _glBindVertexArray;
|
|
var _emscripten_glBindVertexArrayOES = _glBindVertexArrayOES;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glBlendColor = (x0, x1, x2, x3) => GLctx.blendColor(x0, x1, x2, x3);
|
|
var _emscripten_glBlendColor = _glBlendColor;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glBlendEquation = (x0) => GLctx.blendEquation(x0);
|
|
var _emscripten_glBlendEquation = _glBlendEquation;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glBlendEquationSeparate = (x0, x1) => GLctx.blendEquationSeparate(x0, x1);
|
|
var _emscripten_glBlendEquationSeparate = _glBlendEquationSeparate;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glBlendFunc = (x0, x1) => GLctx.blendFunc(x0, x1);
|
|
var _emscripten_glBlendFunc = _glBlendFunc;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glBlendFuncSeparate = (x0, x1, x2, x3) => GLctx.blendFuncSeparate(x0, x1, x2, x3);
|
|
var _emscripten_glBlendFuncSeparate = _glBlendFuncSeparate;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glBlitFramebuffer = (x0, x1, x2, x3, x4, x5, x6, x7, x8, x9) => GLctx.blitFramebuffer(x0, x1, x2, x3, x4, x5, x6, x7, x8, x9);
|
|
var _emscripten_glBlitFramebuffer = _glBlitFramebuffer;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glBufferData = (target, size, data, usage) => {
|
|
|
|
if (GL.currentContext.version >= 2) {
|
|
// If size is zero, WebGL would interpret uploading the whole input
|
|
// arraybuffer (starting from given offset), which would not make sense in
|
|
// WebAssembly, so avoid uploading if size is zero. However we must still
|
|
// call bufferData to establish a backing storage of zero bytes.
|
|
if (data && size) {
|
|
GLctx.bufferData(target, HEAPU8, usage, data, size);
|
|
} else {
|
|
GLctx.bufferData(target, size, usage);
|
|
}
|
|
return;
|
|
}
|
|
// N.b. here first form specifies a heap subarray, second form an integer
|
|
// size, so the ?: code here is polymorphic. It is advised to avoid
|
|
// randomly mixing both uses in calling code, to avoid any potential JS
|
|
// engine JIT issues.
|
|
GLctx.bufferData(target, data ? HEAPU8.subarray(data, data+size) : size, usage);
|
|
};
|
|
var _emscripten_glBufferData = _glBufferData;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glBufferSubData = (target, offset, size, data) => {
|
|
if (GL.currentContext.version >= 2) {
|
|
size && GLctx.bufferSubData(target, offset, HEAPU8, data, size);
|
|
return;
|
|
}
|
|
GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size));
|
|
};
|
|
var _emscripten_glBufferSubData = _glBufferSubData;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glCheckFramebufferStatus = (x0) => GLctx.checkFramebufferStatus(x0);
|
|
var _emscripten_glCheckFramebufferStatus = _glCheckFramebufferStatus;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glClear = (x0) => GLctx.clear(x0);
|
|
var _emscripten_glClear = _glClear;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glClearBufferfi = (x0, x1, x2, x3) => GLctx.clearBufferfi(x0, x1, x2, x3);
|
|
var _emscripten_glClearBufferfi = _glClearBufferfi;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glClearBufferfv = (buffer, drawbuffer, value) => {
|
|
|
|
GLctx.clearBufferfv(buffer, drawbuffer, HEAPF32, ((value)>>2));
|
|
};
|
|
var _emscripten_glClearBufferfv = _glClearBufferfv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glClearBufferiv = (buffer, drawbuffer, value) => {
|
|
|
|
GLctx.clearBufferiv(buffer, drawbuffer, HEAP32, ((value)>>2));
|
|
};
|
|
var _emscripten_glClearBufferiv = _glClearBufferiv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glClearBufferuiv = (buffer, drawbuffer, value) => {
|
|
|
|
GLctx.clearBufferuiv(buffer, drawbuffer, HEAPU32, ((value)>>2));
|
|
};
|
|
var _emscripten_glClearBufferuiv = _glClearBufferuiv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glClearColor = (x0, x1, x2, x3) => GLctx.clearColor(x0, x1, x2, x3);
|
|
var _emscripten_glClearColor = _glClearColor;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glClearDepthf = (x0) => GLctx.clearDepth(x0);
|
|
var _emscripten_glClearDepthf = _glClearDepthf;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glClearStencil = (x0) => GLctx.clearStencil(x0);
|
|
var _emscripten_glClearStencil = _glClearStencil;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glClientWaitSync = (sync, flags, timeout) => {
|
|
// WebGL2 vs GLES3 differences: in GLES3, the timeout parameter is a uint64, where 0xFFFFFFFFFFFFFFFFULL means GL_TIMEOUT_IGNORED.
|
|
// In JS, there's no 64-bit value types, so instead timeout is taken to be signed, and GL_TIMEOUT_IGNORED is given value -1.
|
|
// Inherently the value accepted in the timeout is lossy, and can't take in arbitrary u64 bit pattern (but most likely doesn't matter)
|
|
// See https://www.khronos.org/registry/webgl/specs/latest/2.0/#5.15
|
|
timeout = Number(timeout);
|
|
return GLctx.clientWaitSync(GL.syncs[sync], flags, timeout);
|
|
};
|
|
var _emscripten_glClientWaitSync = _glClientWaitSync;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glColorMask = (red, green, blue, alpha) => {
|
|
GLctx.colorMask(!!red, !!green, !!blue, !!alpha);
|
|
};
|
|
var _emscripten_glColorMask = _glColorMask;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glCompileShader = (shader) => {
|
|
GLctx.compileShader(GL.shaders[shader]);
|
|
};
|
|
var _emscripten_glCompileShader = _glCompileShader;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glCompressedTexImage2D = (target, level, internalFormat, width, height, border, imageSize, data) => {
|
|
if (GL.currentContext.version >= 2) {
|
|
if (GLctx.currentPixelUnpackBufferBinding || !imageSize) {
|
|
GLctx.compressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data);
|
|
return;
|
|
}
|
|
GLctx.compressedTexImage2D(target, level, internalFormat, width, height, border, HEAPU8, data, imageSize);
|
|
return;
|
|
}
|
|
GLctx.compressedTexImage2D(target, level, internalFormat, width, height, border, data ? HEAPU8.subarray((data), data+imageSize) : null);
|
|
};
|
|
var _emscripten_glCompressedTexImage2D = _glCompressedTexImage2D;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glCompressedTexImage3D = (target, level, internalFormat, width, height, depth, border, imageSize, data) => {
|
|
if (GLctx.currentPixelUnpackBufferBinding) {
|
|
GLctx.compressedTexImage3D(target, level, internalFormat, width, height, depth, border, imageSize, data);
|
|
} else {
|
|
GLctx.compressedTexImage3D(target, level, internalFormat, width, height, depth, border, HEAPU8, data, imageSize);
|
|
}
|
|
};
|
|
var _emscripten_glCompressedTexImage3D = _glCompressedTexImage3D;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glCompressedTexSubImage2D = (target, level, xoffset, yoffset, width, height, format, imageSize, data) => {
|
|
if (GL.currentContext.version >= 2) {
|
|
if (GLctx.currentPixelUnpackBufferBinding || !imageSize) {
|
|
GLctx.compressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, imageSize, data);
|
|
return;
|
|
}
|
|
GLctx.compressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, HEAPU8, data, imageSize);
|
|
return;
|
|
}
|
|
GLctx.compressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, data ? HEAPU8.subarray((data), data+imageSize) : null);
|
|
};
|
|
var _emscripten_glCompressedTexSubImage2D = _glCompressedTexSubImage2D;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glCompressedTexSubImage3D = (target, level, xoffset, yoffset, zoffset, width, height, depth, format, imageSize, data) => {
|
|
if (GLctx.currentPixelUnpackBufferBinding) {
|
|
GLctx.compressedTexSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, imageSize, data);
|
|
} else {
|
|
GLctx.compressedTexSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, HEAPU8, data, imageSize);
|
|
}
|
|
};
|
|
var _emscripten_glCompressedTexSubImage3D = _glCompressedTexSubImage3D;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glCopyBufferSubData = (x0, x1, x2, x3, x4) => GLctx.copyBufferSubData(x0, x1, x2, x3, x4);
|
|
var _emscripten_glCopyBufferSubData = _glCopyBufferSubData;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glCopyTexImage2D = (x0, x1, x2, x3, x4, x5, x6, x7) => GLctx.copyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7);
|
|
var _emscripten_glCopyTexImage2D = _glCopyTexImage2D;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glCopyTexSubImage2D = (x0, x1, x2, x3, x4, x5, x6, x7) => GLctx.copyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7);
|
|
var _emscripten_glCopyTexSubImage2D = _glCopyTexSubImage2D;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glCopyTexSubImage3D = (x0, x1, x2, x3, x4, x5, x6, x7, x8) => GLctx.copyTexSubImage3D(x0, x1, x2, x3, x4, x5, x6, x7, x8);
|
|
var _emscripten_glCopyTexSubImage3D = _glCopyTexSubImage3D;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glCreateProgram = () => {
|
|
var id = GL.getNewId(GL.programs);
|
|
var program = GLctx.createProgram();
|
|
// Store additional information needed for each shader program:
|
|
program.name = id;
|
|
// Lazy cache results of
|
|
// glGetProgramiv(GL_ACTIVE_UNIFORM_MAX_LENGTH/GL_ACTIVE_ATTRIBUTE_MAX_LENGTH/GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH)
|
|
program.maxUniformLength = program.maxAttributeLength = program.maxUniformBlockNameLength = 0;
|
|
program.uniformIdCounter = 1;
|
|
GL.programs[id] = program;
|
|
return id;
|
|
};
|
|
var _emscripten_glCreateProgram = _glCreateProgram;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glCreateShader = (shaderType) => {
|
|
var id = GL.getNewId(GL.shaders);
|
|
GL.shaders[id] = GLctx.createShader(shaderType);
|
|
|
|
return id;
|
|
};
|
|
var _emscripten_glCreateShader = _glCreateShader;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glCullFace = (x0) => GLctx.cullFace(x0);
|
|
var _emscripten_glCullFace = _glCullFace;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDeleteBuffers = (n, buffers) => {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[(((buffers)+(i*4))>>2)];
|
|
var buffer = GL.buffers[id];
|
|
|
|
// From spec: "glDeleteBuffers silently ignores 0's and names that do not
|
|
// correspond to existing buffer objects."
|
|
if (!buffer) continue;
|
|
|
|
GLctx.deleteBuffer(buffer);
|
|
buffer.name = 0;
|
|
GL.buffers[id] = null;
|
|
|
|
if (id == GLctx.currentPixelPackBufferBinding) GLctx.currentPixelPackBufferBinding = 0;
|
|
if (id == GLctx.currentPixelUnpackBufferBinding) GLctx.currentPixelUnpackBufferBinding = 0;
|
|
}
|
|
};
|
|
var _emscripten_glDeleteBuffers = _glDeleteBuffers;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDeleteFramebuffers = (n, framebuffers) => {
|
|
for (var i = 0; i < n; ++i) {
|
|
var id = HEAP32[(((framebuffers)+(i*4))>>2)];
|
|
var framebuffer = GL.framebuffers[id];
|
|
if (!framebuffer) continue; // GL spec: "glDeleteFramebuffers silently ignores 0s and names that do not correspond to existing framebuffer objects".
|
|
GLctx.deleteFramebuffer(framebuffer);
|
|
framebuffer.name = 0;
|
|
GL.framebuffers[id] = null;
|
|
}
|
|
};
|
|
var _emscripten_glDeleteFramebuffers = _glDeleteFramebuffers;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDeleteProgram = (id) => {
|
|
if (!id) return;
|
|
var program = GL.programs[id];
|
|
if (!program) {
|
|
// glDeleteProgram actually signals an error when deleting a nonexisting
|
|
// object, unlike some other GL delete functions.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
GLctx.deleteProgram(program);
|
|
program.name = 0;
|
|
GL.programs[id] = null;
|
|
};
|
|
var _emscripten_glDeleteProgram = _glDeleteProgram;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDeleteQueries = (n, ids) => {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[(((ids)+(i*4))>>2)];
|
|
var query = GL.queries[id];
|
|
if (!query) continue; // GL spec: "unused names in ids are ignored, as is the name zero."
|
|
GLctx.deleteQuery(query);
|
|
GL.queries[id] = null;
|
|
}
|
|
};
|
|
var _emscripten_glDeleteQueries = _glDeleteQueries;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDeleteQueriesEXT = (n, ids) => {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[(((ids)+(i*4))>>2)];
|
|
var query = GL.queries[id];
|
|
if (!query) continue; // GL spec: "unused names in ids are ignored, as is the name zero."
|
|
GLctx.disjointTimerQueryExt['deleteQueryEXT'](query);
|
|
GL.queries[id] = null;
|
|
}
|
|
};
|
|
var _emscripten_glDeleteQueriesEXT = _glDeleteQueriesEXT;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDeleteRenderbuffers = (n, renderbuffers) => {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[(((renderbuffers)+(i*4))>>2)];
|
|
var renderbuffer = GL.renderbuffers[id];
|
|
if (!renderbuffer) continue; // GL spec: "glDeleteRenderbuffers silently ignores 0s and names that do not correspond to existing renderbuffer objects".
|
|
GLctx.deleteRenderbuffer(renderbuffer);
|
|
renderbuffer.name = 0;
|
|
GL.renderbuffers[id] = null;
|
|
}
|
|
};
|
|
var _emscripten_glDeleteRenderbuffers = _glDeleteRenderbuffers;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDeleteSamplers = (n, samplers) => {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[(((samplers)+(i*4))>>2)];
|
|
var sampler = GL.samplers[id];
|
|
if (!sampler) continue;
|
|
GLctx.deleteSampler(sampler);
|
|
sampler.name = 0;
|
|
GL.samplers[id] = null;
|
|
}
|
|
};
|
|
var _emscripten_glDeleteSamplers = _glDeleteSamplers;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDeleteShader = (id) => {
|
|
if (!id) return;
|
|
var shader = GL.shaders[id];
|
|
if (!shader) {
|
|
// glDeleteShader actually signals an error when deleting a nonexisting
|
|
// object, unlike some other GL delete functions.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
GLctx.deleteShader(shader);
|
|
GL.shaders[id] = null;
|
|
};
|
|
var _emscripten_glDeleteShader = _glDeleteShader;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDeleteSync = (id) => {
|
|
if (!id) return;
|
|
var sync = GL.syncs[id];
|
|
if (!sync) { // glDeleteSync signals an error when deleting a nonexisting object, unlike some other GL delete functions.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
GLctx.deleteSync(sync);
|
|
sync.name = 0;
|
|
GL.syncs[id] = null;
|
|
};
|
|
var _emscripten_glDeleteSync = _glDeleteSync;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDeleteTextures = (n, textures) => {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[(((textures)+(i*4))>>2)];
|
|
var texture = GL.textures[id];
|
|
// GL spec: "glDeleteTextures silently ignores 0s and names that do not
|
|
// correspond to existing textures".
|
|
if (!texture) continue;
|
|
GLctx.deleteTexture(texture);
|
|
texture.name = 0;
|
|
GL.textures[id] = null;
|
|
}
|
|
};
|
|
var _emscripten_glDeleteTextures = _glDeleteTextures;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDeleteTransformFeedbacks = (n, ids) => {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[(((ids)+(i*4))>>2)];
|
|
var transformFeedback = GL.transformFeedbacks[id];
|
|
if (!transformFeedback) continue; // GL spec: "unused names in ids are ignored, as is the name zero."
|
|
GLctx.deleteTransformFeedback(transformFeedback);
|
|
transformFeedback.name = 0;
|
|
GL.transformFeedbacks[id] = null;
|
|
}
|
|
};
|
|
var _emscripten_glDeleteTransformFeedbacks = _glDeleteTransformFeedbacks;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDeleteVertexArrays = (n, vaos) => {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[(((vaos)+(i*4))>>2)];
|
|
GLctx.deleteVertexArray(GL.vaos[id]);
|
|
GL.vaos[id] = null;
|
|
}
|
|
};
|
|
var _emscripten_glDeleteVertexArrays = _glDeleteVertexArrays;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDeleteVertexArraysOES = _glDeleteVertexArrays;
|
|
var _emscripten_glDeleteVertexArraysOES = _glDeleteVertexArraysOES;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDepthFunc = (x0) => GLctx.depthFunc(x0);
|
|
var _emscripten_glDepthFunc = _glDepthFunc;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDepthMask = (flag) => {
|
|
GLctx.depthMask(!!flag);
|
|
};
|
|
var _emscripten_glDepthMask = _glDepthMask;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDepthRangef = (x0, x1) => GLctx.depthRange(x0, x1);
|
|
var _emscripten_glDepthRangef = _glDepthRangef;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDetachShader = (program, shader) => {
|
|
GLctx.detachShader(GL.programs[program], GL.shaders[shader]);
|
|
};
|
|
var _emscripten_glDetachShader = _glDetachShader;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDisable = (x0) => GLctx.disable(x0);
|
|
var _emscripten_glDisable = _glDisable;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDisableVertexAttribArray = (index) => {
|
|
GLctx.disableVertexAttribArray(index);
|
|
};
|
|
var _emscripten_glDisableVertexAttribArray = _glDisableVertexAttribArray;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDrawArrays = (mode, first, count) => {
|
|
|
|
GLctx.drawArrays(mode, first, count);
|
|
|
|
};
|
|
var _emscripten_glDrawArrays = _glDrawArrays;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDrawArraysInstanced = (mode, first, count, primcount) => {
|
|
GLctx.drawArraysInstanced(mode, first, count, primcount);
|
|
};
|
|
var _emscripten_glDrawArraysInstanced = _glDrawArraysInstanced;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDrawArraysInstancedANGLE = _glDrawArraysInstanced;
|
|
var _emscripten_glDrawArraysInstancedANGLE = _glDrawArraysInstancedANGLE;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDrawArraysInstancedARB = _glDrawArraysInstanced;
|
|
var _emscripten_glDrawArraysInstancedARB = _glDrawArraysInstancedARB;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDrawArraysInstancedEXT = _glDrawArraysInstanced;
|
|
var _emscripten_glDrawArraysInstancedEXT = _glDrawArraysInstancedEXT;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDrawArraysInstancedNV = _glDrawArraysInstanced;
|
|
var _emscripten_glDrawArraysInstancedNV = _glDrawArraysInstancedNV;
|
|
|
|
var tempFixedLengthArray = [];
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDrawBuffers = (n, bufs) => {
|
|
|
|
var bufArray = tempFixedLengthArray[n];
|
|
for (var i = 0; i < n; i++) {
|
|
bufArray[i] = HEAP32[(((bufs)+(i*4))>>2)];
|
|
}
|
|
|
|
GLctx.drawBuffers(bufArray);
|
|
};
|
|
var _emscripten_glDrawBuffers = _glDrawBuffers;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDrawBuffersEXT = _glDrawBuffers;
|
|
var _emscripten_glDrawBuffersEXT = _glDrawBuffersEXT;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDrawBuffersWEBGL = _glDrawBuffers;
|
|
var _emscripten_glDrawBuffersWEBGL = _glDrawBuffersWEBGL;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDrawElements = (mode, count, type, indices) => {
|
|
|
|
GLctx.drawElements(mode, count, type, indices);
|
|
|
|
};
|
|
var _emscripten_glDrawElements = _glDrawElements;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDrawElementsInstanced = (mode, count, type, indices, primcount) => {
|
|
GLctx.drawElementsInstanced(mode, count, type, indices, primcount);
|
|
};
|
|
var _emscripten_glDrawElementsInstanced = _glDrawElementsInstanced;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDrawElementsInstancedANGLE = _glDrawElementsInstanced;
|
|
var _emscripten_glDrawElementsInstancedANGLE = _glDrawElementsInstancedANGLE;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDrawElementsInstancedARB = _glDrawElementsInstanced;
|
|
var _emscripten_glDrawElementsInstancedARB = _glDrawElementsInstancedARB;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDrawElementsInstancedEXT = _glDrawElementsInstanced;
|
|
var _emscripten_glDrawElementsInstancedEXT = _glDrawElementsInstancedEXT;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDrawElementsInstancedNV = _glDrawElementsInstanced;
|
|
var _emscripten_glDrawElementsInstancedNV = _glDrawElementsInstancedNV;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glDrawRangeElements = (mode, start, end, count, type, indices) => {
|
|
// TODO: This should be a trivial pass-though function registered at the bottom of this page as
|
|
// glFuncs[6][1] += ' drawRangeElements';
|
|
// but due to https://bugzilla.mozilla.org/show_bug.cgi?id=1202427,
|
|
// we work around by ignoring the range.
|
|
_glDrawElements(mode, count, type, indices);
|
|
};
|
|
var _emscripten_glDrawRangeElements = _glDrawRangeElements;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glEnable = (x0) => GLctx.enable(x0);
|
|
var _emscripten_glEnable = _glEnable;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glEnableVertexAttribArray = (index) => {
|
|
GLctx.enableVertexAttribArray(index);
|
|
};
|
|
var _emscripten_glEnableVertexAttribArray = _glEnableVertexAttribArray;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glEndQuery = (x0) => GLctx.endQuery(x0);
|
|
var _emscripten_glEndQuery = _glEndQuery;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glEndQueryEXT = (target) => {
|
|
GLctx.disjointTimerQueryExt['endQueryEXT'](target);
|
|
};
|
|
var _emscripten_glEndQueryEXT = _glEndQueryEXT;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glEndTransformFeedback = () => GLctx.endTransformFeedback();
|
|
var _emscripten_glEndTransformFeedback = _glEndTransformFeedback;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glFenceSync = (condition, flags) => {
|
|
var sync = GLctx.fenceSync(condition, flags);
|
|
if (sync) {
|
|
var id = GL.getNewId(GL.syncs);
|
|
sync.name = id;
|
|
GL.syncs[id] = sync;
|
|
return id;
|
|
}
|
|
return 0; // Failed to create a sync object
|
|
};
|
|
var _emscripten_glFenceSync = _glFenceSync;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glFinish = () => GLctx.finish();
|
|
var _emscripten_glFinish = _glFinish;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glFlush = () => GLctx.flush();
|
|
var _emscripten_glFlush = _glFlush;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glFramebufferRenderbuffer = (target, attachment, renderbuffertarget, renderbuffer) => {
|
|
GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget,
|
|
GL.renderbuffers[renderbuffer]);
|
|
};
|
|
var _emscripten_glFramebufferRenderbuffer = _glFramebufferRenderbuffer;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glFramebufferTexture2D = (target, attachment, textarget, texture, level) => {
|
|
GLctx.framebufferTexture2D(target, attachment, textarget,
|
|
GL.textures[texture], level);
|
|
};
|
|
var _emscripten_glFramebufferTexture2D = _glFramebufferTexture2D;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glFramebufferTextureLayer = (target, attachment, texture, level, layer) => {
|
|
GLctx.framebufferTextureLayer(target, attachment, GL.textures[texture], level, layer);
|
|
};
|
|
var _emscripten_glFramebufferTextureLayer = _glFramebufferTextureLayer;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glFrontFace = (x0) => GLctx.frontFace(x0);
|
|
var _emscripten_glFrontFace = _glFrontFace;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGenBuffers = (n, buffers) => {
|
|
GL.genObject(n, buffers, 'createBuffer', GL.buffers
|
|
);
|
|
};
|
|
var _emscripten_glGenBuffers = _glGenBuffers;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGenFramebuffers = (n, ids) => {
|
|
GL.genObject(n, ids, 'createFramebuffer', GL.framebuffers
|
|
);
|
|
};
|
|
var _emscripten_glGenFramebuffers = _glGenFramebuffers;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGenQueries = (n, ids) => {
|
|
GL.genObject(n, ids, 'createQuery', GL.queries
|
|
);
|
|
};
|
|
var _emscripten_glGenQueries = _glGenQueries;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGenQueriesEXT = (n, ids) => {
|
|
for (var i = 0; i < n; i++) {
|
|
var query = GLctx.disjointTimerQueryExt['createQueryEXT']();
|
|
if (!query) {
|
|
GL.recordError(0x502 /* GL_INVALID_OPERATION */);
|
|
while (i < n) HEAP32[(((ids)+(i++*4))>>2)] = 0;
|
|
return;
|
|
}
|
|
var id = GL.getNewId(GL.queries);
|
|
query.name = id;
|
|
GL.queries[id] = query;
|
|
HEAP32[(((ids)+(i*4))>>2)] = id;
|
|
}
|
|
};
|
|
var _emscripten_glGenQueriesEXT = _glGenQueriesEXT;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGenRenderbuffers = (n, renderbuffers) => {
|
|
GL.genObject(n, renderbuffers, 'createRenderbuffer', GL.renderbuffers
|
|
);
|
|
};
|
|
var _emscripten_glGenRenderbuffers = _glGenRenderbuffers;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGenSamplers = (n, samplers) => {
|
|
GL.genObject(n, samplers, 'createSampler', GL.samplers
|
|
);
|
|
};
|
|
var _emscripten_glGenSamplers = _glGenSamplers;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGenTextures = (n, textures) => {
|
|
GL.genObject(n, textures, 'createTexture', GL.textures
|
|
);
|
|
};
|
|
var _emscripten_glGenTextures = _glGenTextures;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGenTransformFeedbacks = (n, ids) => {
|
|
GL.genObject(n, ids, 'createTransformFeedback', GL.transformFeedbacks
|
|
);
|
|
};
|
|
var _emscripten_glGenTransformFeedbacks = _glGenTransformFeedbacks;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGenVertexArrays = (n, arrays) => {
|
|
GL.genObject(n, arrays, 'createVertexArray', GL.vaos
|
|
);
|
|
};
|
|
var _emscripten_glGenVertexArrays = _glGenVertexArrays;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGenVertexArraysOES = _glGenVertexArrays;
|
|
var _emscripten_glGenVertexArraysOES = _glGenVertexArraysOES;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGenerateMipmap = (x0) => GLctx.generateMipmap(x0);
|
|
var _emscripten_glGenerateMipmap = _glGenerateMipmap;
|
|
|
|
|
|
var __glGetActiveAttribOrUniform = (funcName, program, index, bufSize, length, size, type, name) => {
|
|
program = GL.programs[program];
|
|
var info = GLctx[funcName](program, index);
|
|
if (info) {
|
|
// If an error occurs, nothing will be written to length, size and type and name.
|
|
var numBytesWrittenExclNull = name && stringToUTF8(info.name, name, bufSize);
|
|
if (length) HEAP32[((length)>>2)] = numBytesWrittenExclNull;
|
|
if (size) HEAP32[((size)>>2)] = info.size;
|
|
if (type) HEAP32[((type)>>2)] = info.type;
|
|
}
|
|
};
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetActiveAttrib = (program, index, bufSize, length, size, type, name) => {
|
|
__glGetActiveAttribOrUniform('getActiveAttrib', program, index, bufSize, length, size, type, name);
|
|
};
|
|
var _emscripten_glGetActiveAttrib = _glGetActiveAttrib;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetActiveUniform = (program, index, bufSize, length, size, type, name) => {
|
|
__glGetActiveAttribOrUniform('getActiveUniform', program, index, bufSize, length, size, type, name);
|
|
};
|
|
var _emscripten_glGetActiveUniform = _glGetActiveUniform;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetActiveUniformBlockName = (program, uniformBlockIndex, bufSize, length, uniformBlockName) => {
|
|
program = GL.programs[program];
|
|
|
|
var result = GLctx.getActiveUniformBlockName(program, uniformBlockIndex);
|
|
if (!result) return; // If an error occurs, nothing will be written to uniformBlockName or length.
|
|
if (uniformBlockName && bufSize > 0) {
|
|
var numBytesWrittenExclNull = stringToUTF8(result, uniformBlockName, bufSize);
|
|
if (length) HEAP32[((length)>>2)] = numBytesWrittenExclNull;
|
|
} else {
|
|
if (length) HEAP32[((length)>>2)] = 0;
|
|
}
|
|
};
|
|
var _emscripten_glGetActiveUniformBlockName = _glGetActiveUniformBlockName;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetActiveUniformBlockiv = (program, uniformBlockIndex, pname, params) => {
|
|
if (!params) {
|
|
// GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
|
|
// if params == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
program = GL.programs[program];
|
|
|
|
if (pname == 0x8A41 /* GL_UNIFORM_BLOCK_NAME_LENGTH */) {
|
|
var name = GLctx.getActiveUniformBlockName(program, uniformBlockIndex);
|
|
HEAP32[((params)>>2)] = name.length+1;
|
|
return;
|
|
}
|
|
|
|
var result = GLctx.getActiveUniformBlockParameter(program, uniformBlockIndex, pname);
|
|
if (result === null) return; // If an error occurs, nothing should be written to params.
|
|
if (pname == 0x8A43 /*GL_UNIFORM_BLOCK_ACTIVE_UNIFORM_INDICES*/) {
|
|
for (var i = 0; i < result.length; i++) {
|
|
HEAP32[(((params)+(i*4))>>2)] = result[i];
|
|
}
|
|
} else {
|
|
HEAP32[((params)>>2)] = result;
|
|
}
|
|
};
|
|
var _emscripten_glGetActiveUniformBlockiv = _glGetActiveUniformBlockiv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetActiveUniformsiv = (program, uniformCount, uniformIndices, pname, params) => {
|
|
if (!params) {
|
|
// GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
|
|
// if params == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
if (uniformCount > 0 && uniformIndices == 0) {
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
program = GL.programs[program];
|
|
var ids = [];
|
|
for (var i = 0; i < uniformCount; i++) {
|
|
ids.push(HEAP32[(((uniformIndices)+(i*4))>>2)]);
|
|
}
|
|
|
|
var result = GLctx.getActiveUniforms(program, ids, pname);
|
|
if (!result) return; // GL spec: If an error is generated, nothing is written out to params.
|
|
|
|
var len = result.length;
|
|
for (var i = 0; i < len; i++) {
|
|
HEAP32[(((params)+(i*4))>>2)] = result[i];
|
|
}
|
|
};
|
|
var _emscripten_glGetActiveUniformsiv = _glGetActiveUniformsiv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetAttachedShaders = (program, maxCount, count, shaders) => {
|
|
var result = GLctx.getAttachedShaders(GL.programs[program]);
|
|
var len = result.length;
|
|
if (len > maxCount) {
|
|
len = maxCount;
|
|
}
|
|
HEAP32[((count)>>2)] = len;
|
|
for (var i = 0; i < len; ++i) {
|
|
var id = GL.shaders.indexOf(result[i]);
|
|
HEAP32[(((shaders)+(i*4))>>2)] = id;
|
|
}
|
|
};
|
|
var _emscripten_glGetAttachedShaders = _glGetAttachedShaders;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetAttribLocation = (program, name) => {
|
|
return GLctx.getAttribLocation(GL.programs[program], UTF8ToString(name));
|
|
};
|
|
var _emscripten_glGetAttribLocation = _glGetAttribLocation;
|
|
|
|
var writeI53ToI64 = (ptr, num) => {
|
|
HEAPU32[((ptr)>>2)] = num;
|
|
var lower = HEAPU32[((ptr)>>2)];
|
|
HEAPU32[(((ptr)+(4))>>2)] = (num - lower)/4294967296;
|
|
};
|
|
|
|
|
|
var webglGetExtensions = function $webglGetExtensions() {
|
|
var exts = getEmscriptenSupportedExtensions(GLctx);
|
|
exts = exts.concat(exts.map((e) => "GL_" + e));
|
|
return exts;
|
|
};
|
|
|
|
var emscriptenWebGLGet = (name_, p, type) => {
|
|
// Guard against user passing a null pointer.
|
|
// Note that GLES2 spec does not say anything about how passing a null
|
|
// pointer should be treated. Testing on desktop core GL 3, the application
|
|
// crashes on glGetIntegerv to a null pointer, but better to report an error
|
|
// instead of doing anything random.
|
|
if (!p) {
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
var ret = undefined;
|
|
switch (name_) { // Handle a few trivial GLES values
|
|
case 0x8DFA: // GL_SHADER_COMPILER
|
|
ret = 1;
|
|
break;
|
|
case 0x8DF8: // GL_SHADER_BINARY_FORMATS
|
|
if (type != 0 && type != 1) {
|
|
GL.recordError(0x500); // GL_INVALID_ENUM
|
|
}
|
|
// Do not write anything to the out pointer, since no binary formats are
|
|
// supported.
|
|
return;
|
|
case 0x87FE: // GL_NUM_PROGRAM_BINARY_FORMATS
|
|
case 0x8DF9: // GL_NUM_SHADER_BINARY_FORMATS
|
|
ret = 0;
|
|
break;
|
|
case 0x86A2: // GL_NUM_COMPRESSED_TEXTURE_FORMATS
|
|
// WebGL doesn't have GL_NUM_COMPRESSED_TEXTURE_FORMATS (it's obsolete
|
|
// since GL_COMPRESSED_TEXTURE_FORMATS returns a JS array that can be
|
|
// queried for length), so implement it ourselves to allow C++ GLES2
|
|
// code get the length.
|
|
var formats = GLctx.getParameter(0x86A3 /*GL_COMPRESSED_TEXTURE_FORMATS*/);
|
|
ret = formats ? formats.length : 0;
|
|
break;
|
|
|
|
case 0x821D: // GL_NUM_EXTENSIONS
|
|
if (GL.currentContext.version < 2) {
|
|
// Calling GLES3/WebGL2 function with a GLES2/WebGL1 context
|
|
GL.recordError(0x502 /* GL_INVALID_OPERATION */);
|
|
return;
|
|
}
|
|
ret = webglGetExtensions().length;
|
|
break;
|
|
case 0x821B: // GL_MAJOR_VERSION
|
|
case 0x821C: // GL_MINOR_VERSION
|
|
if (GL.currentContext.version < 2) {
|
|
GL.recordError(0x500); // GL_INVALID_ENUM
|
|
return;
|
|
}
|
|
ret = name_ == 0x821B ? 3 : 0; // return version 3.0
|
|
break;
|
|
}
|
|
|
|
if (ret === undefined) {
|
|
var result = GLctx.getParameter(name_);
|
|
switch (typeof result) {
|
|
case "number":
|
|
ret = result;
|
|
break;
|
|
case "boolean":
|
|
ret = result ? 1 : 0;
|
|
break;
|
|
case "string":
|
|
GL.recordError(0x500); // GL_INVALID_ENUM
|
|
return;
|
|
case "object":
|
|
if (result === null) {
|
|
// null is a valid result for some (e.g., which buffer is bound -
|
|
// perhaps nothing is bound), but otherwise can mean an invalid
|
|
// name_, which we need to report as an error
|
|
switch (name_) {
|
|
case 0x8894: // ARRAY_BUFFER_BINDING
|
|
case 0x8B8D: // CURRENT_PROGRAM
|
|
case 0x8895: // ELEMENT_ARRAY_BUFFER_BINDING
|
|
case 0x8CA6: // FRAMEBUFFER_BINDING or DRAW_FRAMEBUFFER_BINDING
|
|
case 0x8CA7: // RENDERBUFFER_BINDING
|
|
case 0x8069: // TEXTURE_BINDING_2D
|
|
case 0x85B5: // WebGL 2 GL_VERTEX_ARRAY_BINDING, or WebGL 1 extension OES_vertex_array_object GL_VERTEX_ARRAY_BINDING_OES
|
|
case 0x8F36: // COPY_READ_BUFFER_BINDING or COPY_READ_BUFFER
|
|
case 0x8F37: // COPY_WRITE_BUFFER_BINDING or COPY_WRITE_BUFFER
|
|
case 0x88ED: // PIXEL_PACK_BUFFER_BINDING
|
|
case 0x88EF: // PIXEL_UNPACK_BUFFER_BINDING
|
|
case 0x8CAA: // READ_FRAMEBUFFER_BINDING
|
|
case 0x8919: // SAMPLER_BINDING
|
|
case 0x8C1D: // TEXTURE_BINDING_2D_ARRAY
|
|
case 0x806A: // TEXTURE_BINDING_3D
|
|
case 0x8E25: // TRANSFORM_FEEDBACK_BINDING
|
|
case 0x8C8F: // TRANSFORM_FEEDBACK_BUFFER_BINDING
|
|
case 0x8A28: // UNIFORM_BUFFER_BINDING
|
|
case 0x8514: { // TEXTURE_BINDING_CUBE_MAP
|
|
ret = 0;
|
|
break;
|
|
}
|
|
default: {
|
|
GL.recordError(0x500); // GL_INVALID_ENUM
|
|
return;
|
|
}
|
|
}
|
|
} else if (result instanceof Float32Array ||
|
|
result instanceof Uint32Array ||
|
|
result instanceof Int32Array ||
|
|
result instanceof Array) {
|
|
for (var i = 0; i < result.length; ++i) {
|
|
switch (type) {
|
|
case 0: HEAP32[(((p)+(i*4))>>2)] = result[i]; break;
|
|
case 2: HEAPF32[(((p)+(i*4))>>2)] = result[i]; break;
|
|
case 4: HEAP8[(p)+(i)] = result[i] ? 1 : 0; break;
|
|
}
|
|
}
|
|
return;
|
|
} else {
|
|
try {
|
|
ret = result.name | 0;
|
|
} catch(e) {
|
|
GL.recordError(0x500); // GL_INVALID_ENUM
|
|
err(`GL_INVALID_ENUM in glGet${type}v: Unknown object returned from WebGL getParameter(${name_})! (error: ${e})`);
|
|
return;
|
|
}
|
|
}
|
|
break;
|
|
default:
|
|
GL.recordError(0x500); // GL_INVALID_ENUM
|
|
err(`GL_INVALID_ENUM in glGet${type}v: Native code calling glGet${type}v(${name_}) and it returns ${result} of type ${typeof(result)}!`);
|
|
return;
|
|
}
|
|
}
|
|
|
|
switch (type) {
|
|
case 1: writeI53ToI64(p, ret); break;
|
|
case 0: HEAP32[((p)>>2)] = ret; break;
|
|
case 2: HEAPF32[((p)>>2)] = ret; break;
|
|
case 4: HEAP8[p] = ret ? 1 : 0; break;
|
|
}
|
|
};
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetBooleanv = (name_, p) => emscriptenWebGLGet(name_, p, 4);
|
|
var _emscripten_glGetBooleanv = _glGetBooleanv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetBufferParameteri64v = (target, value, data) => {
|
|
if (!data) {
|
|
// GLES2 specification does not specify how to behave if data is a null pointer. Since calling this function does not make sense
|
|
// if data == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
writeI53ToI64(data, GLctx.getBufferParameter(target, value));
|
|
};
|
|
var _emscripten_glGetBufferParameteri64v = _glGetBufferParameteri64v;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetBufferParameteriv = (target, value, data) => {
|
|
if (!data) {
|
|
// GLES2 specification does not specify how to behave if data is a null
|
|
// pointer. Since calling this function does not make sense if data ==
|
|
// null, issue a GL error to notify user about it.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
HEAP32[((data)>>2)] = GLctx.getBufferParameter(target, value);
|
|
};
|
|
var _emscripten_glGetBufferParameteriv = _glGetBufferParameteriv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetError = () => {
|
|
var error = GLctx.getError() || GL.lastError;
|
|
GL.lastError = 0/*GL_NO_ERROR*/;
|
|
return error;
|
|
};
|
|
var _emscripten_glGetError = _glGetError;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetFloatv = (name_, p) => emscriptenWebGLGet(name_, p, 2);
|
|
var _emscripten_glGetFloatv = _glGetFloatv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetFragDataLocation = (program, name) => {
|
|
return GLctx.getFragDataLocation(GL.programs[program], UTF8ToString(name));
|
|
};
|
|
var _emscripten_glGetFragDataLocation = _glGetFragDataLocation;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetFramebufferAttachmentParameteriv = (target, attachment, pname, params) => {
|
|
var result = GLctx.getFramebufferAttachmentParameter(target, attachment, pname);
|
|
if (result instanceof WebGLRenderbuffer ||
|
|
result instanceof WebGLTexture) {
|
|
result = result.name | 0;
|
|
}
|
|
HEAP32[((params)>>2)] = result;
|
|
};
|
|
var _emscripten_glGetFramebufferAttachmentParameteriv = _glGetFramebufferAttachmentParameteriv;
|
|
|
|
var emscriptenWebGLGetIndexed = (target, index, data, type) => {
|
|
if (!data) {
|
|
// GLES2 specification does not specify how to behave if data is a null pointer. Since calling this function does not make sense
|
|
// if data == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
var result = GLctx.getIndexedParameter(target, index);
|
|
var ret;
|
|
switch (typeof result) {
|
|
case 'boolean':
|
|
ret = result ? 1 : 0;
|
|
break;
|
|
case 'number':
|
|
ret = result;
|
|
break;
|
|
case 'object':
|
|
if (result === null) {
|
|
switch (target) {
|
|
case 0x8C8F: // TRANSFORM_FEEDBACK_BUFFER_BINDING
|
|
case 0x8A28: // UNIFORM_BUFFER_BINDING
|
|
ret = 0;
|
|
break;
|
|
default: {
|
|
GL.recordError(0x500); // GL_INVALID_ENUM
|
|
return;
|
|
}
|
|
}
|
|
} else if (result instanceof WebGLBuffer) {
|
|
ret = result.name | 0;
|
|
} else {
|
|
GL.recordError(0x500); // GL_INVALID_ENUM
|
|
return;
|
|
}
|
|
break;
|
|
default:
|
|
GL.recordError(0x500); // GL_INVALID_ENUM
|
|
return;
|
|
}
|
|
|
|
switch (type) {
|
|
case 1: writeI53ToI64(data, ret); break;
|
|
case 0: HEAP32[((data)>>2)] = ret; break;
|
|
case 2: HEAPF32[((data)>>2)] = ret; break;
|
|
case 4: HEAP8[data] = ret ? 1 : 0; break;
|
|
default: throw 'internal emscriptenWebGLGetIndexed() error, bad type: ' + type;
|
|
}
|
|
};
|
|
/** @suppress {duplicate } */
|
|
var _glGetInteger64i_v = (target, index, data) =>
|
|
emscriptenWebGLGetIndexed(target, index, data, 1);
|
|
var _emscripten_glGetInteger64i_v = _glGetInteger64i_v;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetInteger64v = (name_, p) => {
|
|
emscriptenWebGLGet(name_, p, 1);
|
|
};
|
|
var _emscripten_glGetInteger64v = _glGetInteger64v;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetIntegeri_v = (target, index, data) =>
|
|
emscriptenWebGLGetIndexed(target, index, data, 0);
|
|
var _emscripten_glGetIntegeri_v = _glGetIntegeri_v;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetIntegerv = (name_, p) => emscriptenWebGLGet(name_, p, 0);
|
|
var _emscripten_glGetIntegerv = _glGetIntegerv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetInternalformativ = (target, internalformat, pname, bufSize, params) => {
|
|
if (bufSize < 0) {
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
if (!params) {
|
|
// GLES3 specification does not specify how to behave if values is a null pointer. Since calling this function does not make sense
|
|
// if values == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
var ret = GLctx.getInternalformatParameter(target, internalformat, pname);
|
|
if (ret === null) return;
|
|
for (var i = 0; i < ret.length && i < bufSize; ++i) {
|
|
HEAP32[(((params)+(i*4))>>2)] = ret[i];
|
|
}
|
|
};
|
|
var _emscripten_glGetInternalformativ = _glGetInternalformativ;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetProgramBinary = (program, bufSize, length, binaryFormat, binary) => {
|
|
GL.recordError(0x502/*GL_INVALID_OPERATION*/);
|
|
};
|
|
var _emscripten_glGetProgramBinary = _glGetProgramBinary;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetProgramInfoLog = (program, maxLength, length, infoLog) => {
|
|
var log = GLctx.getProgramInfoLog(GL.programs[program]);
|
|
if (log === null) log = '(unknown error)';
|
|
var numBytesWrittenExclNull = (maxLength > 0 && infoLog) ? stringToUTF8(log, infoLog, maxLength) : 0;
|
|
if (length) HEAP32[((length)>>2)] = numBytesWrittenExclNull;
|
|
};
|
|
var _emscripten_glGetProgramInfoLog = _glGetProgramInfoLog;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetProgramiv = (program, pname, p) => {
|
|
if (!p) {
|
|
// GLES2 specification does not specify how to behave if p is a null
|
|
// pointer. Since calling this function does not make sense if p == null,
|
|
// issue a GL error to notify user about it.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
|
|
if (program >= GL.counter) {
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
|
|
program = GL.programs[program];
|
|
|
|
if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
|
|
var log = GLctx.getProgramInfoLog(program);
|
|
if (log === null) log = '(unknown error)';
|
|
HEAP32[((p)>>2)] = log.length + 1;
|
|
} else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) {
|
|
if (!program.maxUniformLength) {
|
|
for (var i = 0; i < GLctx.getProgramParameter(program, 0x8B86/*GL_ACTIVE_UNIFORMS*/); ++i) {
|
|
program.maxUniformLength = Math.max(program.maxUniformLength, GLctx.getActiveUniform(program, i).name.length+1);
|
|
}
|
|
}
|
|
HEAP32[((p)>>2)] = program.maxUniformLength;
|
|
} else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) {
|
|
if (!program.maxAttributeLength) {
|
|
for (var i = 0; i < GLctx.getProgramParameter(program, 0x8B89/*GL_ACTIVE_ATTRIBUTES*/); ++i) {
|
|
program.maxAttributeLength = Math.max(program.maxAttributeLength, GLctx.getActiveAttrib(program, i).name.length+1);
|
|
}
|
|
}
|
|
HEAP32[((p)>>2)] = program.maxAttributeLength;
|
|
} else if (pname == 0x8A35 /* GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH */) {
|
|
if (!program.maxUniformBlockNameLength) {
|
|
for (var i = 0; i < GLctx.getProgramParameter(program, 0x8A36/*GL_ACTIVE_UNIFORM_BLOCKS*/); ++i) {
|
|
program.maxUniformBlockNameLength = Math.max(program.maxUniformBlockNameLength, GLctx.getActiveUniformBlockName(program, i).length+1);
|
|
}
|
|
}
|
|
HEAP32[((p)>>2)] = program.maxUniformBlockNameLength;
|
|
} else {
|
|
HEAP32[((p)>>2)] = GLctx.getProgramParameter(program, pname);
|
|
}
|
|
};
|
|
var _emscripten_glGetProgramiv = _glGetProgramiv;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetQueryObjecti64vEXT = (id, pname, params) => {
|
|
if (!params) {
|
|
// GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
|
|
// if p == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
var query = GL.queries[id];
|
|
var param;
|
|
if (GL.currentContext.version < 2)
|
|
{
|
|
param = GLctx.disjointTimerQueryExt['getQueryObjectEXT'](query, pname);
|
|
}
|
|
else {
|
|
param = GLctx.getQueryParameter(query, pname);
|
|
}
|
|
var ret;
|
|
if (typeof param == 'boolean') {
|
|
ret = param ? 1 : 0;
|
|
} else {
|
|
ret = param;
|
|
}
|
|
writeI53ToI64(params, ret);
|
|
};
|
|
var _emscripten_glGetQueryObjecti64vEXT = _glGetQueryObjecti64vEXT;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetQueryObjectivEXT = (id, pname, params) => {
|
|
if (!params) {
|
|
// GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
|
|
// if p == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
var query = GL.queries[id];
|
|
var param = GLctx.disjointTimerQueryExt['getQueryObjectEXT'](query, pname);
|
|
var ret;
|
|
if (typeof param == 'boolean') {
|
|
ret = param ? 1 : 0;
|
|
} else {
|
|
ret = param;
|
|
}
|
|
HEAP32[((params)>>2)] = ret;
|
|
};
|
|
var _emscripten_glGetQueryObjectivEXT = _glGetQueryObjectivEXT;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetQueryObjectui64vEXT = _glGetQueryObjecti64vEXT;
|
|
var _emscripten_glGetQueryObjectui64vEXT = _glGetQueryObjectui64vEXT;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetQueryObjectuiv = (id, pname, params) => {
|
|
if (!params) {
|
|
// GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
|
|
// if p == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
var query = GL.queries[id];
|
|
var param = GLctx.getQueryParameter(query, pname);
|
|
var ret;
|
|
if (typeof param == 'boolean') {
|
|
ret = param ? 1 : 0;
|
|
} else {
|
|
ret = param;
|
|
}
|
|
HEAP32[((params)>>2)] = ret;
|
|
};
|
|
var _emscripten_glGetQueryObjectuiv = _glGetQueryObjectuiv;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetQueryObjectuivEXT = _glGetQueryObjectivEXT;
|
|
var _emscripten_glGetQueryObjectuivEXT = _glGetQueryObjectuivEXT;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetQueryiv = (target, pname, params) => {
|
|
if (!params) {
|
|
// GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
|
|
// if p == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
HEAP32[((params)>>2)] = GLctx.getQuery(target, pname);
|
|
};
|
|
var _emscripten_glGetQueryiv = _glGetQueryiv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetQueryivEXT = (target, pname, params) => {
|
|
if (!params) {
|
|
// GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
|
|
// if p == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
HEAP32[((params)>>2)] = GLctx.disjointTimerQueryExt['getQueryEXT'](target, pname);
|
|
};
|
|
var _emscripten_glGetQueryivEXT = _glGetQueryivEXT;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetRenderbufferParameteriv = (target, pname, params) => {
|
|
if (!params) {
|
|
// GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
|
|
// if params == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
HEAP32[((params)>>2)] = GLctx.getRenderbufferParameter(target, pname);
|
|
};
|
|
var _emscripten_glGetRenderbufferParameteriv = _glGetRenderbufferParameteriv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetSamplerParameterfv = (sampler, pname, params) => {
|
|
if (!params) {
|
|
// GLES3 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
|
|
// if p == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
HEAPF32[((params)>>2)] = GLctx.getSamplerParameter(GL.samplers[sampler], pname);
|
|
};
|
|
var _emscripten_glGetSamplerParameterfv = _glGetSamplerParameterfv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetSamplerParameteriv = (sampler, pname, params) => {
|
|
if (!params) {
|
|
// GLES3 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
|
|
// if p == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
HEAP32[((params)>>2)] = GLctx.getSamplerParameter(GL.samplers[sampler], pname);
|
|
};
|
|
var _emscripten_glGetSamplerParameteriv = _glGetSamplerParameteriv;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetShaderInfoLog = (shader, maxLength, length, infoLog) => {
|
|
var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
|
|
if (log === null) log = '(unknown error)';
|
|
var numBytesWrittenExclNull = (maxLength > 0 && infoLog) ? stringToUTF8(log, infoLog, maxLength) : 0;
|
|
if (length) HEAP32[((length)>>2)] = numBytesWrittenExclNull;
|
|
};
|
|
var _emscripten_glGetShaderInfoLog = _glGetShaderInfoLog;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetShaderPrecisionFormat = (shaderType, precisionType, range, precision) => {
|
|
var result = GLctx.getShaderPrecisionFormat(shaderType, precisionType);
|
|
HEAP32[((range)>>2)] = result.rangeMin;
|
|
HEAP32[(((range)+(4))>>2)] = result.rangeMax;
|
|
HEAP32[((precision)>>2)] = result.precision;
|
|
};
|
|
var _emscripten_glGetShaderPrecisionFormat = _glGetShaderPrecisionFormat;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetShaderSource = (shader, bufSize, length, source) => {
|
|
var result = GLctx.getShaderSource(GL.shaders[shader]);
|
|
if (!result) return; // If an error occurs, nothing will be written to length or source.
|
|
var numBytesWrittenExclNull = (bufSize > 0 && source) ? stringToUTF8(result, source, bufSize) : 0;
|
|
if (length) HEAP32[((length)>>2)] = numBytesWrittenExclNull;
|
|
};
|
|
var _emscripten_glGetShaderSource = _glGetShaderSource;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetShaderiv = (shader, pname, p) => {
|
|
if (!p) {
|
|
// GLES2 specification does not specify how to behave if p is a null
|
|
// pointer. Since calling this function does not make sense if p == null,
|
|
// issue a GL error to notify user about it.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
|
|
var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
|
|
if (log === null) log = '(unknown error)';
|
|
// The GLES2 specification says that if the shader has an empty info log,
|
|
// a value of 0 is returned. Otherwise the log has a null char appended.
|
|
// (An empty string is falsey, so we can just check that instead of
|
|
// looking at log.length.)
|
|
var logLength = log ? log.length + 1 : 0;
|
|
HEAP32[((p)>>2)] = logLength;
|
|
} else if (pname == 0x8B88) { // GL_SHADER_SOURCE_LENGTH
|
|
var source = GLctx.getShaderSource(GL.shaders[shader]);
|
|
// source may be a null, or the empty string, both of which are falsey
|
|
// values that we report a 0 length for.
|
|
var sourceLength = source ? source.length + 1 : 0;
|
|
HEAP32[((p)>>2)] = sourceLength;
|
|
} else {
|
|
HEAP32[((p)>>2)] = GLctx.getShaderParameter(GL.shaders[shader], pname);
|
|
}
|
|
};
|
|
var _emscripten_glGetShaderiv = _glGetShaderiv;
|
|
|
|
|
|
|
|
var stringToNewUTF8 = (str) => {
|
|
var size = lengthBytesUTF8(str) + 1;
|
|
var ret = _malloc(size);
|
|
if (ret) stringToUTF8(str, ret, size);
|
|
return ret;
|
|
};
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetString = (name_) => {
|
|
var ret = GL.stringCache[name_];
|
|
if (!ret) {
|
|
switch (name_) {
|
|
case 0x1F03 /* GL_EXTENSIONS */:
|
|
ret = stringToNewUTF8(webglGetExtensions().join(' '));
|
|
break;
|
|
case 0x1F00 /* GL_VENDOR */:
|
|
case 0x1F01 /* GL_RENDERER */:
|
|
case 0x9245 /* UNMASKED_VENDOR_WEBGL */:
|
|
case 0x9246 /* UNMASKED_RENDERER_WEBGL */:
|
|
var s = GLctx.getParameter(name_);
|
|
if (!s) {
|
|
GL.recordError(0x500/*GL_INVALID_ENUM*/);
|
|
}
|
|
ret = s ? stringToNewUTF8(s) : 0;
|
|
break;
|
|
|
|
case 0x1F02 /* GL_VERSION */:
|
|
var glVersion = GLctx.getParameter(0x1F02 /*GL_VERSION*/);
|
|
// return GLES version string corresponding to the version of the WebGL context
|
|
if (GL.currentContext.version >= 2) glVersion = `OpenGL ES 3.0 (${glVersion})`;
|
|
else
|
|
{
|
|
glVersion = `OpenGL ES 2.0 (${glVersion})`;
|
|
}
|
|
ret = stringToNewUTF8(glVersion);
|
|
break;
|
|
case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */:
|
|
var glslVersion = GLctx.getParameter(0x8B8C /*GL_SHADING_LANGUAGE_VERSION*/);
|
|
// extract the version number 'N.M' from the string 'WebGL GLSL ES N.M ...'
|
|
var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;
|
|
var ver_num = glslVersion.match(ver_re);
|
|
if (ver_num !== null) {
|
|
if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + '0'; // ensure minor version has 2 digits
|
|
glslVersion = `OpenGL ES GLSL ES ${ver_num[1]} (${glslVersion})`;
|
|
}
|
|
ret = stringToNewUTF8(glslVersion);
|
|
break;
|
|
default:
|
|
GL.recordError(0x500/*GL_INVALID_ENUM*/);
|
|
// fall through
|
|
}
|
|
GL.stringCache[name_] = ret;
|
|
}
|
|
return ret;
|
|
};
|
|
var _emscripten_glGetString = _glGetString;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetStringi = (name, index) => {
|
|
if (GL.currentContext.version < 2) {
|
|
GL.recordError(0x502 /* GL_INVALID_OPERATION */); // Calling GLES3/WebGL2 function with a GLES2/WebGL1 context
|
|
return 0;
|
|
}
|
|
var stringiCache = GL.stringiCache[name];
|
|
if (stringiCache) {
|
|
if (index < 0 || index >= stringiCache.length) {
|
|
GL.recordError(0x501/*GL_INVALID_VALUE*/);
|
|
return 0;
|
|
}
|
|
return stringiCache[index];
|
|
}
|
|
switch (name) {
|
|
case 0x1F03 /* GL_EXTENSIONS */:
|
|
var exts = webglGetExtensions().map(stringToNewUTF8);
|
|
stringiCache = GL.stringiCache[name] = exts;
|
|
if (index < 0 || index >= stringiCache.length) {
|
|
GL.recordError(0x501/*GL_INVALID_VALUE*/);
|
|
return 0;
|
|
}
|
|
return stringiCache[index];
|
|
default:
|
|
GL.recordError(0x500/*GL_INVALID_ENUM*/);
|
|
return 0;
|
|
}
|
|
};
|
|
var _emscripten_glGetStringi = _glGetStringi;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetSynciv = (sync, pname, bufSize, length, values) => {
|
|
if (bufSize < 0) {
|
|
// GLES3 specification does not specify how to behave if bufSize < 0, however in the spec wording for glGetInternalformativ, it does say that GL_INVALID_VALUE should be raised,
|
|
// so raise GL_INVALID_VALUE here as well.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
if (!values) {
|
|
// GLES3 specification does not specify how to behave if values is a null pointer. Since calling this function does not make sense
|
|
// if values == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
var ret = GLctx.getSyncParameter(GL.syncs[sync], pname);
|
|
if (ret !== null) {
|
|
HEAP32[((values)>>2)] = ret;
|
|
if (length) HEAP32[((length)>>2)] = 1; // Report a single value outputted.
|
|
}
|
|
};
|
|
var _emscripten_glGetSynciv = _glGetSynciv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetTexParameterfv = (target, pname, params) => {
|
|
if (!params) {
|
|
// GLES2 specification does not specify how to behave if params is a null
|
|
// pointer. Since calling this function does not make sense if p == null,
|
|
// issue a GL error to notify user about it.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
HEAPF32[((params)>>2)] = GLctx.getTexParameter(target, pname);
|
|
};
|
|
var _emscripten_glGetTexParameterfv = _glGetTexParameterfv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetTexParameteriv = (target, pname, params) => {
|
|
if (!params) {
|
|
// GLES2 specification does not specify how to behave if params is a null
|
|
// pointer. Since calling this function does not make sense if p == null,
|
|
// issue a GL error to notify user about it.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
HEAP32[((params)>>2)] = GLctx.getTexParameter(target, pname);
|
|
};
|
|
var _emscripten_glGetTexParameteriv = _glGetTexParameteriv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetTransformFeedbackVarying = (program, index, bufSize, length, size, type, name) => {
|
|
program = GL.programs[program];
|
|
var info = GLctx.getTransformFeedbackVarying(program, index);
|
|
if (!info) return; // If an error occurred, the return parameters length, size, type and name will be unmodified.
|
|
|
|
if (name && bufSize > 0) {
|
|
var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize);
|
|
if (length) HEAP32[((length)>>2)] = numBytesWrittenExclNull;
|
|
} else {
|
|
if (length) HEAP32[((length)>>2)] = 0;
|
|
}
|
|
|
|
if (size) HEAP32[((size)>>2)] = info.size;
|
|
if (type) HEAP32[((type)>>2)] = info.type;
|
|
};
|
|
var _emscripten_glGetTransformFeedbackVarying = _glGetTransformFeedbackVarying;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetUniformBlockIndex = (program, uniformBlockName) => {
|
|
return GLctx.getUniformBlockIndex(GL.programs[program], UTF8ToString(uniformBlockName));
|
|
};
|
|
var _emscripten_glGetUniformBlockIndex = _glGetUniformBlockIndex;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetUniformIndices = (program, uniformCount, uniformNames, uniformIndices) => {
|
|
if (!uniformIndices) {
|
|
// GLES2 specification does not specify how to behave if uniformIndices is a null pointer. Since calling this function does not make sense
|
|
// if uniformIndices == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
if (uniformCount > 0 && (uniformNames == 0 || uniformIndices == 0)) {
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
program = GL.programs[program];
|
|
var names = [];
|
|
for (var i = 0; i < uniformCount; i++)
|
|
names.push(UTF8ToString(HEAP32[(((uniformNames)+(i*4))>>2)]));
|
|
|
|
var result = GLctx.getUniformIndices(program, names);
|
|
if (!result) return; // GL spec: If an error is generated, nothing is written out to uniformIndices.
|
|
|
|
var len = result.length;
|
|
for (var i = 0; i < len; i++) {
|
|
HEAP32[(((uniformIndices)+(i*4))>>2)] = result[i];
|
|
}
|
|
};
|
|
var _emscripten_glGetUniformIndices = _glGetUniformIndices;
|
|
|
|
|
|
/** @noinline */
|
|
var webglGetLeftBracePos = (name) => name.slice(-1) == ']' && name.lastIndexOf('[');
|
|
|
|
var webglPrepareUniformLocationsBeforeFirstUse = (program) => {
|
|
var uniformLocsById = program.uniformLocsById, // Maps GLuint -> WebGLUniformLocation
|
|
uniformSizeAndIdsByName = program.uniformSizeAndIdsByName, // Maps name -> [uniform array length, GLuint]
|
|
i, j;
|
|
|
|
// On the first time invocation of glGetUniformLocation on this shader program:
|
|
// initialize cache data structures and discover which uniforms are arrays.
|
|
if (!uniformLocsById) {
|
|
// maps GLint integer locations to WebGLUniformLocations
|
|
program.uniformLocsById = uniformLocsById = {};
|
|
// maps integer locations back to uniform name strings, so that we can lazily fetch uniform array locations
|
|
program.uniformArrayNamesById = {};
|
|
|
|
for (i = 0; i < GLctx.getProgramParameter(program, 0x8B86/*GL_ACTIVE_UNIFORMS*/); ++i) {
|
|
var u = GLctx.getActiveUniform(program, i);
|
|
var nm = u.name;
|
|
var sz = u.size;
|
|
var lb = webglGetLeftBracePos(nm);
|
|
var arrayName = lb > 0 ? nm.slice(0, lb) : nm;
|
|
|
|
// Assign a new location.
|
|
var id = program.uniformIdCounter;
|
|
program.uniformIdCounter += sz;
|
|
// Eagerly get the location of the uniformArray[0] base element.
|
|
// The remaining indices >0 will be left for lazy evaluation to
|
|
// improve performance. Those may never be needed to fetch, if the
|
|
// application fills arrays always in full starting from the first
|
|
// element of the array.
|
|
uniformSizeAndIdsByName[arrayName] = [sz, id];
|
|
|
|
// Store placeholder integers in place that highlight that these
|
|
// >0 index locations are array indices pending population.
|
|
for (j = 0; j < sz; ++j) {
|
|
uniformLocsById[id] = j;
|
|
program.uniformArrayNamesById[id++] = arrayName;
|
|
}
|
|
}
|
|
}
|
|
};
|
|
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetUniformLocation = (program, name) => {
|
|
|
|
name = UTF8ToString(name);
|
|
|
|
if (program = GL.programs[program]) {
|
|
webglPrepareUniformLocationsBeforeFirstUse(program);
|
|
var uniformLocsById = program.uniformLocsById; // Maps GLuint -> WebGLUniformLocation
|
|
var arrayIndex = 0;
|
|
var uniformBaseName = name;
|
|
|
|
// Invariant: when populating integer IDs for uniform locations, we must
|
|
// maintain the precondition that arrays reside in contiguous addresses,
|
|
// i.e. for a 'vec4 colors[10];', colors[4] must be at location
|
|
// colors[0]+4. However, user might call glGetUniformLocation(program,
|
|
// "colors") for an array, so we cannot discover based on the user input
|
|
// arguments whether the uniform we are dealing with is an array. The only
|
|
// way to discover which uniforms are arrays is to enumerate over all the
|
|
// active uniforms in the program.
|
|
var leftBrace = webglGetLeftBracePos(name);
|
|
|
|
// If user passed an array accessor "[index]", parse the array index off the accessor.
|
|
if (leftBrace > 0) {
|
|
arrayIndex = jstoi_q(name.slice(leftBrace + 1)) >>> 0; // "index]", coerce parseInt(']') with >>>0 to treat "foo[]" as "foo[0]" and foo[-1] as unsigned out-of-bounds.
|
|
uniformBaseName = name.slice(0, leftBrace);
|
|
}
|
|
|
|
// Have we cached the location of this uniform before?
|
|
// A pair [array length, GLint of the uniform location]
|
|
var sizeAndId = program.uniformSizeAndIdsByName[uniformBaseName];
|
|
|
|
// If an uniform with this name exists, and if its index is within the
|
|
// array limits (if it's even an array), query the WebGLlocation, or
|
|
// return an existing cached location.
|
|
if (sizeAndId && arrayIndex < sizeAndId[0]) {
|
|
arrayIndex += sizeAndId[1]; // Add the base location of the uniform to the array index offset.
|
|
if ((uniformLocsById[arrayIndex] = uniformLocsById[arrayIndex] || GLctx.getUniformLocation(program, name))) {
|
|
return arrayIndex;
|
|
}
|
|
}
|
|
}
|
|
else {
|
|
// N.b. we are currently unable to distinguish between GL program IDs that
|
|
// never existed vs GL program IDs that have been deleted, so report
|
|
// GL_INVALID_VALUE in both cases.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
}
|
|
return -1;
|
|
};
|
|
var _emscripten_glGetUniformLocation = _glGetUniformLocation;
|
|
|
|
var webglGetUniformLocation = (location) => {
|
|
var p = GLctx.currentProgram;
|
|
|
|
if (p) {
|
|
var webglLoc = p.uniformLocsById[location];
|
|
// p.uniformLocsById[location] stores either an integer, or a
|
|
// WebGLUniformLocation.
|
|
// If an integer, we have not yet bound the location, so do it now. The
|
|
// integer value specifies the array index we should bind to.
|
|
if (typeof webglLoc == 'number') {
|
|
p.uniformLocsById[location] = webglLoc = GLctx.getUniformLocation(p, p.uniformArrayNamesById[location] + (webglLoc > 0 ? `[${webglLoc}]` : ''));
|
|
}
|
|
// Else an already cached WebGLUniformLocation, return it.
|
|
return webglLoc;
|
|
} else {
|
|
GL.recordError(0x502/*GL_INVALID_OPERATION*/);
|
|
}
|
|
};
|
|
|
|
|
|
/** @suppress{checkTypes} */
|
|
var emscriptenWebGLGetUniform = (program, location, params, type) => {
|
|
if (!params) {
|
|
// GLES2 specification does not specify how to behave if params is a null
|
|
// pointer. Since calling this function does not make sense if params ==
|
|
// null, issue a GL error to notify user about it.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
program = GL.programs[program];
|
|
webglPrepareUniformLocationsBeforeFirstUse(program);
|
|
var data = GLctx.getUniform(program, webglGetUniformLocation(location));
|
|
if (typeof data == 'number' || typeof data == 'boolean') {
|
|
switch (type) {
|
|
case 0: HEAP32[((params)>>2)] = data; break;
|
|
case 2: HEAPF32[((params)>>2)] = data; break;
|
|
}
|
|
} else {
|
|
for (var i = 0; i < data.length; i++) {
|
|
switch (type) {
|
|
case 0: HEAP32[(((params)+(i*4))>>2)] = data[i]; break;
|
|
case 2: HEAPF32[(((params)+(i*4))>>2)] = data[i]; break;
|
|
}
|
|
}
|
|
}
|
|
};
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetUniformfv = (program, location, params) => {
|
|
emscriptenWebGLGetUniform(program, location, params, 2);
|
|
};
|
|
var _emscripten_glGetUniformfv = _glGetUniformfv;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetUniformiv = (program, location, params) => {
|
|
emscriptenWebGLGetUniform(program, location, params, 0);
|
|
};
|
|
var _emscripten_glGetUniformiv = _glGetUniformiv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetUniformuiv = (program, location, params) =>
|
|
emscriptenWebGLGetUniform(program, location, params, 0);
|
|
var _emscripten_glGetUniformuiv = _glGetUniformuiv;
|
|
|
|
/** @suppress{checkTypes} */
|
|
var emscriptenWebGLGetVertexAttrib = (index, pname, params, type) => {
|
|
if (!params) {
|
|
// GLES2 specification does not specify how to behave if params is a null
|
|
// pointer. Since calling this function does not make sense if params ==
|
|
// null, issue a GL error to notify user about it.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
var data = GLctx.getVertexAttrib(index, pname);
|
|
if (pname == 0x889F/*VERTEX_ATTRIB_ARRAY_BUFFER_BINDING*/) {
|
|
HEAP32[((params)>>2)] = data && data["name"];
|
|
} else if (typeof data == 'number' || typeof data == 'boolean') {
|
|
switch (type) {
|
|
case 0: HEAP32[((params)>>2)] = data; break;
|
|
case 2: HEAPF32[((params)>>2)] = data; break;
|
|
case 5: HEAP32[((params)>>2)] = Math.fround(data); break;
|
|
}
|
|
} else {
|
|
for (var i = 0; i < data.length; i++) {
|
|
switch (type) {
|
|
case 0: HEAP32[(((params)+(i*4))>>2)] = data[i]; break;
|
|
case 2: HEAPF32[(((params)+(i*4))>>2)] = data[i]; break;
|
|
case 5: HEAP32[(((params)+(i*4))>>2)] = Math.fround(data[i]); break;
|
|
}
|
|
}
|
|
}
|
|
};
|
|
/** @suppress {duplicate } */
|
|
var _glGetVertexAttribIiv = (index, pname, params) => {
|
|
// N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttribI4iv(),
|
|
// otherwise the results are undefined. (GLES3 spec 6.1.12)
|
|
emscriptenWebGLGetVertexAttrib(index, pname, params, 0);
|
|
};
|
|
var _emscripten_glGetVertexAttribIiv = _glGetVertexAttribIiv;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetVertexAttribIuiv = _glGetVertexAttribIiv;
|
|
var _emscripten_glGetVertexAttribIuiv = _glGetVertexAttribIuiv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetVertexAttribPointerv = (index, pname, pointer) => {
|
|
if (!pointer) {
|
|
// GLES2 specification does not specify how to behave if pointer is a null
|
|
// pointer. Since calling this function does not make sense if pointer ==
|
|
// null, issue a GL error to notify user about it.
|
|
GL.recordError(0x501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
HEAP32[((pointer)>>2)] = GLctx.getVertexAttribOffset(index, pname);
|
|
};
|
|
var _emscripten_glGetVertexAttribPointerv = _glGetVertexAttribPointerv;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetVertexAttribfv = (index, pname, params) => {
|
|
// N.B. This function may only be called if the vertex attribute was
|
|
// specified using the function glVertexAttrib*f(), otherwise the results
|
|
// are undefined. (GLES3 spec 6.1.12)
|
|
emscriptenWebGLGetVertexAttrib(index, pname, params, 2);
|
|
};
|
|
var _emscripten_glGetVertexAttribfv = _glGetVertexAttribfv;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glGetVertexAttribiv = (index, pname, params) => {
|
|
// N.B. This function may only be called if the vertex attribute was
|
|
// specified using the function glVertexAttrib*f(), otherwise the results
|
|
// are undefined. (GLES3 spec 6.1.12)
|
|
emscriptenWebGLGetVertexAttrib(index, pname, params, 5);
|
|
};
|
|
var _emscripten_glGetVertexAttribiv = _glGetVertexAttribiv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glHint = (x0, x1) => GLctx.hint(x0, x1);
|
|
var _emscripten_glHint = _glHint;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glInvalidateFramebuffer = (target, numAttachments, attachments) => {
|
|
var list = tempFixedLengthArray[numAttachments];
|
|
for (var i = 0; i < numAttachments; i++) {
|
|
list[i] = HEAP32[(((attachments)+(i*4))>>2)];
|
|
}
|
|
|
|
GLctx.invalidateFramebuffer(target, list);
|
|
};
|
|
var _emscripten_glInvalidateFramebuffer = _glInvalidateFramebuffer;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glInvalidateSubFramebuffer = (target, numAttachments, attachments, x, y, width, height) => {
|
|
var list = tempFixedLengthArray[numAttachments];
|
|
for (var i = 0; i < numAttachments; i++) {
|
|
list[i] = HEAP32[(((attachments)+(i*4))>>2)];
|
|
}
|
|
|
|
GLctx.invalidateSubFramebuffer(target, list, x, y, width, height);
|
|
};
|
|
var _emscripten_glInvalidateSubFramebuffer = _glInvalidateSubFramebuffer;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glIsBuffer = (buffer) => {
|
|
var b = GL.buffers[buffer];
|
|
if (!b) return 0;
|
|
return GLctx.isBuffer(b);
|
|
};
|
|
var _emscripten_glIsBuffer = _glIsBuffer;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glIsEnabled = (x0) => GLctx.isEnabled(x0);
|
|
var _emscripten_glIsEnabled = _glIsEnabled;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glIsFramebuffer = (framebuffer) => {
|
|
var fb = GL.framebuffers[framebuffer];
|
|
if (!fb) return 0;
|
|
return GLctx.isFramebuffer(fb);
|
|
};
|
|
var _emscripten_glIsFramebuffer = _glIsFramebuffer;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glIsProgram = (program) => {
|
|
program = GL.programs[program];
|
|
if (!program) return 0;
|
|
return GLctx.isProgram(program);
|
|
};
|
|
var _emscripten_glIsProgram = _glIsProgram;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glIsQuery = (id) => {
|
|
var query = GL.queries[id];
|
|
if (!query) return 0;
|
|
return GLctx.isQuery(query);
|
|
};
|
|
var _emscripten_glIsQuery = _glIsQuery;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glIsQueryEXT = (id) => {
|
|
var query = GL.queries[id];
|
|
if (!query) return 0;
|
|
return GLctx.disjointTimerQueryExt['isQueryEXT'](query);
|
|
};
|
|
var _emscripten_glIsQueryEXT = _glIsQueryEXT;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glIsRenderbuffer = (renderbuffer) => {
|
|
var rb = GL.renderbuffers[renderbuffer];
|
|
if (!rb) return 0;
|
|
return GLctx.isRenderbuffer(rb);
|
|
};
|
|
var _emscripten_glIsRenderbuffer = _glIsRenderbuffer;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glIsSampler = (id) => {
|
|
var sampler = GL.samplers[id];
|
|
if (!sampler) return 0;
|
|
return GLctx.isSampler(sampler);
|
|
};
|
|
var _emscripten_glIsSampler = _glIsSampler;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glIsShader = (shader) => {
|
|
var s = GL.shaders[shader];
|
|
if (!s) return 0;
|
|
return GLctx.isShader(s);
|
|
};
|
|
var _emscripten_glIsShader = _glIsShader;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glIsSync = (sync) => GLctx.isSync(GL.syncs[sync]);
|
|
var _emscripten_glIsSync = _glIsSync;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glIsTexture = (id) => {
|
|
var texture = GL.textures[id];
|
|
if (!texture) return 0;
|
|
return GLctx.isTexture(texture);
|
|
};
|
|
var _emscripten_glIsTexture = _glIsTexture;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glIsTransformFeedback = (id) => GLctx.isTransformFeedback(GL.transformFeedbacks[id]);
|
|
var _emscripten_glIsTransformFeedback = _glIsTransformFeedback;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glIsVertexArray = (array) => {
|
|
|
|
var vao = GL.vaos[array];
|
|
if (!vao) return 0;
|
|
return GLctx.isVertexArray(vao);
|
|
};
|
|
var _emscripten_glIsVertexArray = _glIsVertexArray;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glIsVertexArrayOES = _glIsVertexArray;
|
|
var _emscripten_glIsVertexArrayOES = _glIsVertexArrayOES;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glLineWidth = (x0) => GLctx.lineWidth(x0);
|
|
var _emscripten_glLineWidth = _glLineWidth;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glLinkProgram = (program) => {
|
|
program = GL.programs[program];
|
|
GLctx.linkProgram(program);
|
|
// Invalidate earlier computed uniform->ID mappings, those have now become stale
|
|
program.uniformLocsById = 0; // Mark as null-like so that glGetUniformLocation() knows to populate this again.
|
|
program.uniformSizeAndIdsByName = {};
|
|
|
|
};
|
|
var _emscripten_glLinkProgram = _glLinkProgram;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glPauseTransformFeedback = () => GLctx.pauseTransformFeedback();
|
|
var _emscripten_glPauseTransformFeedback = _glPauseTransformFeedback;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glPixelStorei = (pname, param) => {
|
|
if (pname == 0xCF5 /* GL_UNPACK_ALIGNMENT */) {
|
|
GL.unpackAlignment = param;
|
|
}
|
|
GLctx.pixelStorei(pname, param);
|
|
};
|
|
var _emscripten_glPixelStorei = _glPixelStorei;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glPolygonOffset = (x0, x1) => GLctx.polygonOffset(x0, x1);
|
|
var _emscripten_glPolygonOffset = _glPolygonOffset;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glProgramBinary = (program, binaryFormat, binary, length) => {
|
|
GL.recordError(0x500/*GL_INVALID_ENUM*/);
|
|
};
|
|
var _emscripten_glProgramBinary = _glProgramBinary;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glProgramParameteri = (program, pname, value) => {
|
|
GL.recordError(0x500/*GL_INVALID_ENUM*/);
|
|
};
|
|
var _emscripten_glProgramParameteri = _glProgramParameteri;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glQueryCounterEXT = (id, target) => {
|
|
GLctx.disjointTimerQueryExt['queryCounterEXT'](GL.queries[id], target);
|
|
};
|
|
var _emscripten_glQueryCounterEXT = _glQueryCounterEXT;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glReadBuffer = (x0) => GLctx.readBuffer(x0);
|
|
var _emscripten_glReadBuffer = _glReadBuffer;
|
|
|
|
var computeUnpackAlignedImageSize = (width, height, sizePerPixel, alignment) => {
|
|
function roundedToNextMultipleOf(x, y) {
|
|
return (x + y - 1) & -y;
|
|
}
|
|
var plainRowSize = width * sizePerPixel;
|
|
var alignedRowSize = roundedToNextMultipleOf(plainRowSize, alignment);
|
|
return height * alignedRowSize;
|
|
};
|
|
|
|
var colorChannelsInGlTextureFormat = (format) => {
|
|
// Micro-optimizations for size: map format to size by subtracting smallest
|
|
// enum value (0x1902) from all values first. Also omit the most common
|
|
// size value (1) from the list, which is assumed by formats not on the
|
|
// list.
|
|
var colorChannels = {
|
|
// 0x1902 /* GL_DEPTH_COMPONENT */ - 0x1902: 1,
|
|
// 0x1906 /* GL_ALPHA */ - 0x1902: 1,
|
|
5: 3,
|
|
6: 4,
|
|
// 0x1909 /* GL_LUMINANCE */ - 0x1902: 1,
|
|
8: 2,
|
|
29502: 3,
|
|
29504: 4,
|
|
// 0x1903 /* GL_RED */ - 0x1902: 1,
|
|
26917: 2,
|
|
26918: 2,
|
|
// 0x8D94 /* GL_RED_INTEGER */ - 0x1902: 1,
|
|
29846: 3,
|
|
29847: 4
|
|
};
|
|
return colorChannels[format - 0x1902]||1;
|
|
};
|
|
|
|
var heapObjectForWebGLType = (type) => {
|
|
// Micro-optimization for size: Subtract lowest GL enum number (0x1400/* GL_BYTE */) from type to compare
|
|
// smaller values for the heap, for shorter generated code size.
|
|
// Also the type HEAPU16 is not tested for explicitly, but any unrecognized type will return out HEAPU16.
|
|
// (since most types are HEAPU16)
|
|
type -= 0x1400;
|
|
if (type == 0) return HEAP8;
|
|
|
|
if (type == 1) return HEAPU8;
|
|
|
|
if (type == 2) return HEAP16;
|
|
|
|
if (type == 4) return HEAP32;
|
|
|
|
if (type == 6) return HEAPF32;
|
|
|
|
if (type == 5
|
|
|| type == 28922
|
|
|| type == 28520
|
|
|| type == 30779
|
|
|| type == 30782
|
|
)
|
|
return HEAPU32;
|
|
|
|
return HEAPU16;
|
|
};
|
|
|
|
var toTypedArrayIndex = (pointer, heap) =>
|
|
pointer >>> (31 - Math.clz32(heap.BYTES_PER_ELEMENT));
|
|
|
|
var emscriptenWebGLGetTexPixelData = (type, format, width, height, pixels, internalFormat) => {
|
|
var heap = heapObjectForWebGLType(type);
|
|
var sizePerPixel = colorChannelsInGlTextureFormat(format) * heap.BYTES_PER_ELEMENT;
|
|
var bytes = computeUnpackAlignedImageSize(width, height, sizePerPixel, GL.unpackAlignment);
|
|
return heap.subarray(toTypedArrayIndex(pixels, heap), toTypedArrayIndex(pixels + bytes, heap));
|
|
};
|
|
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glReadPixels = (x, y, width, height, format, type, pixels) => {
|
|
if (GL.currentContext.version >= 2) {
|
|
if (GLctx.currentPixelPackBufferBinding) {
|
|
GLctx.readPixels(x, y, width, height, format, type, pixels);
|
|
return;
|
|
}
|
|
var heap = heapObjectForWebGLType(type);
|
|
var target = toTypedArrayIndex(pixels, heap);
|
|
GLctx.readPixels(x, y, width, height, format, type, heap, target);
|
|
return;
|
|
}
|
|
var pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format);
|
|
if (!pixelData) {
|
|
GL.recordError(0x500/*GL_INVALID_ENUM*/);
|
|
return;
|
|
}
|
|
GLctx.readPixels(x, y, width, height, format, type, pixelData);
|
|
};
|
|
var _emscripten_glReadPixels = _glReadPixels;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glReleaseShaderCompiler = () => {
|
|
// NOP (as allowed by GLES 2.0 spec)
|
|
};
|
|
var _emscripten_glReleaseShaderCompiler = _glReleaseShaderCompiler;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glRenderbufferStorage = (x0, x1, x2, x3) => GLctx.renderbufferStorage(x0, x1, x2, x3);
|
|
var _emscripten_glRenderbufferStorage = _glRenderbufferStorage;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glRenderbufferStorageMultisample = (x0, x1, x2, x3, x4) => GLctx.renderbufferStorageMultisample(x0, x1, x2, x3, x4);
|
|
var _emscripten_glRenderbufferStorageMultisample = _glRenderbufferStorageMultisample;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glResumeTransformFeedback = () => GLctx.resumeTransformFeedback();
|
|
var _emscripten_glResumeTransformFeedback = _glResumeTransformFeedback;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glSampleCoverage = (value, invert) => {
|
|
GLctx.sampleCoverage(value, !!invert);
|
|
};
|
|
var _emscripten_glSampleCoverage = _glSampleCoverage;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glSamplerParameterf = (sampler, pname, param) => {
|
|
GLctx.samplerParameterf(GL.samplers[sampler], pname, param);
|
|
};
|
|
var _emscripten_glSamplerParameterf = _glSamplerParameterf;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glSamplerParameterfv = (sampler, pname, params) => {
|
|
var param = HEAPF32[((params)>>2)];
|
|
GLctx.samplerParameterf(GL.samplers[sampler], pname, param);
|
|
};
|
|
var _emscripten_glSamplerParameterfv = _glSamplerParameterfv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glSamplerParameteri = (sampler, pname, param) => {
|
|
GLctx.samplerParameteri(GL.samplers[sampler], pname, param);
|
|
};
|
|
var _emscripten_glSamplerParameteri = _glSamplerParameteri;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glSamplerParameteriv = (sampler, pname, params) => {
|
|
var param = HEAP32[((params)>>2)];
|
|
GLctx.samplerParameteri(GL.samplers[sampler], pname, param);
|
|
};
|
|
var _emscripten_glSamplerParameteriv = _glSamplerParameteriv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glScissor = (x0, x1, x2, x3) => GLctx.scissor(x0, x1, x2, x3);
|
|
var _emscripten_glScissor = _glScissor;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glShaderBinary = (count, shaders, binaryformat, binary, length) => {
|
|
GL.recordError(0x500/*GL_INVALID_ENUM*/);
|
|
};
|
|
var _emscripten_glShaderBinary = _glShaderBinary;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glShaderSource = (shader, count, string, length) => {
|
|
var source = GL.getSource(shader, count, string, length);
|
|
|
|
GLctx.shaderSource(GL.shaders[shader], source);
|
|
};
|
|
var _emscripten_glShaderSource = _glShaderSource;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glStencilFunc = (x0, x1, x2) => GLctx.stencilFunc(x0, x1, x2);
|
|
var _emscripten_glStencilFunc = _glStencilFunc;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glStencilFuncSeparate = (x0, x1, x2, x3) => GLctx.stencilFuncSeparate(x0, x1, x2, x3);
|
|
var _emscripten_glStencilFuncSeparate = _glStencilFuncSeparate;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glStencilMask = (x0) => GLctx.stencilMask(x0);
|
|
var _emscripten_glStencilMask = _glStencilMask;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glStencilMaskSeparate = (x0, x1) => GLctx.stencilMaskSeparate(x0, x1);
|
|
var _emscripten_glStencilMaskSeparate = _glStencilMaskSeparate;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glStencilOp = (x0, x1, x2) => GLctx.stencilOp(x0, x1, x2);
|
|
var _emscripten_glStencilOp = _glStencilOp;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glStencilOpSeparate = (x0, x1, x2, x3) => GLctx.stencilOpSeparate(x0, x1, x2, x3);
|
|
var _emscripten_glStencilOpSeparate = _glStencilOpSeparate;
|
|
|
|
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glTexImage2D = (target, level, internalFormat, width, height, border, format, type, pixels) => {
|
|
if (GL.currentContext.version >= 2) {
|
|
if (GLctx.currentPixelUnpackBufferBinding) {
|
|
GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixels);
|
|
return;
|
|
}
|
|
if (pixels) {
|
|
var heap = heapObjectForWebGLType(type);
|
|
var index = toTypedArrayIndex(pixels, heap);
|
|
GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, heap, index);
|
|
return;
|
|
}
|
|
}
|
|
var pixelData = pixels ? emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) : null;
|
|
GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData);
|
|
};
|
|
var _emscripten_glTexImage2D = _glTexImage2D;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glTexImage3D = (target, level, internalFormat, width, height, depth, border, format, type, pixels) => {
|
|
if (GLctx.currentPixelUnpackBufferBinding) {
|
|
GLctx.texImage3D(target, level, internalFormat, width, height, depth, border, format, type, pixels);
|
|
} else if (pixels) {
|
|
var heap = heapObjectForWebGLType(type);
|
|
GLctx.texImage3D(target, level, internalFormat, width, height, depth, border, format, type, heap, toTypedArrayIndex(pixels, heap));
|
|
} else {
|
|
GLctx.texImage3D(target, level, internalFormat, width, height, depth, border, format, type, null);
|
|
}
|
|
};
|
|
var _emscripten_glTexImage3D = _glTexImage3D;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glTexParameterf = (x0, x1, x2) => GLctx.texParameterf(x0, x1, x2);
|
|
var _emscripten_glTexParameterf = _glTexParameterf;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glTexParameterfv = (target, pname, params) => {
|
|
var param = HEAPF32[((params)>>2)];
|
|
GLctx.texParameterf(target, pname, param);
|
|
};
|
|
var _emscripten_glTexParameterfv = _glTexParameterfv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glTexParameteri = (x0, x1, x2) => GLctx.texParameteri(x0, x1, x2);
|
|
var _emscripten_glTexParameteri = _glTexParameteri;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glTexParameteriv = (target, pname, params) => {
|
|
var param = HEAP32[((params)>>2)];
|
|
GLctx.texParameteri(target, pname, param);
|
|
};
|
|
var _emscripten_glTexParameteriv = _glTexParameteriv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glTexStorage2D = (x0, x1, x2, x3, x4) => GLctx.texStorage2D(x0, x1, x2, x3, x4);
|
|
var _emscripten_glTexStorage2D = _glTexStorage2D;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glTexStorage3D = (x0, x1, x2, x3, x4, x5) => GLctx.texStorage3D(x0, x1, x2, x3, x4, x5);
|
|
var _emscripten_glTexStorage3D = _glTexStorage3D;
|
|
|
|
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glTexSubImage2D = (target, level, xoffset, yoffset, width, height, format, type, pixels) => {
|
|
if (GL.currentContext.version >= 2) {
|
|
if (GLctx.currentPixelUnpackBufferBinding) {
|
|
GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels);
|
|
return;
|
|
}
|
|
if (pixels) {
|
|
var heap = heapObjectForWebGLType(type);
|
|
GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, heap, toTypedArrayIndex(pixels, heap));
|
|
return;
|
|
}
|
|
}
|
|
var pixelData = pixels ? emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, 0) : null;
|
|
GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixelData);
|
|
};
|
|
var _emscripten_glTexSubImage2D = _glTexSubImage2D;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glTexSubImage3D = (target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, pixels) => {
|
|
if (GLctx.currentPixelUnpackBufferBinding) {
|
|
GLctx.texSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, pixels);
|
|
} else if (pixels) {
|
|
var heap = heapObjectForWebGLType(type);
|
|
GLctx.texSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, heap, toTypedArrayIndex(pixels, heap));
|
|
} else {
|
|
GLctx.texSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, null);
|
|
}
|
|
};
|
|
var _emscripten_glTexSubImage3D = _glTexSubImage3D;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glTransformFeedbackVaryings = (program, count, varyings, bufferMode) => {
|
|
program = GL.programs[program];
|
|
var vars = [];
|
|
for (var i = 0; i < count; i++)
|
|
vars.push(UTF8ToString(HEAP32[(((varyings)+(i*4))>>2)]));
|
|
|
|
GLctx.transformFeedbackVaryings(program, vars, bufferMode);
|
|
};
|
|
var _emscripten_glTransformFeedbackVaryings = _glTransformFeedbackVaryings;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniform1f = (location, v0) => {
|
|
GLctx.uniform1f(webglGetUniformLocation(location), v0);
|
|
};
|
|
var _emscripten_glUniform1f = _glUniform1f;
|
|
|
|
|
|
var miniTempWebGLFloatBuffers = [];
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniform1fv = (location, count, value) => {
|
|
|
|
if (GL.currentContext.version >= 2) {
|
|
count && GLctx.uniform1fv(webglGetUniformLocation(location), HEAPF32, ((value)>>2), count);
|
|
return;
|
|
}
|
|
|
|
if (count <= 288) {
|
|
// avoid allocation when uploading few enough uniforms
|
|
var view = miniTempWebGLFloatBuffers[count-1];
|
|
for (var i = 0; i < count; ++i) {
|
|
view[i] = HEAPF32[(((value)+(4*i))>>2)];
|
|
}
|
|
} else
|
|
{
|
|
var view = HEAPF32.subarray((((value)>>2)), ((value+count*4)>>2));
|
|
}
|
|
GLctx.uniform1fv(webglGetUniformLocation(location), view);
|
|
};
|
|
var _emscripten_glUniform1fv = _glUniform1fv;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniform1i = (location, v0) => {
|
|
GLctx.uniform1i(webglGetUniformLocation(location), v0);
|
|
};
|
|
var _emscripten_glUniform1i = _glUniform1i;
|
|
|
|
|
|
var miniTempWebGLIntBuffers = [];
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniform1iv = (location, count, value) => {
|
|
|
|
if (GL.currentContext.version >= 2) {
|
|
count && GLctx.uniform1iv(webglGetUniformLocation(location), HEAP32, ((value)>>2), count);
|
|
return;
|
|
}
|
|
|
|
if (count <= 288) {
|
|
// avoid allocation when uploading few enough uniforms
|
|
var view = miniTempWebGLIntBuffers[count-1];
|
|
for (var i = 0; i < count; ++i) {
|
|
view[i] = HEAP32[(((value)+(4*i))>>2)];
|
|
}
|
|
} else
|
|
{
|
|
var view = HEAP32.subarray((((value)>>2)), ((value+count*4)>>2));
|
|
}
|
|
GLctx.uniform1iv(webglGetUniformLocation(location), view);
|
|
};
|
|
var _emscripten_glUniform1iv = _glUniform1iv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniform1ui = (location, v0) => {
|
|
GLctx.uniform1ui(webglGetUniformLocation(location), v0);
|
|
};
|
|
var _emscripten_glUniform1ui = _glUniform1ui;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniform1uiv = (location, count, value) => {
|
|
count && GLctx.uniform1uiv(webglGetUniformLocation(location), HEAPU32, ((value)>>2), count);
|
|
};
|
|
var _emscripten_glUniform1uiv = _glUniform1uiv;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniform2f = (location, v0, v1) => {
|
|
GLctx.uniform2f(webglGetUniformLocation(location), v0, v1);
|
|
};
|
|
var _emscripten_glUniform2f = _glUniform2f;
|
|
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniform2fv = (location, count, value) => {
|
|
|
|
if (GL.currentContext.version >= 2) {
|
|
count && GLctx.uniform2fv(webglGetUniformLocation(location), HEAPF32, ((value)>>2), count*2);
|
|
return;
|
|
}
|
|
|
|
if (count <= 144) {
|
|
// avoid allocation when uploading few enough uniforms
|
|
var view = miniTempWebGLFloatBuffers[2*count-1];
|
|
for (var i = 0; i < 2*count; i += 2) {
|
|
view[i] = HEAPF32[(((value)+(4*i))>>2)];
|
|
view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
|
|
}
|
|
} else
|
|
{
|
|
var view = HEAPF32.subarray((((value)>>2)), ((value+count*8)>>2));
|
|
}
|
|
GLctx.uniform2fv(webglGetUniformLocation(location), view);
|
|
};
|
|
var _emscripten_glUniform2fv = _glUniform2fv;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniform2i = (location, v0, v1) => {
|
|
GLctx.uniform2i(webglGetUniformLocation(location), v0, v1);
|
|
};
|
|
var _emscripten_glUniform2i = _glUniform2i;
|
|
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniform2iv = (location, count, value) => {
|
|
|
|
if (GL.currentContext.version >= 2) {
|
|
count && GLctx.uniform2iv(webglGetUniformLocation(location), HEAP32, ((value)>>2), count*2);
|
|
return;
|
|
}
|
|
|
|
if (count <= 144) {
|
|
// avoid allocation when uploading few enough uniforms
|
|
var view = miniTempWebGLIntBuffers[2*count-1];
|
|
for (var i = 0; i < 2*count; i += 2) {
|
|
view[i] = HEAP32[(((value)+(4*i))>>2)];
|
|
view[i+1] = HEAP32[(((value)+(4*i+4))>>2)];
|
|
}
|
|
} else
|
|
{
|
|
var view = HEAP32.subarray((((value)>>2)), ((value+count*8)>>2));
|
|
}
|
|
GLctx.uniform2iv(webglGetUniformLocation(location), view);
|
|
};
|
|
var _emscripten_glUniform2iv = _glUniform2iv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniform2ui = (location, v0, v1) => {
|
|
GLctx.uniform2ui(webglGetUniformLocation(location), v0, v1);
|
|
};
|
|
var _emscripten_glUniform2ui = _glUniform2ui;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniform2uiv = (location, count, value) => {
|
|
count && GLctx.uniform2uiv(webglGetUniformLocation(location), HEAPU32, ((value)>>2), count*2);
|
|
};
|
|
var _emscripten_glUniform2uiv = _glUniform2uiv;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniform3f = (location, v0, v1, v2) => {
|
|
GLctx.uniform3f(webglGetUniformLocation(location), v0, v1, v2);
|
|
};
|
|
var _emscripten_glUniform3f = _glUniform3f;
|
|
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniform3fv = (location, count, value) => {
|
|
|
|
if (GL.currentContext.version >= 2) {
|
|
count && GLctx.uniform3fv(webglGetUniformLocation(location), HEAPF32, ((value)>>2), count*3);
|
|
return;
|
|
}
|
|
|
|
if (count <= 96) {
|
|
// avoid allocation when uploading few enough uniforms
|
|
var view = miniTempWebGLFloatBuffers[3*count-1];
|
|
for (var i = 0; i < 3*count; i += 3) {
|
|
view[i] = HEAPF32[(((value)+(4*i))>>2)];
|
|
view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
|
|
view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
|
|
}
|
|
} else
|
|
{
|
|
var view = HEAPF32.subarray((((value)>>2)), ((value+count*12)>>2));
|
|
}
|
|
GLctx.uniform3fv(webglGetUniformLocation(location), view);
|
|
};
|
|
var _emscripten_glUniform3fv = _glUniform3fv;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniform3i = (location, v0, v1, v2) => {
|
|
GLctx.uniform3i(webglGetUniformLocation(location), v0, v1, v2);
|
|
};
|
|
var _emscripten_glUniform3i = _glUniform3i;
|
|
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniform3iv = (location, count, value) => {
|
|
|
|
if (GL.currentContext.version >= 2) {
|
|
count && GLctx.uniform3iv(webglGetUniformLocation(location), HEAP32, ((value)>>2), count*3);
|
|
return;
|
|
}
|
|
|
|
if (count <= 96) {
|
|
// avoid allocation when uploading few enough uniforms
|
|
var view = miniTempWebGLIntBuffers[3*count-1];
|
|
for (var i = 0; i < 3*count; i += 3) {
|
|
view[i] = HEAP32[(((value)+(4*i))>>2)];
|
|
view[i+1] = HEAP32[(((value)+(4*i+4))>>2)];
|
|
view[i+2] = HEAP32[(((value)+(4*i+8))>>2)];
|
|
}
|
|
} else
|
|
{
|
|
var view = HEAP32.subarray((((value)>>2)), ((value+count*12)>>2));
|
|
}
|
|
GLctx.uniform3iv(webglGetUniformLocation(location), view);
|
|
};
|
|
var _emscripten_glUniform3iv = _glUniform3iv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniform3ui = (location, v0, v1, v2) => {
|
|
GLctx.uniform3ui(webglGetUniformLocation(location), v0, v1, v2);
|
|
};
|
|
var _emscripten_glUniform3ui = _glUniform3ui;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniform3uiv = (location, count, value) => {
|
|
count && GLctx.uniform3uiv(webglGetUniformLocation(location), HEAPU32, ((value)>>2), count*3);
|
|
};
|
|
var _emscripten_glUniform3uiv = _glUniform3uiv;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniform4f = (location, v0, v1, v2, v3) => {
|
|
GLctx.uniform4f(webglGetUniformLocation(location), v0, v1, v2, v3);
|
|
};
|
|
var _emscripten_glUniform4f = _glUniform4f;
|
|
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniform4fv = (location, count, value) => {
|
|
|
|
if (GL.currentContext.version >= 2) {
|
|
count && GLctx.uniform4fv(webglGetUniformLocation(location), HEAPF32, ((value)>>2), count*4);
|
|
return;
|
|
}
|
|
|
|
if (count <= 72) {
|
|
// avoid allocation when uploading few enough uniforms
|
|
var view = miniTempWebGLFloatBuffers[4*count-1];
|
|
// hoist the heap out of the loop for size and for pthreads+growth.
|
|
var heap = HEAPF32;
|
|
value = ((value)>>2);
|
|
for (var i = 0; i < 4 * count; i += 4) {
|
|
var dst = value + i;
|
|
view[i] = heap[dst];
|
|
view[i + 1] = heap[dst + 1];
|
|
view[i + 2] = heap[dst + 2];
|
|
view[i + 3] = heap[dst + 3];
|
|
}
|
|
} else
|
|
{
|
|
var view = HEAPF32.subarray((((value)>>2)), ((value+count*16)>>2));
|
|
}
|
|
GLctx.uniform4fv(webglGetUniformLocation(location), view);
|
|
};
|
|
var _emscripten_glUniform4fv = _glUniform4fv;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniform4i = (location, v0, v1, v2, v3) => {
|
|
GLctx.uniform4i(webglGetUniformLocation(location), v0, v1, v2, v3);
|
|
};
|
|
var _emscripten_glUniform4i = _glUniform4i;
|
|
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniform4iv = (location, count, value) => {
|
|
|
|
if (GL.currentContext.version >= 2) {
|
|
count && GLctx.uniform4iv(webglGetUniformLocation(location), HEAP32, ((value)>>2), count*4);
|
|
return;
|
|
}
|
|
|
|
if (count <= 72) {
|
|
// avoid allocation when uploading few enough uniforms
|
|
var view = miniTempWebGLIntBuffers[4*count-1];
|
|
for (var i = 0; i < 4*count; i += 4) {
|
|
view[i] = HEAP32[(((value)+(4*i))>>2)];
|
|
view[i+1] = HEAP32[(((value)+(4*i+4))>>2)];
|
|
view[i+2] = HEAP32[(((value)+(4*i+8))>>2)];
|
|
view[i+3] = HEAP32[(((value)+(4*i+12))>>2)];
|
|
}
|
|
} else
|
|
{
|
|
var view = HEAP32.subarray((((value)>>2)), ((value+count*16)>>2));
|
|
}
|
|
GLctx.uniform4iv(webglGetUniformLocation(location), view);
|
|
};
|
|
var _emscripten_glUniform4iv = _glUniform4iv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniform4ui = (location, v0, v1, v2, v3) => {
|
|
GLctx.uniform4ui(webglGetUniformLocation(location), v0, v1, v2, v3);
|
|
};
|
|
var _emscripten_glUniform4ui = _glUniform4ui;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniform4uiv = (location, count, value) => {
|
|
count && GLctx.uniform4uiv(webglGetUniformLocation(location), HEAPU32, ((value)>>2), count*4);
|
|
};
|
|
var _emscripten_glUniform4uiv = _glUniform4uiv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniformBlockBinding = (program, uniformBlockIndex, uniformBlockBinding) => {
|
|
program = GL.programs[program];
|
|
|
|
GLctx.uniformBlockBinding(program, uniformBlockIndex, uniformBlockBinding);
|
|
};
|
|
var _emscripten_glUniformBlockBinding = _glUniformBlockBinding;
|
|
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniformMatrix2fv = (location, count, transpose, value) => {
|
|
|
|
if (GL.currentContext.version >= 2) {
|
|
count && GLctx.uniformMatrix2fv(webglGetUniformLocation(location), !!transpose, HEAPF32, ((value)>>2), count*4);
|
|
return;
|
|
}
|
|
|
|
if (count <= 72) {
|
|
// avoid allocation when uploading few enough uniforms
|
|
var view = miniTempWebGLFloatBuffers[4*count-1];
|
|
for (var i = 0; i < 4*count; i += 4) {
|
|
view[i] = HEAPF32[(((value)+(4*i))>>2)];
|
|
view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
|
|
view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
|
|
view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
|
|
}
|
|
} else
|
|
{
|
|
var view = HEAPF32.subarray((((value)>>2)), ((value+count*16)>>2));
|
|
}
|
|
GLctx.uniformMatrix2fv(webglGetUniformLocation(location), !!transpose, view);
|
|
};
|
|
var _emscripten_glUniformMatrix2fv = _glUniformMatrix2fv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniformMatrix2x3fv = (location, count, transpose, value) => {
|
|
count && GLctx.uniformMatrix2x3fv(webglGetUniformLocation(location), !!transpose, HEAPF32, ((value)>>2), count*6);
|
|
};
|
|
var _emscripten_glUniformMatrix2x3fv = _glUniformMatrix2x3fv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniformMatrix2x4fv = (location, count, transpose, value) => {
|
|
count && GLctx.uniformMatrix2x4fv(webglGetUniformLocation(location), !!transpose, HEAPF32, ((value)>>2), count*8);
|
|
};
|
|
var _emscripten_glUniformMatrix2x4fv = _glUniformMatrix2x4fv;
|
|
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniformMatrix3fv = (location, count, transpose, value) => {
|
|
|
|
if (GL.currentContext.version >= 2) {
|
|
count && GLctx.uniformMatrix3fv(webglGetUniformLocation(location), !!transpose, HEAPF32, ((value)>>2), count*9);
|
|
return;
|
|
}
|
|
|
|
if (count <= 32) {
|
|
// avoid allocation when uploading few enough uniforms
|
|
var view = miniTempWebGLFloatBuffers[9*count-1];
|
|
for (var i = 0; i < 9*count; i += 9) {
|
|
view[i] = HEAPF32[(((value)+(4*i))>>2)];
|
|
view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
|
|
view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
|
|
view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
|
|
view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)];
|
|
view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)];
|
|
view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)];
|
|
view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)];
|
|
view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)];
|
|
}
|
|
} else
|
|
{
|
|
var view = HEAPF32.subarray((((value)>>2)), ((value+count*36)>>2));
|
|
}
|
|
GLctx.uniformMatrix3fv(webglGetUniformLocation(location), !!transpose, view);
|
|
};
|
|
var _emscripten_glUniformMatrix3fv = _glUniformMatrix3fv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniformMatrix3x2fv = (location, count, transpose, value) => {
|
|
count && GLctx.uniformMatrix3x2fv(webglGetUniformLocation(location), !!transpose, HEAPF32, ((value)>>2), count*6);
|
|
};
|
|
var _emscripten_glUniformMatrix3x2fv = _glUniformMatrix3x2fv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniformMatrix3x4fv = (location, count, transpose, value) => {
|
|
count && GLctx.uniformMatrix3x4fv(webglGetUniformLocation(location), !!transpose, HEAPF32, ((value)>>2), count*12);
|
|
};
|
|
var _emscripten_glUniformMatrix3x4fv = _glUniformMatrix3x4fv;
|
|
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniformMatrix4fv = (location, count, transpose, value) => {
|
|
|
|
if (GL.currentContext.version >= 2) {
|
|
count && GLctx.uniformMatrix4fv(webglGetUniformLocation(location), !!transpose, HEAPF32, ((value)>>2), count*16);
|
|
return;
|
|
}
|
|
|
|
if (count <= 18) {
|
|
// avoid allocation when uploading few enough uniforms
|
|
var view = miniTempWebGLFloatBuffers[16*count-1];
|
|
// hoist the heap out of the loop for size and for pthreads+growth.
|
|
var heap = HEAPF32;
|
|
value = ((value)>>2);
|
|
for (var i = 0; i < 16 * count; i += 16) {
|
|
var dst = value + i;
|
|
view[i] = heap[dst];
|
|
view[i + 1] = heap[dst + 1];
|
|
view[i + 2] = heap[dst + 2];
|
|
view[i + 3] = heap[dst + 3];
|
|
view[i + 4] = heap[dst + 4];
|
|
view[i + 5] = heap[dst + 5];
|
|
view[i + 6] = heap[dst + 6];
|
|
view[i + 7] = heap[dst + 7];
|
|
view[i + 8] = heap[dst + 8];
|
|
view[i + 9] = heap[dst + 9];
|
|
view[i + 10] = heap[dst + 10];
|
|
view[i + 11] = heap[dst + 11];
|
|
view[i + 12] = heap[dst + 12];
|
|
view[i + 13] = heap[dst + 13];
|
|
view[i + 14] = heap[dst + 14];
|
|
view[i + 15] = heap[dst + 15];
|
|
}
|
|
} else
|
|
{
|
|
var view = HEAPF32.subarray((((value)>>2)), ((value+count*64)>>2));
|
|
}
|
|
GLctx.uniformMatrix4fv(webglGetUniformLocation(location), !!transpose, view);
|
|
};
|
|
var _emscripten_glUniformMatrix4fv = _glUniformMatrix4fv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniformMatrix4x2fv = (location, count, transpose, value) => {
|
|
count && GLctx.uniformMatrix4x2fv(webglGetUniformLocation(location), !!transpose, HEAPF32, ((value)>>2), count*8);
|
|
};
|
|
var _emscripten_glUniformMatrix4x2fv = _glUniformMatrix4x2fv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUniformMatrix4x3fv = (location, count, transpose, value) => {
|
|
count && GLctx.uniformMatrix4x3fv(webglGetUniformLocation(location), !!transpose, HEAPF32, ((value)>>2), count*12);
|
|
};
|
|
var _emscripten_glUniformMatrix4x3fv = _glUniformMatrix4x3fv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glUseProgram = (program) => {
|
|
program = GL.programs[program];
|
|
GLctx.useProgram(program);
|
|
// Record the currently active program so that we can access the uniform
|
|
// mapping table of that program.
|
|
GLctx.currentProgram = program;
|
|
};
|
|
var _emscripten_glUseProgram = _glUseProgram;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glValidateProgram = (program) => {
|
|
GLctx.validateProgram(GL.programs[program]);
|
|
};
|
|
var _emscripten_glValidateProgram = _glValidateProgram;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glVertexAttrib1f = (x0, x1) => GLctx.vertexAttrib1f(x0, x1);
|
|
var _emscripten_glVertexAttrib1f = _glVertexAttrib1f;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glVertexAttrib1fv = (index, v) => {
|
|
|
|
GLctx.vertexAttrib1f(index, HEAPF32[v>>2]);
|
|
};
|
|
var _emscripten_glVertexAttrib1fv = _glVertexAttrib1fv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glVertexAttrib2f = (x0, x1, x2) => GLctx.vertexAttrib2f(x0, x1, x2);
|
|
var _emscripten_glVertexAttrib2f = _glVertexAttrib2f;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glVertexAttrib2fv = (index, v) => {
|
|
|
|
GLctx.vertexAttrib2f(index, HEAPF32[v>>2], HEAPF32[v+4>>2]);
|
|
};
|
|
var _emscripten_glVertexAttrib2fv = _glVertexAttrib2fv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glVertexAttrib3f = (x0, x1, x2, x3) => GLctx.vertexAttrib3f(x0, x1, x2, x3);
|
|
var _emscripten_glVertexAttrib3f = _glVertexAttrib3f;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glVertexAttrib3fv = (index, v) => {
|
|
|
|
GLctx.vertexAttrib3f(index, HEAPF32[v>>2], HEAPF32[v+4>>2], HEAPF32[v+8>>2]);
|
|
};
|
|
var _emscripten_glVertexAttrib3fv = _glVertexAttrib3fv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glVertexAttrib4f = (x0, x1, x2, x3, x4) => GLctx.vertexAttrib4f(x0, x1, x2, x3, x4);
|
|
var _emscripten_glVertexAttrib4f = _glVertexAttrib4f;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glVertexAttrib4fv = (index, v) => {
|
|
|
|
GLctx.vertexAttrib4f(index, HEAPF32[v>>2], HEAPF32[v+4>>2], HEAPF32[v+8>>2], HEAPF32[v+12>>2]);
|
|
};
|
|
var _emscripten_glVertexAttrib4fv = _glVertexAttrib4fv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glVertexAttribDivisor = (index, divisor) => {
|
|
GLctx.vertexAttribDivisor(index, divisor);
|
|
};
|
|
var _emscripten_glVertexAttribDivisor = _glVertexAttribDivisor;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glVertexAttribDivisorANGLE = _glVertexAttribDivisor;
|
|
var _emscripten_glVertexAttribDivisorANGLE = _glVertexAttribDivisorANGLE;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glVertexAttribDivisorARB = _glVertexAttribDivisor;
|
|
var _emscripten_glVertexAttribDivisorARB = _glVertexAttribDivisorARB;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glVertexAttribDivisorEXT = _glVertexAttribDivisor;
|
|
var _emscripten_glVertexAttribDivisorEXT = _glVertexAttribDivisorEXT;
|
|
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glVertexAttribDivisorNV = _glVertexAttribDivisor;
|
|
var _emscripten_glVertexAttribDivisorNV = _glVertexAttribDivisorNV;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glVertexAttribI4i = (x0, x1, x2, x3, x4) => GLctx.vertexAttribI4i(x0, x1, x2, x3, x4);
|
|
var _emscripten_glVertexAttribI4i = _glVertexAttribI4i;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glVertexAttribI4iv = (index, v) => {
|
|
GLctx.vertexAttribI4i(index, HEAP32[v>>2], HEAP32[v+4>>2], HEAP32[v+8>>2], HEAP32[v+12>>2]);
|
|
};
|
|
var _emscripten_glVertexAttribI4iv = _glVertexAttribI4iv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glVertexAttribI4ui = (x0, x1, x2, x3, x4) => GLctx.vertexAttribI4ui(x0, x1, x2, x3, x4);
|
|
var _emscripten_glVertexAttribI4ui = _glVertexAttribI4ui;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glVertexAttribI4uiv = (index, v) => {
|
|
GLctx.vertexAttribI4ui(index, HEAPU32[v>>2], HEAPU32[v+4>>2], HEAPU32[v+8>>2], HEAPU32[v+12>>2]);
|
|
};
|
|
var _emscripten_glVertexAttribI4uiv = _glVertexAttribI4uiv;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glVertexAttribIPointer = (index, size, type, stride, ptr) => {
|
|
GLctx.vertexAttribIPointer(index, size, type, stride, ptr);
|
|
};
|
|
var _emscripten_glVertexAttribIPointer = _glVertexAttribIPointer;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glVertexAttribPointer = (index, size, type, normalized, stride, ptr) => {
|
|
GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr);
|
|
};
|
|
var _emscripten_glVertexAttribPointer = _glVertexAttribPointer;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glViewport = (x0, x1, x2, x3) => GLctx.viewport(x0, x1, x2, x3);
|
|
var _emscripten_glViewport = _glViewport;
|
|
|
|
/** @suppress {duplicate } */
|
|
var _glWaitSync = (sync, flags, timeout) => {
|
|
// See WebGL2 vs GLES3 difference on GL_TIMEOUT_IGNORED above (https://www.khronos.org/registry/webgl/specs/latest/2.0/#5.15)
|
|
timeout = Number(timeout);
|
|
GLctx.waitSync(GL.syncs[sync], flags, timeout);
|
|
};
|
|
var _emscripten_glWaitSync = _glWaitSync;
|
|
|
|
|
|
var growMemory = (size) => {
|
|
var b = wasmMemory.buffer;
|
|
var pages = (size - b.byteLength + 65535) / 65536;
|
|
try {
|
|
// round size grow request up to wasm page size (fixed 64KB per spec)
|
|
wasmMemory.grow(pages); // .grow() takes a delta compared to the previous size
|
|
updateMemoryViews();
|
|
return 1 /*success*/;
|
|
} catch(e) {
|
|
}
|
|
// implicit 0 return to save code size (caller will cast "undefined" into 0
|
|
// anyhow)
|
|
};
|
|
var _emscripten_resize_heap = (requestedSize) => {
|
|
var oldSize = HEAPU8.length;
|
|
// With CAN_ADDRESS_2GB or MEMORY64, pointers are already unsigned.
|
|
requestedSize >>>= 0;
|
|
// With multithreaded builds, races can happen (another thread might increase the size
|
|
// in between), so return a failure, and let the caller retry.
|
|
|
|
// Memory resize rules:
|
|
// 1. Always increase heap size to at least the requested size, rounded up
|
|
// to next page multiple.
|
|
// 2a. If MEMORY_GROWTH_LINEAR_STEP == -1, excessively resize the heap
|
|
// geometrically: increase the heap size according to
|
|
// MEMORY_GROWTH_GEOMETRIC_STEP factor (default +20%), At most
|
|
// overreserve by MEMORY_GROWTH_GEOMETRIC_CAP bytes (default 96MB).
|
|
// 2b. If MEMORY_GROWTH_LINEAR_STEP != -1, excessively resize the heap
|
|
// linearly: increase the heap size by at least
|
|
// MEMORY_GROWTH_LINEAR_STEP bytes.
|
|
// 3. Max size for the heap is capped at 2048MB-WASM_PAGE_SIZE, or by
|
|
// MAXIMUM_MEMORY, or by ASAN limit, depending on which is smallest
|
|
// 4. If we were unable to allocate as much memory, it may be due to
|
|
// over-eager decision to excessively reserve due to (3) above.
|
|
// Hence if an allocation fails, cut down on the amount of excess
|
|
// growth, in an attempt to succeed to perform a smaller allocation.
|
|
|
|
// A limit is set for how much we can grow. We should not exceed that
|
|
// (the wasm binary specifies it, so if we tried, we'd fail anyhow).
|
|
var maxHeapSize = getHeapMax();
|
|
if (requestedSize > maxHeapSize) {
|
|
return false;
|
|
}
|
|
|
|
var alignUp = (x, multiple) => x + (multiple - x % multiple) % multiple;
|
|
|
|
// Loop through potential heap size increases. If we attempt a too eager
|
|
// reservation that fails, cut down on the attempted size and reserve a
|
|
// smaller bump instead. (max 3 times, chosen somewhat arbitrarily)
|
|
for (var cutDown = 1; cutDown <= 4; cutDown *= 2) {
|
|
var overGrownHeapSize = oldSize * (1 + 0.2 / cutDown); // ensure geometric growth
|
|
// but limit overreserving (default to capping at +96MB overgrowth at most)
|
|
overGrownHeapSize = Math.min(overGrownHeapSize, requestedSize + 100663296 );
|
|
|
|
var newSize = Math.min(maxHeapSize, alignUp(Math.max(requestedSize, overGrownHeapSize), 65536));
|
|
|
|
var replacement = growMemory(newSize);
|
|
if (replacement) {
|
|
|
|
return true;
|
|
}
|
|
}
|
|
return false;
|
|
};
|
|
|
|
var ENV = {
|
|
};
|
|
|
|
var getExecutableName = () => {
|
|
return thisProgram || './this.program';
|
|
};
|
|
var getEnvStrings = () => {
|
|
if (!getEnvStrings.strings) {
|
|
// Default values.
|
|
// Browser language detection #8751
|
|
var lang = ((typeof navigator == 'object' && navigator.languages && navigator.languages[0]) || 'C').replace('-', '_') + '.UTF-8';
|
|
var env = {
|
|
'USER': 'web_user',
|
|
'LOGNAME': 'web_user',
|
|
'PATH': '/',
|
|
'PWD': '/',
|
|
'HOME': '/home/web_user',
|
|
'LANG': lang,
|
|
'_': getExecutableName()
|
|
};
|
|
// Apply the user-provided values, if any.
|
|
for (var x in ENV) {
|
|
// x is a key in ENV; if ENV[x] is undefined, that means it was
|
|
// explicitly set to be so. We allow user code to do that to
|
|
// force variables with default values to remain unset.
|
|
if (ENV[x] === undefined) delete env[x];
|
|
else env[x] = ENV[x];
|
|
}
|
|
var strings = [];
|
|
for (var x in env) {
|
|
strings.push(`${x}=${env[x]}`);
|
|
}
|
|
getEnvStrings.strings = strings;
|
|
}
|
|
return getEnvStrings.strings;
|
|
};
|
|
|
|
var stringToAscii = (str, buffer) => {
|
|
for (var i = 0; i < str.length; ++i) {
|
|
HEAP8[buffer++] = str.charCodeAt(i);
|
|
}
|
|
// Null-terminate the string
|
|
HEAP8[buffer] = 0;
|
|
};
|
|
var _environ_get = (__environ, environ_buf) => {
|
|
var bufSize = 0;
|
|
getEnvStrings().forEach((string, i) => {
|
|
var ptr = environ_buf + bufSize;
|
|
HEAPU32[(((__environ)+(i*4))>>2)] = ptr;
|
|
stringToAscii(string, ptr);
|
|
bufSize += string.length + 1;
|
|
});
|
|
return 0;
|
|
};
|
|
|
|
var _environ_sizes_get = (penviron_count, penviron_buf_size) => {
|
|
var strings = getEnvStrings();
|
|
HEAPU32[((penviron_count)>>2)] = strings.length;
|
|
var bufSize = 0;
|
|
strings.forEach((string) => bufSize += string.length + 1);
|
|
HEAPU32[((penviron_buf_size)>>2)] = bufSize;
|
|
return 0;
|
|
};
|
|
|
|
|
|
function _fd_close(fd) {
|
|
try {
|
|
|
|
var stream = SYSCALLS.getStreamFromFD(fd);
|
|
FS.close(stream);
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return e.errno;
|
|
}
|
|
}
|
|
|
|
/** @param {number=} offset */
|
|
var doReadv = (stream, iov, iovcnt, offset) => {
|
|
var ret = 0;
|
|
for (var i = 0; i < iovcnt; i++) {
|
|
var ptr = HEAPU32[((iov)>>2)];
|
|
var len = HEAPU32[(((iov)+(4))>>2)];
|
|
iov += 8;
|
|
var curr = FS.read(stream, HEAP8, ptr, len, offset);
|
|
if (curr < 0) return -1;
|
|
ret += curr;
|
|
if (curr < len) break; // nothing more to read
|
|
if (typeof offset !== 'undefined') {
|
|
offset += curr;
|
|
}
|
|
}
|
|
return ret;
|
|
};
|
|
|
|
|
|
function _fd_pread(fd, iov, iovcnt, offset, pnum) {
|
|
offset = bigintToI53Checked(offset);
|
|
|
|
|
|
try {
|
|
|
|
if (isNaN(offset)) return 61;
|
|
var stream = SYSCALLS.getStreamFromFD(fd)
|
|
var num = doReadv(stream, iov, iovcnt, offset);
|
|
HEAPU32[((pnum)>>2)] = num;
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return e.errno;
|
|
}
|
|
;
|
|
}
|
|
|
|
/** @param {number=} offset */
|
|
var doWritev = (stream, iov, iovcnt, offset) => {
|
|
var ret = 0;
|
|
for (var i = 0; i < iovcnt; i++) {
|
|
var ptr = HEAPU32[((iov)>>2)];
|
|
var len = HEAPU32[(((iov)+(4))>>2)];
|
|
iov += 8;
|
|
var curr = FS.write(stream, HEAP8, ptr, len, offset);
|
|
if (curr < 0) return -1;
|
|
ret += curr;
|
|
if (typeof offset !== 'undefined') {
|
|
offset += curr;
|
|
}
|
|
}
|
|
return ret;
|
|
};
|
|
|
|
|
|
function _fd_pwrite(fd, iov, iovcnt, offset, pnum) {
|
|
offset = bigintToI53Checked(offset);
|
|
|
|
|
|
try {
|
|
|
|
if (isNaN(offset)) return 61;
|
|
var stream = SYSCALLS.getStreamFromFD(fd)
|
|
var num = doWritev(stream, iov, iovcnt, offset);
|
|
HEAPU32[((pnum)>>2)] = num;
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return e.errno;
|
|
}
|
|
;
|
|
}
|
|
|
|
|
|
function _fd_read(fd, iov, iovcnt, pnum) {
|
|
try {
|
|
|
|
var stream = SYSCALLS.getStreamFromFD(fd);
|
|
var num = doReadv(stream, iov, iovcnt);
|
|
HEAPU32[((pnum)>>2)] = num;
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return e.errno;
|
|
}
|
|
}
|
|
|
|
|
|
function _fd_seek(fd, offset, whence, newOffset) {
|
|
offset = bigintToI53Checked(offset);
|
|
|
|
|
|
try {
|
|
|
|
if (isNaN(offset)) return 61;
|
|
var stream = SYSCALLS.getStreamFromFD(fd);
|
|
FS.llseek(stream, offset, whence);
|
|
HEAP64[((newOffset)>>3)] = BigInt(stream.position);
|
|
if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return e.errno;
|
|
}
|
|
;
|
|
}
|
|
|
|
function _fd_sync(fd) {
|
|
try {
|
|
|
|
var stream = SYSCALLS.getStreamFromFD(fd);
|
|
if (stream.stream_ops?.fsync) {
|
|
return stream.stream_ops.fsync(stream);
|
|
}
|
|
return 0; // we can't do anything synchronously; the in-memory FS is already synced to
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return e.errno;
|
|
}
|
|
}
|
|
|
|
|
|
function _fd_write(fd, iov, iovcnt, pnum) {
|
|
try {
|
|
|
|
var stream = SYSCALLS.getStreamFromFD(fd);
|
|
var num = doWritev(stream, iov, iovcnt);
|
|
HEAPU32[((pnum)>>2)] = num;
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS == 'undefined' || !(e.name === 'ErrnoError')) throw e;
|
|
return e.errno;
|
|
}
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
var _glDrawArraysInstancedBaseInstanceWEBGL = (mode, first, count, instanceCount, baseInstance) => {
|
|
GLctx.dibvbi['drawArraysInstancedBaseInstanceWEBGL'](mode, first, count, instanceCount, baseInstance);
|
|
};
|
|
|
|
|
|
|
|
|
|
var _glDrawElementsInstancedBaseVertexBaseInstanceWEBGL = (mode, count, type, offset, instanceCount, baseVertex, baseinstance) => {
|
|
GLctx.dibvbi['drawElementsInstancedBaseVertexBaseInstanceWEBGL'](mode, count, type, offset, instanceCount, baseVertex, baseinstance);
|
|
};
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
var _glMultiDrawArraysInstancedBaseInstanceWEBGL = (mode, firsts, counts, instanceCounts, baseInstances, drawCount) => {
|
|
GLctx.mdibvbi['multiDrawArraysInstancedBaseInstanceWEBGL'](
|
|
mode,
|
|
HEAP32,
|
|
((firsts)>>2),
|
|
HEAP32,
|
|
((counts)>>2),
|
|
HEAP32,
|
|
((instanceCounts)>>2),
|
|
HEAPU32,
|
|
((baseInstances)>>2),
|
|
drawCount);
|
|
};
|
|
|
|
var _glMultiDrawElementsInstancedBaseVertexBaseInstanceWEBGL = (mode, counts, type, offsets, instanceCounts, baseVertices, baseInstances, drawCount) => {
|
|
GLctx.mdibvbi['multiDrawElementsInstancedBaseVertexBaseInstanceWEBGL'](
|
|
mode,
|
|
HEAP32,
|
|
((counts)>>2),
|
|
type,
|
|
HEAP32,
|
|
((offsets)>>2),
|
|
HEAP32,
|
|
((instanceCounts)>>2),
|
|
HEAP32,
|
|
((baseVertices)>>2),
|
|
HEAPU32,
|
|
((baseInstances)>>2),
|
|
drawCount);
|
|
};
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
var DOTNET = {
|
|
setup:function setup(emscriptenBuildOptions) {
|
|
// USE_PTHREADS is emscripten's define symbol, which is passed to acorn optimizer, so we could use it here
|
|
const modulePThread = {};
|
|
const ENVIRONMENT_IS_PTHREAD = false;
|
|
const dotnet_replacements = {
|
|
fetch: globalThis.fetch,
|
|
ENVIRONMENT_IS_WORKER,
|
|
require,
|
|
modulePThread,
|
|
scriptDirectory,
|
|
};
|
|
|
|
ENVIRONMENT_IS_WORKER = dotnet_replacements.ENVIRONMENT_IS_WORKER;
|
|
Module.__dotnet_runtime.initializeReplacements(dotnet_replacements);
|
|
noExitRuntime = dotnet_replacements.noExitRuntime;
|
|
fetch = dotnet_replacements.fetch;
|
|
require = dotnet_replacements.require;
|
|
_scriptDir = __dirname = scriptDirectory = dotnet_replacements.scriptDirectory;
|
|
Module.__dotnet_runtime.passEmscriptenInternals({
|
|
isPThread: ENVIRONMENT_IS_PTHREAD,
|
|
quit_, ExitStatus,
|
|
updateMemoryViews,
|
|
getMemory: () => { return wasmMemory; },
|
|
getWasmIndirectFunctionTable: () => { return wasmTable; },
|
|
}, emscriptenBuildOptions);
|
|
|
|
Module.__dotnet_runtime.configureEmscriptenStartup(Module);
|
|
},
|
|
};
|
|
function _mono_interp_flush_jitcall_queue(
|
|
) {
|
|
return {runtime_idx:12};//mono_interp_flush_jitcall_queue
|
|
}
|
|
|
|
function _mono_interp_invoke_wasm_jit_call_trampoline(
|
|
) {
|
|
return {runtime_idx:11};//mono_interp_invoke_wasm_jit_call_trampoline
|
|
}
|
|
|
|
function _mono_interp_jit_wasm_entry_trampoline(
|
|
) {
|
|
return {runtime_idx:9};//mono_interp_jit_wasm_entry_trampoline
|
|
}
|
|
|
|
function _mono_interp_jit_wasm_jit_call_trampoline(
|
|
) {
|
|
return {runtime_idx:10};//mono_interp_jit_wasm_jit_call_trampoline
|
|
}
|
|
|
|
function _mono_interp_record_interp_entry(
|
|
) {
|
|
return {runtime_idx:8};//mono_interp_record_interp_entry
|
|
}
|
|
|
|
function _mono_interp_tier_prepare_jiterpreter(
|
|
) {
|
|
return {runtime_idx:7};//mono_interp_tier_prepare_jiterpreter
|
|
}
|
|
|
|
function _mono_wasm_bind_js_import_ST(
|
|
) {
|
|
return {runtime_idx:22};//mono_wasm_bind_js_import_ST
|
|
}
|
|
|
|
function _mono_wasm_browser_entropy(
|
|
) {
|
|
return {runtime_idx:18};//mono_wasm_browser_entropy
|
|
}
|
|
|
|
function _mono_wasm_cancel_promise(
|
|
) {
|
|
return {runtime_idx:26};//mono_wasm_cancel_promise
|
|
}
|
|
|
|
function _mono_wasm_console_clear(
|
|
) {
|
|
return {runtime_idx:20};//mono_wasm_console_clear
|
|
}
|
|
|
|
function _mono_wasm_free_method_data(
|
|
) {
|
|
return {runtime_idx:13};//mono_wasm_free_method_data
|
|
}
|
|
|
|
function _mono_wasm_get_locale_info(
|
|
) {
|
|
return {runtime_idx:27};//mono_wasm_get_locale_info
|
|
}
|
|
|
|
function _mono_wasm_invoke_js_function(
|
|
) {
|
|
return {runtime_idx:23};//mono_wasm_invoke_js_function
|
|
}
|
|
|
|
function _mono_wasm_invoke_jsimport_ST(
|
|
) {
|
|
return {runtime_idx:24};//mono_wasm_invoke_jsimport_ST
|
|
}
|
|
|
|
function _mono_wasm_process_current_pid(
|
|
) {
|
|
return {runtime_idx:19};//mono_wasm_process_current_pid
|
|
}
|
|
|
|
function _mono_wasm_release_cs_owned_object(
|
|
) {
|
|
return {runtime_idx:21};//mono_wasm_release_cs_owned_object
|
|
}
|
|
|
|
function _mono_wasm_resolve_or_reject_promise(
|
|
) {
|
|
return {runtime_idx:25};//mono_wasm_resolve_or_reject_promise
|
|
}
|
|
|
|
function _mono_wasm_schedule_timer(
|
|
) {
|
|
return {runtime_idx:0};//mono_wasm_schedule_timer
|
|
}
|
|
|
|
function _mono_wasm_set_entrypoint_breakpoint(
|
|
) {
|
|
return {runtime_idx:17};//mono_wasm_set_entrypoint_breakpoint
|
|
}
|
|
|
|
function _mono_wasm_trace_logger(
|
|
) {
|
|
return {runtime_idx:16};//mono_wasm_trace_logger
|
|
}
|
|
|
|
function _schedule_background_exec(
|
|
) {
|
|
return {runtime_idx:6};//schedule_background_exec
|
|
}
|
|
|
|
|
|
var arraySum = (array, index) => {
|
|
var sum = 0;
|
|
for (var i = 0; i <= index; sum += array[i++]) {
|
|
// no-op
|
|
}
|
|
return sum;
|
|
};
|
|
|
|
|
|
var MONTH_DAYS_LEAP = [31,29,31,30,31,30,31,31,30,31,30,31];
|
|
|
|
var MONTH_DAYS_REGULAR = [31,28,31,30,31,30,31,31,30,31,30,31];
|
|
var addDays = (date, days) => {
|
|
var newDate = new Date(date.getTime());
|
|
while (days > 0) {
|
|
var leap = isLeapYear(newDate.getFullYear());
|
|
var currentMonth = newDate.getMonth();
|
|
var daysInCurrentMonth = (leap ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR)[currentMonth];
|
|
|
|
if (days > daysInCurrentMonth-newDate.getDate()) {
|
|
// we spill over to next month
|
|
days -= (daysInCurrentMonth-newDate.getDate()+1);
|
|
newDate.setDate(1);
|
|
if (currentMonth < 11) {
|
|
newDate.setMonth(currentMonth+1)
|
|
} else {
|
|
newDate.setMonth(0);
|
|
newDate.setFullYear(newDate.getFullYear()+1);
|
|
}
|
|
} else {
|
|
// we stay in current month
|
|
newDate.setDate(newDate.getDate()+days);
|
|
return newDate;
|
|
}
|
|
}
|
|
|
|
return newDate;
|
|
};
|
|
|
|
|
|
|
|
|
|
var writeArrayToMemory = (array, buffer) => {
|
|
HEAP8.set(array, buffer);
|
|
};
|
|
|
|
var _strftime = (s, maxsize, format, tm) => {
|
|
// size_t strftime(char *restrict s, size_t maxsize, const char *restrict format, const struct tm *restrict timeptr);
|
|
// http://pubs.opengroup.org/onlinepubs/009695399/functions/strftime.html
|
|
|
|
var tm_zone = HEAPU32[(((tm)+(40))>>2)];
|
|
|
|
var date = {
|
|
tm_sec: HEAP32[((tm)>>2)],
|
|
tm_min: HEAP32[(((tm)+(4))>>2)],
|
|
tm_hour: HEAP32[(((tm)+(8))>>2)],
|
|
tm_mday: HEAP32[(((tm)+(12))>>2)],
|
|
tm_mon: HEAP32[(((tm)+(16))>>2)],
|
|
tm_year: HEAP32[(((tm)+(20))>>2)],
|
|
tm_wday: HEAP32[(((tm)+(24))>>2)],
|
|
tm_yday: HEAP32[(((tm)+(28))>>2)],
|
|
tm_isdst: HEAP32[(((tm)+(32))>>2)],
|
|
tm_gmtoff: HEAP32[(((tm)+(36))>>2)],
|
|
tm_zone: tm_zone ? UTF8ToString(tm_zone) : ''
|
|
};
|
|
|
|
|
|
var pattern = UTF8ToString(format);
|
|
|
|
// expand format
|
|
var EXPANSION_RULES_1 = {
|
|
'%c': '%a %b %d %H:%M:%S %Y', // Replaced by the locale's appropriate date and time representation - e.g., Mon Aug 3 14:02:01 2013
|
|
'%D': '%m/%d/%y', // Equivalent to %m / %d / %y
|
|
'%F': '%Y-%m-%d', // Equivalent to %Y - %m - %d
|
|
'%h': '%b', // Equivalent to %b
|
|
'%r': '%I:%M:%S %p', // Replaced by the time in a.m. and p.m. notation
|
|
'%R': '%H:%M', // Replaced by the time in 24-hour notation
|
|
'%T': '%H:%M:%S', // Replaced by the time
|
|
'%x': '%m/%d/%y', // Replaced by the locale's appropriate date representation
|
|
'%X': '%H:%M:%S', // Replaced by the locale's appropriate time representation
|
|
// Modified Conversion Specifiers
|
|
'%Ec': '%c', // Replaced by the locale's alternative appropriate date and time representation.
|
|
'%EC': '%C', // Replaced by the name of the base year (period) in the locale's alternative representation.
|
|
'%Ex': '%m/%d/%y', // Replaced by the locale's alternative date representation.
|
|
'%EX': '%H:%M:%S', // Replaced by the locale's alternative time representation.
|
|
'%Ey': '%y', // Replaced by the offset from %EC (year only) in the locale's alternative representation.
|
|
'%EY': '%Y', // Replaced by the full alternative year representation.
|
|
'%Od': '%d', // Replaced by the day of the month, using the locale's alternative numeric symbols, filled as needed with leading zeros if there is any alternative symbol for zero; otherwise, with leading <space> characters.
|
|
'%Oe': '%e', // Replaced by the day of the month, using the locale's alternative numeric symbols, filled as needed with leading <space> characters.
|
|
'%OH': '%H', // Replaced by the hour (24-hour clock) using the locale's alternative numeric symbols.
|
|
'%OI': '%I', // Replaced by the hour (12-hour clock) using the locale's alternative numeric symbols.
|
|
'%Om': '%m', // Replaced by the month using the locale's alternative numeric symbols.
|
|
'%OM': '%M', // Replaced by the minutes using the locale's alternative numeric symbols.
|
|
'%OS': '%S', // Replaced by the seconds using the locale's alternative numeric symbols.
|
|
'%Ou': '%u', // Replaced by the weekday as a number in the locale's alternative representation (Monday=1).
|
|
'%OU': '%U', // Replaced by the week number of the year (Sunday as the first day of the week, rules corresponding to %U ) using the locale's alternative numeric symbols.
|
|
'%OV': '%V', // Replaced by the week number of the year (Monday as the first day of the week, rules corresponding to %V ) using the locale's alternative numeric symbols.
|
|
'%Ow': '%w', // Replaced by the number of the weekday (Sunday=0) using the locale's alternative numeric symbols.
|
|
'%OW': '%W', // Replaced by the week number of the year (Monday as the first day of the week) using the locale's alternative numeric symbols.
|
|
'%Oy': '%y', // Replaced by the year (offset from %C ) using the locale's alternative numeric symbols.
|
|
};
|
|
for (var rule in EXPANSION_RULES_1) {
|
|
pattern = pattern.replace(new RegExp(rule, 'g'), EXPANSION_RULES_1[rule]);
|
|
}
|
|
|
|
var WEEKDAYS = ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'];
|
|
var MONTHS = ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'];
|
|
|
|
function leadingSomething(value, digits, character) {
|
|
var str = typeof value == 'number' ? value.toString() : (value || '');
|
|
while (str.length < digits) {
|
|
str = character[0]+str;
|
|
}
|
|
return str;
|
|
}
|
|
|
|
function leadingNulls(value, digits) {
|
|
return leadingSomething(value, digits, '0');
|
|
}
|
|
|
|
function compareByDay(date1, date2) {
|
|
function sgn(value) {
|
|
return value < 0 ? -1 : (value > 0 ? 1 : 0);
|
|
}
|
|
|
|
var compare;
|
|
if ((compare = sgn(date1.getFullYear()-date2.getFullYear())) === 0) {
|
|
if ((compare = sgn(date1.getMonth()-date2.getMonth())) === 0) {
|
|
compare = sgn(date1.getDate()-date2.getDate());
|
|
}
|
|
}
|
|
return compare;
|
|
}
|
|
|
|
function getFirstWeekStartDate(janFourth) {
|
|
switch (janFourth.getDay()) {
|
|
case 0: // Sunday
|
|
return new Date(janFourth.getFullYear()-1, 11, 29);
|
|
case 1: // Monday
|
|
return janFourth;
|
|
case 2: // Tuesday
|
|
return new Date(janFourth.getFullYear(), 0, 3);
|
|
case 3: // Wednesday
|
|
return new Date(janFourth.getFullYear(), 0, 2);
|
|
case 4: // Thursday
|
|
return new Date(janFourth.getFullYear(), 0, 1);
|
|
case 5: // Friday
|
|
return new Date(janFourth.getFullYear()-1, 11, 31);
|
|
case 6: // Saturday
|
|
return new Date(janFourth.getFullYear()-1, 11, 30);
|
|
}
|
|
}
|
|
|
|
function getWeekBasedYear(date) {
|
|
var thisDate = addDays(new Date(date.tm_year+1900, 0, 1), date.tm_yday);
|
|
|
|
var janFourthThisYear = new Date(thisDate.getFullYear(), 0, 4);
|
|
var janFourthNextYear = new Date(thisDate.getFullYear()+1, 0, 4);
|
|
|
|
var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear);
|
|
var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear);
|
|
|
|
if (compareByDay(firstWeekStartThisYear, thisDate) <= 0) {
|
|
// this date is after the start of the first week of this year
|
|
if (compareByDay(firstWeekStartNextYear, thisDate) <= 0) {
|
|
return thisDate.getFullYear()+1;
|
|
}
|
|
return thisDate.getFullYear();
|
|
}
|
|
return thisDate.getFullYear()-1;
|
|
}
|
|
|
|
var EXPANSION_RULES_2 = {
|
|
'%a': (date) => WEEKDAYS[date.tm_wday].substring(0,3) ,
|
|
'%A': (date) => WEEKDAYS[date.tm_wday],
|
|
'%b': (date) => MONTHS[date.tm_mon].substring(0,3),
|
|
'%B': (date) => MONTHS[date.tm_mon],
|
|
'%C': (date) => {
|
|
var year = date.tm_year+1900;
|
|
return leadingNulls((year/100)|0,2);
|
|
},
|
|
'%d': (date) => leadingNulls(date.tm_mday, 2),
|
|
'%e': (date) => leadingSomething(date.tm_mday, 2, ' '),
|
|
'%g': (date) => {
|
|
// %g, %G, and %V give values according to the ISO 8601:2000 standard week-based year.
|
|
// In this system, weeks begin on a Monday and week 1 of the year is the week that includes
|
|
// January 4th, which is also the week that includes the first Thursday of the year, and
|
|
// is also the first week that contains at least four days in the year.
|
|
// If the first Monday of January is the 2nd, 3rd, or 4th, the preceding days are part of
|
|
// the last week of the preceding year; thus, for Saturday 2nd January 1999,
|
|
// %G is replaced by 1998 and %V is replaced by 53. If December 29th, 30th,
|
|
// or 31st is a Monday, it and any following days are part of week 1 of the following year.
|
|
// Thus, for Tuesday 30th December 1997, %G is replaced by 1998 and %V is replaced by 01.
|
|
|
|
return getWeekBasedYear(date).toString().substring(2);
|
|
},
|
|
'%G': getWeekBasedYear,
|
|
'%H': (date) => leadingNulls(date.tm_hour, 2),
|
|
'%I': (date) => {
|
|
var twelveHour = date.tm_hour;
|
|
if (twelveHour == 0) twelveHour = 12;
|
|
else if (twelveHour > 12) twelveHour -= 12;
|
|
return leadingNulls(twelveHour, 2);
|
|
},
|
|
'%j': (date) => {
|
|
// Day of the year (001-366)
|
|
return leadingNulls(date.tm_mday + arraySum(isLeapYear(date.tm_year+1900) ? MONTH_DAYS_LEAP : MONTH_DAYS_REGULAR, date.tm_mon-1), 3);
|
|
},
|
|
'%m': (date) => leadingNulls(date.tm_mon+1, 2),
|
|
'%M': (date) => leadingNulls(date.tm_min, 2),
|
|
'%n': () => '\n',
|
|
'%p': (date) => {
|
|
if (date.tm_hour >= 0 && date.tm_hour < 12) {
|
|
return 'AM';
|
|
}
|
|
return 'PM';
|
|
},
|
|
'%S': (date) => leadingNulls(date.tm_sec, 2),
|
|
'%t': () => '\t',
|
|
'%u': (date) => date.tm_wday || 7,
|
|
'%U': (date) => {
|
|
var days = date.tm_yday + 7 - date.tm_wday;
|
|
return leadingNulls(Math.floor(days / 7), 2);
|
|
},
|
|
'%V': (date) => {
|
|
// Replaced by the week number of the year (Monday as the first day of the week)
|
|
// as a decimal number [01,53]. If the week containing 1 January has four
|
|
// or more days in the new year, then it is considered week 1.
|
|
// Otherwise, it is the last week of the previous year, and the next week is week 1.
|
|
// Both January 4th and the first Thursday of January are always in week 1. [ tm_year, tm_wday, tm_yday]
|
|
var val = Math.floor((date.tm_yday + 7 - (date.tm_wday + 6) % 7 ) / 7);
|
|
// If 1 Jan is just 1-3 days past Monday, the previous week
|
|
// is also in this year.
|
|
if ((date.tm_wday + 371 - date.tm_yday - 2) % 7 <= 2) {
|
|
val++;
|
|
}
|
|
if (!val) {
|
|
val = 52;
|
|
// If 31 December of prev year a Thursday, or Friday of a
|
|
// leap year, then the prev year has 53 weeks.
|
|
var dec31 = (date.tm_wday + 7 - date.tm_yday - 1) % 7;
|
|
if (dec31 == 4 || (dec31 == 5 && isLeapYear(date.tm_year%400-1))) {
|
|
val++;
|
|
}
|
|
} else if (val == 53) {
|
|
// If 1 January is not a Thursday, and not a Wednesday of a
|
|
// leap year, then this year has only 52 weeks.
|
|
var jan1 = (date.tm_wday + 371 - date.tm_yday) % 7;
|
|
if (jan1 != 4 && (jan1 != 3 || !isLeapYear(date.tm_year)))
|
|
val = 1;
|
|
}
|
|
return leadingNulls(val, 2);
|
|
},
|
|
'%w': (date) => date.tm_wday,
|
|
'%W': (date) => {
|
|
var days = date.tm_yday + 7 - ((date.tm_wday + 6) % 7);
|
|
return leadingNulls(Math.floor(days / 7), 2);
|
|
},
|
|
'%y': (date) => {
|
|
// Replaced by the last two digits of the year as a decimal number [00,99]. [ tm_year]
|
|
return (date.tm_year+1900).toString().substring(2);
|
|
},
|
|
// Replaced by the year as a decimal number (for example, 1997). [ tm_year]
|
|
'%Y': (date) => date.tm_year+1900,
|
|
'%z': (date) => {
|
|
// Replaced by the offset from UTC in the ISO 8601:2000 standard format ( +hhmm or -hhmm ).
|
|
// For example, "-0430" means 4 hours 30 minutes behind UTC (west of Greenwich).
|
|
var off = date.tm_gmtoff;
|
|
var ahead = off >= 0;
|
|
off = Math.abs(off) / 60;
|
|
// convert from minutes into hhmm format (which means 60 minutes = 100 units)
|
|
off = (off / 60)*100 + (off % 60);
|
|
return (ahead ? '+' : '-') + String("0000" + off).slice(-4);
|
|
},
|
|
'%Z': (date) => date.tm_zone,
|
|
'%%': () => '%'
|
|
};
|
|
|
|
// Replace %% with a pair of NULLs (which cannot occur in a C string), then
|
|
// re-inject them after processing.
|
|
pattern = pattern.replace(/%%/g, '\0\0')
|
|
for (var rule in EXPANSION_RULES_2) {
|
|
if (pattern.includes(rule)) {
|
|
pattern = pattern.replace(new RegExp(rule, 'g'), EXPANSION_RULES_2[rule](date));
|
|
}
|
|
}
|
|
pattern = pattern.replace(/\0\0/g, '%')
|
|
|
|
var bytes = intArrayFromString(pattern, false);
|
|
if (bytes.length > maxsize) {
|
|
return 0;
|
|
}
|
|
|
|
writeArrayToMemory(bytes, s);
|
|
return bytes.length-1;
|
|
};
|
|
|
|
var _strftime_l = (s, maxsize, format, tm, loc) => {
|
|
return _strftime(s, maxsize, format, tm); // no locale support yet
|
|
};
|
|
|
|
|
|
|
|
|
|
var getCFunc = (ident) => {
|
|
var func = Module['_' + ident]; // closure exported function
|
|
return func;
|
|
};
|
|
|
|
|
|
|
|
var stringToUTF8OnStack = (str) => {
|
|
var size = lengthBytesUTF8(str) + 1;
|
|
var ret = stackAlloc(size);
|
|
stringToUTF8(str, ret, size);
|
|
return ret;
|
|
};
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
* @param {string|null=} returnType
|
|
* @param {Array=} argTypes
|
|
* @param {Arguments|Array=} args
|
|
* @param {Object=} opts
|
|
*/
|
|
var ccall = (ident, returnType, argTypes, args, opts) => {
|
|
// For fast lookup of conversion functions
|
|
var toC = {
|
|
'string': (str) => {
|
|
var ret = 0;
|
|
if (str !== null && str !== undefined && str !== 0) { // null string
|
|
// at most 4 bytes per UTF-8 code point, +1 for the trailing '\0'
|
|
ret = stringToUTF8OnStack(str);
|
|
}
|
|
return ret;
|
|
},
|
|
'array': (arr) => {
|
|
var ret = stackAlloc(arr.length);
|
|
writeArrayToMemory(arr, ret);
|
|
return ret;
|
|
}
|
|
};
|
|
|
|
function convertReturnValue(ret) {
|
|
if (returnType === 'string') {
|
|
|
|
return UTF8ToString(ret);
|
|
}
|
|
if (returnType === 'boolean') return Boolean(ret);
|
|
return ret;
|
|
}
|
|
|
|
var func = getCFunc(ident);
|
|
var cArgs = [];
|
|
var stack = 0;
|
|
if (args) {
|
|
for (var i = 0; i < args.length; i++) {
|
|
var converter = toC[argTypes[i]];
|
|
if (converter) {
|
|
if (stack === 0) stack = stackSave();
|
|
cArgs[i] = converter(args[i]);
|
|
} else {
|
|
cArgs[i] = args[i];
|
|
}
|
|
}
|
|
}
|
|
var ret = func(...cArgs);
|
|
function onDone(ret) {
|
|
if (stack !== 0) stackRestore(stack);
|
|
return convertReturnValue(ret);
|
|
}
|
|
|
|
ret = onDone(ret);
|
|
return ret;
|
|
};
|
|
|
|
|
|
|
|
/**
|
|
* @param {string=} returnType
|
|
* @param {Array=} argTypes
|
|
* @param {Object=} opts
|
|
*/
|
|
var cwrap = (ident, returnType, argTypes, opts) => {
|
|
// When the function takes numbers and returns a number, we can just return
|
|
// the original function
|
|
var numericArgs = !argTypes || argTypes.every((type) => type === 'number' || type === 'boolean');
|
|
var numericRet = returnType !== 'string';
|
|
if (numericRet && numericArgs && !opts) {
|
|
return getCFunc(ident);
|
|
}
|
|
return (...args) => ccall(ident, returnType, argTypes, args, opts);
|
|
};
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
var uleb128Encode = (n, target) => {
|
|
if (n < 128) {
|
|
target.push(n);
|
|
} else {
|
|
target.push((n % 128) | 128, n >> 7);
|
|
}
|
|
};
|
|
|
|
var sigToWasmTypes = (sig) => {
|
|
var typeNames = {
|
|
'i': 'i32',
|
|
'j': 'i64',
|
|
'f': 'f32',
|
|
'd': 'f64',
|
|
'e': 'externref',
|
|
'p': 'i32',
|
|
};
|
|
var type = {
|
|
parameters: [],
|
|
results: sig[0] == 'v' ? [] : [typeNames[sig[0]]]
|
|
};
|
|
for (var i = 1; i < sig.length; ++i) {
|
|
type.parameters.push(typeNames[sig[i]]);
|
|
}
|
|
return type;
|
|
};
|
|
|
|
var generateFuncType = (sig, target) => {
|
|
var sigRet = sig.slice(0, 1);
|
|
var sigParam = sig.slice(1);
|
|
var typeCodes = {
|
|
'i': 0x7f, // i32
|
|
'p': 0x7f, // i32
|
|
'j': 0x7e, // i64
|
|
'f': 0x7d, // f32
|
|
'd': 0x7c, // f64
|
|
'e': 0x6f, // externref
|
|
};
|
|
|
|
// Parameters, length + signatures
|
|
target.push(0x60 /* form: func */);
|
|
uleb128Encode(sigParam.length, target);
|
|
for (var i = 0; i < sigParam.length; ++i) {
|
|
target.push(typeCodes[sigParam[i]]);
|
|
}
|
|
|
|
// Return values, length + signatures
|
|
// With no multi-return in MVP, either 0 (void) or 1 (anything else)
|
|
if (sigRet == 'v') {
|
|
target.push(0x00);
|
|
} else {
|
|
target.push(0x01, typeCodes[sigRet]);
|
|
}
|
|
};
|
|
var convertJsFunctionToWasm = (func, sig) => {
|
|
|
|
// If the type reflection proposal is available, use the new
|
|
// "WebAssembly.Function" constructor.
|
|
// Otherwise, construct a minimal wasm module importing the JS function and
|
|
// re-exporting it.
|
|
if (typeof WebAssembly.Function == "function") {
|
|
return new WebAssembly.Function(sigToWasmTypes(sig), func);
|
|
}
|
|
|
|
// The module is static, with the exception of the type section, which is
|
|
// generated based on the signature passed in.
|
|
var typeSectionBody = [
|
|
0x01, // count: 1
|
|
];
|
|
generateFuncType(sig, typeSectionBody);
|
|
|
|
// Rest of the module is static
|
|
var bytes = [
|
|
0x00, 0x61, 0x73, 0x6d, // magic ("\0asm")
|
|
0x01, 0x00, 0x00, 0x00, // version: 1
|
|
0x01, // Type section code
|
|
];
|
|
// Write the overall length of the type section followed by the body
|
|
uleb128Encode(typeSectionBody.length, bytes);
|
|
bytes.push(...typeSectionBody);
|
|
|
|
// The rest of the module is static
|
|
bytes.push(
|
|
0x02, 0x07, // import section
|
|
// (import "e" "f" (func 0 (type 0)))
|
|
0x01, 0x01, 0x65, 0x01, 0x66, 0x00, 0x00,
|
|
0x07, 0x05, // export section
|
|
// (export "f" (func 0 (type 0)))
|
|
0x01, 0x01, 0x66, 0x00, 0x00,
|
|
);
|
|
|
|
// We can compile this wasm module synchronously because it is very small.
|
|
// This accepts an import (at "e.f"), that it reroutes to an export (at "f")
|
|
var module = new WebAssembly.Module(new Uint8Array(bytes));
|
|
var instance = new WebAssembly.Instance(module, { 'e': { 'f': func } });
|
|
var wrappedFunc = instance.exports['f'];
|
|
return wrappedFunc;
|
|
};
|
|
|
|
var wasmTableMirror = [];
|
|
|
|
var wasmTable;
|
|
var getWasmTableEntry = (funcPtr) => {
|
|
var func = wasmTableMirror[funcPtr];
|
|
if (!func) {
|
|
if (funcPtr >= wasmTableMirror.length) wasmTableMirror.length = funcPtr + 1;
|
|
wasmTableMirror[funcPtr] = func = wasmTable.get(funcPtr);
|
|
}
|
|
return func;
|
|
};
|
|
|
|
var updateTableMap = (offset, count) => {
|
|
if (functionsInTableMap) {
|
|
for (var i = offset; i < offset + count; i++) {
|
|
var item = getWasmTableEntry(i);
|
|
// Ignore null values.
|
|
if (item) {
|
|
functionsInTableMap.set(item, i);
|
|
}
|
|
}
|
|
}
|
|
};
|
|
|
|
var functionsInTableMap;
|
|
|
|
var getFunctionAddress = (func) => {
|
|
// First, create the map if this is the first use.
|
|
if (!functionsInTableMap) {
|
|
functionsInTableMap = new WeakMap();
|
|
updateTableMap(0, wasmTable.length);
|
|
}
|
|
return functionsInTableMap.get(func) || 0;
|
|
};
|
|
|
|
|
|
var freeTableIndexes = [];
|
|
|
|
var getEmptyTableSlot = () => {
|
|
// Reuse a free index if there is one, otherwise grow.
|
|
if (freeTableIndexes.length) {
|
|
return freeTableIndexes.pop();
|
|
}
|
|
// Grow the table
|
|
try {
|
|
wasmTable.grow(1);
|
|
} catch (err) {
|
|
if (!(err instanceof RangeError)) {
|
|
throw err;
|
|
}
|
|
throw 'Unable to grow wasm table. Set ALLOW_TABLE_GROWTH.';
|
|
}
|
|
return wasmTable.length - 1;
|
|
};
|
|
|
|
|
|
|
|
var setWasmTableEntry = (idx, func) => {
|
|
wasmTable.set(idx, func);
|
|
// With ABORT_ON_WASM_EXCEPTIONS wasmTable.get is overridden to return wrapped
|
|
// functions so we need to call it here to retrieve the potential wrapper correctly
|
|
// instead of just storing 'func' directly into wasmTableMirror
|
|
wasmTableMirror[idx] = wasmTable.get(idx);
|
|
};
|
|
|
|
/** @param {string=} sig */
|
|
var addFunction = (func, sig) => {
|
|
// Check if the function is already in the table, to ensure each function
|
|
// gets a unique index.
|
|
var rtn = getFunctionAddress(func);
|
|
if (rtn) {
|
|
return rtn;
|
|
}
|
|
|
|
// It's not in the table, add it now.
|
|
|
|
var ret = getEmptyTableSlot();
|
|
|
|
// Set the new value.
|
|
try {
|
|
// Attempting to call this with JS function will cause of table.set() to fail
|
|
setWasmTableEntry(ret, func);
|
|
} catch (err) {
|
|
if (!(err instanceof TypeError)) {
|
|
throw err;
|
|
}
|
|
var wrapped = convertJsFunctionToWasm(func, sig);
|
|
setWasmTableEntry(ret, wrapped);
|
|
}
|
|
|
|
functionsInTableMap.set(func, ret);
|
|
|
|
return ret;
|
|
};
|
|
|
|
var handleException = (e) => {
|
|
// Certain exception types we do not treat as errors since they are used for
|
|
// internal control flow.
|
|
// 1. ExitStatus, which is thrown by exit()
|
|
// 2. "unwind", which is thrown by emscripten_unwind_to_js_event_loop() and others
|
|
// that wish to return to JS event loop.
|
|
if (e instanceof ExitStatus || e == 'unwind') {
|
|
return EXITSTATUS;
|
|
}
|
|
quit_(1, e);
|
|
};
|
|
|
|
|
|
|
|
var maybeExit = () => {
|
|
if (runtimeExited) {
|
|
return;
|
|
}
|
|
if (!keepRuntimeAlive()) {
|
|
try {
|
|
_exit(EXITSTATUS);
|
|
} catch (e) {
|
|
handleException(e);
|
|
}
|
|
}
|
|
};
|
|
var callUserCallback = (func) => {
|
|
if (runtimeExited || ABORT) {
|
|
return;
|
|
}
|
|
try {
|
|
func();
|
|
maybeExit();
|
|
} catch (e) {
|
|
handleException(e);
|
|
}
|
|
};
|
|
|
|
var runtimeKeepalivePush = () => {
|
|
runtimeKeepaliveCounter += 1;
|
|
};
|
|
|
|
var runtimeKeepalivePop = () => {
|
|
runtimeKeepaliveCounter -= 1;
|
|
};
|
|
/** @param {number=} timeout */
|
|
var safeSetTimeout = (func, timeout) => {
|
|
runtimeKeepalivePush();
|
|
return setTimeout(() => {
|
|
runtimeKeepalivePop();
|
|
callUserCallback(func);
|
|
}, timeout);
|
|
};
|
|
|
|
|
|
|
|
|
|
|
|
|
|
var FS_unlink = (path) => FS.unlink(path);
|
|
|
|
FS.createPreloadedFile = FS_createPreloadedFile;
|
|
FS.staticInit();Module["FS_createPath"] = FS.createPath;Module["FS_createDataFile"] = FS.createDataFile;Module["FS_createPath"] = FS.createPath;Module["FS_createDataFile"] = FS.createDataFile;Module["FS_createPreloadedFile"] = FS.createPreloadedFile;Module["FS_unlink"] = FS.unlink;Module["FS_createLazyFile"] = FS.createLazyFile;Module["FS_createDevice"] = FS.createDevice;;
|
|
var GLctx;;
|
|
for (var i = 0; i < 32; ++i) tempFixedLengthArray.push(new Array(i));;
|
|
var miniTempWebGLFloatBuffersStorage = new Float32Array(288);
|
|
for (/**@suppress{duplicate}*/var i = 0; i < 288; ++i) {
|
|
miniTempWebGLFloatBuffers[i] = miniTempWebGLFloatBuffersStorage.subarray(0, i+1);
|
|
};
|
|
var miniTempWebGLIntBuffersStorage = new Int32Array(288);
|
|
for (/**@suppress{duplicate}*/var i = 0; i < 288; ++i) {
|
|
miniTempWebGLIntBuffers[i] = miniTempWebGLIntBuffersStorage.subarray(0, i+1);
|
|
};
|
|
DOTNET.setup({ wasmEnableSIMD: true,wasmEnableEH: true,enableAotProfiler: false, enableDevToolsProfiler: false, enableLogProfiler: false, enableEventPipe: false, runAOTCompilation: false, wasmEnableThreads: false, gitHash: "44525024595742ebe09023abe709df51de65009b", });;
|
|
var wasmImports = {
|
|
/** @export */
|
|
__assert_fail: ___assert_fail,
|
|
/** @export */
|
|
__syscall_connect: ___syscall_connect,
|
|
/** @export */
|
|
__syscall_faccessat: ___syscall_faccessat,
|
|
/** @export */
|
|
__syscall_fadvise64: ___syscall_fadvise64,
|
|
/** @export */
|
|
__syscall_fcntl64: ___syscall_fcntl64,
|
|
/** @export */
|
|
__syscall_fstat64: ___syscall_fstat64,
|
|
/** @export */
|
|
__syscall_fstatfs64: ___syscall_fstatfs64,
|
|
/** @export */
|
|
__syscall_ftruncate64: ___syscall_ftruncate64,
|
|
/** @export */
|
|
__syscall_getcwd: ___syscall_getcwd,
|
|
/** @export */
|
|
__syscall_getdents64: ___syscall_getdents64,
|
|
/** @export */
|
|
__syscall_ioctl: ___syscall_ioctl,
|
|
/** @export */
|
|
__syscall_lstat64: ___syscall_lstat64,
|
|
/** @export */
|
|
__syscall_newfstatat: ___syscall_newfstatat,
|
|
/** @export */
|
|
__syscall_openat: ___syscall_openat,
|
|
/** @export */
|
|
__syscall_readlinkat: ___syscall_readlinkat,
|
|
/** @export */
|
|
__syscall_sendto: ___syscall_sendto,
|
|
/** @export */
|
|
__syscall_socket: ___syscall_socket,
|
|
/** @export */
|
|
__syscall_stat64: ___syscall_stat64,
|
|
/** @export */
|
|
__syscall_unlinkat: ___syscall_unlinkat,
|
|
/** @export */
|
|
_emscripten_get_now_is_monotonic: __emscripten_get_now_is_monotonic,
|
|
/** @export */
|
|
_gmtime_js: __gmtime_js,
|
|
/** @export */
|
|
_localtime_js: __localtime_js,
|
|
/** @export */
|
|
_mmap_js: __mmap_js,
|
|
/** @export */
|
|
_munmap_js: __munmap_js,
|
|
/** @export */
|
|
_tzset_js: __tzset_js,
|
|
/** @export */
|
|
abort: _abort,
|
|
/** @export */
|
|
emscripten_date_now: _emscripten_date_now,
|
|
/** @export */
|
|
emscripten_force_exit: _emscripten_force_exit,
|
|
/** @export */
|
|
emscripten_get_heap_max: _emscripten_get_heap_max,
|
|
/** @export */
|
|
emscripten_get_now: _emscripten_get_now,
|
|
/** @export */
|
|
emscripten_get_now_res: _emscripten_get_now_res,
|
|
/** @export */
|
|
emscripten_glActiveTexture: _emscripten_glActiveTexture,
|
|
/** @export */
|
|
emscripten_glAttachShader: _emscripten_glAttachShader,
|
|
/** @export */
|
|
emscripten_glBeginQuery: _emscripten_glBeginQuery,
|
|
/** @export */
|
|
emscripten_glBeginQueryEXT: _emscripten_glBeginQueryEXT,
|
|
/** @export */
|
|
emscripten_glBeginTransformFeedback: _emscripten_glBeginTransformFeedback,
|
|
/** @export */
|
|
emscripten_glBindAttribLocation: _emscripten_glBindAttribLocation,
|
|
/** @export */
|
|
emscripten_glBindBuffer: _emscripten_glBindBuffer,
|
|
/** @export */
|
|
emscripten_glBindBufferBase: _emscripten_glBindBufferBase,
|
|
/** @export */
|
|
emscripten_glBindBufferRange: _emscripten_glBindBufferRange,
|
|
/** @export */
|
|
emscripten_glBindFramebuffer: _emscripten_glBindFramebuffer,
|
|
/** @export */
|
|
emscripten_glBindRenderbuffer: _emscripten_glBindRenderbuffer,
|
|
/** @export */
|
|
emscripten_glBindSampler: _emscripten_glBindSampler,
|
|
/** @export */
|
|
emscripten_glBindTexture: _emscripten_glBindTexture,
|
|
/** @export */
|
|
emscripten_glBindTransformFeedback: _emscripten_glBindTransformFeedback,
|
|
/** @export */
|
|
emscripten_glBindVertexArray: _emscripten_glBindVertexArray,
|
|
/** @export */
|
|
emscripten_glBindVertexArrayOES: _emscripten_glBindVertexArrayOES,
|
|
/** @export */
|
|
emscripten_glBlendColor: _emscripten_glBlendColor,
|
|
/** @export */
|
|
emscripten_glBlendEquation: _emscripten_glBlendEquation,
|
|
/** @export */
|
|
emscripten_glBlendEquationSeparate: _emscripten_glBlendEquationSeparate,
|
|
/** @export */
|
|
emscripten_glBlendFunc: _emscripten_glBlendFunc,
|
|
/** @export */
|
|
emscripten_glBlendFuncSeparate: _emscripten_glBlendFuncSeparate,
|
|
/** @export */
|
|
emscripten_glBlitFramebuffer: _emscripten_glBlitFramebuffer,
|
|
/** @export */
|
|
emscripten_glBufferData: _emscripten_glBufferData,
|
|
/** @export */
|
|
emscripten_glBufferSubData: _emscripten_glBufferSubData,
|
|
/** @export */
|
|
emscripten_glCheckFramebufferStatus: _emscripten_glCheckFramebufferStatus,
|
|
/** @export */
|
|
emscripten_glClear: _emscripten_glClear,
|
|
/** @export */
|
|
emscripten_glClearBufferfi: _emscripten_glClearBufferfi,
|
|
/** @export */
|
|
emscripten_glClearBufferfv: _emscripten_glClearBufferfv,
|
|
/** @export */
|
|
emscripten_glClearBufferiv: _emscripten_glClearBufferiv,
|
|
/** @export */
|
|
emscripten_glClearBufferuiv: _emscripten_glClearBufferuiv,
|
|
/** @export */
|
|
emscripten_glClearColor: _emscripten_glClearColor,
|
|
/** @export */
|
|
emscripten_glClearDepthf: _emscripten_glClearDepthf,
|
|
/** @export */
|
|
emscripten_glClearStencil: _emscripten_glClearStencil,
|
|
/** @export */
|
|
emscripten_glClientWaitSync: _emscripten_glClientWaitSync,
|
|
/** @export */
|
|
emscripten_glColorMask: _emscripten_glColorMask,
|
|
/** @export */
|
|
emscripten_glCompileShader: _emscripten_glCompileShader,
|
|
/** @export */
|
|
emscripten_glCompressedTexImage2D: _emscripten_glCompressedTexImage2D,
|
|
/** @export */
|
|
emscripten_glCompressedTexImage3D: _emscripten_glCompressedTexImage3D,
|
|
/** @export */
|
|
emscripten_glCompressedTexSubImage2D: _emscripten_glCompressedTexSubImage2D,
|
|
/** @export */
|
|
emscripten_glCompressedTexSubImage3D: _emscripten_glCompressedTexSubImage3D,
|
|
/** @export */
|
|
emscripten_glCopyBufferSubData: _emscripten_glCopyBufferSubData,
|
|
/** @export */
|
|
emscripten_glCopyTexImage2D: _emscripten_glCopyTexImage2D,
|
|
/** @export */
|
|
emscripten_glCopyTexSubImage2D: _emscripten_glCopyTexSubImage2D,
|
|
/** @export */
|
|
emscripten_glCopyTexSubImage3D: _emscripten_glCopyTexSubImage3D,
|
|
/** @export */
|
|
emscripten_glCreateProgram: _emscripten_glCreateProgram,
|
|
/** @export */
|
|
emscripten_glCreateShader: _emscripten_glCreateShader,
|
|
/** @export */
|
|
emscripten_glCullFace: _emscripten_glCullFace,
|
|
/** @export */
|
|
emscripten_glDeleteBuffers: _emscripten_glDeleteBuffers,
|
|
/** @export */
|
|
emscripten_glDeleteFramebuffers: _emscripten_glDeleteFramebuffers,
|
|
/** @export */
|
|
emscripten_glDeleteProgram: _emscripten_glDeleteProgram,
|
|
/** @export */
|
|
emscripten_glDeleteQueries: _emscripten_glDeleteQueries,
|
|
/** @export */
|
|
emscripten_glDeleteQueriesEXT: _emscripten_glDeleteQueriesEXT,
|
|
/** @export */
|
|
emscripten_glDeleteRenderbuffers: _emscripten_glDeleteRenderbuffers,
|
|
/** @export */
|
|
emscripten_glDeleteSamplers: _emscripten_glDeleteSamplers,
|
|
/** @export */
|
|
emscripten_glDeleteShader: _emscripten_glDeleteShader,
|
|
/** @export */
|
|
emscripten_glDeleteSync: _emscripten_glDeleteSync,
|
|
/** @export */
|
|
emscripten_glDeleteTextures: _emscripten_glDeleteTextures,
|
|
/** @export */
|
|
emscripten_glDeleteTransformFeedbacks: _emscripten_glDeleteTransformFeedbacks,
|
|
/** @export */
|
|
emscripten_glDeleteVertexArrays: _emscripten_glDeleteVertexArrays,
|
|
/** @export */
|
|
emscripten_glDeleteVertexArraysOES: _emscripten_glDeleteVertexArraysOES,
|
|
/** @export */
|
|
emscripten_glDepthFunc: _emscripten_glDepthFunc,
|
|
/** @export */
|
|
emscripten_glDepthMask: _emscripten_glDepthMask,
|
|
/** @export */
|
|
emscripten_glDepthRangef: _emscripten_glDepthRangef,
|
|
/** @export */
|
|
emscripten_glDetachShader: _emscripten_glDetachShader,
|
|
/** @export */
|
|
emscripten_glDisable: _emscripten_glDisable,
|
|
/** @export */
|
|
emscripten_glDisableVertexAttribArray: _emscripten_glDisableVertexAttribArray,
|
|
/** @export */
|
|
emscripten_glDrawArrays: _emscripten_glDrawArrays,
|
|
/** @export */
|
|
emscripten_glDrawArraysInstanced: _emscripten_glDrawArraysInstanced,
|
|
/** @export */
|
|
emscripten_glDrawArraysInstancedANGLE: _emscripten_glDrawArraysInstancedANGLE,
|
|
/** @export */
|
|
emscripten_glDrawArraysInstancedARB: _emscripten_glDrawArraysInstancedARB,
|
|
/** @export */
|
|
emscripten_glDrawArraysInstancedEXT: _emscripten_glDrawArraysInstancedEXT,
|
|
/** @export */
|
|
emscripten_glDrawArraysInstancedNV: _emscripten_glDrawArraysInstancedNV,
|
|
/** @export */
|
|
emscripten_glDrawBuffers: _emscripten_glDrawBuffers,
|
|
/** @export */
|
|
emscripten_glDrawBuffersEXT: _emscripten_glDrawBuffersEXT,
|
|
/** @export */
|
|
emscripten_glDrawBuffersWEBGL: _emscripten_glDrawBuffersWEBGL,
|
|
/** @export */
|
|
emscripten_glDrawElements: _emscripten_glDrawElements,
|
|
/** @export */
|
|
emscripten_glDrawElementsInstanced: _emscripten_glDrawElementsInstanced,
|
|
/** @export */
|
|
emscripten_glDrawElementsInstancedANGLE: _emscripten_glDrawElementsInstancedANGLE,
|
|
/** @export */
|
|
emscripten_glDrawElementsInstancedARB: _emscripten_glDrawElementsInstancedARB,
|
|
/** @export */
|
|
emscripten_glDrawElementsInstancedEXT: _emscripten_glDrawElementsInstancedEXT,
|
|
/** @export */
|
|
emscripten_glDrawElementsInstancedNV: _emscripten_glDrawElementsInstancedNV,
|
|
/** @export */
|
|
emscripten_glDrawRangeElements: _emscripten_glDrawRangeElements,
|
|
/** @export */
|
|
emscripten_glEnable: _emscripten_glEnable,
|
|
/** @export */
|
|
emscripten_glEnableVertexAttribArray: _emscripten_glEnableVertexAttribArray,
|
|
/** @export */
|
|
emscripten_glEndQuery: _emscripten_glEndQuery,
|
|
/** @export */
|
|
emscripten_glEndQueryEXT: _emscripten_glEndQueryEXT,
|
|
/** @export */
|
|
emscripten_glEndTransformFeedback: _emscripten_glEndTransformFeedback,
|
|
/** @export */
|
|
emscripten_glFenceSync: _emscripten_glFenceSync,
|
|
/** @export */
|
|
emscripten_glFinish: _emscripten_glFinish,
|
|
/** @export */
|
|
emscripten_glFlush: _emscripten_glFlush,
|
|
/** @export */
|
|
emscripten_glFramebufferRenderbuffer: _emscripten_glFramebufferRenderbuffer,
|
|
/** @export */
|
|
emscripten_glFramebufferTexture2D: _emscripten_glFramebufferTexture2D,
|
|
/** @export */
|
|
emscripten_glFramebufferTextureLayer: _emscripten_glFramebufferTextureLayer,
|
|
/** @export */
|
|
emscripten_glFrontFace: _emscripten_glFrontFace,
|
|
/** @export */
|
|
emscripten_glGenBuffers: _emscripten_glGenBuffers,
|
|
/** @export */
|
|
emscripten_glGenFramebuffers: _emscripten_glGenFramebuffers,
|
|
/** @export */
|
|
emscripten_glGenQueries: _emscripten_glGenQueries,
|
|
/** @export */
|
|
emscripten_glGenQueriesEXT: _emscripten_glGenQueriesEXT,
|
|
/** @export */
|
|
emscripten_glGenRenderbuffers: _emscripten_glGenRenderbuffers,
|
|
/** @export */
|
|
emscripten_glGenSamplers: _emscripten_glGenSamplers,
|
|
/** @export */
|
|
emscripten_glGenTextures: _emscripten_glGenTextures,
|
|
/** @export */
|
|
emscripten_glGenTransformFeedbacks: _emscripten_glGenTransformFeedbacks,
|
|
/** @export */
|
|
emscripten_glGenVertexArrays: _emscripten_glGenVertexArrays,
|
|
/** @export */
|
|
emscripten_glGenVertexArraysOES: _emscripten_glGenVertexArraysOES,
|
|
/** @export */
|
|
emscripten_glGenerateMipmap: _emscripten_glGenerateMipmap,
|
|
/** @export */
|
|
emscripten_glGetActiveAttrib: _emscripten_glGetActiveAttrib,
|
|
/** @export */
|
|
emscripten_glGetActiveUniform: _emscripten_glGetActiveUniform,
|
|
/** @export */
|
|
emscripten_glGetActiveUniformBlockName: _emscripten_glGetActiveUniformBlockName,
|
|
/** @export */
|
|
emscripten_glGetActiveUniformBlockiv: _emscripten_glGetActiveUniformBlockiv,
|
|
/** @export */
|
|
emscripten_glGetActiveUniformsiv: _emscripten_glGetActiveUniformsiv,
|
|
/** @export */
|
|
emscripten_glGetAttachedShaders: _emscripten_glGetAttachedShaders,
|
|
/** @export */
|
|
emscripten_glGetAttribLocation: _emscripten_glGetAttribLocation,
|
|
/** @export */
|
|
emscripten_glGetBooleanv: _emscripten_glGetBooleanv,
|
|
/** @export */
|
|
emscripten_glGetBufferParameteri64v: _emscripten_glGetBufferParameteri64v,
|
|
/** @export */
|
|
emscripten_glGetBufferParameteriv: _emscripten_glGetBufferParameteriv,
|
|
/** @export */
|
|
emscripten_glGetError: _emscripten_glGetError,
|
|
/** @export */
|
|
emscripten_glGetFloatv: _emscripten_glGetFloatv,
|
|
/** @export */
|
|
emscripten_glGetFragDataLocation: _emscripten_glGetFragDataLocation,
|
|
/** @export */
|
|
emscripten_glGetFramebufferAttachmentParameteriv: _emscripten_glGetFramebufferAttachmentParameteriv,
|
|
/** @export */
|
|
emscripten_glGetInteger64i_v: _emscripten_glGetInteger64i_v,
|
|
/** @export */
|
|
emscripten_glGetInteger64v: _emscripten_glGetInteger64v,
|
|
/** @export */
|
|
emscripten_glGetIntegeri_v: _emscripten_glGetIntegeri_v,
|
|
/** @export */
|
|
emscripten_glGetIntegerv: _emscripten_glGetIntegerv,
|
|
/** @export */
|
|
emscripten_glGetInternalformativ: _emscripten_glGetInternalformativ,
|
|
/** @export */
|
|
emscripten_glGetProgramBinary: _emscripten_glGetProgramBinary,
|
|
/** @export */
|
|
emscripten_glGetProgramInfoLog: _emscripten_glGetProgramInfoLog,
|
|
/** @export */
|
|
emscripten_glGetProgramiv: _emscripten_glGetProgramiv,
|
|
/** @export */
|
|
emscripten_glGetQueryObjecti64vEXT: _emscripten_glGetQueryObjecti64vEXT,
|
|
/** @export */
|
|
emscripten_glGetQueryObjectivEXT: _emscripten_glGetQueryObjectivEXT,
|
|
/** @export */
|
|
emscripten_glGetQueryObjectui64vEXT: _emscripten_glGetQueryObjectui64vEXT,
|
|
/** @export */
|
|
emscripten_glGetQueryObjectuiv: _emscripten_glGetQueryObjectuiv,
|
|
/** @export */
|
|
emscripten_glGetQueryObjectuivEXT: _emscripten_glGetQueryObjectuivEXT,
|
|
/** @export */
|
|
emscripten_glGetQueryiv: _emscripten_glGetQueryiv,
|
|
/** @export */
|
|
emscripten_glGetQueryivEXT: _emscripten_glGetQueryivEXT,
|
|
/** @export */
|
|
emscripten_glGetRenderbufferParameteriv: _emscripten_glGetRenderbufferParameteriv,
|
|
/** @export */
|
|
emscripten_glGetSamplerParameterfv: _emscripten_glGetSamplerParameterfv,
|
|
/** @export */
|
|
emscripten_glGetSamplerParameteriv: _emscripten_glGetSamplerParameteriv,
|
|
/** @export */
|
|
emscripten_glGetShaderInfoLog: _emscripten_glGetShaderInfoLog,
|
|
/** @export */
|
|
emscripten_glGetShaderPrecisionFormat: _emscripten_glGetShaderPrecisionFormat,
|
|
/** @export */
|
|
emscripten_glGetShaderSource: _emscripten_glGetShaderSource,
|
|
/** @export */
|
|
emscripten_glGetShaderiv: _emscripten_glGetShaderiv,
|
|
/** @export */
|
|
emscripten_glGetString: _emscripten_glGetString,
|
|
/** @export */
|
|
emscripten_glGetStringi: _emscripten_glGetStringi,
|
|
/** @export */
|
|
emscripten_glGetSynciv: _emscripten_glGetSynciv,
|
|
/** @export */
|
|
emscripten_glGetTexParameterfv: _emscripten_glGetTexParameterfv,
|
|
/** @export */
|
|
emscripten_glGetTexParameteriv: _emscripten_glGetTexParameteriv,
|
|
/** @export */
|
|
emscripten_glGetTransformFeedbackVarying: _emscripten_glGetTransformFeedbackVarying,
|
|
/** @export */
|
|
emscripten_glGetUniformBlockIndex: _emscripten_glGetUniformBlockIndex,
|
|
/** @export */
|
|
emscripten_glGetUniformIndices: _emscripten_glGetUniformIndices,
|
|
/** @export */
|
|
emscripten_glGetUniformLocation: _emscripten_glGetUniformLocation,
|
|
/** @export */
|
|
emscripten_glGetUniformfv: _emscripten_glGetUniformfv,
|
|
/** @export */
|
|
emscripten_glGetUniformiv: _emscripten_glGetUniformiv,
|
|
/** @export */
|
|
emscripten_glGetUniformuiv: _emscripten_glGetUniformuiv,
|
|
/** @export */
|
|
emscripten_glGetVertexAttribIiv: _emscripten_glGetVertexAttribIiv,
|
|
/** @export */
|
|
emscripten_glGetVertexAttribIuiv: _emscripten_glGetVertexAttribIuiv,
|
|
/** @export */
|
|
emscripten_glGetVertexAttribPointerv: _emscripten_glGetVertexAttribPointerv,
|
|
/** @export */
|
|
emscripten_glGetVertexAttribfv: _emscripten_glGetVertexAttribfv,
|
|
/** @export */
|
|
emscripten_glGetVertexAttribiv: _emscripten_glGetVertexAttribiv,
|
|
/** @export */
|
|
emscripten_glHint: _emscripten_glHint,
|
|
/** @export */
|
|
emscripten_glInvalidateFramebuffer: _emscripten_glInvalidateFramebuffer,
|
|
/** @export */
|
|
emscripten_glInvalidateSubFramebuffer: _emscripten_glInvalidateSubFramebuffer,
|
|
/** @export */
|
|
emscripten_glIsBuffer: _emscripten_glIsBuffer,
|
|
/** @export */
|
|
emscripten_glIsEnabled: _emscripten_glIsEnabled,
|
|
/** @export */
|
|
emscripten_glIsFramebuffer: _emscripten_glIsFramebuffer,
|
|
/** @export */
|
|
emscripten_glIsProgram: _emscripten_glIsProgram,
|
|
/** @export */
|
|
emscripten_glIsQuery: _emscripten_glIsQuery,
|
|
/** @export */
|
|
emscripten_glIsQueryEXT: _emscripten_glIsQueryEXT,
|
|
/** @export */
|
|
emscripten_glIsRenderbuffer: _emscripten_glIsRenderbuffer,
|
|
/** @export */
|
|
emscripten_glIsSampler: _emscripten_glIsSampler,
|
|
/** @export */
|
|
emscripten_glIsShader: _emscripten_glIsShader,
|
|
/** @export */
|
|
emscripten_glIsSync: _emscripten_glIsSync,
|
|
/** @export */
|
|
emscripten_glIsTexture: _emscripten_glIsTexture,
|
|
/** @export */
|
|
emscripten_glIsTransformFeedback: _emscripten_glIsTransformFeedback,
|
|
/** @export */
|
|
emscripten_glIsVertexArray: _emscripten_glIsVertexArray,
|
|
/** @export */
|
|
emscripten_glIsVertexArrayOES: _emscripten_glIsVertexArrayOES,
|
|
/** @export */
|
|
emscripten_glLineWidth: _emscripten_glLineWidth,
|
|
/** @export */
|
|
emscripten_glLinkProgram: _emscripten_glLinkProgram,
|
|
/** @export */
|
|
emscripten_glPauseTransformFeedback: _emscripten_glPauseTransformFeedback,
|
|
/** @export */
|
|
emscripten_glPixelStorei: _emscripten_glPixelStorei,
|
|
/** @export */
|
|
emscripten_glPolygonOffset: _emscripten_glPolygonOffset,
|
|
/** @export */
|
|
emscripten_glProgramBinary: _emscripten_glProgramBinary,
|
|
/** @export */
|
|
emscripten_glProgramParameteri: _emscripten_glProgramParameteri,
|
|
/** @export */
|
|
emscripten_glQueryCounterEXT: _emscripten_glQueryCounterEXT,
|
|
/** @export */
|
|
emscripten_glReadBuffer: _emscripten_glReadBuffer,
|
|
/** @export */
|
|
emscripten_glReadPixels: _emscripten_glReadPixels,
|
|
/** @export */
|
|
emscripten_glReleaseShaderCompiler: _emscripten_glReleaseShaderCompiler,
|
|
/** @export */
|
|
emscripten_glRenderbufferStorage: _emscripten_glRenderbufferStorage,
|
|
/** @export */
|
|
emscripten_glRenderbufferStorageMultisample: _emscripten_glRenderbufferStorageMultisample,
|
|
/** @export */
|
|
emscripten_glResumeTransformFeedback: _emscripten_glResumeTransformFeedback,
|
|
/** @export */
|
|
emscripten_glSampleCoverage: _emscripten_glSampleCoverage,
|
|
/** @export */
|
|
emscripten_glSamplerParameterf: _emscripten_glSamplerParameterf,
|
|
/** @export */
|
|
emscripten_glSamplerParameterfv: _emscripten_glSamplerParameterfv,
|
|
/** @export */
|
|
emscripten_glSamplerParameteri: _emscripten_glSamplerParameteri,
|
|
/** @export */
|
|
emscripten_glSamplerParameteriv: _emscripten_glSamplerParameteriv,
|
|
/** @export */
|
|
emscripten_glScissor: _emscripten_glScissor,
|
|
/** @export */
|
|
emscripten_glShaderBinary: _emscripten_glShaderBinary,
|
|
/** @export */
|
|
emscripten_glShaderSource: _emscripten_glShaderSource,
|
|
/** @export */
|
|
emscripten_glStencilFunc: _emscripten_glStencilFunc,
|
|
/** @export */
|
|
emscripten_glStencilFuncSeparate: _emscripten_glStencilFuncSeparate,
|
|
/** @export */
|
|
emscripten_glStencilMask: _emscripten_glStencilMask,
|
|
/** @export */
|
|
emscripten_glStencilMaskSeparate: _emscripten_glStencilMaskSeparate,
|
|
/** @export */
|
|
emscripten_glStencilOp: _emscripten_glStencilOp,
|
|
/** @export */
|
|
emscripten_glStencilOpSeparate: _emscripten_glStencilOpSeparate,
|
|
/** @export */
|
|
emscripten_glTexImage2D: _emscripten_glTexImage2D,
|
|
/** @export */
|
|
emscripten_glTexImage3D: _emscripten_glTexImage3D,
|
|
/** @export */
|
|
emscripten_glTexParameterf: _emscripten_glTexParameterf,
|
|
/** @export */
|
|
emscripten_glTexParameterfv: _emscripten_glTexParameterfv,
|
|
/** @export */
|
|
emscripten_glTexParameteri: _emscripten_glTexParameteri,
|
|
/** @export */
|
|
emscripten_glTexParameteriv: _emscripten_glTexParameteriv,
|
|
/** @export */
|
|
emscripten_glTexStorage2D: _emscripten_glTexStorage2D,
|
|
/** @export */
|
|
emscripten_glTexStorage3D: _emscripten_glTexStorage3D,
|
|
/** @export */
|
|
emscripten_glTexSubImage2D: _emscripten_glTexSubImage2D,
|
|
/** @export */
|
|
emscripten_glTexSubImage3D: _emscripten_glTexSubImage3D,
|
|
/** @export */
|
|
emscripten_glTransformFeedbackVaryings: _emscripten_glTransformFeedbackVaryings,
|
|
/** @export */
|
|
emscripten_glUniform1f: _emscripten_glUniform1f,
|
|
/** @export */
|
|
emscripten_glUniform1fv: _emscripten_glUniform1fv,
|
|
/** @export */
|
|
emscripten_glUniform1i: _emscripten_glUniform1i,
|
|
/** @export */
|
|
emscripten_glUniform1iv: _emscripten_glUniform1iv,
|
|
/** @export */
|
|
emscripten_glUniform1ui: _emscripten_glUniform1ui,
|
|
/** @export */
|
|
emscripten_glUniform1uiv: _emscripten_glUniform1uiv,
|
|
/** @export */
|
|
emscripten_glUniform2f: _emscripten_glUniform2f,
|
|
/** @export */
|
|
emscripten_glUniform2fv: _emscripten_glUniform2fv,
|
|
/** @export */
|
|
emscripten_glUniform2i: _emscripten_glUniform2i,
|
|
/** @export */
|
|
emscripten_glUniform2iv: _emscripten_glUniform2iv,
|
|
/** @export */
|
|
emscripten_glUniform2ui: _emscripten_glUniform2ui,
|
|
/** @export */
|
|
emscripten_glUniform2uiv: _emscripten_glUniform2uiv,
|
|
/** @export */
|
|
emscripten_glUniform3f: _emscripten_glUniform3f,
|
|
/** @export */
|
|
emscripten_glUniform3fv: _emscripten_glUniform3fv,
|
|
/** @export */
|
|
emscripten_glUniform3i: _emscripten_glUniform3i,
|
|
/** @export */
|
|
emscripten_glUniform3iv: _emscripten_glUniform3iv,
|
|
/** @export */
|
|
emscripten_glUniform3ui: _emscripten_glUniform3ui,
|
|
/** @export */
|
|
emscripten_glUniform3uiv: _emscripten_glUniform3uiv,
|
|
/** @export */
|
|
emscripten_glUniform4f: _emscripten_glUniform4f,
|
|
/** @export */
|
|
emscripten_glUniform4fv: _emscripten_glUniform4fv,
|
|
/** @export */
|
|
emscripten_glUniform4i: _emscripten_glUniform4i,
|
|
/** @export */
|
|
emscripten_glUniform4iv: _emscripten_glUniform4iv,
|
|
/** @export */
|
|
emscripten_glUniform4ui: _emscripten_glUniform4ui,
|
|
/** @export */
|
|
emscripten_glUniform4uiv: _emscripten_glUniform4uiv,
|
|
/** @export */
|
|
emscripten_glUniformBlockBinding: _emscripten_glUniformBlockBinding,
|
|
/** @export */
|
|
emscripten_glUniformMatrix2fv: _emscripten_glUniformMatrix2fv,
|
|
/** @export */
|
|
emscripten_glUniformMatrix2x3fv: _emscripten_glUniformMatrix2x3fv,
|
|
/** @export */
|
|
emscripten_glUniformMatrix2x4fv: _emscripten_glUniformMatrix2x4fv,
|
|
/** @export */
|
|
emscripten_glUniformMatrix3fv: _emscripten_glUniformMatrix3fv,
|
|
/** @export */
|
|
emscripten_glUniformMatrix3x2fv: _emscripten_glUniformMatrix3x2fv,
|
|
/** @export */
|
|
emscripten_glUniformMatrix3x4fv: _emscripten_glUniformMatrix3x4fv,
|
|
/** @export */
|
|
emscripten_glUniformMatrix4fv: _emscripten_glUniformMatrix4fv,
|
|
/** @export */
|
|
emscripten_glUniformMatrix4x2fv: _emscripten_glUniformMatrix4x2fv,
|
|
/** @export */
|
|
emscripten_glUniformMatrix4x3fv: _emscripten_glUniformMatrix4x3fv,
|
|
/** @export */
|
|
emscripten_glUseProgram: _emscripten_glUseProgram,
|
|
/** @export */
|
|
emscripten_glValidateProgram: _emscripten_glValidateProgram,
|
|
/** @export */
|
|
emscripten_glVertexAttrib1f: _emscripten_glVertexAttrib1f,
|
|
/** @export */
|
|
emscripten_glVertexAttrib1fv: _emscripten_glVertexAttrib1fv,
|
|
/** @export */
|
|
emscripten_glVertexAttrib2f: _emscripten_glVertexAttrib2f,
|
|
/** @export */
|
|
emscripten_glVertexAttrib2fv: _emscripten_glVertexAttrib2fv,
|
|
/** @export */
|
|
emscripten_glVertexAttrib3f: _emscripten_glVertexAttrib3f,
|
|
/** @export */
|
|
emscripten_glVertexAttrib3fv: _emscripten_glVertexAttrib3fv,
|
|
/** @export */
|
|
emscripten_glVertexAttrib4f: _emscripten_glVertexAttrib4f,
|
|
/** @export */
|
|
emscripten_glVertexAttrib4fv: _emscripten_glVertexAttrib4fv,
|
|
/** @export */
|
|
emscripten_glVertexAttribDivisor: _emscripten_glVertexAttribDivisor,
|
|
/** @export */
|
|
emscripten_glVertexAttribDivisorANGLE: _emscripten_glVertexAttribDivisorANGLE,
|
|
/** @export */
|
|
emscripten_glVertexAttribDivisorARB: _emscripten_glVertexAttribDivisorARB,
|
|
/** @export */
|
|
emscripten_glVertexAttribDivisorEXT: _emscripten_glVertexAttribDivisorEXT,
|
|
/** @export */
|
|
emscripten_glVertexAttribDivisorNV: _emscripten_glVertexAttribDivisorNV,
|
|
/** @export */
|
|
emscripten_glVertexAttribI4i: _emscripten_glVertexAttribI4i,
|
|
/** @export */
|
|
emscripten_glVertexAttribI4iv: _emscripten_glVertexAttribI4iv,
|
|
/** @export */
|
|
emscripten_glVertexAttribI4ui: _emscripten_glVertexAttribI4ui,
|
|
/** @export */
|
|
emscripten_glVertexAttribI4uiv: _emscripten_glVertexAttribI4uiv,
|
|
/** @export */
|
|
emscripten_glVertexAttribIPointer: _emscripten_glVertexAttribIPointer,
|
|
/** @export */
|
|
emscripten_glVertexAttribPointer: _emscripten_glVertexAttribPointer,
|
|
/** @export */
|
|
emscripten_glViewport: _emscripten_glViewport,
|
|
/** @export */
|
|
emscripten_glWaitSync: _emscripten_glWaitSync,
|
|
/** @export */
|
|
emscripten_resize_heap: _emscripten_resize_heap,
|
|
/** @export */
|
|
environ_get: _environ_get,
|
|
/** @export */
|
|
environ_sizes_get: _environ_sizes_get,
|
|
/** @export */
|
|
exit: _exit,
|
|
/** @export */
|
|
fd_close: _fd_close,
|
|
/** @export */
|
|
fd_pread: _fd_pread,
|
|
/** @export */
|
|
fd_pwrite: _fd_pwrite,
|
|
/** @export */
|
|
fd_read: _fd_read,
|
|
/** @export */
|
|
fd_seek: _fd_seek,
|
|
/** @export */
|
|
fd_sync: _fd_sync,
|
|
/** @export */
|
|
fd_write: _fd_write,
|
|
/** @export */
|
|
glActiveTexture: _glActiveTexture,
|
|
/** @export */
|
|
glAttachShader: _glAttachShader,
|
|
/** @export */
|
|
glBindAttribLocation: _glBindAttribLocation,
|
|
/** @export */
|
|
glBindBuffer: _glBindBuffer,
|
|
/** @export */
|
|
glBindFramebuffer: _glBindFramebuffer,
|
|
/** @export */
|
|
glBindRenderbuffer: _glBindRenderbuffer,
|
|
/** @export */
|
|
glBindSampler: _glBindSampler,
|
|
/** @export */
|
|
glBindTexture: _glBindTexture,
|
|
/** @export */
|
|
glBindVertexArray: _glBindVertexArray,
|
|
/** @export */
|
|
glBindVertexArrayOES: _glBindVertexArrayOES,
|
|
/** @export */
|
|
glBlendColor: _glBlendColor,
|
|
/** @export */
|
|
glBlendEquation: _glBlendEquation,
|
|
/** @export */
|
|
glBlendFunc: _glBlendFunc,
|
|
/** @export */
|
|
glBlitFramebuffer: _glBlitFramebuffer,
|
|
/** @export */
|
|
glBufferData: _glBufferData,
|
|
/** @export */
|
|
glBufferSubData: _glBufferSubData,
|
|
/** @export */
|
|
glCheckFramebufferStatus: _glCheckFramebufferStatus,
|
|
/** @export */
|
|
glClear: _glClear,
|
|
/** @export */
|
|
glClearColor: _glClearColor,
|
|
/** @export */
|
|
glClearStencil: _glClearStencil,
|
|
/** @export */
|
|
glClientWaitSync: _glClientWaitSync,
|
|
/** @export */
|
|
glColorMask: _glColorMask,
|
|
/** @export */
|
|
glCompileShader: _glCompileShader,
|
|
/** @export */
|
|
glCompressedTexImage2D: _glCompressedTexImage2D,
|
|
/** @export */
|
|
glCompressedTexSubImage2D: _glCompressedTexSubImage2D,
|
|
/** @export */
|
|
glCopyBufferSubData: _glCopyBufferSubData,
|
|
/** @export */
|
|
glCopyTexSubImage2D: _glCopyTexSubImage2D,
|
|
/** @export */
|
|
glCreateProgram: _glCreateProgram,
|
|
/** @export */
|
|
glCreateShader: _glCreateShader,
|
|
/** @export */
|
|
glCullFace: _glCullFace,
|
|
/** @export */
|
|
glDeleteBuffers: _glDeleteBuffers,
|
|
/** @export */
|
|
glDeleteFramebuffers: _glDeleteFramebuffers,
|
|
/** @export */
|
|
glDeleteProgram: _glDeleteProgram,
|
|
/** @export */
|
|
glDeleteRenderbuffers: _glDeleteRenderbuffers,
|
|
/** @export */
|
|
glDeleteSamplers: _glDeleteSamplers,
|
|
/** @export */
|
|
glDeleteShader: _glDeleteShader,
|
|
/** @export */
|
|
glDeleteSync: _glDeleteSync,
|
|
/** @export */
|
|
glDeleteTextures: _glDeleteTextures,
|
|
/** @export */
|
|
glDeleteVertexArrays: _glDeleteVertexArrays,
|
|
/** @export */
|
|
glDeleteVertexArraysOES: _glDeleteVertexArraysOES,
|
|
/** @export */
|
|
glDepthMask: _glDepthMask,
|
|
/** @export */
|
|
glDisable: _glDisable,
|
|
/** @export */
|
|
glDisableVertexAttribArray: _glDisableVertexAttribArray,
|
|
/** @export */
|
|
glDrawArrays: _glDrawArrays,
|
|
/** @export */
|
|
glDrawArraysInstanced: _glDrawArraysInstanced,
|
|
/** @export */
|
|
glDrawArraysInstancedBaseInstanceWEBGL: _glDrawArraysInstancedBaseInstanceWEBGL,
|
|
/** @export */
|
|
glDrawBuffers: _glDrawBuffers,
|
|
/** @export */
|
|
glDrawElements: _glDrawElements,
|
|
/** @export */
|
|
glDrawElementsInstanced: _glDrawElementsInstanced,
|
|
/** @export */
|
|
glDrawElementsInstancedBaseVertexBaseInstanceWEBGL: _glDrawElementsInstancedBaseVertexBaseInstanceWEBGL,
|
|
/** @export */
|
|
glDrawRangeElements: _glDrawRangeElements,
|
|
/** @export */
|
|
glEnable: _glEnable,
|
|
/** @export */
|
|
glEnableVertexAttribArray: _glEnableVertexAttribArray,
|
|
/** @export */
|
|
glFenceSync: _glFenceSync,
|
|
/** @export */
|
|
glFinish: _glFinish,
|
|
/** @export */
|
|
glFlush: _glFlush,
|
|
/** @export */
|
|
glFramebufferRenderbuffer: _glFramebufferRenderbuffer,
|
|
/** @export */
|
|
glFramebufferTexture2D: _glFramebufferTexture2D,
|
|
/** @export */
|
|
glFrontFace: _glFrontFace,
|
|
/** @export */
|
|
glGenBuffers: _glGenBuffers,
|
|
/** @export */
|
|
glGenFramebuffers: _glGenFramebuffers,
|
|
/** @export */
|
|
glGenRenderbuffers: _glGenRenderbuffers,
|
|
/** @export */
|
|
glGenSamplers: _glGenSamplers,
|
|
/** @export */
|
|
glGenTextures: _glGenTextures,
|
|
/** @export */
|
|
glGenVertexArrays: _glGenVertexArrays,
|
|
/** @export */
|
|
glGenVertexArraysOES: _glGenVertexArraysOES,
|
|
/** @export */
|
|
glGenerateMipmap: _glGenerateMipmap,
|
|
/** @export */
|
|
glGetBufferParameteriv: _glGetBufferParameteriv,
|
|
/** @export */
|
|
glGetError: _glGetError,
|
|
/** @export */
|
|
glGetFloatv: _glGetFloatv,
|
|
/** @export */
|
|
glGetFramebufferAttachmentParameteriv: _glGetFramebufferAttachmentParameteriv,
|
|
/** @export */
|
|
glGetIntegerv: _glGetIntegerv,
|
|
/** @export */
|
|
glGetProgramInfoLog: _glGetProgramInfoLog,
|
|
/** @export */
|
|
glGetProgramiv: _glGetProgramiv,
|
|
/** @export */
|
|
glGetRenderbufferParameteriv: _glGetRenderbufferParameteriv,
|
|
/** @export */
|
|
glGetShaderInfoLog: _glGetShaderInfoLog,
|
|
/** @export */
|
|
glGetShaderPrecisionFormat: _glGetShaderPrecisionFormat,
|
|
/** @export */
|
|
glGetShaderiv: _glGetShaderiv,
|
|
/** @export */
|
|
glGetString: _glGetString,
|
|
/** @export */
|
|
glGetStringi: _glGetStringi,
|
|
/** @export */
|
|
glGetUniformLocation: _glGetUniformLocation,
|
|
/** @export */
|
|
glInvalidateFramebuffer: _glInvalidateFramebuffer,
|
|
/** @export */
|
|
glInvalidateSubFramebuffer: _glInvalidateSubFramebuffer,
|
|
/** @export */
|
|
glIsSync: _glIsSync,
|
|
/** @export */
|
|
glIsTexture: _glIsTexture,
|
|
/** @export */
|
|
glLineWidth: _glLineWidth,
|
|
/** @export */
|
|
glLinkProgram: _glLinkProgram,
|
|
/** @export */
|
|
glMultiDrawArraysInstancedBaseInstanceWEBGL: _glMultiDrawArraysInstancedBaseInstanceWEBGL,
|
|
/** @export */
|
|
glMultiDrawElementsInstancedBaseVertexBaseInstanceWEBGL: _glMultiDrawElementsInstancedBaseVertexBaseInstanceWEBGL,
|
|
/** @export */
|
|
glPixelStorei: _glPixelStorei,
|
|
/** @export */
|
|
glReadBuffer: _glReadBuffer,
|
|
/** @export */
|
|
glReadPixels: _glReadPixels,
|
|
/** @export */
|
|
glRenderbufferStorage: _glRenderbufferStorage,
|
|
/** @export */
|
|
glRenderbufferStorageMultisample: _glRenderbufferStorageMultisample,
|
|
/** @export */
|
|
glSamplerParameterf: _glSamplerParameterf,
|
|
/** @export */
|
|
glSamplerParameteri: _glSamplerParameteri,
|
|
/** @export */
|
|
glSamplerParameteriv: _glSamplerParameteriv,
|
|
/** @export */
|
|
glScissor: _glScissor,
|
|
/** @export */
|
|
glShaderSource: _glShaderSource,
|
|
/** @export */
|
|
glStencilFunc: _glStencilFunc,
|
|
/** @export */
|
|
glStencilFuncSeparate: _glStencilFuncSeparate,
|
|
/** @export */
|
|
glStencilMask: _glStencilMask,
|
|
/** @export */
|
|
glStencilMaskSeparate: _glStencilMaskSeparate,
|
|
/** @export */
|
|
glStencilOp: _glStencilOp,
|
|
/** @export */
|
|
glStencilOpSeparate: _glStencilOpSeparate,
|
|
/** @export */
|
|
glTexImage2D: _glTexImage2D,
|
|
/** @export */
|
|
glTexParameterf: _glTexParameterf,
|
|
/** @export */
|
|
glTexParameterfv: _glTexParameterfv,
|
|
/** @export */
|
|
glTexParameteri: _glTexParameteri,
|
|
/** @export */
|
|
glTexParameteriv: _glTexParameteriv,
|
|
/** @export */
|
|
glTexStorage2D: _glTexStorage2D,
|
|
/** @export */
|
|
glTexSubImage2D: _glTexSubImage2D,
|
|
/** @export */
|
|
glUniform1f: _glUniform1f,
|
|
/** @export */
|
|
glUniform1fv: _glUniform1fv,
|
|
/** @export */
|
|
glUniform1i: _glUniform1i,
|
|
/** @export */
|
|
glUniform1iv: _glUniform1iv,
|
|
/** @export */
|
|
glUniform2f: _glUniform2f,
|
|
/** @export */
|
|
glUniform2fv: _glUniform2fv,
|
|
/** @export */
|
|
glUniform2i: _glUniform2i,
|
|
/** @export */
|
|
glUniform2iv: _glUniform2iv,
|
|
/** @export */
|
|
glUniform3f: _glUniform3f,
|
|
/** @export */
|
|
glUniform3fv: _glUniform3fv,
|
|
/** @export */
|
|
glUniform3i: _glUniform3i,
|
|
/** @export */
|
|
glUniform3iv: _glUniform3iv,
|
|
/** @export */
|
|
glUniform4f: _glUniform4f,
|
|
/** @export */
|
|
glUniform4fv: _glUniform4fv,
|
|
/** @export */
|
|
glUniform4i: _glUniform4i,
|
|
/** @export */
|
|
glUniform4iv: _glUniform4iv,
|
|
/** @export */
|
|
glUniformMatrix2fv: _glUniformMatrix2fv,
|
|
/** @export */
|
|
glUniformMatrix3fv: _glUniformMatrix3fv,
|
|
/** @export */
|
|
glUniformMatrix4fv: _glUniformMatrix4fv,
|
|
/** @export */
|
|
glUseProgram: _glUseProgram,
|
|
/** @export */
|
|
glVertexAttrib1f: _glVertexAttrib1f,
|
|
/** @export */
|
|
glVertexAttrib2fv: _glVertexAttrib2fv,
|
|
/** @export */
|
|
glVertexAttrib3fv: _glVertexAttrib3fv,
|
|
/** @export */
|
|
glVertexAttrib4fv: _glVertexAttrib4fv,
|
|
/** @export */
|
|
glVertexAttribDivisor: _glVertexAttribDivisor,
|
|
/** @export */
|
|
glVertexAttribIPointer: _glVertexAttribIPointer,
|
|
/** @export */
|
|
glVertexAttribPointer: _glVertexAttribPointer,
|
|
/** @export */
|
|
glViewport: _glViewport,
|
|
/** @export */
|
|
glWaitSync: _glWaitSync,
|
|
/** @export */
|
|
mono_interp_flush_jitcall_queue: _mono_interp_flush_jitcall_queue,
|
|
/** @export */
|
|
mono_interp_invoke_wasm_jit_call_trampoline: _mono_interp_invoke_wasm_jit_call_trampoline,
|
|
/** @export */
|
|
mono_interp_jit_wasm_entry_trampoline: _mono_interp_jit_wasm_entry_trampoline,
|
|
/** @export */
|
|
mono_interp_jit_wasm_jit_call_trampoline: _mono_interp_jit_wasm_jit_call_trampoline,
|
|
/** @export */
|
|
mono_interp_record_interp_entry: _mono_interp_record_interp_entry,
|
|
/** @export */
|
|
mono_interp_tier_prepare_jiterpreter: _mono_interp_tier_prepare_jiterpreter,
|
|
/** @export */
|
|
mono_wasm_bind_js_import_ST: _mono_wasm_bind_js_import_ST,
|
|
/** @export */
|
|
mono_wasm_browser_entropy: _mono_wasm_browser_entropy,
|
|
/** @export */
|
|
mono_wasm_cancel_promise: _mono_wasm_cancel_promise,
|
|
/** @export */
|
|
mono_wasm_console_clear: _mono_wasm_console_clear,
|
|
/** @export */
|
|
mono_wasm_free_method_data: _mono_wasm_free_method_data,
|
|
/** @export */
|
|
mono_wasm_get_locale_info: _mono_wasm_get_locale_info,
|
|
/** @export */
|
|
mono_wasm_invoke_js_function: _mono_wasm_invoke_js_function,
|
|
/** @export */
|
|
mono_wasm_invoke_jsimport_ST: _mono_wasm_invoke_jsimport_ST,
|
|
/** @export */
|
|
mono_wasm_process_current_pid: _mono_wasm_process_current_pid,
|
|
/** @export */
|
|
mono_wasm_release_cs_owned_object: _mono_wasm_release_cs_owned_object,
|
|
/** @export */
|
|
mono_wasm_resolve_or_reject_promise: _mono_wasm_resolve_or_reject_promise,
|
|
/** @export */
|
|
mono_wasm_schedule_timer: _mono_wasm_schedule_timer,
|
|
/** @export */
|
|
mono_wasm_set_entrypoint_breakpoint: _mono_wasm_set_entrypoint_breakpoint,
|
|
/** @export */
|
|
mono_wasm_trace_logger: _mono_wasm_trace_logger,
|
|
/** @export */
|
|
schedule_background_exec: _schedule_background_exec,
|
|
/** @export */
|
|
strftime: _strftime,
|
|
/** @export */
|
|
strftime_l: _strftime_l
|
|
};
|
|
var wasmExports = createWasm();
|
|
var ___wasm_call_ctors = () => (___wasm_call_ctors = wasmExports['__wasm_call_ctors'])();
|
|
var _free = Module['_free'] = (a0) => (_free = Module['_free'] = wasmExports['free'])(a0);
|
|
var _memset = Module['_memset'] = (a0, a1, a2) => (_memset = Module['_memset'] = wasmExports['memset'])(a0, a1, a2);
|
|
var _malloc = Module['_malloc'] = (a0) => (_malloc = Module['_malloc'] = wasmExports['malloc'])(a0);
|
|
var _tanf = Module['_tanf'] = (a0) => (_tanf = Module['_tanf'] = wasmExports['tanf'])(a0);
|
|
var _atanf = Module['_atanf'] = (a0) => (_atanf = Module['_atanf'] = wasmExports['atanf'])(a0);
|
|
var _sinf = Module['_sinf'] = (a0) => (_sinf = Module['_sinf'] = wasmExports['sinf'])(a0);
|
|
var _cosf = Module['_cosf'] = (a0) => (_cosf = Module['_cosf'] = wasmExports['cosf'])(a0);
|
|
var _mono_wasm_register_root = Module['_mono_wasm_register_root'] = (a0, a1, a2) => (_mono_wasm_register_root = Module['_mono_wasm_register_root'] = wasmExports['mono_wasm_register_root'])(a0, a1, a2);
|
|
var _mono_wasm_deregister_root = Module['_mono_wasm_deregister_root'] = (a0) => (_mono_wasm_deregister_root = Module['_mono_wasm_deregister_root'] = wasmExports['mono_wasm_deregister_root'])(a0);
|
|
var _mono_wasm_add_assembly = Module['_mono_wasm_add_assembly'] = (a0, a1, a2) => (_mono_wasm_add_assembly = Module['_mono_wasm_add_assembly'] = wasmExports['mono_wasm_add_assembly'])(a0, a1, a2);
|
|
var _mono_wasm_add_satellite_assembly = Module['_mono_wasm_add_satellite_assembly'] = (a0, a1, a2, a3) => (_mono_wasm_add_satellite_assembly = Module['_mono_wasm_add_satellite_assembly'] = wasmExports['mono_wasm_add_satellite_assembly'])(a0, a1, a2, a3);
|
|
var _mono_wasm_setenv = Module['_mono_wasm_setenv'] = (a0, a1) => (_mono_wasm_setenv = Module['_mono_wasm_setenv'] = wasmExports['mono_wasm_setenv'])(a0, a1);
|
|
var _mono_wasm_getenv = Module['_mono_wasm_getenv'] = (a0) => (_mono_wasm_getenv = Module['_mono_wasm_getenv'] = wasmExports['mono_wasm_getenv'])(a0);
|
|
var _mono_wasm_load_runtime = Module['_mono_wasm_load_runtime'] = (a0, a1, a2, a3) => (_mono_wasm_load_runtime = Module['_mono_wasm_load_runtime'] = wasmExports['mono_wasm_load_runtime'])(a0, a1, a2, a3);
|
|
var _mono_wasm_invoke_jsexport = Module['_mono_wasm_invoke_jsexport'] = (a0, a1) => (_mono_wasm_invoke_jsexport = Module['_mono_wasm_invoke_jsexport'] = wasmExports['mono_wasm_invoke_jsexport'])(a0, a1);
|
|
var _mono_wasm_string_from_utf16_ref = Module['_mono_wasm_string_from_utf16_ref'] = (a0, a1, a2) => (_mono_wasm_string_from_utf16_ref = Module['_mono_wasm_string_from_utf16_ref'] = wasmExports['mono_wasm_string_from_utf16_ref'])(a0, a1, a2);
|
|
var _mono_wasm_exec_regression = Module['_mono_wasm_exec_regression'] = (a0, a1) => (_mono_wasm_exec_regression = Module['_mono_wasm_exec_regression'] = wasmExports['mono_wasm_exec_regression'])(a0, a1);
|
|
var _mono_wasm_exit = Module['_mono_wasm_exit'] = (a0) => (_mono_wasm_exit = Module['_mono_wasm_exit'] = wasmExports['mono_wasm_exit'])(a0);
|
|
var _fflush = (a0) => (_fflush = wasmExports['fflush'])(a0);
|
|
var _mono_wasm_set_main_args = Module['_mono_wasm_set_main_args'] = (a0, a1) => (_mono_wasm_set_main_args = Module['_mono_wasm_set_main_args'] = wasmExports['mono_wasm_set_main_args'])(a0, a1);
|
|
var _mono_wasm_strdup = Module['_mono_wasm_strdup'] = (a0) => (_mono_wasm_strdup = Module['_mono_wasm_strdup'] = wasmExports['mono_wasm_strdup'])(a0);
|
|
var _mono_wasm_parse_runtime_options = Module['_mono_wasm_parse_runtime_options'] = (a0, a1) => (_mono_wasm_parse_runtime_options = Module['_mono_wasm_parse_runtime_options'] = wasmExports['mono_wasm_parse_runtime_options'])(a0, a1);
|
|
var _mono_wasm_intern_string_ref = Module['_mono_wasm_intern_string_ref'] = (a0) => (_mono_wasm_intern_string_ref = Module['_mono_wasm_intern_string_ref'] = wasmExports['mono_wasm_intern_string_ref'])(a0);
|
|
var _mono_wasm_string_get_data_ref = Module['_mono_wasm_string_get_data_ref'] = (a0, a1, a2, a3) => (_mono_wasm_string_get_data_ref = Module['_mono_wasm_string_get_data_ref'] = wasmExports['mono_wasm_string_get_data_ref'])(a0, a1, a2, a3);
|
|
var _mono_wasm_write_managed_pointer_unsafe = Module['_mono_wasm_write_managed_pointer_unsafe'] = (a0, a1) => (_mono_wasm_write_managed_pointer_unsafe = Module['_mono_wasm_write_managed_pointer_unsafe'] = wasmExports['mono_wasm_write_managed_pointer_unsafe'])(a0, a1);
|
|
var _mono_wasm_copy_managed_pointer = Module['_mono_wasm_copy_managed_pointer'] = (a0, a1) => (_mono_wasm_copy_managed_pointer = Module['_mono_wasm_copy_managed_pointer'] = wasmExports['mono_wasm_copy_managed_pointer'])(a0, a1);
|
|
var _mono_wasm_init_finalizer_thread = Module['_mono_wasm_init_finalizer_thread'] = () => (_mono_wasm_init_finalizer_thread = Module['_mono_wasm_init_finalizer_thread'] = wasmExports['mono_wasm_init_finalizer_thread'])();
|
|
var _mono_wasm_i52_to_f64 = Module['_mono_wasm_i52_to_f64'] = (a0, a1) => (_mono_wasm_i52_to_f64 = Module['_mono_wasm_i52_to_f64'] = wasmExports['mono_wasm_i52_to_f64'])(a0, a1);
|
|
var _mono_wasm_u52_to_f64 = Module['_mono_wasm_u52_to_f64'] = (a0, a1) => (_mono_wasm_u52_to_f64 = Module['_mono_wasm_u52_to_f64'] = wasmExports['mono_wasm_u52_to_f64'])(a0, a1);
|
|
var _mono_wasm_f64_to_u52 = Module['_mono_wasm_f64_to_u52'] = (a0, a1) => (_mono_wasm_f64_to_u52 = Module['_mono_wasm_f64_to_u52'] = wasmExports['mono_wasm_f64_to_u52'])(a0, a1);
|
|
var _mono_wasm_f64_to_i52 = Module['_mono_wasm_f64_to_i52'] = (a0, a1) => (_mono_wasm_f64_to_i52 = Module['_mono_wasm_f64_to_i52'] = wasmExports['mono_wasm_f64_to_i52'])(a0, a1);
|
|
var _mono_wasm_method_get_full_name = Module['_mono_wasm_method_get_full_name'] = (a0) => (_mono_wasm_method_get_full_name = Module['_mono_wasm_method_get_full_name'] = wasmExports['mono_wasm_method_get_full_name'])(a0);
|
|
var _mono_wasm_method_get_name = Module['_mono_wasm_method_get_name'] = (a0) => (_mono_wasm_method_get_name = Module['_mono_wasm_method_get_name'] = wasmExports['mono_wasm_method_get_name'])(a0);
|
|
var _mono_wasm_method_get_name_ex = Module['_mono_wasm_method_get_name_ex'] = (a0) => (_mono_wasm_method_get_name_ex = Module['_mono_wasm_method_get_name_ex'] = wasmExports['mono_wasm_method_get_name_ex'])(a0);
|
|
var _mono_wasm_get_f32_unaligned = Module['_mono_wasm_get_f32_unaligned'] = (a0) => (_mono_wasm_get_f32_unaligned = Module['_mono_wasm_get_f32_unaligned'] = wasmExports['mono_wasm_get_f32_unaligned'])(a0);
|
|
var _mono_wasm_get_f64_unaligned = Module['_mono_wasm_get_f64_unaligned'] = (a0) => (_mono_wasm_get_f64_unaligned = Module['_mono_wasm_get_f64_unaligned'] = wasmExports['mono_wasm_get_f64_unaligned'])(a0);
|
|
var _mono_wasm_get_i32_unaligned = Module['_mono_wasm_get_i32_unaligned'] = (a0) => (_mono_wasm_get_i32_unaligned = Module['_mono_wasm_get_i32_unaligned'] = wasmExports['mono_wasm_get_i32_unaligned'])(a0);
|
|
var _mono_wasm_is_zero_page_reserved = Module['_mono_wasm_is_zero_page_reserved'] = () => (_mono_wasm_is_zero_page_reserved = Module['_mono_wasm_is_zero_page_reserved'] = wasmExports['mono_wasm_is_zero_page_reserved'])();
|
|
var _mono_wasm_read_as_bool_or_null_unsafe = Module['_mono_wasm_read_as_bool_or_null_unsafe'] = (a0) => (_mono_wasm_read_as_bool_or_null_unsafe = Module['_mono_wasm_read_as_bool_or_null_unsafe'] = wasmExports['mono_wasm_read_as_bool_or_null_unsafe'])(a0);
|
|
var _mono_wasm_assembly_load = Module['_mono_wasm_assembly_load'] = (a0) => (_mono_wasm_assembly_load = Module['_mono_wasm_assembly_load'] = wasmExports['mono_wasm_assembly_load'])(a0);
|
|
var _mono_wasm_assembly_find_class = Module['_mono_wasm_assembly_find_class'] = (a0, a1, a2) => (_mono_wasm_assembly_find_class = Module['_mono_wasm_assembly_find_class'] = wasmExports['mono_wasm_assembly_find_class'])(a0, a1, a2);
|
|
var _mono_wasm_assembly_find_method = Module['_mono_wasm_assembly_find_method'] = (a0, a1, a2) => (_mono_wasm_assembly_find_method = Module['_mono_wasm_assembly_find_method'] = wasmExports['mono_wasm_assembly_find_method'])(a0, a1, a2);
|
|
var _mono_wasm_send_dbg_command_with_parms = Module['_mono_wasm_send_dbg_command_with_parms'] = (a0, a1, a2, a3, a4, a5, a6) => (_mono_wasm_send_dbg_command_with_parms = Module['_mono_wasm_send_dbg_command_with_parms'] = wasmExports['mono_wasm_send_dbg_command_with_parms'])(a0, a1, a2, a3, a4, a5, a6);
|
|
var _mono_wasm_send_dbg_command = Module['_mono_wasm_send_dbg_command'] = (a0, a1, a2, a3, a4) => (_mono_wasm_send_dbg_command = Module['_mono_wasm_send_dbg_command'] = wasmExports['mono_wasm_send_dbg_command'])(a0, a1, a2, a3, a4);
|
|
var _mono_jiterp_register_jit_call_thunk = Module['_mono_jiterp_register_jit_call_thunk'] = (a0, a1) => (_mono_jiterp_register_jit_call_thunk = Module['_mono_jiterp_register_jit_call_thunk'] = wasmExports['mono_jiterp_register_jit_call_thunk'])(a0, a1);
|
|
var _mono_jiterp_stackval_to_data = Module['_mono_jiterp_stackval_to_data'] = (a0, a1, a2) => (_mono_jiterp_stackval_to_data = Module['_mono_jiterp_stackval_to_data'] = wasmExports['mono_jiterp_stackval_to_data'])(a0, a1, a2);
|
|
var _mono_jiterp_stackval_from_data = Module['_mono_jiterp_stackval_from_data'] = (a0, a1, a2) => (_mono_jiterp_stackval_from_data = Module['_mono_jiterp_stackval_from_data'] = wasmExports['mono_jiterp_stackval_from_data'])(a0, a1, a2);
|
|
var _mono_jiterp_get_arg_offset = Module['_mono_jiterp_get_arg_offset'] = (a0, a1, a2) => (_mono_jiterp_get_arg_offset = Module['_mono_jiterp_get_arg_offset'] = wasmExports['mono_jiterp_get_arg_offset'])(a0, a1, a2);
|
|
var _mono_jiterp_overflow_check_i4 = Module['_mono_jiterp_overflow_check_i4'] = (a0, a1, a2) => (_mono_jiterp_overflow_check_i4 = Module['_mono_jiterp_overflow_check_i4'] = wasmExports['mono_jiterp_overflow_check_i4'])(a0, a1, a2);
|
|
var _mono_jiterp_overflow_check_u4 = Module['_mono_jiterp_overflow_check_u4'] = (a0, a1, a2) => (_mono_jiterp_overflow_check_u4 = Module['_mono_jiterp_overflow_check_u4'] = wasmExports['mono_jiterp_overflow_check_u4'])(a0, a1, a2);
|
|
var _mono_jiterp_ld_delegate_method_ptr = Module['_mono_jiterp_ld_delegate_method_ptr'] = (a0, a1) => (_mono_jiterp_ld_delegate_method_ptr = Module['_mono_jiterp_ld_delegate_method_ptr'] = wasmExports['mono_jiterp_ld_delegate_method_ptr'])(a0, a1);
|
|
var _mono_jiterp_interp_entry = Module['_mono_jiterp_interp_entry'] = (a0, a1) => (_mono_jiterp_interp_entry = Module['_mono_jiterp_interp_entry'] = wasmExports['mono_jiterp_interp_entry'])(a0, a1);
|
|
var _fmodf = Module['_fmodf'] = (a0, a1) => (_fmodf = Module['_fmodf'] = wasmExports['fmodf'])(a0, a1);
|
|
var _fmod = Module['_fmod'] = (a0, a1) => (_fmod = Module['_fmod'] = wasmExports['fmod'])(a0, a1);
|
|
var _asin = Module['_asin'] = (a0) => (_asin = Module['_asin'] = wasmExports['asin'])(a0);
|
|
var _asinh = Module['_asinh'] = (a0) => (_asinh = Module['_asinh'] = wasmExports['asinh'])(a0);
|
|
var _acos = Module['_acos'] = (a0) => (_acos = Module['_acos'] = wasmExports['acos'])(a0);
|
|
var _acosh = Module['_acosh'] = (a0) => (_acosh = Module['_acosh'] = wasmExports['acosh'])(a0);
|
|
var _atan = Module['_atan'] = (a0) => (_atan = Module['_atan'] = wasmExports['atan'])(a0);
|
|
var _atanh = Module['_atanh'] = (a0) => (_atanh = Module['_atanh'] = wasmExports['atanh'])(a0);
|
|
var _cos = Module['_cos'] = (a0) => (_cos = Module['_cos'] = wasmExports['cos'])(a0);
|
|
var _cbrt = Module['_cbrt'] = (a0) => (_cbrt = Module['_cbrt'] = wasmExports['cbrt'])(a0);
|
|
var _cosh = Module['_cosh'] = (a0) => (_cosh = Module['_cosh'] = wasmExports['cosh'])(a0);
|
|
var _exp = Module['_exp'] = (a0) => (_exp = Module['_exp'] = wasmExports['exp'])(a0);
|
|
var _log = Module['_log'] = (a0) => (_log = Module['_log'] = wasmExports['log'])(a0);
|
|
var _log2 = Module['_log2'] = (a0) => (_log2 = Module['_log2'] = wasmExports['log2'])(a0);
|
|
var _log10 = Module['_log10'] = (a0) => (_log10 = Module['_log10'] = wasmExports['log10'])(a0);
|
|
var _sin = Module['_sin'] = (a0) => (_sin = Module['_sin'] = wasmExports['sin'])(a0);
|
|
var _sinh = Module['_sinh'] = (a0) => (_sinh = Module['_sinh'] = wasmExports['sinh'])(a0);
|
|
var _tan = Module['_tan'] = (a0) => (_tan = Module['_tan'] = wasmExports['tan'])(a0);
|
|
var _tanh = Module['_tanh'] = (a0) => (_tanh = Module['_tanh'] = wasmExports['tanh'])(a0);
|
|
var _atan2 = Module['_atan2'] = (a0, a1) => (_atan2 = Module['_atan2'] = wasmExports['atan2'])(a0, a1);
|
|
var _pow = Module['_pow'] = (a0, a1) => (_pow = Module['_pow'] = wasmExports['pow'])(a0, a1);
|
|
var _fma = Module['_fma'] = (a0, a1, a2) => (_fma = Module['_fma'] = wasmExports['fma'])(a0, a1, a2);
|
|
var _asinf = Module['_asinf'] = (a0) => (_asinf = Module['_asinf'] = wasmExports['asinf'])(a0);
|
|
var _asinhf = Module['_asinhf'] = (a0) => (_asinhf = Module['_asinhf'] = wasmExports['asinhf'])(a0);
|
|
var _acosf = Module['_acosf'] = (a0) => (_acosf = Module['_acosf'] = wasmExports['acosf'])(a0);
|
|
var _acoshf = Module['_acoshf'] = (a0) => (_acoshf = Module['_acoshf'] = wasmExports['acoshf'])(a0);
|
|
var _atanhf = Module['_atanhf'] = (a0) => (_atanhf = Module['_atanhf'] = wasmExports['atanhf'])(a0);
|
|
var _cbrtf = Module['_cbrtf'] = (a0) => (_cbrtf = Module['_cbrtf'] = wasmExports['cbrtf'])(a0);
|
|
var _coshf = Module['_coshf'] = (a0) => (_coshf = Module['_coshf'] = wasmExports['coshf'])(a0);
|
|
var _expf = Module['_expf'] = (a0) => (_expf = Module['_expf'] = wasmExports['expf'])(a0);
|
|
var _logf = Module['_logf'] = (a0) => (_logf = Module['_logf'] = wasmExports['logf'])(a0);
|
|
var _log2f = Module['_log2f'] = (a0) => (_log2f = Module['_log2f'] = wasmExports['log2f'])(a0);
|
|
var _log10f = Module['_log10f'] = (a0) => (_log10f = Module['_log10f'] = wasmExports['log10f'])(a0);
|
|
var _sinhf = Module['_sinhf'] = (a0) => (_sinhf = Module['_sinhf'] = wasmExports['sinhf'])(a0);
|
|
var _tanhf = Module['_tanhf'] = (a0) => (_tanhf = Module['_tanhf'] = wasmExports['tanhf'])(a0);
|
|
var _atan2f = Module['_atan2f'] = (a0, a1) => (_atan2f = Module['_atan2f'] = wasmExports['atan2f'])(a0, a1);
|
|
var _powf = Module['_powf'] = (a0, a1) => (_powf = Module['_powf'] = wasmExports['powf'])(a0, a1);
|
|
var _fmaf = Module['_fmaf'] = (a0, a1, a2) => (_fmaf = Module['_fmaf'] = wasmExports['fmaf'])(a0, a1, a2);
|
|
var _mono_jiterp_get_polling_required_address = Module['_mono_jiterp_get_polling_required_address'] = () => (_mono_jiterp_get_polling_required_address = Module['_mono_jiterp_get_polling_required_address'] = wasmExports['mono_jiterp_get_polling_required_address'])();
|
|
var _mono_jiterp_prof_enter = Module['_mono_jiterp_prof_enter'] = (a0, a1) => (_mono_jiterp_prof_enter = Module['_mono_jiterp_prof_enter'] = wasmExports['mono_jiterp_prof_enter'])(a0, a1);
|
|
var _mono_jiterp_prof_samplepoint = Module['_mono_jiterp_prof_samplepoint'] = (a0, a1) => (_mono_jiterp_prof_samplepoint = Module['_mono_jiterp_prof_samplepoint'] = wasmExports['mono_jiterp_prof_samplepoint'])(a0, a1);
|
|
var _mono_jiterp_prof_leave = Module['_mono_jiterp_prof_leave'] = (a0, a1) => (_mono_jiterp_prof_leave = Module['_mono_jiterp_prof_leave'] = wasmExports['mono_jiterp_prof_leave'])(a0, a1);
|
|
var _mono_jiterp_do_safepoint = Module['_mono_jiterp_do_safepoint'] = (a0, a1) => (_mono_jiterp_do_safepoint = Module['_mono_jiterp_do_safepoint'] = wasmExports['mono_jiterp_do_safepoint'])(a0, a1);
|
|
var _mono_jiterp_imethod_to_ftnptr = Module['_mono_jiterp_imethod_to_ftnptr'] = (a0) => (_mono_jiterp_imethod_to_ftnptr = Module['_mono_jiterp_imethod_to_ftnptr'] = wasmExports['mono_jiterp_imethod_to_ftnptr'])(a0);
|
|
var _mono_jiterp_enum_hasflag = Module['_mono_jiterp_enum_hasflag'] = (a0, a1, a2, a3) => (_mono_jiterp_enum_hasflag = Module['_mono_jiterp_enum_hasflag'] = wasmExports['mono_jiterp_enum_hasflag'])(a0, a1, a2, a3);
|
|
var _mono_jiterp_get_simd_intrinsic = Module['_mono_jiterp_get_simd_intrinsic'] = (a0, a1) => (_mono_jiterp_get_simd_intrinsic = Module['_mono_jiterp_get_simd_intrinsic'] = wasmExports['mono_jiterp_get_simd_intrinsic'])(a0, a1);
|
|
var _mono_jiterp_get_simd_opcode = Module['_mono_jiterp_get_simd_opcode'] = (a0, a1) => (_mono_jiterp_get_simd_opcode = Module['_mono_jiterp_get_simd_opcode'] = wasmExports['mono_jiterp_get_simd_opcode'])(a0, a1);
|
|
var _mono_jiterp_get_opcode_info = Module['_mono_jiterp_get_opcode_info'] = (a0, a1) => (_mono_jiterp_get_opcode_info = Module['_mono_jiterp_get_opcode_info'] = wasmExports['mono_jiterp_get_opcode_info'])(a0, a1);
|
|
var _mono_jiterp_placeholder_trace = Module['_mono_jiterp_placeholder_trace'] = (a0, a1, a2, a3) => (_mono_jiterp_placeholder_trace = Module['_mono_jiterp_placeholder_trace'] = wasmExports['mono_jiterp_placeholder_trace'])(a0, a1, a2, a3);
|
|
var _mono_jiterp_placeholder_jit_call = Module['_mono_jiterp_placeholder_jit_call'] = (a0, a1, a2, a3) => (_mono_jiterp_placeholder_jit_call = Module['_mono_jiterp_placeholder_jit_call'] = wasmExports['mono_jiterp_placeholder_jit_call'])(a0, a1, a2, a3);
|
|
var _mono_jiterp_get_interp_entry_func = Module['_mono_jiterp_get_interp_entry_func'] = (a0) => (_mono_jiterp_get_interp_entry_func = Module['_mono_jiterp_get_interp_entry_func'] = wasmExports['mono_jiterp_get_interp_entry_func'])(a0);
|
|
var _mono_jiterp_is_enabled = Module['_mono_jiterp_is_enabled'] = () => (_mono_jiterp_is_enabled = Module['_mono_jiterp_is_enabled'] = wasmExports['mono_jiterp_is_enabled'])();
|
|
var _mono_jiterp_encode_leb64_ref = Module['_mono_jiterp_encode_leb64_ref'] = (a0, a1, a2) => (_mono_jiterp_encode_leb64_ref = Module['_mono_jiterp_encode_leb64_ref'] = wasmExports['mono_jiterp_encode_leb64_ref'])(a0, a1, a2);
|
|
var _mono_jiterp_encode_leb52 = Module['_mono_jiterp_encode_leb52'] = (a0, a1, a2) => (_mono_jiterp_encode_leb52 = Module['_mono_jiterp_encode_leb52'] = wasmExports['mono_jiterp_encode_leb52'])(a0, a1, a2);
|
|
var _mono_jiterp_encode_leb_signed_boundary = Module['_mono_jiterp_encode_leb_signed_boundary'] = (a0, a1, a2) => (_mono_jiterp_encode_leb_signed_boundary = Module['_mono_jiterp_encode_leb_signed_boundary'] = wasmExports['mono_jiterp_encode_leb_signed_boundary'])(a0, a1, a2);
|
|
var _mono_jiterp_increase_entry_count = Module['_mono_jiterp_increase_entry_count'] = (a0) => (_mono_jiterp_increase_entry_count = Module['_mono_jiterp_increase_entry_count'] = wasmExports['mono_jiterp_increase_entry_count'])(a0);
|
|
var _mono_jiterp_object_unbox = Module['_mono_jiterp_object_unbox'] = (a0) => (_mono_jiterp_object_unbox = Module['_mono_jiterp_object_unbox'] = wasmExports['mono_jiterp_object_unbox'])(a0);
|
|
var _mono_jiterp_type_is_byref = Module['_mono_jiterp_type_is_byref'] = (a0) => (_mono_jiterp_type_is_byref = Module['_mono_jiterp_type_is_byref'] = wasmExports['mono_jiterp_type_is_byref'])(a0);
|
|
var _mono_jiterp_value_copy = Module['_mono_jiterp_value_copy'] = (a0, a1, a2) => (_mono_jiterp_value_copy = Module['_mono_jiterp_value_copy'] = wasmExports['mono_jiterp_value_copy'])(a0, a1, a2);
|
|
var _mono_jiterp_try_newobj_inlined = Module['_mono_jiterp_try_newobj_inlined'] = (a0, a1) => (_mono_jiterp_try_newobj_inlined = Module['_mono_jiterp_try_newobj_inlined'] = wasmExports['mono_jiterp_try_newobj_inlined'])(a0, a1);
|
|
var _mono_jiterp_try_newstr = Module['_mono_jiterp_try_newstr'] = (a0, a1) => (_mono_jiterp_try_newstr = Module['_mono_jiterp_try_newstr'] = wasmExports['mono_jiterp_try_newstr'])(a0, a1);
|
|
var _mono_jiterp_try_newarr = Module['_mono_jiterp_try_newarr'] = (a0, a1, a2) => (_mono_jiterp_try_newarr = Module['_mono_jiterp_try_newarr'] = wasmExports['mono_jiterp_try_newarr'])(a0, a1, a2);
|
|
var _mono_jiterp_gettype_ref = Module['_mono_jiterp_gettype_ref'] = (a0, a1) => (_mono_jiterp_gettype_ref = Module['_mono_jiterp_gettype_ref'] = wasmExports['mono_jiterp_gettype_ref'])(a0, a1);
|
|
var _mono_jiterp_has_parent_fast = Module['_mono_jiterp_has_parent_fast'] = (a0, a1) => (_mono_jiterp_has_parent_fast = Module['_mono_jiterp_has_parent_fast'] = wasmExports['mono_jiterp_has_parent_fast'])(a0, a1);
|
|
var _mono_jiterp_implements_interface = Module['_mono_jiterp_implements_interface'] = (a0, a1) => (_mono_jiterp_implements_interface = Module['_mono_jiterp_implements_interface'] = wasmExports['mono_jiterp_implements_interface'])(a0, a1);
|
|
var _mono_jiterp_is_special_interface = Module['_mono_jiterp_is_special_interface'] = (a0) => (_mono_jiterp_is_special_interface = Module['_mono_jiterp_is_special_interface'] = wasmExports['mono_jiterp_is_special_interface'])(a0);
|
|
var _mono_jiterp_implements_special_interface = Module['_mono_jiterp_implements_special_interface'] = (a0, a1, a2) => (_mono_jiterp_implements_special_interface = Module['_mono_jiterp_implements_special_interface'] = wasmExports['mono_jiterp_implements_special_interface'])(a0, a1, a2);
|
|
var _mono_jiterp_cast_v2 = Module['_mono_jiterp_cast_v2'] = (a0, a1, a2, a3) => (_mono_jiterp_cast_v2 = Module['_mono_jiterp_cast_v2'] = wasmExports['mono_jiterp_cast_v2'])(a0, a1, a2, a3);
|
|
var _mono_jiterp_localloc = Module['_mono_jiterp_localloc'] = (a0, a1, a2) => (_mono_jiterp_localloc = Module['_mono_jiterp_localloc'] = wasmExports['mono_jiterp_localloc'])(a0, a1, a2);
|
|
var _mono_jiterp_ldtsflda = Module['_mono_jiterp_ldtsflda'] = (a0, a1) => (_mono_jiterp_ldtsflda = Module['_mono_jiterp_ldtsflda'] = wasmExports['mono_jiterp_ldtsflda'])(a0, a1);
|
|
var _mono_jiterp_box_ref = Module['_mono_jiterp_box_ref'] = (a0, a1, a2, a3) => (_mono_jiterp_box_ref = Module['_mono_jiterp_box_ref'] = wasmExports['mono_jiterp_box_ref'])(a0, a1, a2, a3);
|
|
var _mono_jiterp_conv = Module['_mono_jiterp_conv'] = (a0, a1, a2) => (_mono_jiterp_conv = Module['_mono_jiterp_conv'] = wasmExports['mono_jiterp_conv'])(a0, a1, a2);
|
|
var _mono_jiterp_relop_fp = Module['_mono_jiterp_relop_fp'] = (a0, a1, a2) => (_mono_jiterp_relop_fp = Module['_mono_jiterp_relop_fp'] = wasmExports['mono_jiterp_relop_fp'])(a0, a1, a2);
|
|
var _mono_jiterp_get_size_of_stackval = Module['_mono_jiterp_get_size_of_stackval'] = () => (_mono_jiterp_get_size_of_stackval = Module['_mono_jiterp_get_size_of_stackval'] = wasmExports['mono_jiterp_get_size_of_stackval'])();
|
|
var _mono_jiterp_type_get_raw_value_size = Module['_mono_jiterp_type_get_raw_value_size'] = (a0) => (_mono_jiterp_type_get_raw_value_size = Module['_mono_jiterp_type_get_raw_value_size'] = wasmExports['mono_jiterp_type_get_raw_value_size'])(a0);
|
|
var _mono_jiterp_trace_bailout = Module['_mono_jiterp_trace_bailout'] = (a0) => (_mono_jiterp_trace_bailout = Module['_mono_jiterp_trace_bailout'] = wasmExports['mono_jiterp_trace_bailout'])(a0);
|
|
var _mono_jiterp_get_trace_bailout_count = Module['_mono_jiterp_get_trace_bailout_count'] = (a0) => (_mono_jiterp_get_trace_bailout_count = Module['_mono_jiterp_get_trace_bailout_count'] = wasmExports['mono_jiterp_get_trace_bailout_count'])(a0);
|
|
var _mono_jiterp_adjust_abort_count = Module['_mono_jiterp_adjust_abort_count'] = (a0, a1) => (_mono_jiterp_adjust_abort_count = Module['_mono_jiterp_adjust_abort_count'] = wasmExports['mono_jiterp_adjust_abort_count'])(a0, a1);
|
|
var _mono_jiterp_interp_entry_prologue = Module['_mono_jiterp_interp_entry_prologue'] = (a0, a1) => (_mono_jiterp_interp_entry_prologue = Module['_mono_jiterp_interp_entry_prologue'] = wasmExports['mono_jiterp_interp_entry_prologue'])(a0, a1);
|
|
var _mono_jiterp_get_opcode_value_table_entry = Module['_mono_jiterp_get_opcode_value_table_entry'] = (a0) => (_mono_jiterp_get_opcode_value_table_entry = Module['_mono_jiterp_get_opcode_value_table_entry'] = wasmExports['mono_jiterp_get_opcode_value_table_entry'])(a0);
|
|
var _mono_jiterp_get_trace_hit_count = Module['_mono_jiterp_get_trace_hit_count'] = (a0) => (_mono_jiterp_get_trace_hit_count = Module['_mono_jiterp_get_trace_hit_count'] = wasmExports['mono_jiterp_get_trace_hit_count'])(a0);
|
|
var _mono_jiterp_parse_option = Module['_mono_jiterp_parse_option'] = (a0) => (_mono_jiterp_parse_option = Module['_mono_jiterp_parse_option'] = wasmExports['mono_jiterp_parse_option'])(a0);
|
|
var _mono_jiterp_get_options_version = Module['_mono_jiterp_get_options_version'] = () => (_mono_jiterp_get_options_version = Module['_mono_jiterp_get_options_version'] = wasmExports['mono_jiterp_get_options_version'])();
|
|
var _mono_jiterp_get_options_as_json = Module['_mono_jiterp_get_options_as_json'] = () => (_mono_jiterp_get_options_as_json = Module['_mono_jiterp_get_options_as_json'] = wasmExports['mono_jiterp_get_options_as_json'])();
|
|
var _mono_jiterp_get_option_as_int = Module['_mono_jiterp_get_option_as_int'] = (a0) => (_mono_jiterp_get_option_as_int = Module['_mono_jiterp_get_option_as_int'] = wasmExports['mono_jiterp_get_option_as_int'])(a0);
|
|
var _mono_jiterp_object_has_component_size = Module['_mono_jiterp_object_has_component_size'] = (a0) => (_mono_jiterp_object_has_component_size = Module['_mono_jiterp_object_has_component_size'] = wasmExports['mono_jiterp_object_has_component_size'])(a0);
|
|
var _mono_jiterp_get_hashcode = Module['_mono_jiterp_get_hashcode'] = (a0) => (_mono_jiterp_get_hashcode = Module['_mono_jiterp_get_hashcode'] = wasmExports['mono_jiterp_get_hashcode'])(a0);
|
|
var _mono_jiterp_try_get_hashcode = Module['_mono_jiterp_try_get_hashcode'] = (a0) => (_mono_jiterp_try_get_hashcode = Module['_mono_jiterp_try_get_hashcode'] = wasmExports['mono_jiterp_try_get_hashcode'])(a0);
|
|
var _mono_jiterp_get_signature_has_this = Module['_mono_jiterp_get_signature_has_this'] = (a0) => (_mono_jiterp_get_signature_has_this = Module['_mono_jiterp_get_signature_has_this'] = wasmExports['mono_jiterp_get_signature_has_this'])(a0);
|
|
var _mono_jiterp_get_signature_return_type = Module['_mono_jiterp_get_signature_return_type'] = (a0) => (_mono_jiterp_get_signature_return_type = Module['_mono_jiterp_get_signature_return_type'] = wasmExports['mono_jiterp_get_signature_return_type'])(a0);
|
|
var _mono_jiterp_get_signature_param_count = Module['_mono_jiterp_get_signature_param_count'] = (a0) => (_mono_jiterp_get_signature_param_count = Module['_mono_jiterp_get_signature_param_count'] = wasmExports['mono_jiterp_get_signature_param_count'])(a0);
|
|
var _mono_jiterp_get_signature_params = Module['_mono_jiterp_get_signature_params'] = (a0) => (_mono_jiterp_get_signature_params = Module['_mono_jiterp_get_signature_params'] = wasmExports['mono_jiterp_get_signature_params'])(a0);
|
|
var _mono_jiterp_type_to_ldind = Module['_mono_jiterp_type_to_ldind'] = (a0) => (_mono_jiterp_type_to_ldind = Module['_mono_jiterp_type_to_ldind'] = wasmExports['mono_jiterp_type_to_ldind'])(a0);
|
|
var _mono_jiterp_type_to_stind = Module['_mono_jiterp_type_to_stind'] = (a0) => (_mono_jiterp_type_to_stind = Module['_mono_jiterp_type_to_stind'] = wasmExports['mono_jiterp_type_to_stind'])(a0);
|
|
var _mono_jiterp_get_array_rank = Module['_mono_jiterp_get_array_rank'] = (a0, a1) => (_mono_jiterp_get_array_rank = Module['_mono_jiterp_get_array_rank'] = wasmExports['mono_jiterp_get_array_rank'])(a0, a1);
|
|
var _mono_jiterp_get_array_element_size = Module['_mono_jiterp_get_array_element_size'] = (a0, a1) => (_mono_jiterp_get_array_element_size = Module['_mono_jiterp_get_array_element_size'] = wasmExports['mono_jiterp_get_array_element_size'])(a0, a1);
|
|
var _mono_jiterp_set_object_field = Module['_mono_jiterp_set_object_field'] = (a0, a1, a2, a3) => (_mono_jiterp_set_object_field = Module['_mono_jiterp_set_object_field'] = wasmExports['mono_jiterp_set_object_field'])(a0, a1, a2, a3);
|
|
var _mono_jiterp_debug_count = Module['_mono_jiterp_debug_count'] = () => (_mono_jiterp_debug_count = Module['_mono_jiterp_debug_count'] = wasmExports['mono_jiterp_debug_count'])();
|
|
var _mono_jiterp_stelem_ref = Module['_mono_jiterp_stelem_ref'] = (a0, a1, a2) => (_mono_jiterp_stelem_ref = Module['_mono_jiterp_stelem_ref'] = wasmExports['mono_jiterp_stelem_ref'])(a0, a1, a2);
|
|
var _mono_jiterp_get_member_offset = Module['_mono_jiterp_get_member_offset'] = (a0) => (_mono_jiterp_get_member_offset = Module['_mono_jiterp_get_member_offset'] = wasmExports['mono_jiterp_get_member_offset'])(a0);
|
|
var _mono_jiterp_get_counter = Module['_mono_jiterp_get_counter'] = (a0) => (_mono_jiterp_get_counter = Module['_mono_jiterp_get_counter'] = wasmExports['mono_jiterp_get_counter'])(a0);
|
|
var _mono_jiterp_modify_counter = Module['_mono_jiterp_modify_counter'] = (a0, a1) => (_mono_jiterp_modify_counter = Module['_mono_jiterp_modify_counter'] = wasmExports['mono_jiterp_modify_counter'])(a0, a1);
|
|
var _mono_jiterp_write_number_unaligned = Module['_mono_jiterp_write_number_unaligned'] = (a0, a1, a2) => (_mono_jiterp_write_number_unaligned = Module['_mono_jiterp_write_number_unaligned'] = wasmExports['mono_jiterp_write_number_unaligned'])(a0, a1, a2);
|
|
var _mono_jiterp_get_rejected_trace_count = Module['_mono_jiterp_get_rejected_trace_count'] = () => (_mono_jiterp_get_rejected_trace_count = Module['_mono_jiterp_get_rejected_trace_count'] = wasmExports['mono_jiterp_get_rejected_trace_count'])();
|
|
var _mono_jiterp_boost_back_branch_target = Module['_mono_jiterp_boost_back_branch_target'] = (a0) => (_mono_jiterp_boost_back_branch_target = Module['_mono_jiterp_boost_back_branch_target'] = wasmExports['mono_jiterp_boost_back_branch_target'])(a0);
|
|
var _mono_jiterp_is_imethod_var_address_taken = Module['_mono_jiterp_is_imethod_var_address_taken'] = (a0, a1) => (_mono_jiterp_is_imethod_var_address_taken = Module['_mono_jiterp_is_imethod_var_address_taken'] = wasmExports['mono_jiterp_is_imethod_var_address_taken'])(a0, a1);
|
|
var _mono_jiterp_initialize_table = Module['_mono_jiterp_initialize_table'] = (a0, a1, a2) => (_mono_jiterp_initialize_table = Module['_mono_jiterp_initialize_table'] = wasmExports['mono_jiterp_initialize_table'])(a0, a1, a2);
|
|
var _mono_jiterp_allocate_table_entry = Module['_mono_jiterp_allocate_table_entry'] = (a0) => (_mono_jiterp_allocate_table_entry = Module['_mono_jiterp_allocate_table_entry'] = wasmExports['mono_jiterp_allocate_table_entry'])(a0);
|
|
var _mono_jiterp_tlqueue_next = Module['_mono_jiterp_tlqueue_next'] = (a0) => (_mono_jiterp_tlqueue_next = Module['_mono_jiterp_tlqueue_next'] = wasmExports['mono_jiterp_tlqueue_next'])(a0);
|
|
var _mono_jiterp_tlqueue_add = Module['_mono_jiterp_tlqueue_add'] = (a0, a1) => (_mono_jiterp_tlqueue_add = Module['_mono_jiterp_tlqueue_add'] = wasmExports['mono_jiterp_tlqueue_add'])(a0, a1);
|
|
var _mono_jiterp_tlqueue_clear = Module['_mono_jiterp_tlqueue_clear'] = (a0) => (_mono_jiterp_tlqueue_clear = Module['_mono_jiterp_tlqueue_clear'] = wasmExports['mono_jiterp_tlqueue_clear'])(a0);
|
|
var _mono_interp_pgo_load_table = Module['_mono_interp_pgo_load_table'] = (a0, a1) => (_mono_interp_pgo_load_table = Module['_mono_interp_pgo_load_table'] = wasmExports['mono_interp_pgo_load_table'])(a0, a1);
|
|
var _mono_interp_pgo_save_table = Module['_mono_interp_pgo_save_table'] = (a0, a1) => (_mono_interp_pgo_save_table = Module['_mono_interp_pgo_save_table'] = wasmExports['mono_interp_pgo_save_table'])(a0, a1);
|
|
var _mono_llvm_cpp_catch_exception = Module['_mono_llvm_cpp_catch_exception'] = (a0, a1, a2) => (_mono_llvm_cpp_catch_exception = Module['_mono_llvm_cpp_catch_exception'] = wasmExports['mono_llvm_cpp_catch_exception'])(a0, a1, a2);
|
|
var _mono_jiterp_begin_catch = Module['_mono_jiterp_begin_catch'] = (a0) => (_mono_jiterp_begin_catch = Module['_mono_jiterp_begin_catch'] = wasmExports['mono_jiterp_begin_catch'])(a0);
|
|
var _mono_jiterp_end_catch = Module['_mono_jiterp_end_catch'] = () => (_mono_jiterp_end_catch = Module['_mono_jiterp_end_catch'] = wasmExports['mono_jiterp_end_catch'])();
|
|
var _sbrk = Module['_sbrk'] = (a0) => (_sbrk = Module['_sbrk'] = wasmExports['sbrk'])(a0);
|
|
var _posix_memalign = Module['_posix_memalign'] = (a0, a1, a2) => (_posix_memalign = Module['_posix_memalign'] = wasmExports['posix_memalign'])(a0, a1, a2);
|
|
var _mono_background_exec = Module['_mono_background_exec'] = () => (_mono_background_exec = Module['_mono_background_exec'] = wasmExports['mono_background_exec'])();
|
|
var _mono_wasm_ds_exec = Module['_mono_wasm_ds_exec'] = () => (_mono_wasm_ds_exec = Module['_mono_wasm_ds_exec'] = wasmExports['mono_wasm_ds_exec'])();
|
|
var _mono_wasm_gc_lock = Module['_mono_wasm_gc_lock'] = () => (_mono_wasm_gc_lock = Module['_mono_wasm_gc_lock'] = wasmExports['mono_wasm_gc_lock'])();
|
|
var _mono_wasm_gc_unlock = Module['_mono_wasm_gc_unlock'] = () => (_mono_wasm_gc_unlock = Module['_mono_wasm_gc_unlock'] = wasmExports['mono_wasm_gc_unlock'])();
|
|
var _mono_print_method_from_ip = Module['_mono_print_method_from_ip'] = (a0) => (_mono_print_method_from_ip = Module['_mono_print_method_from_ip'] = wasmExports['mono_print_method_from_ip'])(a0);
|
|
var _mono_wasm_execute_timer = Module['_mono_wasm_execute_timer'] = () => (_mono_wasm_execute_timer = Module['_mono_wasm_execute_timer'] = wasmExports['mono_wasm_execute_timer'])();
|
|
var _mono_wasm_load_icu_data = Module['_mono_wasm_load_icu_data'] = (a0) => (_mono_wasm_load_icu_data = Module['_mono_wasm_load_icu_data'] = wasmExports['mono_wasm_load_icu_data'])(a0);
|
|
var ___funcs_on_exit = () => (___funcs_on_exit = wasmExports['__funcs_on_exit'])();
|
|
var _htons = Module['_htons'] = (a0) => (_htons = Module['_htons'] = wasmExports['htons'])(a0);
|
|
var _emscripten_builtin_memalign = (a0, a1) => (_emscripten_builtin_memalign = wasmExports['emscripten_builtin_memalign'])(a0, a1);
|
|
var _ntohs = Module['_ntohs'] = (a0) => (_ntohs = Module['_ntohs'] = wasmExports['ntohs'])(a0);
|
|
var _memalign = Module['_memalign'] = (a0, a1) => (_memalign = Module['_memalign'] = wasmExports['memalign'])(a0, a1);
|
|
var ___trap = () => (___trap = wasmExports['__trap'])();
|
|
var stackSave = Module['stackSave'] = () => (stackSave = Module['stackSave'] = wasmExports['stackSave'])();
|
|
var stackRestore = Module['stackRestore'] = (a0) => (stackRestore = Module['stackRestore'] = wasmExports['stackRestore'])(a0);
|
|
var stackAlloc = Module['stackAlloc'] = (a0) => (stackAlloc = Module['stackAlloc'] = wasmExports['stackAlloc'])(a0);
|
|
|
|
|
|
// include: postamble.js
|
|
// === Auto-generated postamble setup entry stuff ===
|
|
|
|
Module['addRunDependency'] = addRunDependency;
|
|
Module['removeRunDependency'] = removeRunDependency;
|
|
Module['FS_createPath'] = FS.createPath;
|
|
Module['FS_createLazyFile'] = FS.createLazyFile;
|
|
Module['FS_createDevice'] = FS.createDevice;
|
|
Module['out'] = out;
|
|
Module['err'] = err;
|
|
Module['abort'] = abort;
|
|
Module['wasmExports'] = wasmExports;
|
|
Module['runtimeKeepalivePush'] = runtimeKeepalivePush;
|
|
Module['runtimeKeepalivePop'] = runtimeKeepalivePop;
|
|
Module['maybeExit'] = maybeExit;
|
|
Module['ccall'] = ccall;
|
|
Module['cwrap'] = cwrap;
|
|
Module['addFunction'] = addFunction;
|
|
Module['setValue'] = setValue;
|
|
Module['getValue'] = getValue;
|
|
Module['UTF8ArrayToString'] = UTF8ArrayToString;
|
|
Module['UTF8ToString'] = UTF8ToString;
|
|
Module['stringToUTF8Array'] = stringToUTF8Array;
|
|
Module['lengthBytesUTF8'] = lengthBytesUTF8;
|
|
Module['safeSetTimeout'] = safeSetTimeout;
|
|
Module['FS_createPreloadedFile'] = FS.createPreloadedFile;
|
|
Module['FS'] = FS;
|
|
Module['FS_createDataFile'] = FS.createDataFile;
|
|
Module['FS_unlink'] = FS.unlink;
|
|
Module['GL'] = GL;
|
|
|
|
|
|
var calledRun;
|
|
|
|
dependenciesFulfilled = function runCaller() {
|
|
// If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false)
|
|
if (!calledRun) run();
|
|
if (!calledRun) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled
|
|
};
|
|
|
|
function run() {
|
|
|
|
if (runDependencies > 0) {
|
|
return;
|
|
}
|
|
|
|
preRun();
|
|
|
|
// a preRun added a dependency, run will be called later
|
|
if (runDependencies > 0) {
|
|
return;
|
|
}
|
|
|
|
function doRun() {
|
|
// run may have just been called through dependencies being fulfilled just in this very frame,
|
|
// or while the async setStatus time below was happening
|
|
if (calledRun) return;
|
|
calledRun = true;
|
|
Module['calledRun'] = true;
|
|
|
|
if (ABORT) return;
|
|
|
|
initRuntime();
|
|
|
|
readyPromiseResolve(Module);
|
|
if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized']();
|
|
|
|
postRun();
|
|
}
|
|
|
|
if (Module['setStatus']) {
|
|
Module['setStatus']('Running...');
|
|
setTimeout(function() {
|
|
setTimeout(function() {
|
|
Module['setStatus']('');
|
|
}, 1);
|
|
doRun();
|
|
}, 1);
|
|
} else
|
|
{
|
|
doRun();
|
|
}
|
|
}
|
|
|
|
if (Module['preInit']) {
|
|
if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']];
|
|
while (Module['preInit'].length > 0) {
|
|
Module['preInit'].pop()();
|
|
}
|
|
}
|
|
|
|
run();
|
|
|
|
// end include: postamble.js
|
|
|
|
|
|
|
|
return moduleArg.ready
|
|
}
|
|
);
|
|
})();
|
|
export default createDotnetRuntime;
|
|
var fetch = fetch || undefined; var require = require || undefined; var __dirname = __dirname || ''; var _nativeModuleLoaded = false;
|